diff --git a/WebContentt/public/assets/bootstrap/css/bootstrap.min.css b/WebContentt/public/assets/bootstrap/css/bootstrap.min.css
new file mode 100644
index 0000000..c794db6
--- /dev/null
+++ b/WebContentt/public/assets/bootstrap/css/bootstrap.min.css
@@ -0,0 +1,5 @@
+@charset "UTF-8";/*!
+ * Bootstrap  v5.3.3 (https://getbootstrap.com/)
+ * Copyright 2011-2024 The Bootstrap Authors
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23052c65' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush>.accordion-item:first-child{border-top:0}.accordion-flush>.accordion-item:last-child{border-bottom:0}.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}.accordion-flush>.accordion-item>.accordion-collapse{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin:calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}
diff --git a/WebContentt/public/assets/bootstrap/js/bootstrap.min.js b/WebContentt/public/assets/bootstrap/js/bootstrap.min.js
new file mode 100644
index 0000000..bbd9b5e
--- /dev/null
+++ b/WebContentt/public/assets/bootstrap/js/bootstrap.min.js
@@ -0,0 +1,6 @@
+/*!
+  * Bootstrap v5.3.3 (https://getbootstrap.com/)
+  * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+  */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function j(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function M(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${M(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${M(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=j(t.dataset[n])}return e},getDataAttribute:(t,e)=>j(t.getAttribute(`data-bs-${M(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>n(t))).join(","):null},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",jt="collapsing",Mt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(jt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(jt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(Mt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function je(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const Me={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:je(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:je(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C<v.length;C++){var O=v[C],x=be(O),k=Fe(O)===Xt,L=[zt,Rt].indexOf(x)>=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},j=p?3:1;j>0&&"break"!==P(j);j--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],j=f?-T[$]/2:0,M=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-j-q-z-O.mainAxis:M-q-z-O.mainAxis,K=v?-E[$]/2+j+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;i<t;i++)e[i]=arguments[i];return!e.some((function(t){return!(t&&"function"==typeof t.getBoundingClientRect)}))}function mi(t){void 0===t&&(t={});var e=t,i=e.defaultModifiers,n=void 0===i?[]:i,s=e.defaultOptions,o=void 0===s?fi:s;return function(t,e,i){void 0===i&&(i=o);var s,r,a={placement:"bottom",orderedModifiers:[],options:Object.assign({},fi,o),modifiersData:{},elements:{reference:t,popper:e},attributes:{},styles:{}},l=[],c=!1,h={state:a,setOptions:function(i){var s="function"==typeof i?i(a.options):i;d(),a.options=Object.assign({},o,a.options,s),a.scrollParents={reference:pe(t)?Je(t):t.contextElement?Je(t.contextElement):[],popper:Je(e)};var r,c,u=function(t){var e=ui(t);return de.reduce((function(t,i){return t.concat(e.filter((function(t){return t.phase===i})))}),[])}((r=[].concat(n,a.options.modifiers),c=r.reduce((function(t,e){var i=t[e.name];return t[e.name]=i?Object.assign({},i,e,{options:Object.assign({},i.options,e.options),data:Object.assign({},i.data,e.data)}):e,t}),{}),Object.keys(c).map((function(t){return c[t]}))));return a.orderedModifiers=u.filter((function(t){return t.enabled})),a.orderedModifiers.forEach((function(t){var e=t.name,i=t.options,n=void 0===i?{}:i,s=t.effect;if("function"==typeof s){var o=s({state:a,name:e,instance:h,options:n});l.push(o||function(){})}})),h.update()},forceUpdate:function(){if(!c){var t=a.elements,e=t.reference,i=t.popper;if(pi(e,i)){a.rects={reference:di(e,$e(i),"fixed"===a.options.strategy),popper:Ce(i)},a.reset=!1,a.placement=a.options.placement,a.orderedModifiers.forEach((function(t){return a.modifiersData[t.name]=Object.assign({},t.data)}));for(var n=0;n<a.orderedModifiers.length;n++)if(!0!==a.reset){var s=a.orderedModifiers[n],o=s.fn,r=s.options,l=void 0===r?{}:r,d=s.name;"function"==typeof o&&(a=o({state:a,options:l,name:d,instance:h})||a)}else a.reset=!1,n=-1}}},update:(s=function(){return new Promise((function(t){h.forceUpdate(),t(a)}))},function(){return r||(r=new Promise((function(t){Promise.resolve().then((function(){r=void 0,t(s())}))}))),r}),destroy:function(){d(),c=!0}};if(!pi(t,e))return h;function d(){l.forEach((function(t){return t()})),l=[]}return h.setOptions(i).then((function(t){!c&&i.onFirstUpdate&&i.onFirstUpdate(t)})),h}}var gi=mi(),_i=mi({defaultModifiers:[Re,ci,Be,_e]}),bi=mi({defaultModifiers:[Re,ci,Be,_e,li,si,hi,Me,ai]});const vi=Object.freeze(Object.defineProperty({__proto__:null,afterMain:ae,afterRead:se,afterWrite:he,applyStyles:_e,arrow:Me,auto:Kt,basePlacements:Qt,beforeMain:oe,beforeRead:ie,beforeWrite:le,bottom:Rt,clippingParents:Ut,computeStyles:Be,createPopper:bi,createPopperBase:gi,createPopperLite:_i,detectOverflow:ii,end:Yt,eventListeners:Re,flip:si,hide:ai,left:Vt,main:re,modifierPhases:de,offset:li,placements:ee,popper:Jt,popperGenerator:mi,popperOffsets:ci,preventOverflow:hi,read:ne,reference:Zt,right:qt,start:Xt,top:zt,variationPlacements:te,viewport:Gt,write:ce},Symbol.toStringTag,{value:"Module"})),yi="dropdown",wi=".bs.dropdown",Ai=".data-api",Ei="ArrowUp",Ti="ArrowDown",Ci=`hide${wi}`,Oi=`hidden${wi}`,xi=`show${wi}`,ki=`shown${wi}`,Li=`click${wi}${Ai}`,Si=`keydown${wi}${Ai}`,Di=`keyup${wi}${Ai}`,$i="show",Ii='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',Ni=`${Ii}.${$i}`,Pi=".dropdown-menu",ji=p()?"top-end":"top-start",Mi=p()?"top-start":"top-end",Fi=p()?"bottom-end":"bottom-start",Hi=p()?"bottom-start":"bottom-end",Wi=p()?"left-start":"right-start",Bi=p()?"right-start":"left-start",zi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Ri={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class qi extends W{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=z.next(this._element,Pi)[0]||z.prev(this._element,Pi)[0]||z.findOne(Pi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return zi}static get DefaultType(){return Ri}static get NAME(){return yi}toggle(){return this._isShown()?this.hide():this.show()}show(){if(l(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!N.trigger(this._element,xi,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add($i),this._element.classList.add($i),N.trigger(this._element,ki,t)}}hide(){if(l(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!N.trigger(this._element,Ci,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._popper&&this._popper.destroy(),this._menu.classList.remove($i),this._element.classList.remove($i),this._element.setAttribute("aria-expanded","false"),F.removeDataAttribute(this._menu,"popper"),N.trigger(this._element,Oi,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!o(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${yi.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===vi)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:o(this._config.reference)?t=r(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const e=this._getPopperConfig();this._popper=bi(t,this._menu,e)}_isShown(){return this._menu.classList.contains($i)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Wi;if(t.classList.contains("dropstart"))return Bi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Mi:ji:e?Hi:Fi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,jn=`hide${xn}`,Mn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,jn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,Mn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,Mn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"<div></div>"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'<div class="popover" role="tooltip"><div class="popover-arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",js="Home",Ms="End",Fs="active",Hs="fade",Ws="show",Bs=".dropdown-toggle",zs=`:not(${Bs})`,Rs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${zs}, .list-group-item${zs}, [role="tab"]${zs}, ${Rs}`,Vs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Ks extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,js,Ms].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([js,Ms].includes(t.key))i=e[t.key===js?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Ks.getOrCreateInstance(i).show())}_getChildren(){return z.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(Bs,Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(qs)?t:z.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Ks.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,Rs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Ks.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(Vs))Ks.getOrCreateInstance(t)})),m(Ks);const Qs=".bs.toast",Xs=`mouseover${Qs}`,Ys=`mouseout${Qs}`,Us=`focusin${Qs}`,Gs=`focusout${Qs}`,Js=`hide${Qs}`,Zs=`hidden${Qs}`,to=`show${Qs}`,eo=`shown${Qs}`,io="hide",no="show",so="showing",oo={animation:"boolean",autohide:"boolean",delay:"number"},ro={animation:!0,autohide:!0,delay:5e3};class ao extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return ro}static get DefaultType(){return oo}static get NAME(){return"toast"}show(){N.trigger(this._element,to).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(io),d(this._element),this._element.classList.add(no,so),this._queueCallback((()=>{this._element.classList.remove(so),N.trigger(this._element,eo),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Js).defaultPrevented||(this._element.classList.add(so),this._queueCallback((()=>{this._element.classList.add(io),this._element.classList.remove(so,no),N.trigger(this._element,Zs)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(no),super.dispose()}isShown(){return this._element.classList.contains(no)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Xs,(t=>this._onInteraction(t,!0))),N.on(this._element,Ys,(t=>this._onInteraction(t,!1))),N.on(this._element,Us,(t=>this._onInteraction(t,!0))),N.on(this._element,Gs,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ao.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ao),m(ao),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Ks,Toast:ao,Tooltip:cs}}));
diff --git a/WebContentt/public/assets/css/Font Awesome 5 Brands.css b/WebContentt/public/assets/css/Font Awesome 5 Brands.css
new file mode 100644
index 0000000..c127b5f
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 5 Brands.css	
@@ -0,0 +1,8 @@
+@font-face {
+	font-family: 'Font Awesome 5 Brands';
+	src: url(../../assets/fonts/Font%20Awesome%205%20Brands-9f495c22369544f2a6865c9d60b59dee.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%205%20Brands-ea242bb20f9fe7db35296896fae9867f.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Font Awesome 5 Duotone.css b/WebContentt/public/assets/css/Font Awesome 5 Duotone.css
new file mode 100644
index 0000000..2e0ab1e
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 5 Duotone.css	
@@ -0,0 +1,8 @@
+@font-face {
+	font-family: 'Font Awesome 5 Duotone';
+	src: url(../../assets/fonts/Font%20Awesome%205%20Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%205%20Duotone-0609b5442e186979b732d3eecf885c57.ttf) format('truetype');
+	font-weight: 900;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Font Awesome 5 Pro.css b/WebContentt/public/assets/css/Font Awesome 5 Pro.css
new file mode 100644
index 0000000..594aed9
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 5 Pro.css	
@@ -0,0 +1,26 @@
+@font-face {
+	font-family: 'Font Awesome 5 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%205%20Pro-813a01e49b4431cc33412a84ca94d347.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%205%20Pro-87a1b179a40953ca88a6205650aa32c9.ttf) format('truetype');
+	font-weight: 300;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'Font Awesome 5 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%205%20Pro-82e3029674e5d3395e37aea7b40ecc63.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%205%20Pro-8a781dd91fd45555bafe112b5008c208.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'Font Awesome 5 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%205%20Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%205%20Pro-3724e0236c1ca473e4d73f7065e5de28.ttf) format('truetype');
+	font-weight: 900;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Font Awesome 6 Brands.css b/WebContentt/public/assets/css/Font Awesome 6 Brands.css
new file mode 100644
index 0000000..0c5549a
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 6 Brands.css	
@@ -0,0 +1,8 @@
+@font-face {
+	font-family: 'Font Awesome 6 Brands';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Brands-9f495c22369544f2a6865c9d60b59dee.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Brands-ea242bb20f9fe7db35296896fae9867f.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Font Awesome 6 Duotone.css b/WebContentt/public/assets/css/Font Awesome 6 Duotone.css
new file mode 100644
index 0000000..64b5fc4
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 6 Duotone.css	
@@ -0,0 +1,8 @@
+@font-face {
+	font-family: 'Font Awesome 6 Duotone';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Duotone-0609b5442e186979b732d3eecf885c57.ttf) format('truetype');
+	font-weight: 900;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Font Awesome 6 Pro.css b/WebContentt/public/assets/css/Font Awesome 6 Pro.css
new file mode 100644
index 0000000..7814bb6
--- /dev/null
+++ b/WebContentt/public/assets/css/Font Awesome 6 Pro.css	
@@ -0,0 +1,35 @@
+@font-face {
+	font-family: 'Font Awesome 6 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Pro-61d823b3361d879c119cf056e85d3dbf.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Pro-4eda3069f6f64ce115228a4726aef19f.ttf) format('truetype');
+	font-weight: 100;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'Font Awesome 6 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Pro-813a01e49b4431cc33412a84ca94d347.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Pro-87a1b179a40953ca88a6205650aa32c9.ttf) format('truetype');
+	font-weight: 300;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'Font Awesome 6 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Pro-82e3029674e5d3395e37aea7b40ecc63.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Pro-8a781dd91fd45555bafe112b5008c208.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'Font Awesome 6 Pro';
+	src: url(../../assets/fonts/Font%20Awesome%206%20Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2) format('woff2'),
+	url(../../assets/fonts/Font%20Awesome%206%20Pro-3724e0236c1ca473e4d73f7065e5de28.ttf) format('truetype');
+	font-weight: 900;
+	font-style: normal;
+	font-display: block;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/FontAwesome.css b/WebContentt/public/assets/css/FontAwesome.css
new file mode 100644
index 0000000..29249b3
--- /dev/null
+++ b/WebContentt/public/assets/css/FontAwesome.css
@@ -0,0 +1,37 @@
+@font-face {
+	font-family: 'FontAwesome';
+	src: url(../../assets/fonts/FontAwesome-e17c2daa07b98413686eaeccf1f5e65a.woff2) format('woff2'),
+	url(../../assets/fonts/FontAwesome-3724e0236c1ca473e4d73f7065e5de28.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'FontAwesome';
+	src: url(../../assets/fonts/FontAwesome-9f495c22369544f2a6865c9d60b59dee.woff2) format('woff2'),
+	url(../../assets/fonts/FontAwesome-ea242bb20f9fe7db35296896fae9867f.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+}
+
+@font-face {
+	font-family: 'FontAwesome';
+	src: url(../../assets/fonts/FontAwesome-82e3029674e5d3395e37aea7b40ecc63.woff2) format('woff2'),
+	url(../../assets/fonts/FontAwesome-8a781dd91fd45555bafe112b5008c208.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+	unicode-range: u+f003,u+f006,u+f014,u+f016-f017,u+f01a-f01b,u+f01d,u+f022,u+f03e,u+f044,u+f046,u+f05c-f05d,u+f06e,u+f070,u+f087-f088,u+f08a,u+f094,u+f096-f097,u+f09d,u+f0a0,u+f0a2,u+f0a4-f0a7,u+f0c5,u+f0c7,u+f0e5-f0e6,u+f0eb,u+f0f6-f0f8,u+f10c,u+f114-f115,u+f118-f11a,u+f11c-f11d,u+f133,u+f147,u+f14e,u+f150-f152,u+f185-f186,u+f18e,u+f190-f192,u+f196,u+f1c1-f1c9,u+f1d9,u+f1db,u+f1e3,u+f1ea,u+f1f7,u+f1f9,u+f20a,u+f247-f248,u+f24a,u+f24d,u+f255-f25b,u+f25d,u+f271-f274,u+f278,u+f27b,u+f28c,u+f28e,u+f29c,u+f2b5,u+f2b7,u+f2ba,u+f2bc,u+f2be,u+f2c0-f2c1,u+f2c3,u+f2d0,u+f2d2,u+f2d4,u+f2dc;
+}
+
+@font-face {
+	font-family: 'FontAwesome';
+	src: url(../../assets/fonts/FontAwesome-817c19ff4bd5fc55e3922afce45e4117.woff2) format('woff2'),
+	url(../../assets/fonts/FontAwesome-01b9ff0cac2f6363c217c19d5787b037.ttf) format('truetype');
+	font-weight: 400;
+	font-style: normal;
+	font-display: block;
+	unicode-range: u+f041,u+f047,u+f065-f066,u+f07d-f07e,u+f080,u+f08b,u+f08e,u+f090,u+f09a,u+f0ac,u+f0ae,u+f0b2,u+f0d0,u+f0d6,u+f0e4,u+f0ec,u+f10a-f10b,u+f123,u+f13e,u+f148-f149,u+f14c,u+f156,u+f15e,u+f160-f161,u+f163,u+f175-f178,u+f195,u+f1f8,u+f219,u+f27a;
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/css/Navbar-Centered-Brand-icons.css b/WebContentt/public/assets/css/Navbar-Centered-Brand-icons.css
new file mode 100644
index 0000000..b6e79a3
--- /dev/null
+++ b/WebContentt/public/assets/css/Navbar-Centered-Brand-icons.css
@@ -0,0 +1,57 @@
+.bs-icon {
+  --bs-icon-size: .75rem;
+  display: flex;
+  flex-shrink: 0;
+  justify-content: center;
+  align-items: center;
+  font-size: var(--bs-icon-size);
+  width: calc(var(--bs-icon-size) * 2);
+  height: calc(var(--bs-icon-size) * 2);
+  color: var(--bs-primary);
+}
+
+.bs-icon-xs {
+  --bs-icon-size: 1rem;
+  width: calc(var(--bs-icon-size) * 1.5);
+  height: calc(var(--bs-icon-size) * 1.5);
+}
+
+.bs-icon-sm {
+  --bs-icon-size: 1rem;
+}
+
+.bs-icon-md {
+  --bs-icon-size: 1.5rem;
+}
+
+.bs-icon-lg {
+  --bs-icon-size: 2rem;
+}
+
+.bs-icon-xl {
+  --bs-icon-size: 2.5rem;
+}
+
+.bs-icon.bs-icon-primary {
+  color: var(--bs-white);
+  background: var(--bs-primary);
+}
+
+.bs-icon.bs-icon-primary-light {
+  color: var(--bs-primary);
+  background: rgba(var(--bs-primary-rgb), .2);
+}
+
+.bs-icon.bs-icon-semi-white {
+  color: var(--bs-primary);
+  background: rgba(255, 255, 255, .5);
+}
+
+.bs-icon.bs-icon-rounded {
+  border-radius: .5rem;
+}
+
+.bs-icon.bs-icon-circle {
+  border-radius: 50%;
+}
+
diff --git a/WebContentt/public/assets/css/all.min.css b/WebContentt/public/assets/css/all.min.css
new file mode 100644
index 0000000..4f5eef5
--- /dev/null
+++ b/WebContentt/public/assets/css/all.min.css
@@ -0,0 +1,28905 @@
+/* !
+ * Font Awesome Pro 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license (Commercial License)
+ * Copyright 2024 Fonticons, Inc. */
+
+.fa {
+  font-family: var(--fa-style-family,"Font Awesome 6 Pro");
+  font-weight: var(--fa-style,900);
+}
+
+.fa, .fa-brands, .fa-classic, .fa-duotone, .fa-light, .fa-regular, .fa-sharp, .fa-sharp-solid, .fa-solid, .fa-thin, .fab, .fad, .fal, .far, .fas, .fasl, .fasr, .fass, .fast, .fat {
+  -moz-osx-font-smoothing: grayscale;
+  -webkit-font-smoothing: antialiased;
+  display: var(--fa-display,inline-block);
+  font-style: normal;
+  font-variant: normal;
+  line-height: 1;
+  text-rendering: auto;
+}
+
+.fa-classic, .fa-light, .fa-regular, .fa-solid, .fa-thin, .fal, .far, .fas, .fat {
+  font-family: "Font Awesome 6 Pro";
+}
+
+.fa-brands, .fab {
+  font-family: "Font Awesome 6 Brands";
+}
+
+.fa-classic.fa-duotone, .fa-duotone, .fad {
+  font-family: "Font Awesome 6 Duotone";
+}
+
+.fa-sharp, .fasl, .fasr, .fass, .fast {
+  font-family: "Font Awesome 6 Sharp";
+}
+
+.fa-sharp, .fass {
+  font-weight: 900;
+}
+
+.fa-1x {
+  font-size: 1em;
+}
+
+.fa-2x {
+  font-size: 2em;
+}
+
+.fa-3x {
+  font-size: 3em;
+}
+
+.fa-4x {
+  font-size: 4em;
+}
+
+.fa-5x {
+  font-size: 5em;
+}
+
+.fa-6x {
+  font-size: 6em;
+}
+
+.fa-7x {
+  font-size: 7em;
+}
+
+.fa-8x {
+  font-size: 8em;
+}
+
+.fa-9x {
+  font-size: 9em;
+}
+
+.fa-10x {
+  font-size: 10em;
+}
+
+.fa-2xs {
+  font-size: .625em;
+  line-height: .1em;
+  vertical-align: .225em;
+}
+
+.fa-xs {
+  font-size: .75em;
+  line-height: .08333em;
+  vertical-align: .125em;
+}
+
+.fa-sm {
+  font-size: .875em;
+  line-height: .07143em;
+  vertical-align: .05357em;
+}
+
+.fa-lg {
+  font-size: 1.25em;
+  line-height: .05em;
+  vertical-align: -.075em;
+}
+
+.fa-xl {
+  font-size: 1.5em;
+  line-height: .04167em;
+  vertical-align: -.125em;
+}
+
+.fa-2xl {
+  font-size: 2em;
+  line-height: .03125em;
+  vertical-align: -.1875em;
+}
+
+.fa-fw {
+  text-align: center;
+  width: 1.25em;
+}
+
+.fa-ul {
+  list-style-type: none;
+  margin-left: var(--fa-li-margin,2.5em);
+  padding-left: 0;
+}
+
+.fa-ul > li {
+  position: relative;
+}
+
+.fa-li {
+  left: calc(var(--fa-li-width, 2em)*-1);
+  position: absolute;
+  text-align: center;
+  width: var(--fa-li-width,2em);
+  line-height: inherit;
+}
+
+.fa-border {
+  border-radius: var(--fa-border-radius,.1em);
+  border: var(--fa-border-width,.08em) var(--fa-border-style,solid) var(--fa-border-color,#eee);
+  padding: var(--fa-border-padding,.2em .25em .15em);
+}
+
+.fa-pull-left {
+  float: left;
+  margin-right: var(--fa-pull-margin,.3em);
+}
+
+.fa-pull-right {
+  float: right;
+  margin-left: var(--fa-pull-margin,.3em);
+}
+
+.fa-beat {
+  -webkit-animation-name: fa-beat;
+  animation-name: fa-beat;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,ease-in-out);
+  animation-timing-function: var(--fa-animation-timing,ease-in-out);
+}
+
+.fa-bounce {
+  -webkit-animation-name: fa-bounce;
+  animation-name: fa-bounce;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1));
+}
+
+.fa-fade {
+  -webkit-animation-name: fa-fade;
+  animation-name: fa-fade;
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+}
+
+.fa-beat-fade, .fa-fade {
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+}
+
+.fa-beat-fade {
+  -webkit-animation-name: fa-beat-fade;
+  animation-name: fa-beat-fade;
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+}
+
+.fa-flip {
+  -webkit-animation-name: fa-flip;
+  animation-name: fa-flip;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,ease-in-out);
+  animation-timing-function: var(--fa-animation-timing,ease-in-out);
+}
+
+.fa-shake {
+  -webkit-animation-name: fa-shake;
+  animation-name: fa-shake;
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,linear);
+  animation-timing-function: var(--fa-animation-timing,linear);
+}
+
+.fa-shake, .fa-spin {
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+}
+
+.fa-spin {
+  -webkit-animation-name: fa-spin;
+  animation-name: fa-spin;
+  -webkit-animation-duration: var(--fa-animation-duration,2s);
+  animation-duration: var(--fa-animation-duration,2s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,linear);
+  animation-timing-function: var(--fa-animation-timing,linear);
+}
+
+.fa-spin-reverse {
+  --fa-animation-direction: reverse;
+}
+
+.fa-pulse, .fa-spin-pulse {
+  -webkit-animation-name: fa-spin;
+  animation-name: fa-spin;
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,steps(8));
+  animation-timing-function: var(--fa-animation-timing,steps(8));
+}
+
+@media (prefers-reduced-motion:reduce) {
+  .fa-beat, .fa-beat-fade, .fa-bounce, .fa-fade, .fa-flip, .fa-pulse, .fa-shake, .fa-spin, .fa-spin-pulse {
+    -webkit-animation-delay: -1ms;
+    animation-delay: -1ms;
+    -webkit-animation-duration: 1ms;
+    animation-duration: 1ms;
+    -webkit-animation-iteration-count: 1;
+    animation-iteration-count: 1;
+    -webkit-transition-delay: 0s;
+    transition-delay: 0s;
+    -webkit-transition-duration: 0s;
+    transition-duration: 0s;
+  }
+}
+
+@keyframes fa-beat {
+  0%, 90% {
+    -webkit-transform: scale(1);
+    transform: scale(1);
+  }
+  45% {
+    -webkit-transform: scale(var(--fa-beat-scale,1.25));
+    transform: scale(var(--fa-beat-scale,1.25));
+  }
+}
+
+@keyframes fa-bounce {
+  0% {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+  10% {
+    -webkit-transform: scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);
+    transform: scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);
+  }
+  30% {
+    -webkit-transform: scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));
+    transform: scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));
+  }
+  50% {
+    -webkit-transform: scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);
+    transform: scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);
+  }
+  57% {
+    -webkit-transform: scale(1) translateY(var(--fa-bounce-rebound,-.125em));
+    transform: scale(1) translateY(var(--fa-bounce-rebound,-.125em));
+  }
+  64% {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+  to {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+}
+
+@keyframes fa-fade {
+  50% {
+    opacity: var(--fa-fade-opacity,.4);
+  }
+}
+
+@keyframes fa-beat-fade {
+  0%, to {
+    opacity: var(--fa-beat-fade-opacity,.4);
+    -webkit-transform: scale(1);
+    transform: scale(1);
+  }
+  50% {
+    opacity: 1;
+    -webkit-transform: scale(var(--fa-beat-fade-scale,1.125));
+    transform: scale(var(--fa-beat-fade-scale,1.125));
+  }
+}
+
+@keyframes fa-flip {
+  50% {
+    -webkit-transform: rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));
+    transform: rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));
+  }
+}
+
+@keyframes fa-shake {
+  0% {
+    -webkit-transform: rotate(-15deg);
+    transform: rotate(-15deg);
+  }
+  4% {
+    -webkit-transform: rotate(15deg);
+    transform: rotate(15deg);
+  }
+  8%, 24% {
+    -webkit-transform: rotate(-18deg);
+    transform: rotate(-18deg);
+  }
+  12%, 28% {
+    -webkit-transform: rotate(18deg);
+    transform: rotate(18deg);
+  }
+  16% {
+    -webkit-transform: rotate(-22deg);
+    transform: rotate(-22deg);
+  }
+  20% {
+    -webkit-transform: rotate(22deg);
+    transform: rotate(22deg);
+  }
+  32% {
+    -webkit-transform: rotate(-12deg);
+    transform: rotate(-12deg);
+  }
+  36% {
+    -webkit-transform: rotate(12deg);
+    transform: rotate(12deg);
+  }
+  40%, to {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+}
+
+@keyframes fa-spin {
+  0% {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+  to {
+    -webkit-transform: rotate(1turn);
+    transform: rotate(1turn);
+  }
+}
+
+.fa-rotate-90 {
+  -webkit-transform: rotate(90deg);
+  transform: rotate(90deg);
+}
+
+.fa-rotate-180 {
+  -webkit-transform: rotate(180deg);
+  transform: rotate(180deg);
+}
+
+.fa-rotate-270 {
+  -webkit-transform: rotate(270deg);
+  transform: rotate(270deg);
+}
+
+.fa-flip-horizontal {
+  -webkit-transform: scaleX(-1);
+  transform: scaleX(-1);
+}
+
+.fa-flip-vertical {
+  -webkit-transform: scaleY(-1);
+  transform: scaleY(-1);
+}
+
+.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {
+  -webkit-transform: scale(-1);
+  transform: scale(-1);
+}
+
+.fa-rotate-by {
+  -webkit-transform: rotate(var(--fa-rotate-angle,0));
+  transform: rotate(var(--fa-rotate-angle,0));
+}
+
+.fa-stack {
+  display: inline-block;
+  height: 2em;
+  line-height: 2em;
+  position: relative;
+  vertical-align: middle;
+  width: 2.5em;
+}
+
+.fa-stack-1x, .fa-stack-2x {
+  left: 0;
+  position: absolute;
+  text-align: center;
+  width: 100%;
+  z-index: var(--fa-stack-z-index,auto);
+}
+
+.fa-stack-1x {
+  line-height: inherit;
+}
+
+.fa-stack-2x {
+  font-size: 2em;
+}
+
+.fa-inverse {
+  color: var(--fa-inverse,#fff);
+}
+
+.fa-0:before {
+  content: "\30";
+}
+
+.fa-1:before {
+  content: "\31";
+}
+
+.fa-2:before {
+  content: "\32";
+}
+
+.fa-3:before {
+  content: "\33";
+}
+
+.fa-4:before {
+  content: "\34";
+}
+
+.fa-5:before {
+  content: "\35";
+}
+
+.fa-6:before {
+  content: "\36";
+}
+
+.fa-7:before {
+  content: "\37";
+}
+
+.fa-8:before {
+  content: "\38";
+}
+
+.fa-9:before {
+  content: "\39";
+}
+
+.fa-fill-drip:before {
+  content: "\f576";
+}
+
+.fa-arrows-to-circle:before {
+  content: "\e4bd";
+}
+
+.fa-chevron-circle-right:before, .fa-circle-chevron-right:before {
+  content: "\f138";
+}
+
+.fa-wagon-covered:before {
+  content: "\f8ee";
+}
+
+.fa-line-height:before {
+  content: "\f871";
+}
+
+.fa-bagel:before {
+  content: "\e3d7";
+}
+
+.fa-transporter-7:before {
+  content: "\e2a8";
+}
+
+.fa-at:before {
+  content: "\40";
+}
+
+.fa-rectangles-mixed:before {
+  content: "\e323";
+}
+
+.fa-phone-arrow-up-right:before, .fa-phone-arrow-up:before, .fa-phone-outgoing:before {
+  content: "\e224";
+}
+
+.fa-trash-alt:before, .fa-trash-can:before {
+  content: "\f2ed";
+}
+
+.fa-circle-l:before {
+  content: "\e114";
+}
+
+.fa-head-side-goggles:before, .fa-head-vr:before {
+  content: "\f6ea";
+}
+
+.fa-text-height:before {
+  content: "\f034";
+}
+
+.fa-user-times:before, .fa-user-xmark:before {
+  content: "\f235";
+}
+
+.fa-face-hand-yawn:before {
+  content: "\e379";
+}
+
+.fa-gauge-simple-min:before, .fa-tachometer-slowest:before {
+  content: "\f62d";
+}
+
+.fa-stethoscope:before {
+  content: "\f0f1";
+}
+
+.fa-coffin:before {
+  content: "\f6c6";
+}
+
+.fa-comment-alt:before, .fa-message:before {
+  content: "\f27a";
+}
+
+.fa-bowl-salad:before, .fa-salad:before {
+  content: "\f81e";
+}
+
+.fa-info:before {
+  content: "\f129";
+}
+
+.fa-robot-astromech:before {
+  content: "\e2d2";
+}
+
+.fa-ring-diamond:before {
+  content: "\e5ab";
+}
+
+.fa-fondue-pot:before {
+  content: "\e40d";
+}
+
+.fa-theta:before {
+  content: "\f69e";
+}
+
+.fa-face-hand-peeking:before {
+  content: "\e481";
+}
+
+.fa-square-user:before {
+  content: "\e283";
+}
+
+.fa-compress-alt:before, .fa-down-left-and-up-right-to-center:before {
+  content: "\f422";
+}
+
+.fa-explosion:before {
+  content: "\e4e9";
+}
+
+.fa-file-alt:before, .fa-file-lines:before, .fa-file-text:before {
+  content: "\f15c";
+}
+
+.fa-wave-square:before {
+  content: "\f83e";
+}
+
+.fa-ring:before {
+  content: "\f70b";
+}
+
+.fa-building-un:before {
+  content: "\e4d9";
+}
+
+.fa-dice-three:before {
+  content: "\f527";
+}
+
+.fa-tire-pressure-warning:before {
+  content: "\f633";
+}
+
+.fa-wifi-2:before, .fa-wifi-fair:before {
+  content: "\f6ab";
+}
+
+.fa-calendar-alt:before, .fa-calendar-days:before {
+  content: "\f073";
+}
+
+.fa-mp3-player:before {
+  content: "\f8ce";
+}
+
+.fa-anchor-circle-check:before {
+  content: "\e4aa";
+}
+
+.fa-tally-4:before {
+  content: "\e297";
+}
+
+.fa-rectangle-history:before {
+  content: "\e4a2";
+}
+
+.fa-building-circle-arrow-right:before {
+  content: "\e4d1";
+}
+
+.fa-volleyball-ball:before, .fa-volleyball:before {
+  content: "\f45f";
+}
+
+.fa-sun-haze:before {
+  content: "\f765";
+}
+
+.fa-text-size:before {
+  content: "\f894";
+}
+
+.fa-ufo:before {
+  content: "\e047";
+}
+
+.fa-fork:before, .fa-utensil-fork:before {
+  content: "\f2e3";
+}
+
+.fa-arrows-up-to-line:before {
+  content: "\e4c2";
+}
+
+.fa-mobile-signal:before {
+  content: "\e1ef";
+}
+
+.fa-barcode-scan:before {
+  content: "\f465";
+}
+
+.fa-sort-desc:before, .fa-sort-down:before {
+  content: "\f0dd";
+}
+
+.fa-folder-arrow-down:before, .fa-folder-download:before {
+  content: "\e053";
+}
+
+.fa-circle-minus:before, .fa-minus-circle:before {
+  content: "\f056";
+}
+
+.fa-face-icicles:before {
+  content: "\e37c";
+}
+
+.fa-shovel:before {
+  content: "\f713";
+}
+
+.fa-door-open:before {
+  content: "\f52b";
+}
+
+.fa-films:before {
+  content: "\e17a";
+}
+
+.fa-right-from-bracket:before, .fa-sign-out-alt:before {
+  content: "\f2f5";
+}
+
+.fa-face-glasses:before {
+  content: "\e377";
+}
+
+.fa-nfc:before {
+  content: "\e1f7";
+}
+
+.fa-atom:before {
+  content: "\f5d2";
+}
+
+.fa-soap:before {
+  content: "\e06e";
+}
+
+.fa-heart-music-camera-bolt:before, .fa-icons:before {
+  content: "\f86d";
+}
+
+.fa-microphone-alt-slash:before, .fa-microphone-lines-slash:before {
+  content: "\f539";
+}
+
+.fa-closed-captioning-slash:before {
+  content: "\e135";
+}
+
+.fa-calculator-alt:before, .fa-calculator-simple:before {
+  content: "\f64c";
+}
+
+.fa-bridge-circle-check:before {
+  content: "\e4c9";
+}
+
+.fa-sliders-up:before, .fa-sliders-v:before {
+  content: "\f3f1";
+}
+
+.fa-location-minus:before, .fa-map-marker-minus:before {
+  content: "\f609";
+}
+
+.fa-pump-medical:before {
+  content: "\e06a";
+}
+
+.fa-fingerprint:before {
+  content: "\f577";
+}
+
+.fa-ski-boot:before {
+  content: "\e3cc";
+}
+
+.fa-rectangle-sd:before, .fa-standard-definition:before {
+  content: "\e28a";
+}
+
+.fa-h1:before {
+  content: "\f313";
+}
+
+.fa-hand-point-right:before {
+  content: "\f0a4";
+}
+
+.fa-magnifying-glass-location:before, .fa-search-location:before {
+  content: "\f689";
+}
+
+.fa-message-bot:before {
+  content: "\e3b8";
+}
+
+.fa-forward-step:before, .fa-step-forward:before {
+  content: "\f051";
+}
+
+.fa-face-smile-beam:before, .fa-smile-beam:before {
+  content: "\f5b8";
+}
+
+.fa-light-ceiling:before {
+  content: "\e016";
+}
+
+.fa-comment-alt-exclamation:before, .fa-message-exclamation:before {
+  content: "\f4a5";
+}
+
+.fa-bowl-scoop:before, .fa-bowl-shaved-ice:before {
+  content: "\e3de";
+}
+
+.fa-square-x:before {
+  content: "\e286";
+}
+
+.fa-building-memo:before {
+  content: "\e61e";
+}
+
+.fa-utility-pole-double:before {
+  content: "\e2c4";
+}
+
+.fa-flag-checkered:before {
+  content: "\f11e";
+}
+
+.fa-chevron-double-up:before, .fa-chevrons-up:before {
+  content: "\f325";
+}
+
+.fa-football-ball:before, .fa-football:before {
+  content: "\f44e";
+}
+
+.fa-user-vneck:before {
+  content: "\e461";
+}
+
+.fa-school-circle-exclamation:before {
+  content: "\e56c";
+}
+
+.fa-crop:before {
+  content: "\f125";
+}
+
+.fa-angle-double-down:before, .fa-angles-down:before {
+  content: "\f103";
+}
+
+.fa-users-rectangle:before {
+  content: "\e594";
+}
+
+.fa-people-roof:before {
+  content: "\e537";
+}
+
+.fa-arrow-square-right:before, .fa-square-arrow-right:before {
+  content: "\f33b";
+}
+
+.fa-location-plus:before, .fa-map-marker-plus:before {
+  content: "\f60a";
+}
+
+.fa-lightbulb-exclamation-on:before {
+  content: "\e1ca";
+}
+
+.fa-people-line:before {
+  content: "\e534";
+}
+
+.fa-beer-mug-empty:before, .fa-beer:before {
+  content: "\f0fc";
+}
+
+.fa-crate-empty:before {
+  content: "\e151";
+}
+
+.fa-diagram-predecessor:before {
+  content: "\e477";
+}
+
+.fa-transporter:before {
+  content: "\e042";
+}
+
+.fa-calendar-circle-user:before {
+  content: "\e471";
+}
+
+.fa-arrow-up-long:before, .fa-long-arrow-up:before {
+  content: "\f176";
+}
+
+.fa-person-carry-box:before, .fa-person-carry:before {
+  content: "\f4cf";
+}
+
+.fa-burn:before, .fa-fire-flame-simple:before {
+  content: "\f46a";
+}
+
+.fa-male:before, .fa-person:before {
+  content: "\f183";
+}
+
+.fa-laptop:before {
+  content: "\f109";
+}
+
+.fa-file-csv:before {
+  content: "\f6dd";
+}
+
+.fa-menorah:before {
+  content: "\f676";
+}
+
+.fa-union:before {
+  content: "\f6a2";
+}
+
+.fa-chevron-double-left:before, .fa-chevrons-left:before {
+  content: "\f323";
+}
+
+.fa-circle-heart:before, .fa-heart-circle:before {
+  content: "\f4c7";
+}
+
+.fa-truck-plane:before {
+  content: "\e58f";
+}
+
+.fa-record-vinyl:before {
+  content: "\f8d9";
+}
+
+.fa-bring-forward:before {
+  content: "\f856";
+}
+
+.fa-square-p:before {
+  content: "\e279";
+}
+
+.fa-face-grin-stars:before, .fa-grin-stars:before {
+  content: "\f587";
+}
+
+.fa-sigma:before {
+  content: "\f68b";
+}
+
+.fa-camera-movie:before {
+  content: "\f8a9";
+}
+
+.fa-bong:before {
+  content: "\f55c";
+}
+
+.fa-clarinet:before {
+  content: "\f8ad";
+}
+
+.fa-truck-flatbed:before {
+  content: "\e2b6";
+}
+
+.fa-pastafarianism:before, .fa-spaghetti-monster-flying:before {
+  content: "\f67b";
+}
+
+.fa-arrow-down-up-across-line:before {
+  content: "\e4af";
+}
+
+.fa-arrows-rotate-reverse:before {
+  content: "\e630";
+}
+
+.fa-leaf-heart:before {
+  content: "\f4cb";
+}
+
+.fa-house-building:before {
+  content: "\e1b1";
+}
+
+.fa-cheese-swiss:before {
+  content: "\f7f0";
+}
+
+.fa-spoon:before, .fa-utensil-spoon:before {
+  content: "\f2e5";
+}
+
+.fa-jar-wheat:before {
+  content: "\e517";
+}
+
+.fa-envelopes-bulk:before, .fa-mail-bulk:before {
+  content: "\f674";
+}
+
+.fa-file-circle-exclamation:before {
+  content: "\e4eb";
+}
+
+.fa-bow-arrow:before {
+  content: "\f6b9";
+}
+
+.fa-cart-xmark:before {
+  content: "\e0dd";
+}
+
+.fa-hexagon-xmark:before, .fa-times-hexagon:before, .fa-xmark-hexagon:before {
+  content: "\f2ee";
+}
+
+.fa-circle-h:before, .fa-hospital-symbol:before {
+  content: "\f47e";
+}
+
+.fa-merge:before {
+  content: "\e526";
+}
+
+.fa-pager:before {
+  content: "\f815";
+}
+
+.fa-cart-minus:before {
+  content: "\e0db";
+}
+
+.fa-address-book:before, .fa-contact-book:before {
+  content: "\f2b9";
+}
+
+.fa-pan-frying:before {
+  content: "\e42c";
+}
+
+.fa-grid-3:before, .fa-grid:before {
+  content: "\e195";
+}
+
+.fa-football-helmet:before {
+  content: "\f44f";
+}
+
+.fa-hand-love:before {
+  content: "\e1a5";
+}
+
+.fa-trees:before {
+  content: "\f724";
+}
+
+.fa-strikethrough:before {
+  content: "\f0cc";
+}
+
+.fa-page:before {
+  content: "\e428";
+}
+
+.fa-k:before {
+  content: "\4b";
+}
+
+.fa-diagram-previous:before {
+  content: "\e478";
+}
+
+.fa-gauge-min:before, .fa-tachometer-alt-slowest:before {
+  content: "\f628";
+}
+
+.fa-folder-grid:before {
+  content: "\e188";
+}
+
+.fa-eggplant:before {
+  content: "\e16c";
+}
+
+.fa-excavator:before {
+  content: "\e656";
+}
+
+.fa-ram:before {
+  content: "\f70a";
+}
+
+.fa-landmark-flag:before {
+  content: "\e51c";
+}
+
+.fa-lips:before {
+  content: "\f600";
+}
+
+.fa-pencil-alt:before, .fa-pencil:before {
+  content: "\f303";
+}
+
+.fa-backward:before {
+  content: "\f04a";
+}
+
+.fa-caret-right:before {
+  content: "\f0da";
+}
+
+.fa-comments:before {
+  content: "\f086";
+}
+
+.fa-file-clipboard:before, .fa-paste:before {
+  content: "\f0ea";
+}
+
+.fa-desktop-arrow-down:before {
+  content: "\e155";
+}
+
+.fa-code-pull-request:before {
+  content: "\e13c";
+}
+
+.fa-pumpkin:before {
+  content: "\f707";
+}
+
+.fa-clipboard-list:before {
+  content: "\f46d";
+}
+
+.fa-pen-field:before {
+  content: "\e211";
+}
+
+.fa-blueberries:before {
+  content: "\e2e8";
+}
+
+.fa-truck-loading:before, .fa-truck-ramp-box:before {
+  content: "\f4de";
+}
+
+.fa-note:before {
+  content: "\e1ff";
+}
+
+.fa-arrow-down-to-square:before {
+  content: "\e096";
+}
+
+.fa-user-check:before {
+  content: "\f4fc";
+}
+
+.fa-cloud-xmark:before {
+  content: "\e35f";
+}
+
+.fa-vial-virus:before {
+  content: "\e597";
+}
+
+.fa-book-alt:before, .fa-book-blank:before {
+  content: "\f5d9";
+}
+
+.fa-golf-flag-hole:before {
+  content: "\e3ac";
+}
+
+.fa-comment-alt-arrow-down:before, .fa-message-arrow-down:before {
+  content: "\e1db";
+}
+
+.fa-face-unamused:before {
+  content: "\e39f";
+}
+
+.fa-sheet-plastic:before {
+  content: "\e571";
+}
+
+.fa-circle-9:before {
+  content: "\e0f6";
+}
+
+.fa-blog:before {
+  content: "\f781";
+}
+
+.fa-user-ninja:before {
+  content: "\f504";
+}
+
+.fa-pencil-slash:before {
+  content: "\e215";
+}
+
+.fa-bowling-pins:before {
+  content: "\f437";
+}
+
+.fa-person-arrow-up-from-line:before {
+  content: "\e539";
+}
+
+.fa-down-right:before {
+  content: "\e16b";
+}
+
+.fa-scroll-torah:before, .fa-torah:before {
+  content: "\f6a0";
+}
+
+.fa-webhook:before {
+  content: "\e5d5";
+}
+
+.fa-blinds-open:before {
+  content: "\f8fc";
+}
+
+.fa-fence:before {
+  content: "\e303";
+}
+
+.fa-arrow-alt-up:before, .fa-up:before {
+  content: "\f357";
+}
+
+.fa-broom-ball:before, .fa-quidditch-broom-ball:before, .fa-quidditch:before {
+  content: "\f458";
+}
+
+.fa-drumstick:before {
+  content: "\f6d6";
+}
+
+.fa-square-v:before {
+  content: "\e284";
+}
+
+.fa-face-awesome:before, .fa-gave-dandy:before {
+  content: "\e409";
+}
+
+.fa-dial-off:before {
+  content: "\e162";
+}
+
+.fa-toggle-off:before {
+  content: "\f204";
+}
+
+.fa-face-smile-horns:before {
+  content: "\e391";
+}
+
+.fa-archive:before, .fa-box-archive:before {
+  content: "\f187";
+}
+
+.fa-grapes:before {
+  content: "\e306";
+}
+
+.fa-person-drowning:before {
+  content: "\e545";
+}
+
+.fa-dial-max:before {
+  content: "\e15e";
+}
+
+.fa-circle-m:before {
+  content: "\e115";
+}
+
+.fa-calendar-image:before {
+  content: "\e0d4";
+}
+
+.fa-caret-circle-down:before, .fa-circle-caret-down:before {
+  content: "\f32d";
+}
+
+.fa-arrow-down-9-1:before, .fa-sort-numeric-desc:before, .fa-sort-numeric-down-alt:before {
+  content: "\f886";
+}
+
+.fa-face-grin-tongue-squint:before, .fa-grin-tongue-squint:before {
+  content: "\f58a";
+}
+
+.fa-shish-kebab:before {
+  content: "\f821";
+}
+
+.fa-spray-can:before {
+  content: "\f5bd";
+}
+
+.fa-alarm-snooze:before {
+  content: "\f845";
+}
+
+.fa-scarecrow:before {
+  content: "\f70d";
+}
+
+.fa-truck-monster:before {
+  content: "\f63b";
+}
+
+.fa-gift-card:before {
+  content: "\f663";
+}
+
+.fa-w:before {
+  content: "\57";
+}
+
+.fa-code-pull-request-draft:before {
+  content: "\e3fa";
+}
+
+.fa-square-b:before {
+  content: "\e264";
+}
+
+.fa-elephant:before {
+  content: "\f6da";
+}
+
+.fa-earth-africa:before, .fa-globe-africa:before {
+  content: "\f57c";
+}
+
+.fa-rainbow:before {
+  content: "\f75b";
+}
+
+.fa-circle-notch:before {
+  content: "\f1ce";
+}
+
+.fa-tablet-alt:before, .fa-tablet-screen-button:before {
+  content: "\f3fa";
+}
+
+.fa-paw:before {
+  content: "\f1b0";
+}
+
+.fa-message-question:before {
+  content: "\e1e3";
+}
+
+.fa-cloud:before {
+  content: "\f0c2";
+}
+
+.fa-trowel-bricks:before {
+  content: "\e58a";
+}
+
+.fa-square-3:before {
+  content: "\e258";
+}
+
+.fa-face-flushed:before, .fa-flushed:before {
+  content: "\f579";
+}
+
+.fa-hospital-user:before {
+  content: "\f80d";
+}
+
+.fa-microwave:before {
+  content: "\e01b";
+}
+
+.fa-chf-sign:before {
+  content: "\e602";
+}
+
+.fa-tent-arrow-left-right:before {
+  content: "\e57f";
+}
+
+.fa-cart-circle-arrow-up:before {
+  content: "\e3f0";
+}
+
+.fa-trash-clock:before {
+  content: "\e2b0";
+}
+
+.fa-reflect-both:before {
+  content: "\e66f";
+}
+
+.fa-gavel:before, .fa-legal:before {
+  content: "\f0e3";
+}
+
+.fa-sprinkler-ceiling:before {
+  content: "\e44c";
+}
+
+.fa-browsers:before {
+  content: "\e0cb";
+}
+
+.fa-trillium:before {
+  content: "\e588";
+}
+
+.fa-music-slash:before {
+  content: "\f8d1";
+}
+
+.fa-truck-ramp:before {
+  content: "\f4e0";
+}
+
+.fa-binoculars:before {
+  content: "\f1e5";
+}
+
+.fa-microphone-slash:before {
+  content: "\f131";
+}
+
+.fa-box-tissue:before {
+  content: "\e05b";
+}
+
+.fa-circle-c:before {
+  content: "\e101";
+}
+
+.fa-star-christmas:before {
+  content: "\f7d4";
+}
+
+.fa-chart-bullet:before {
+  content: "\e0e1";
+}
+
+.fa-motorcycle:before {
+  content: "\f21c";
+}
+
+.fa-tree-christmas:before {
+  content: "\f7db";
+}
+
+.fa-tire-flat:before {
+  content: "\f632";
+}
+
+.fa-sunglasses:before {
+  content: "\f892";
+}
+
+.fa-badge:before {
+  content: "\f335";
+}
+
+.fa-comment-alt-edit:before, .fa-message-edit:before, .fa-message-pen:before {
+  content: "\f4a4";
+}
+
+.fa-bell-concierge:before, .fa-concierge-bell:before {
+  content: "\f562";
+}
+
+.fa-pen-ruler:before, .fa-pencil-ruler:before {
+  content: "\f5ae";
+}
+
+.fa-file-mp3:before {
+  content: "\e648";
+}
+
+.fa-arrow-progress:before {
+  content: "\e5df";
+}
+
+.fa-chess-rook-alt:before, .fa-chess-rook-piece:before {
+  content: "\f448";
+}
+
+.fa-square-root:before {
+  content: "\f697";
+}
+
+.fa-album-collection-circle-plus:before {
+  content: "\e48e";
+}
+
+.fa-people-arrows-left-right:before, .fa-people-arrows:before {
+  content: "\e068";
+}
+
+.fa-sign-post:before {
+  content: "\e624";
+}
+
+.fa-face-angry-horns:before {
+  content: "\e368";
+}
+
+.fa-mars-and-venus-burst:before {
+  content: "\e523";
+}
+
+.fa-tombstone:before {
+  content: "\f720";
+}
+
+.fa-caret-square-right:before, .fa-square-caret-right:before {
+  content: "\f152";
+}
+
+.fa-cut:before, .fa-scissors:before {
+  content: "\f0c4";
+}
+
+.fa-list-music:before {
+  content: "\f8c9";
+}
+
+.fa-sun-plant-wilt:before {
+  content: "\e57a";
+}
+
+.fa-toilets-portable:before {
+  content: "\e584";
+}
+
+.fa-hockey-puck:before {
+  content: "\f453";
+}
+
+.fa-mustache:before {
+  content: "\e5bc";
+}
+
+.fa-hyphen:before {
+  content: "\2d";
+}
+
+.fa-table:before {
+  content: "\f0ce";
+}
+
+.fa-user-chef:before {
+  content: "\e3d2";
+}
+
+.fa-comment-alt-image:before, .fa-message-image:before {
+  content: "\e1e0";
+}
+
+.fa-users-medical:before {
+  content: "\f830";
+}
+
+.fa-sensor-alert:before, .fa-sensor-triangle-exclamation:before {
+  content: "\e029";
+}
+
+.fa-magnifying-glass-arrow-right:before {
+  content: "\e521";
+}
+
+.fa-digital-tachograph:before, .fa-tachograph-digital:before {
+  content: "\f566";
+}
+
+.fa-face-mask:before {
+  content: "\e37f";
+}
+
+.fa-pickleball:before {
+  content: "\e435";
+}
+
+.fa-star-sharp-half:before {
+  content: "\e28c";
+}
+
+.fa-users-slash:before {
+  content: "\e073";
+}
+
+.fa-clover:before {
+  content: "\e139";
+}
+
+.fa-meat:before {
+  content: "\f814";
+}
+
+.fa-mail-reply:before, .fa-reply:before {
+  content: "\f3e5";
+}
+
+.fa-star-and-crescent:before {
+  content: "\f699";
+}
+
+.fa-empty-set:before {
+  content: "\f656";
+}
+
+.fa-house-fire:before {
+  content: "\e50c";
+}
+
+.fa-minus-square:before, .fa-square-minus:before {
+  content: "\f146";
+}
+
+.fa-helicopter:before {
+  content: "\f533";
+}
+
+.fa-bird:before {
+  content: "\e469";
+}
+
+.fa-compass:before {
+  content: "\f14e";
+}
+
+.fa-caret-square-down:before, .fa-square-caret-down:before {
+  content: "\f150";
+}
+
+.fa-heart-half-alt:before, .fa-heart-half-stroke:before {
+  content: "\e1ac";
+}
+
+.fa-file-circle-question:before {
+  content: "\e4ef";
+}
+
+.fa-truck-utensils:before {
+  content: "\e628";
+}
+
+.fa-laptop-code:before {
+  content: "\f5fc";
+}
+
+.fa-joystick:before {
+  content: "\f8c5";
+}
+
+.fa-grill-fire:before {
+  content: "\e5a4";
+}
+
+.fa-rectangle-vertical-history:before {
+  content: "\e237";
+}
+
+.fa-swatchbook:before {
+  content: "\f5c3";
+}
+
+.fa-prescription-bottle:before {
+  content: "\f485";
+}
+
+.fa-bars:before, .fa-navicon:before {
+  content: "\f0c9";
+}
+
+.fa-keyboard-left:before {
+  content: "\e1c3";
+}
+
+.fa-people-group:before {
+  content: "\e533";
+}
+
+.fa-hourglass-3:before, .fa-hourglass-end:before {
+  content: "\f253";
+}
+
+.fa-heart-broken:before, .fa-heart-crack:before {
+  content: "\f7a9";
+}
+
+.fa-face-beam-hand-over-mouth:before {
+  content: "\e47c";
+}
+
+.fa-droplet-percent:before, .fa-humidity:before {
+  content: "\f750";
+}
+
+.fa-external-link-square-alt:before, .fa-square-up-right:before {
+  content: "\f360";
+}
+
+.fa-face-kiss-beam:before, .fa-kiss-beam:before {
+  content: "\f597";
+}
+
+.fa-corn:before {
+  content: "\f6c7";
+}
+
+.fa-roller-coaster:before {
+  content: "\e324";
+}
+
+.fa-photo-film-music:before {
+  content: "\e228";
+}
+
+.fa-radar:before {
+  content: "\e024";
+}
+
+.fa-sickle:before {
+  content: "\f822";
+}
+
+.fa-film:before {
+  content: "\f008";
+}
+
+.fa-coconut:before {
+  content: "\e2f6";
+}
+
+.fa-ruler-horizontal:before {
+  content: "\f547";
+}
+
+.fa-shield-cross:before {
+  content: "\f712";
+}
+
+.fa-cassette-tape:before {
+  content: "\f8ab";
+}
+
+.fa-square-terminal:before {
+  content: "\e32a";
+}
+
+.fa-people-robbery:before {
+  content: "\e536";
+}
+
+.fa-lightbulb:before {
+  content: "\f0eb";
+}
+
+.fa-caret-left:before {
+  content: "\f0d9";
+}
+
+.fa-comment-middle:before {
+  content: "\e149";
+}
+
+.fa-trash-can-list:before {
+  content: "\e2ab";
+}
+
+.fa-block:before {
+  content: "\e46a";
+}
+
+.fa-circle-exclamation:before, .fa-exclamation-circle:before {
+  content: "\f06a";
+}
+
+.fa-school-circle-xmark:before {
+  content: "\e56d";
+}
+
+.fa-arrow-right-from-bracket:before, .fa-sign-out:before {
+  content: "\f08b";
+}
+
+.fa-face-frown-slight:before {
+  content: "\e376";
+}
+
+.fa-chevron-circle-down:before, .fa-circle-chevron-down:before {
+  content: "\f13a";
+}
+
+.fa-sidebar-flip:before {
+  content: "\e24f";
+}
+
+.fa-unlock-alt:before, .fa-unlock-keyhole:before {
+  content: "\f13e";
+}
+
+.fa-temperature-list:before {
+  content: "\e299";
+}
+
+.fa-cloud-showers-heavy:before {
+  content: "\f740";
+}
+
+.fa-headphones-alt:before, .fa-headphones-simple:before {
+  content: "\f58f";
+}
+
+.fa-sitemap:before {
+  content: "\f0e8";
+}
+
+.fa-pipe-section:before {
+  content: "\e438";
+}
+
+.fa-space-station-moon-alt:before, .fa-space-station-moon-construction:before {
+  content: "\e034";
+}
+
+.fa-circle-dollar-to-slot:before, .fa-donate:before {
+  content: "\f4b9";
+}
+
+.fa-memory:before {
+  content: "\f538";
+}
+
+.fa-face-sleeping:before {
+  content: "\e38d";
+}
+
+.fa-road-spikes:before {
+  content: "\e568";
+}
+
+.fa-fire-burner:before {
+  content: "\e4f1";
+}
+
+.fa-squirrel:before {
+  content: "\f71a";
+}
+
+.fa-arrow-to-top:before, .fa-arrow-up-to-line:before {
+  content: "\f341";
+}
+
+.fa-flag:before {
+  content: "\f024";
+}
+
+.fa-face-cowboy-hat:before {
+  content: "\e36e";
+}
+
+.fa-hanukiah:before {
+  content: "\f6e6";
+}
+
+.fa-chart-scatter-3d:before {
+  content: "\e0e8";
+}
+
+.fa-display-chart-up:before {
+  content: "\e5e3";
+}
+
+.fa-square-code:before {
+  content: "\e267";
+}
+
+.fa-feather:before {
+  content: "\f52d";
+}
+
+.fa-volume-down:before, .fa-volume-low:before {
+  content: "\f027";
+}
+
+.fa-times-to-slot:before, .fa-vote-nay:before, .fa-xmark-to-slot:before {
+  content: "\f771";
+}
+
+.fa-box-alt:before, .fa-box-taped:before {
+  content: "\f49a";
+}
+
+.fa-comment-slash:before {
+  content: "\f4b3";
+}
+
+.fa-swords:before {
+  content: "\f71d";
+}
+
+.fa-cloud-sun-rain:before {
+  content: "\f743";
+}
+
+.fa-album:before {
+  content: "\f89f";
+}
+
+.fa-circle-n:before {
+  content: "\e118";
+}
+
+.fa-compress:before {
+  content: "\f066";
+}
+
+.fa-wheat-alt:before, .fa-wheat-awn:before {
+  content: "\e2cd";
+}
+
+.fa-ankh:before {
+  content: "\f644";
+}
+
+.fa-hands-holding-child:before {
+  content: "\e4fa";
+}
+
+.fa-asterisk:before {
+  content: "\2a";
+}
+
+.fa-key-skeleton-left-right:before {
+  content: "\e3b4";
+}
+
+.fa-comment-lines:before {
+  content: "\f4b0";
+}
+
+.fa-luchador-mask:before, .fa-luchador:before, .fa-mask-luchador:before {
+  content: "\f455";
+}
+
+.fa-check-square:before, .fa-square-check:before {
+  content: "\f14a";
+}
+
+.fa-shredder:before {
+  content: "\f68a";
+}
+
+.fa-book-open-alt:before, .fa-book-open-cover:before {
+  content: "\e0c0";
+}
+
+.fa-sandwich:before {
+  content: "\f81f";
+}
+
+.fa-peseta-sign:before {
+  content: "\e221";
+}
+
+.fa-parking-slash:before, .fa-square-parking-slash:before {
+  content: "\f617";
+}
+
+.fa-train-tunnel:before {
+  content: "\e454";
+}
+
+.fa-header:before, .fa-heading:before {
+  content: "\f1dc";
+}
+
+.fa-ghost:before {
+  content: "\f6e2";
+}
+
+.fa-face-anguished:before {
+  content: "\e369";
+}
+
+.fa-hockey-sticks:before {
+  content: "\f454";
+}
+
+.fa-abacus:before {
+  content: "\f640";
+}
+
+.fa-film-alt:before, .fa-film-simple:before {
+  content: "\f3a0";
+}
+
+.fa-list-squares:before, .fa-list:before {
+  content: "\f03a";
+}
+
+.fa-tree-palm:before {
+  content: "\f82b";
+}
+
+.fa-phone-square-alt:before, .fa-square-phone-flip:before {
+  content: "\f87b";
+}
+
+.fa-cart-plus:before {
+  content: "\f217";
+}
+
+.fa-gamepad:before {
+  content: "\f11b";
+}
+
+.fa-border-center-v:before {
+  content: "\f89d";
+}
+
+.fa-circle-dot:before, .fa-dot-circle:before {
+  content: "\f192";
+}
+
+.fa-clipboard-medical:before {
+  content: "\e133";
+}
+
+.fa-dizzy:before, .fa-face-dizzy:before {
+  content: "\f567";
+}
+
+.fa-egg:before {
+  content: "\f7fb";
+}
+
+.fa-arrow-alt-to-top:before, .fa-up-to-line:before {
+  content: "\f34d";
+}
+
+.fa-house-medical-circle-xmark:before {
+  content: "\e513";
+}
+
+.fa-watch-fitness:before {
+  content: "\f63e";
+}
+
+.fa-clock-nine-thirty:before {
+  content: "\e34d";
+}
+
+.fa-campground:before {
+  content: "\f6bb";
+}
+
+.fa-folder-plus:before {
+  content: "\f65e";
+}
+
+.fa-jug:before {
+  content: "\f8c6";
+}
+
+.fa-futbol-ball:before, .fa-futbol:before, .fa-soccer-ball:before {
+  content: "\f1e3";
+}
+
+.fa-snow-blowing:before {
+  content: "\f761";
+}
+
+.fa-paint-brush:before, .fa-paintbrush:before {
+  content: "\f1fc";
+}
+
+.fa-lock:before {
+  content: "\f023";
+}
+
+.fa-arrow-down-from-line:before, .fa-arrow-from-top:before {
+  content: "\f345";
+}
+
+.fa-gas-pump:before {
+  content: "\f52f";
+}
+
+.fa-signal-alt-slash:before, .fa-signal-bars-slash:before {
+  content: "\f694";
+}
+
+.fa-monkey:before {
+  content: "\f6fb";
+}
+
+.fa-pro:before, .fa-rectangle-pro:before {
+  content: "\e235";
+}
+
+.fa-house-night:before {
+  content: "\e010";
+}
+
+.fa-hot-tub-person:before, .fa-hot-tub:before {
+  content: "\f593";
+}
+
+.fa-globe-pointer:before {
+  content: "\e60e";
+}
+
+.fa-blanket:before {
+  content: "\f498";
+}
+
+.fa-map-location:before, .fa-map-marked:before {
+  content: "\f59f";
+}
+
+.fa-house-flood-water:before {
+  content: "\e50e";
+}
+
+.fa-comments-question-check:before {
+  content: "\e14f";
+}
+
+.fa-tree:before {
+  content: "\f1bb";
+}
+
+.fa-arrows-cross:before {
+  content: "\e0a2";
+}
+
+.fa-backpack:before {
+  content: "\f5d4";
+}
+
+.fa-square-small:before {
+  content: "\e27e";
+}
+
+.fa-folder-arrow-up:before, .fa-folder-upload:before {
+  content: "\e054";
+}
+
+.fa-bridge-lock:before {
+  content: "\e4cc";
+}
+
+.fa-crosshairs-simple:before {
+  content: "\e59f";
+}
+
+.fa-sack-dollar:before {
+  content: "\f81d";
+}
+
+.fa-edit:before, .fa-pen-to-square:before {
+  content: "\f044";
+}
+
+.fa-sliders-h-square:before, .fa-square-sliders:before {
+  content: "\f3f0";
+}
+
+.fa-car-side:before {
+  content: "\f5e4";
+}
+
+.fa-comment-middle-top-alt:before, .fa-message-middle-top:before {
+  content: "\e1e2";
+}
+
+.fa-lightbulb-on:before {
+  content: "\f672";
+}
+
+.fa-knife:before, .fa-utensil-knife:before {
+  content: "\f2e4";
+}
+
+.fa-share-alt:before, .fa-share-nodes:before {
+  content: "\f1e0";
+}
+
+.fa-display-chart-up-circle-dollar:before {
+  content: "\e5e6";
+}
+
+.fa-wave-sine:before {
+  content: "\f899";
+}
+
+.fa-heart-circle-minus:before {
+  content: "\e4ff";
+}
+
+.fa-circle-w:before {
+  content: "\e12c";
+}
+
+.fa-calendar-circle:before, .fa-circle-calendar:before {
+  content: "\e102";
+}
+
+.fa-hourglass-2:before, .fa-hourglass-half:before {
+  content: "\f252";
+}
+
+.fa-microscope:before {
+  content: "\f610";
+}
+
+.fa-sunset:before {
+  content: "\f767";
+}
+
+.fa-sink:before {
+  content: "\e06d";
+}
+
+.fa-calendar-exclamation:before {
+  content: "\f334";
+}
+
+.fa-truck-container-empty:before {
+  content: "\e2b5";
+}
+
+.fa-hand-heart:before {
+  content: "\f4bc";
+}
+
+.fa-bag-shopping:before, .fa-shopping-bag:before {
+  content: "\f290";
+}
+
+.fa-arrow-down-z-a:before, .fa-sort-alpha-desc:before, .fa-sort-alpha-down-alt:before {
+  content: "\f881";
+}
+
+.fa-mitten:before {
+  content: "\f7b5";
+}
+
+.fa-reply-clock:before, .fa-reply-time:before {
+  content: "\e239";
+}
+
+.fa-person-rays:before {
+  content: "\e54d";
+}
+
+.fa-arrow-alt-right:before, .fa-right:before {
+  content: "\f356";
+}
+
+.fa-circle-f:before {
+  content: "\e10e";
+}
+
+.fa-users:before {
+  content: "\f0c0";
+}
+
+.fa-face-pleading:before {
+  content: "\e386";
+}
+
+.fa-eye-slash:before {
+  content: "\f070";
+}
+
+.fa-flask-vial:before {
+  content: "\e4f3";
+}
+
+.fa-police-box:before {
+  content: "\e021";
+}
+
+.fa-cucumber:before {
+  content: "\e401";
+}
+
+.fa-head-side-brain:before {
+  content: "\f808";
+}
+
+.fa-hand-paper:before, .fa-hand:before {
+  content: "\f256";
+}
+
+.fa-biking-mountain:before, .fa-person-biking-mountain:before {
+  content: "\f84b";
+}
+
+.fa-utensils-slash:before {
+  content: "\e464";
+}
+
+.fa-print-magnifying-glass:before, .fa-print-search:before {
+  content: "\f81a";
+}
+
+.fa-turn-right:before {
+  content: "\e639";
+}
+
+.fa-folder-bookmark:before {
+  content: "\e186";
+}
+
+.fa-arrow-turn-left-down:before {
+  content: "\e633";
+}
+
+.fa-om:before {
+  content: "\f679";
+}
+
+.fa-pi:before {
+  content: "\f67e";
+}
+
+.fa-flask-potion:before, .fa-flask-round-potion:before {
+  content: "\f6e1";
+}
+
+.fa-face-shush:before {
+  content: "\e38c";
+}
+
+.fa-worm:before {
+  content: "\e599";
+}
+
+.fa-house-circle-xmark:before {
+  content: "\e50b";
+}
+
+.fa-plug:before {
+  content: "\f1e6";
+}
+
+.fa-calendar-circle-exclamation:before {
+  content: "\e46e";
+}
+
+.fa-square-i:before {
+  content: "\e272";
+}
+
+.fa-chevron-up:before {
+  content: "\f077";
+}
+
+.fa-face-saluting:before {
+  content: "\e484";
+}
+
+.fa-gauge-simple-low:before, .fa-tachometer-slow:before {
+  content: "\f62c";
+}
+
+.fa-face-persevering:before {
+  content: "\e385";
+}
+
+.fa-camera-circle:before, .fa-circle-camera:before {
+  content: "\e103";
+}
+
+.fa-hand-spock:before {
+  content: "\f259";
+}
+
+.fa-spider-web:before {
+  content: "\f719";
+}
+
+.fa-circle-microphone:before, .fa-microphone-circle:before {
+  content: "\e116";
+}
+
+.fa-book-arrow-up:before {
+  content: "\e0ba";
+}
+
+.fa-popsicle:before {
+  content: "\e43e";
+}
+
+.fa-command:before {
+  content: "\e142";
+}
+
+.fa-blinds:before {
+  content: "\f8fb";
+}
+
+.fa-stopwatch:before {
+  content: "\f2f2";
+}
+
+.fa-saxophone:before {
+  content: "\f8dc";
+}
+
+.fa-square-2:before {
+  content: "\e257";
+}
+
+.fa-field-hockey-stick-ball:before, .fa-field-hockey:before {
+  content: "\f44c";
+}
+
+.fa-arrow-up-square-triangle:before, .fa-sort-shapes-up-alt:before {
+  content: "\f88b";
+}
+
+.fa-face-scream:before {
+  content: "\e38b";
+}
+
+.fa-square-m:before {
+  content: "\e276";
+}
+
+.fa-camera-web:before, .fa-webcam:before {
+  content: "\f832";
+}
+
+.fa-comment-arrow-down:before {
+  content: "\e143";
+}
+
+.fa-lightbulb-cfl:before {
+  content: "\e5a6";
+}
+
+.fa-window-frame-open:before {
+  content: "\e050";
+}
+
+.fa-face-kiss:before, .fa-kiss:before {
+  content: "\f596";
+}
+
+.fa-bridge-circle-xmark:before {
+  content: "\e4cb";
+}
+
+.fa-period:before {
+  content: "\2e";
+}
+
+.fa-face-grin-tongue:before, .fa-grin-tongue:before {
+  content: "\f589";
+}
+
+.fa-up-to-dotted-line:before {
+  content: "\e457";
+}
+
+.fa-thought-bubble:before {
+  content: "\e32e";
+}
+
+.fa-skeleton-ribs:before {
+  content: "\e5cb";
+}
+
+.fa-raygun:before {
+  content: "\e025";
+}
+
+.fa-flute:before {
+  content: "\f8b9";
+}
+
+.fa-acorn:before {
+  content: "\f6ae";
+}
+
+.fa-video-arrow-up-right:before {
+  content: "\e2c9";
+}
+
+.fa-grate-droplet:before {
+  content: "\e194";
+}
+
+.fa-seal-exclamation:before {
+  content: "\e242";
+}
+
+.fa-chess-bishop:before {
+  content: "\f43a";
+}
+
+.fa-message-sms:before {
+  content: "\e1e5";
+}
+
+.fa-coffee-beans:before {
+  content: "\e13f";
+}
+
+.fa-hat-witch:before {
+  content: "\f6e7";
+}
+
+.fa-face-grin-wink:before, .fa-grin-wink:before {
+  content: "\f58c";
+}
+
+.fa-clock-three-thirty:before {
+  content: "\e357";
+}
+
+.fa-deaf:before, .fa-deafness:before, .fa-ear-deaf:before, .fa-hard-of-hearing:before {
+  content: "\f2a4";
+}
+
+.fa-alarm-clock:before {
+  content: "\f34e";
+}
+
+.fa-eclipse:before {
+  content: "\f749";
+}
+
+.fa-face-relieved:before {
+  content: "\e389";
+}
+
+.fa-road-circle-check:before {
+  content: "\e564";
+}
+
+.fa-dice-five:before {
+  content: "\f523";
+}
+
+.fa-minus-octagon:before, .fa-octagon-minus:before {
+  content: "\f308";
+}
+
+.fa-rss-square:before, .fa-square-rss:before {
+  content: "\f143";
+}
+
+.fa-face-zany:before {
+  content: "\e3a4";
+}
+
+.fa-tricycle:before {
+  content: "\e5c3";
+}
+
+.fa-land-mine-on:before {
+  content: "\e51b";
+}
+
+.fa-square-arrow-up-left:before {
+  content: "\e263";
+}
+
+.fa-i-cursor:before {
+  content: "\f246";
+}
+
+.fa-chart-mixed-up-circle-dollar:before {
+  content: "\e5d9";
+}
+
+.fa-salt-shaker:before {
+  content: "\e446";
+}
+
+.fa-stamp:before {
+  content: "\f5bf";
+}
+
+.fa-file-plus:before {
+  content: "\f319";
+}
+
+.fa-draw-square:before {
+  content: "\f5ef";
+}
+
+.fa-toilet-paper-reverse-slash:before, .fa-toilet-paper-under-slash:before {
+  content: "\e2a1";
+}
+
+.fa-stairs:before {
+  content: "\e289";
+}
+
+.fa-drone-alt:before, .fa-drone-front:before {
+  content: "\f860";
+}
+
+.fa-glass-empty:before {
+  content: "\e191";
+}
+
+.fa-dial-high:before {
+  content: "\e15c";
+}
+
+.fa-user-construction:before, .fa-user-hard-hat:before, .fa-user-helmet-safety:before {
+  content: "\f82c";
+}
+
+.fa-i:before {
+  content: "\49";
+}
+
+.fa-hryvnia-sign:before, .fa-hryvnia:before {
+  content: "\f6f2";
+}
+
+.fa-arrow-down-left-and-arrow-up-right-to-center:before {
+  content: "\e092";
+}
+
+.fa-pills:before {
+  content: "\f484";
+}
+
+.fa-face-grin-wide:before, .fa-grin-alt:before {
+  content: "\f581";
+}
+
+.fa-tooth:before {
+  content: "\f5c9";
+}
+
+.fa-basketball-hoop:before {
+  content: "\f435";
+}
+
+.fa-objects-align-bottom:before {
+  content: "\e3bb";
+}
+
+.fa-v:before {
+  content: "\56";
+}
+
+.fa-sparkles:before {
+  content: "\f890";
+}
+
+.fa-squid:before {
+  content: "\e450";
+}
+
+.fa-leafy-green:before {
+  content: "\e41d";
+}
+
+.fa-circle-arrow-up-right:before {
+  content: "\e0fc";
+}
+
+.fa-calendars:before {
+  content: "\e0d7";
+}
+
+.fa-bangladeshi-taka-sign:before {
+  content: "\e2e6";
+}
+
+.fa-bicycle:before {
+  content: "\f206";
+}
+
+.fa-hammer-war:before {
+  content: "\f6e4";
+}
+
+.fa-circle-d:before {
+  content: "\e104";
+}
+
+.fa-spider-black-widow:before {
+  content: "\f718";
+}
+
+.fa-rod-asclepius:before, .fa-rod-snake:before, .fa-staff-aesculapius:before, .fa-staff-snake:before {
+  content: "\e579";
+}
+
+.fa-pear:before {
+  content: "\e20c";
+}
+
+.fa-head-side-cough-slash:before {
+  content: "\e062";
+}
+
+.fa-file-mov:before {
+  content: "\e647";
+}
+
+.fa-triangle:before {
+  content: "\f2ec";
+}
+
+.fa-apartment:before {
+  content: "\e468";
+}
+
+.fa-ambulance:before, .fa-truck-medical:before {
+  content: "\f0f9";
+}
+
+.fa-pepper:before {
+  content: "\e432";
+}
+
+.fa-piano:before {
+  content: "\f8d4";
+}
+
+.fa-gun-squirt:before {
+  content: "\e19d";
+}
+
+.fa-wheat-awn-circle-exclamation:before {
+  content: "\e598";
+}
+
+.fa-snowman:before {
+  content: "\f7d0";
+}
+
+.fa-user-alien:before {
+  content: "\e04a";
+}
+
+.fa-shield-check:before {
+  content: "\f2f7";
+}
+
+.fa-mortar-pestle:before {
+  content: "\f5a7";
+}
+
+.fa-road-barrier:before {
+  content: "\e562";
+}
+
+.fa-chart-candlestick:before {
+  content: "\e0e2";
+}
+
+.fa-briefcase-blank:before {
+  content: "\e0c8";
+}
+
+.fa-school:before {
+  content: "\f549";
+}
+
+.fa-igloo:before {
+  content: "\f7ae";
+}
+
+.fa-bracket-round:before, .fa-parenthesis:before {
+  content: "\28";
+}
+
+.fa-joint:before {
+  content: "\f595";
+}
+
+.fa-horse-saddle:before {
+  content: "\f8c3";
+}
+
+.fa-mug-marshmallows:before {
+  content: "\f7b7";
+}
+
+.fa-filters:before {
+  content: "\e17e";
+}
+
+.fa-bell-on:before {
+  content: "\f8fa";
+}
+
+.fa-angle-right:before {
+  content: "\f105";
+}
+
+.fa-dial-med:before {
+  content: "\e15f";
+}
+
+.fa-horse:before {
+  content: "\f6f0";
+}
+
+.fa-q:before {
+  content: "\51";
+}
+
+.fa-monitor-heart-rate:before, .fa-monitor-waveform:before {
+  content: "\f611";
+}
+
+.fa-link-simple:before {
+  content: "\e1cd";
+}
+
+.fa-whistle:before {
+  content: "\f460";
+}
+
+.fa-g:before {
+  content: "\47";
+}
+
+.fa-fragile:before, .fa-wine-glass-crack:before {
+  content: "\f4bb";
+}
+
+.fa-slot-machine:before {
+  content: "\e3ce";
+}
+
+.fa-notes-medical:before {
+  content: "\f481";
+}
+
+.fa-car-wash:before {
+  content: "\f5e6";
+}
+
+.fa-escalator:before {
+  content: "\e171";
+}
+
+.fa-comment-image:before {
+  content: "\e148";
+}
+
+.fa-temperature-2:before, .fa-temperature-half:before, .fa-thermometer-2:before, .fa-thermometer-half:before {
+  content: "\f2c9";
+}
+
+.fa-dong-sign:before {
+  content: "\e169";
+}
+
+.fa-donut:before, .fa-doughnut:before {
+  content: "\e406";
+}
+
+.fa-capsules:before {
+  content: "\f46b";
+}
+
+.fa-poo-bolt:before, .fa-poo-storm:before {
+  content: "\f75a";
+}
+
+.fa-tally-1:before {
+  content: "\e294";
+}
+
+.fa-file-vector:before {
+  content: "\e64c";
+}
+
+.fa-face-frown-open:before, .fa-frown-open:before {
+  content: "\f57a";
+}
+
+.fa-square-dashed:before {
+  content: "\e269";
+}
+
+.fa-bag-shopping-plus:before {
+  content: "\e651";
+}
+
+.fa-square-j:before {
+  content: "\e273";
+}
+
+.fa-hand-point-up:before {
+  content: "\f0a6";
+}
+
+.fa-money-bill:before {
+  content: "\f0d6";
+}
+
+.fa-arrow-up-big-small:before, .fa-sort-size-up:before {
+  content: "\f88e";
+}
+
+.fa-barcode-read:before {
+  content: "\f464";
+}
+
+.fa-baguette:before {
+  content: "\e3d8";
+}
+
+.fa-bowl-soft-serve:before {
+  content: "\e46b";
+}
+
+.fa-face-holding-back-tears:before {
+  content: "\e482";
+}
+
+.fa-arrow-alt-square-up:before, .fa-square-up:before {
+  content: "\f353";
+}
+
+.fa-subway-tunnel:before, .fa-train-subway-tunnel:before {
+  content: "\e2a3";
+}
+
+.fa-exclamation-square:before, .fa-square-exclamation:before {
+  content: "\f321";
+}
+
+.fa-semicolon:before {
+  content: "\3b";
+}
+
+.fa-bookmark:before {
+  content: "\f02e";
+}
+
+.fa-fan-table:before {
+  content: "\e004";
+}
+
+.fa-align-justify:before {
+  content: "\f039";
+}
+
+.fa-battery-1:before, .fa-battery-low:before {
+  content: "\e0b1";
+}
+
+.fa-credit-card-front:before {
+  content: "\f38a";
+}
+
+.fa-brain-arrow-curved-right:before, .fa-mind-share:before {
+  content: "\f677";
+}
+
+.fa-umbrella-beach:before {
+  content: "\f5ca";
+}
+
+.fa-helmet-un:before {
+  content: "\e503";
+}
+
+.fa-location-smile:before, .fa-map-marker-smile:before {
+  content: "\f60d";
+}
+
+.fa-arrow-left-to-line:before, .fa-arrow-to-left:before {
+  content: "\f33e";
+}
+
+.fa-bullseye:before {
+  content: "\f140";
+}
+
+.fa-nigiri:before, .fa-sushi:before {
+  content: "\e48a";
+}
+
+.fa-comment-alt-captions:before, .fa-message-captions:before {
+  content: "\e1de";
+}
+
+.fa-trash-list:before {
+  content: "\e2b1";
+}
+
+.fa-bacon:before {
+  content: "\f7e5";
+}
+
+.fa-option:before {
+  content: "\e318";
+}
+
+.fa-raccoon:before {
+  content: "\e613";
+}
+
+.fa-hand-point-down:before {
+  content: "\f0a7";
+}
+
+.fa-arrow-up-from-bracket:before {
+  content: "\e09a";
+}
+
+.fa-head-side-gear:before {
+  content: "\e611";
+}
+
+.fa-trash-plus:before {
+  content: "\e2b2";
+}
+
+.fa-file-cad:before {
+  content: "\e672";
+}
+
+.fa-objects-align-top:before {
+  content: "\e3c0";
+}
+
+.fa-folder-blank:before, .fa-folder:before {
+  content: "\f07b";
+}
+
+.fa-face-anxious-sweat:before {
+  content: "\e36a";
+}
+
+.fa-credit-card-blank:before {
+  content: "\f389";
+}
+
+.fa-file-medical-alt:before, .fa-file-waveform:before {
+  content: "\f478";
+}
+
+.fa-microchip-ai:before {
+  content: "\e1ec";
+}
+
+.fa-mug:before {
+  content: "\f874";
+}
+
+.fa-plane-up-slash:before {
+  content: "\e22e";
+}
+
+.fa-radiation:before {
+  content: "\f7b9";
+}
+
+.fa-pen-circle:before {
+  content: "\e20e";
+}
+
+.fa-bag-seedling:before {
+  content: "\e5f2";
+}
+
+.fa-chart-simple:before {
+  content: "\e473";
+}
+
+.fa-crutches:before {
+  content: "\f7f8";
+}
+
+.fa-circle-parking:before, .fa-parking-circle:before {
+  content: "\f615";
+}
+
+.fa-mars-stroke:before {
+  content: "\f229";
+}
+
+.fa-leaf-oak:before {
+  content: "\f6f7";
+}
+
+.fa-square-bolt:before {
+  content: "\e265";
+}
+
+.fa-vial:before {
+  content: "\f492";
+}
+
+.fa-dashboard:before, .fa-gauge-med:before, .fa-gauge:before, .fa-tachometer-alt-average:before {
+  content: "\f624";
+}
+
+.fa-magic-wand-sparkles:before, .fa-wand-magic-sparkles:before {
+  content: "\e2ca";
+}
+
+.fa-lambda:before {
+  content: "\f66e";
+}
+
+.fa-e:before {
+  content: "\45";
+}
+
+.fa-pizza:before {
+  content: "\f817";
+}
+
+.fa-bowl-chopsticks-noodles:before {
+  content: "\e2ea";
+}
+
+.fa-h3:before {
+  content: "\f315";
+}
+
+.fa-pen-alt:before, .fa-pen-clip:before {
+  content: "\f305";
+}
+
+.fa-bridge-circle-exclamation:before {
+  content: "\e4ca";
+}
+
+.fa-badge-percent:before {
+  content: "\f646";
+}
+
+.fa-rotate-reverse:before {
+  content: "\e631";
+}
+
+.fa-user:before {
+  content: "\f007";
+}
+
+.fa-sensor:before {
+  content: "\e028";
+}
+
+.fa-comma:before {
+  content: "\2c";
+}
+
+.fa-school-circle-check:before {
+  content: "\e56b";
+}
+
+.fa-toilet-paper-reverse:before, .fa-toilet-paper-under:before {
+  content: "\e2a0";
+}
+
+.fa-light-emergency:before {
+  content: "\e41f";
+}
+
+.fa-arrow-down-to-arc:before {
+  content: "\e4ae";
+}
+
+.fa-dumpster:before {
+  content: "\f793";
+}
+
+.fa-shuttle-van:before, .fa-van-shuttle:before {
+  content: "\f5b6";
+}
+
+.fa-building-user:before {
+  content: "\e4da";
+}
+
+.fa-light-switch:before {
+  content: "\e017";
+}
+
+.fa-caret-square-left:before, .fa-square-caret-left:before {
+  content: "\f191";
+}
+
+.fa-highlighter:before {
+  content: "\f591";
+}
+
+.fa-heart-rate:before, .fa-wave-pulse:before {
+  content: "\f5f8";
+}
+
+.fa-key:before {
+  content: "\f084";
+}
+
+.fa-arrow-left-to-bracket:before {
+  content: "\e669";
+}
+
+.fa-hat-santa:before {
+  content: "\f7a7";
+}
+
+.fa-tamale:before {
+  content: "\e451";
+}
+
+.fa-box-check:before {
+  content: "\f467";
+}
+
+.fa-bullhorn:before {
+  content: "\f0a1";
+}
+
+.fa-steak:before {
+  content: "\f824";
+}
+
+.fa-location-crosshairs-slash:before, .fa-location-slash:before {
+  content: "\f603";
+}
+
+.fa-person-dolly:before {
+  content: "\f4d0";
+}
+
+.fa-globe:before {
+  content: "\f0ac";
+}
+
+.fa-synagogue:before {
+  content: "\f69b";
+}
+
+.fa-file-chart-column:before, .fa-file-chart-line:before {
+  content: "\f659";
+}
+
+.fa-person-half-dress:before {
+  content: "\e548";
+}
+
+.fa-folder-image:before {
+  content: "\e18a";
+}
+
+.fa-calendar-edit:before, .fa-calendar-pen:before {
+  content: "\f333";
+}
+
+.fa-road-bridge:before {
+  content: "\e563";
+}
+
+.fa-face-smile-tear:before {
+  content: "\e393";
+}
+
+.fa-comment-alt-plus:before, .fa-message-plus:before {
+  content: "\f4a8";
+}
+
+.fa-location-arrow:before {
+  content: "\f124";
+}
+
+.fa-c:before {
+  content: "\43";
+}
+
+.fa-tablet-button:before {
+  content: "\f10a";
+}
+
+.fa-person-dress-fairy:before {
+  content: "\e607";
+}
+
+.fa-rectangle-history-circle-user:before {
+  content: "\e4a4";
+}
+
+.fa-building-lock:before {
+  content: "\e4d6";
+}
+
+.fa-chart-line-up:before {
+  content: "\e0e5";
+}
+
+.fa-mailbox:before {
+  content: "\f813";
+}
+
+.fa-sign-posts:before {
+  content: "\e625";
+}
+
+.fa-truck-bolt:before {
+  content: "\e3d0";
+}
+
+.fa-pizza-slice:before {
+  content: "\f818";
+}
+
+.fa-money-bill-wave:before {
+  content: "\f53a";
+}
+
+.fa-area-chart:before, .fa-chart-area:before {
+  content: "\f1fe";
+}
+
+.fa-house-flag:before {
+  content: "\e50d";
+}
+
+.fa-circle-three-quarters-stroke:before {
+  content: "\e5d4";
+}
+
+.fa-person-circle-minus:before {
+  content: "\e540";
+}
+
+.fa-scalpel:before {
+  content: "\f61d";
+}
+
+.fa-ban:before, .fa-cancel:before {
+  content: "\f05e";
+}
+
+.fa-bell-exclamation:before {
+  content: "\f848";
+}
+
+.fa-bookmark-circle:before, .fa-circle-bookmark:before {
+  content: "\e100";
+}
+
+.fa-egg-fried:before {
+  content: "\f7fc";
+}
+
+.fa-face-weary:before {
+  content: "\e3a1";
+}
+
+.fa-uniform-martial-arts:before {
+  content: "\e3d1";
+}
+
+.fa-camera-rotate:before {
+  content: "\e0d8";
+}
+
+.fa-sun-dust:before {
+  content: "\f764";
+}
+
+.fa-comment-text:before {
+  content: "\e14d";
+}
+
+.fa-air-freshener:before, .fa-spray-can-sparkles:before {
+  content: "\f5d0";
+}
+
+.fa-signal-alt-4:before, .fa-signal-alt:before, .fa-signal-bars-strong:before, .fa-signal-bars:before {
+  content: "\f690";
+}
+
+.fa-diamond-exclamation:before {
+  content: "\e405";
+}
+
+.fa-star:before {
+  content: "\f005";
+}
+
+.fa-dial-min:before {
+  content: "\e161";
+}
+
+.fa-repeat:before {
+  content: "\f363";
+}
+
+.fa-cross:before {
+  content: "\f654";
+}
+
+.fa-file-caret-down:before, .fa-page-caret-down:before {
+  content: "\e429";
+}
+
+.fa-box:before {
+  content: "\f466";
+}
+
+.fa-venus-mars:before {
+  content: "\f228";
+}
+
+.fa-clock-seven-thirty:before {
+  content: "\e351";
+}
+
+.fa-arrow-pointer:before, .fa-mouse-pointer:before {
+  content: "\f245";
+}
+
+.fa-clock-four-thirty:before {
+  content: "\e34b";
+}
+
+.fa-signal-alt-3:before, .fa-signal-bars-good:before {
+  content: "\f693";
+}
+
+.fa-cactus:before {
+  content: "\f8a7";
+}
+
+.fa-lightbulb-gear:before {
+  content: "\e5fd";
+}
+
+.fa-expand-arrows-alt:before, .fa-maximize:before {
+  content: "\f31e";
+}
+
+.fa-charging-station:before {
+  content: "\f5e7";
+}
+
+.fa-shapes:before, .fa-triangle-circle-square:before {
+  content: "\f61f";
+}
+
+.fa-plane-tail:before {
+  content: "\e22c";
+}
+
+.fa-gauge-simple-max:before, .fa-tachometer-fastest:before {
+  content: "\f62b";
+}
+
+.fa-circle-u:before {
+  content: "\e127";
+}
+
+.fa-shield-slash:before {
+  content: "\e24b";
+}
+
+.fa-phone-square-down:before, .fa-square-phone-hangup:before {
+  content: "\e27a";
+}
+
+.fa-arrow-up-left:before {
+  content: "\e09d";
+}
+
+.fa-transporter-1:before {
+  content: "\e043";
+}
+
+.fa-peanuts:before {
+  content: "\e431";
+}
+
+.fa-random:before, .fa-shuffle:before {
+  content: "\f074";
+}
+
+.fa-person-running:before, .fa-running:before {
+  content: "\f70c";
+}
+
+.fa-mobile-retro:before {
+  content: "\e527";
+}
+
+.fa-grip-lines-vertical:before {
+  content: "\f7a5";
+}
+
+.fa-bin-bottles-recycle:before {
+  content: "\e5f6";
+}
+
+.fa-arrow-up-from-square:before {
+  content: "\e09c";
+}
+
+.fa-file-dashed-line:before, .fa-page-break:before {
+  content: "\f877";
+}
+
+.fa-bracket-curly-right:before {
+  content: "\7d";
+}
+
+.fa-spider:before {
+  content: "\f717";
+}
+
+.fa-clock-three:before {
+  content: "\e356";
+}
+
+.fa-hands-bound:before {
+  content: "\e4f9";
+}
+
+.fa-scalpel-line-dashed:before, .fa-scalpel-path:before {
+  content: "\f61e";
+}
+
+.fa-file-invoice-dollar:before {
+  content: "\f571";
+}
+
+.fa-pipe-smoking:before {
+  content: "\e3c4";
+}
+
+.fa-face-astonished:before {
+  content: "\e36b";
+}
+
+.fa-window:before {
+  content: "\f40e";
+}
+
+.fa-plane-circle-exclamation:before {
+  content: "\e556";
+}
+
+.fa-ear:before {
+  content: "\f5f0";
+}
+
+.fa-file-lock:before {
+  content: "\e3a6";
+}
+
+.fa-diagram-venn:before {
+  content: "\e15a";
+}
+
+.fa-arrow-down-from-bracket:before {
+  content: "\e667";
+}
+
+.fa-x-ray:before {
+  content: "\f497";
+}
+
+.fa-goal-net:before {
+  content: "\e3ab";
+}
+
+.fa-coffin-cross:before {
+  content: "\e051";
+}
+
+.fa-spell-check:before {
+  content: "\f891";
+}
+
+.fa-location-xmark:before, .fa-map-marker-times:before, .fa-map-marker-xmark:before {
+  content: "\f60e";
+}
+
+.fa-circle-quarter-stroke:before {
+  content: "\e5d3";
+}
+
+.fa-lasso:before {
+  content: "\f8c8";
+}
+
+.fa-slash:before {
+  content: "\f715";
+}
+
+.fa-person-to-portal:before, .fa-portal-enter:before {
+  content: "\e022";
+}
+
+.fa-calendar-star:before {
+  content: "\f736";
+}
+
+.fa-computer-mouse:before, .fa-mouse:before {
+  content: "\f8cc";
+}
+
+.fa-arrow-right-to-bracket:before, .fa-sign-in:before {
+  content: "\f090";
+}
+
+.fa-pegasus:before {
+  content: "\f703";
+}
+
+.fa-files-medical:before {
+  content: "\f7fd";
+}
+
+.fa-cannon:before {
+  content: "\e642";
+}
+
+.fa-nfc-lock:before {
+  content: "\e1f8";
+}
+
+.fa-person-ski-lift:before, .fa-ski-lift:before {
+  content: "\f7c8";
+}
+
+.fa-square-6:before {
+  content: "\e25b";
+}
+
+.fa-shop-slash:before, .fa-store-alt-slash:before {
+  content: "\e070";
+}
+
+.fa-wind-turbine:before {
+  content: "\f89b";
+}
+
+.fa-sliders-simple:before {
+  content: "\e253";
+}
+
+.fa-grid-round:before {
+  content: "\e5da";
+}
+
+.fa-badge-sheriff:before {
+  content: "\f8a2";
+}
+
+.fa-server:before {
+  content: "\f233";
+}
+
+.fa-virus-covid-slash:before {
+  content: "\e4a9";
+}
+
+.fa-intersection:before {
+  content: "\f668";
+}
+
+.fa-shop-lock:before {
+  content: "\e4a5";
+}
+
+.fa-family:before {
+  content: "\e300";
+}
+
+.fa-hourglass-1:before, .fa-hourglass-start:before {
+  content: "\f251";
+}
+
+.fa-user-hair-buns:before {
+  content: "\e3d3";
+}
+
+.fa-blender-phone:before {
+  content: "\f6b6";
+}
+
+.fa-hourglass-clock:before {
+  content: "\e41b";
+}
+
+.fa-person-seat-reclined:before {
+  content: "\e21f";
+}
+
+.fa-paper-plane-alt:before, .fa-paper-plane-top:before, .fa-send:before {
+  content: "\e20a";
+}
+
+.fa-comment-alt-arrow-up:before, .fa-message-arrow-up:before {
+  content: "\e1dc";
+}
+
+.fa-lightbulb-exclamation:before {
+  content: "\f671";
+}
+
+.fa-layer-group-minus:before, .fa-layer-minus:before {
+  content: "\f5fe";
+}
+
+.fa-chart-pie-simple-circle-currency:before {
+  content: "\e604";
+}
+
+.fa-circle-e:before {
+  content: "\e109";
+}
+
+.fa-building-wheat:before {
+  content: "\e4db";
+}
+
+.fa-gauge-max:before, .fa-tachometer-alt-fastest:before {
+  content: "\f626";
+}
+
+.fa-person-breastfeeding:before {
+  content: "\e53a";
+}
+
+.fa-apostrophe:before {
+  content: "\27";
+}
+
+.fa-file-png:before {
+  content: "\e666";
+}
+
+.fa-fire-hydrant:before {
+  content: "\e17f";
+}
+
+.fa-right-to-bracket:before, .fa-sign-in-alt:before {
+  content: "\f2f6";
+}
+
+.fa-video-plus:before {
+  content: "\f4e1";
+}
+
+.fa-arrow-alt-square-right:before, .fa-square-right:before {
+  content: "\f352";
+}
+
+.fa-comment-smile:before {
+  content: "\f4b4";
+}
+
+.fa-venus:before {
+  content: "\f221";
+}
+
+.fa-passport:before {
+  content: "\f5ab";
+}
+
+.fa-inbox-arrow-down:before, .fa-inbox-in:before {
+  content: "\f310";
+}
+
+.fa-heart-pulse:before, .fa-heartbeat:before {
+  content: "\f21e";
+}
+
+.fa-circle-8:before {
+  content: "\e0f5";
+}
+
+.fa-clouds-moon:before {
+  content: "\f745";
+}
+
+.fa-clock-ten-thirty:before {
+  content: "\e355";
+}
+
+.fa-people-carry-box:before, .fa-people-carry:before {
+  content: "\f4ce";
+}
+
+.fa-folder-user:before {
+  content: "\e18e";
+}
+
+.fa-trash-can-xmark:before {
+  content: "\e2ae";
+}
+
+.fa-temperature-high:before {
+  content: "\f769";
+}
+
+.fa-microchip:before {
+  content: "\f2db";
+}
+
+.fa-left-long-to-line:before {
+  content: "\e41e";
+}
+
+.fa-crown:before {
+  content: "\f521";
+}
+
+.fa-weight-hanging:before {
+  content: "\f5cd";
+}
+
+.fa-xmarks-lines:before {
+  content: "\e59a";
+}
+
+.fa-file-prescription:before {
+  content: "\f572";
+}
+
+.fa-table-cells-lock:before {
+  content: "\e679";
+}
+
+.fa-calendar-range:before {
+  content: "\e0d6";
+}
+
+.fa-flower-daffodil:before {
+  content: "\f800";
+}
+
+.fa-hand-back-point-up:before {
+  content: "\e1a2";
+}
+
+.fa-weight-scale:before, .fa-weight:before {
+  content: "\f496";
+}
+
+.fa-arrow-up-to-arc:before {
+  content: "\e617";
+}
+
+.fa-star-exclamation:before {
+  content: "\f2f3";
+}
+
+.fa-books:before {
+  content: "\f5db";
+}
+
+.fa-user-friends:before, .fa-user-group:before {
+  content: "\f500";
+}
+
+.fa-arrow-up-a-z:before, .fa-sort-alpha-up:before {
+  content: "\f15e";
+}
+
+.fa-layer-group-plus:before, .fa-layer-plus:before {
+  content: "\f5ff";
+}
+
+.fa-play-pause:before {
+  content: "\e22f";
+}
+
+.fa-block-question:before {
+  content: "\e3dd";
+}
+
+.fa-snooze:before, .fa-zzz:before {
+  content: "\f880";
+}
+
+.fa-scanner-image:before {
+  content: "\f8f3";
+}
+
+.fa-tv-retro:before {
+  content: "\f401";
+}
+
+.fa-square-t:before {
+  content: "\e280";
+}
+
+.fa-barn-silo:before, .fa-farm:before {
+  content: "\f864";
+}
+
+.fa-chess-knight:before {
+  content: "\f441";
+}
+
+.fa-bars-sort:before {
+  content: "\e0ae";
+}
+
+.fa-palette-boxes:before, .fa-pallet-alt:before, .fa-pallet-boxes:before {
+  content: "\f483";
+}
+
+.fa-face-laugh-squint:before, .fa-laugh-squint:before {
+  content: "\f59b";
+}
+
+.fa-code-simple:before {
+  content: "\e13d";
+}
+
+.fa-bolt-slash:before {
+  content: "\e0b8";
+}
+
+.fa-panel-fire:before {
+  content: "\e42f";
+}
+
+.fa-binary-circle-check:before {
+  content: "\e33c";
+}
+
+.fa-comment-minus:before {
+  content: "\f4b1";
+}
+
+.fa-burrito:before {
+  content: "\f7ed";
+}
+
+.fa-violin:before {
+  content: "\f8ed";
+}
+
+.fa-objects-column:before {
+  content: "\e3c1";
+}
+
+.fa-chevron-square-down:before, .fa-square-chevron-down:before {
+  content: "\f329";
+}
+
+.fa-comment-plus:before {
+  content: "\f4b2";
+}
+
+.fa-triangle-instrument:before, .fa-triangle-music:before {
+  content: "\f8e2";
+}
+
+.fa-wheelchair:before {
+  content: "\f193";
+}
+
+.fa-user-pilot-tie:before {
+  content: "\e2c1";
+}
+
+.fa-piano-keyboard:before {
+  content: "\f8d5";
+}
+
+.fa-bed-empty:before {
+  content: "\f8f9";
+}
+
+.fa-arrow-circle-up:before, .fa-circle-arrow-up:before {
+  content: "\f0aa";
+}
+
+.fa-toggle-on:before {
+  content: "\f205";
+}
+
+.fa-rectangle-portrait:before, .fa-rectangle-vertical:before {
+  content: "\f2fb";
+}
+
+.fa-person-walking:before, .fa-walking:before {
+  content: "\f554";
+}
+
+.fa-l:before {
+  content: "\4c";
+}
+
+.fa-signal-stream:before {
+  content: "\f8dd";
+}
+
+.fa-down-to-bracket:before {
+  content: "\e4e7";
+}
+
+.fa-circle-z:before {
+  content: "\e130";
+}
+
+.fa-stars:before {
+  content: "\f762";
+}
+
+.fa-fire:before {
+  content: "\f06d";
+}
+
+.fa-bed-pulse:before, .fa-procedures:before {
+  content: "\f487";
+}
+
+.fa-house-day:before {
+  content: "\e00e";
+}
+
+.fa-shuttle-space:before, .fa-space-shuttle:before {
+  content: "\f197";
+}
+
+.fa-shirt-long-sleeve:before {
+  content: "\e3c7";
+}
+
+.fa-chart-pie-alt:before, .fa-chart-pie-simple:before {
+  content: "\f64e";
+}
+
+.fa-face-laugh:before, .fa-laugh:before {
+  content: "\f599";
+}
+
+.fa-folder-open:before {
+  content: "\f07c";
+}
+
+.fa-album-collection-circle-user:before {
+  content: "\e48f";
+}
+
+.fa-candy:before {
+  content: "\e3e7";
+}
+
+.fa-bowl-hot:before, .fa-soup:before {
+  content: "\f823";
+}
+
+.fa-flatbread:before {
+  content: "\e40b";
+}
+
+.fa-heart-circle-plus:before {
+  content: "\e500";
+}
+
+.fa-code-fork:before {
+  content: "\e13b";
+}
+
+.fa-city:before {
+  content: "\f64f";
+}
+
+.fa-signal-alt-1:before, .fa-signal-bars-weak:before {
+  content: "\f691";
+}
+
+.fa-microphone-alt:before, .fa-microphone-lines:before {
+  content: "\f3c9";
+}
+
+.fa-clock-twelve:before {
+  content: "\e358";
+}
+
+.fa-pepper-hot:before {
+  content: "\f816";
+}
+
+.fa-citrus-slice:before {
+  content: "\e2f5";
+}
+
+.fa-sheep:before {
+  content: "\f711";
+}
+
+.fa-unlock:before {
+  content: "\f09c";
+}
+
+.fa-colon-sign:before {
+  content: "\e140";
+}
+
+.fa-headset:before {
+  content: "\f590";
+}
+
+.fa-badger-honey:before {
+  content: "\f6b4";
+}
+
+.fa-h4:before {
+  content: "\f86a";
+}
+
+.fa-store-slash:before {
+  content: "\e071";
+}
+
+.fa-road-circle-xmark:before {
+  content: "\e566";
+}
+
+.fa-signal-slash:before {
+  content: "\f695";
+}
+
+.fa-user-minus:before {
+  content: "\f503";
+}
+
+.fa-mars-stroke-up:before, .fa-mars-stroke-v:before {
+  content: "\f22a";
+}
+
+.fa-champagne-glasses:before, .fa-glass-cheers:before {
+  content: "\f79f";
+}
+
+.fa-taco:before {
+  content: "\f826";
+}
+
+.fa-hexagon-plus:before, .fa-plus-hexagon:before {
+  content: "\f300";
+}
+
+.fa-clipboard:before {
+  content: "\f328";
+}
+
+.fa-house-circle-exclamation:before {
+  content: "\e50a";
+}
+
+.fa-file-arrow-up:before, .fa-file-upload:before {
+  content: "\f574";
+}
+
+.fa-wifi-3:before, .fa-wifi-strong:before, .fa-wifi:before {
+  content: "\f1eb";
+}
+
+.fa-comments-alt:before, .fa-messages:before {
+  content: "\f4b6";
+}
+
+.fa-bath:before, .fa-bathtub:before {
+  content: "\f2cd";
+}
+
+.fa-umbrella-alt:before, .fa-umbrella-simple:before {
+  content: "\e2bc";
+}
+
+.fa-rectangle-history-circle-plus:before {
+  content: "\e4a3";
+}
+
+.fa-underline:before {
+  content: "\f0cd";
+}
+
+.fa-prescription-bottle-pill:before {
+  content: "\e5c0";
+}
+
+.fa-user-edit:before, .fa-user-pen:before {
+  content: "\f4ff";
+}
+
+.fa-binary-slash:before {
+  content: "\e33e";
+}
+
+.fa-square-o:before {
+  content: "\e278";
+}
+
+.fa-caduceus:before {
+  content: "\e681";
+}
+
+.fa-signature:before {
+  content: "\f5b7";
+}
+
+.fa-stroopwafel:before {
+  content: "\f551";
+}
+
+.fa-bold:before {
+  content: "\f032";
+}
+
+.fa-anchor-lock:before {
+  content: "\e4ad";
+}
+
+.fa-building-ngo:before {
+  content: "\e4d7";
+}
+
+.fa-transporter-3:before {
+  content: "\e045";
+}
+
+.fa-engine-exclamation:before, .fa-engine-warning:before {
+  content: "\f5f2";
+}
+
+.fa-circle-down-right:before {
+  content: "\e108";
+}
+
+.fa-square-k:before {
+  content: "\e274";
+}
+
+.fa-manat-sign:before {
+  content: "\e1d5";
+}
+
+.fa-money-check-edit:before, .fa-money-check-pen:before {
+  content: "\f872";
+}
+
+.fa-not-equal:before {
+  content: "\f53e";
+}
+
+.fa-border-style:before, .fa-border-top-left:before {
+  content: "\f853";
+}
+
+.fa-map-location-dot:before, .fa-map-marked-alt:before {
+  content: "\f5a0";
+}
+
+.fa-tilde:before {
+  content: "\7e";
+}
+
+.fa-jedi:before {
+  content: "\f669";
+}
+
+.fa-poll:before, .fa-square-poll-vertical:before {
+  content: "\f681";
+}
+
+.fa-arrow-down-square-triangle:before, .fa-sort-shapes-down-alt:before {
+  content: "\f889";
+}
+
+.fa-mug-hot:before {
+  content: "\f7b6";
+}
+
+.fa-dog-leashed:before {
+  content: "\f6d4";
+}
+
+.fa-battery-car:before, .fa-car-battery:before {
+  content: "\f5df";
+}
+
+.fa-face-downcast-sweat:before {
+  content: "\e371";
+}
+
+.fa-mailbox-flag-up:before {
+  content: "\e5bb";
+}
+
+.fa-memo-circle-info:before {
+  content: "\e49a";
+}
+
+.fa-gift:before {
+  content: "\f06b";
+}
+
+.fa-dice-two:before {
+  content: "\f528";
+}
+
+.fa-volume-medium:before, .fa-volume:before {
+  content: "\f6a8";
+}
+
+.fa-transporter-5:before {
+  content: "\e2a6";
+}
+
+.fa-gauge-circle-bolt:before {
+  content: "\e496";
+}
+
+.fa-coin-front:before {
+  content: "\e3fc";
+}
+
+.fa-file-slash:before {
+  content: "\e3a7";
+}
+
+.fa-message-arrow-up-right:before {
+  content: "\e1dd";
+}
+
+.fa-treasure-chest:before {
+  content: "\f723";
+}
+
+.fa-chess-queen:before {
+  content: "\f445";
+}
+
+.fa-paint-brush-alt:before, .fa-paint-brush-fine:before, .fa-paintbrush-alt:before, .fa-paintbrush-fine:before {
+  content: "\f5a9";
+}
+
+.fa-glasses:before {
+  content: "\f530";
+}
+
+.fa-hood-cloak:before {
+  content: "\f6ef";
+}
+
+.fa-square-quote:before {
+  content: "\e329";
+}
+
+.fa-up-left:before {
+  content: "\e2bd";
+}
+
+.fa-bring-front:before {
+  content: "\f857";
+}
+
+.fa-chess-board:before {
+  content: "\f43c";
+}
+
+.fa-burger-cheese:before, .fa-cheeseburger:before {
+  content: "\f7f1";
+}
+
+.fa-building-circle-check:before {
+  content: "\e4d2";
+}
+
+.fa-repeat-1:before {
+  content: "\f365";
+}
+
+.fa-arrow-down-to-line:before, .fa-arrow-to-bottom:before {
+  content: "\f33d";
+}
+
+.fa-grid-5:before {
+  content: "\e199";
+}
+
+.fa-swap-arrows:before {
+  content: "\e60a";
+}
+
+.fa-right-long-to-line:before {
+  content: "\e444";
+}
+
+.fa-person-chalkboard:before {
+  content: "\e53d";
+}
+
+.fa-mars-stroke-h:before, .fa-mars-stroke-right:before {
+  content: "\f22b";
+}
+
+.fa-hand-back-fist:before, .fa-hand-rock:before {
+  content: "\f255";
+}
+
+.fa-grid-round-5:before {
+  content: "\e5de";
+}
+
+.fa-tally-5:before, .fa-tally:before {
+  content: "\f69c";
+}
+
+.fa-caret-square-up:before, .fa-square-caret-up:before {
+  content: "\f151";
+}
+
+.fa-cloud-showers-water:before {
+  content: "\e4e4";
+}
+
+.fa-bar-chart:before, .fa-chart-bar:before {
+  content: "\f080";
+}
+
+.fa-hands-bubbles:before, .fa-hands-wash:before {
+  content: "\e05e";
+}
+
+.fa-less-than-equal:before {
+  content: "\f537";
+}
+
+.fa-train:before {
+  content: "\f238";
+}
+
+.fa-up-from-dotted-line:before {
+  content: "\e456";
+}
+
+.fa-eye-low-vision:before, .fa-low-vision:before {
+  content: "\f2a8";
+}
+
+.fa-traffic-light-go:before {
+  content: "\f638";
+}
+
+.fa-face-exhaling:before {
+  content: "\e480";
+}
+
+.fa-sensor-fire:before {
+  content: "\e02a";
+}
+
+.fa-user-unlock:before {
+  content: "\e058";
+}
+
+.fa-hexagon-divide:before {
+  content: "\e1ad";
+}
+
+.fa-00:before {
+  content: "\e467";
+}
+
+.fa-crow:before {
+  content: "\f520";
+}
+
+.fa-betamax:before, .fa-cassette-betamax:before {
+  content: "\f8a4";
+}
+
+.fa-sailboat:before {
+  content: "\e445";
+}
+
+.fa-window-restore:before {
+  content: "\f2d2";
+}
+
+.fa-nfc-magnifying-glass:before {
+  content: "\e1f9";
+}
+
+.fa-file-binary:before {
+  content: "\e175";
+}
+
+.fa-circle-v:before {
+  content: "\e12a";
+}
+
+.fa-plus-square:before, .fa-square-plus:before {
+  content: "\f0fe";
+}
+
+.fa-bowl-scoops:before {
+  content: "\e3df";
+}
+
+.fa-mistletoe:before {
+  content: "\f7b4";
+}
+
+.fa-custard:before {
+  content: "\e403";
+}
+
+.fa-lacrosse-stick:before {
+  content: "\e3b5";
+}
+
+.fa-hockey-mask:before {
+  content: "\f6ee";
+}
+
+.fa-sunrise:before {
+  content: "\f766";
+}
+
+.fa-subtitles:before {
+  content: "\e60f";
+}
+
+.fa-panel-ews:before {
+  content: "\e42e";
+}
+
+.fa-torii-gate:before {
+  content: "\f6a1";
+}
+
+.fa-cloud-exclamation:before {
+  content: "\e491";
+}
+
+.fa-comment-alt-lines:before, .fa-message-lines:before {
+  content: "\f4a6";
+}
+
+.fa-frog:before {
+  content: "\f52e";
+}
+
+.fa-bucket:before {
+  content: "\e4cf";
+}
+
+.fa-floppy-disk-pen:before {
+  content: "\e182";
+}
+
+.fa-image:before {
+  content: "\f03e";
+}
+
+.fa-window-frame:before {
+  content: "\e04f";
+}
+
+.fa-microphone:before {
+  content: "\f130";
+}
+
+.fa-cow:before {
+  content: "\f6c8";
+}
+
+.fa-file-zip:before {
+  content: "\e5ee";
+}
+
+.fa-square-ring:before {
+  content: "\e44f";
+}
+
+.fa-arrow-alt-from-top:before, .fa-down-from-line:before {
+  content: "\f349";
+}
+
+.fa-caret-up:before {
+  content: "\f0d8";
+}
+
+.fa-shield-times:before, .fa-shield-xmark:before {
+  content: "\e24c";
+}
+
+.fa-screwdriver:before {
+  content: "\f54a";
+}
+
+.fa-circle-sort-down:before, .fa-sort-circle-down:before {
+  content: "\e031";
+}
+
+.fa-folder-closed:before {
+  content: "\e185";
+}
+
+.fa-house-tsunami:before {
+  content: "\e515";
+}
+
+.fa-square-nfi:before {
+  content: "\e576";
+}
+
+.fa-forklift:before {
+  content: "\f47a";
+}
+
+.fa-arrow-up-from-ground-water:before {
+  content: "\e4b5";
+}
+
+.fa-bracket-square-right:before {
+  content: "\5d";
+}
+
+.fa-glass-martini-alt:before, .fa-martini-glass:before {
+  content: "\f57b";
+}
+
+.fa-rotate-back:before, .fa-rotate-backward:before, .fa-rotate-left:before, .fa-undo-alt:before {
+  content: "\f2ea";
+}
+
+.fa-columns:before, .fa-table-columns:before {
+  content: "\f0db";
+}
+
+.fa-square-a:before {
+  content: "\e25f";
+}
+
+.fa-tick:before {
+  content: "\e32f";
+}
+
+.fa-lemon:before {
+  content: "\f094";
+}
+
+.fa-head-side-mask:before {
+  content: "\e063";
+}
+
+.fa-handshake:before {
+  content: "\f2b5";
+}
+
+.fa-gem:before {
+  content: "\f3a5";
+}
+
+.fa-dolly-box:before, .fa-dolly:before {
+  content: "\f472";
+}
+
+.fa-smoking:before {
+  content: "\f48d";
+}
+
+.fa-compress-arrows-alt:before, .fa-minimize:before {
+  content: "\f78c";
+}
+
+.fa-refrigerator:before {
+  content: "\e026";
+}
+
+.fa-monument:before {
+  content: "\f5a6";
+}
+
+.fa-octagon-xmark:before, .fa-times-octagon:before, .fa-xmark-octagon:before {
+  content: "\f2f0";
+}
+
+.fa-align-slash:before {
+  content: "\f846";
+}
+
+.fa-snowplow:before {
+  content: "\f7d2";
+}
+
+.fa-angle-double-right:before, .fa-angles-right:before {
+  content: "\f101";
+}
+
+.fa-truck-couch:before, .fa-truck-ramp-couch:before {
+  content: "\f4dd";
+}
+
+.fa-cannabis:before {
+  content: "\f55f";
+}
+
+.fa-circle-play:before, .fa-play-circle:before {
+  content: "\f144";
+}
+
+.fa-arrow-up-right-and-arrow-down-left-from-center:before {
+  content: "\e0a0";
+}
+
+.fa-location-arrow-up:before {
+  content: "\e63a";
+}
+
+.fa-tablets:before {
+  content: "\f490";
+}
+
+.fa-360-degrees:before {
+  content: "\e2dc";
+}
+
+.fa-ethernet:before {
+  content: "\f796";
+}
+
+.fa-eur:before, .fa-euro-sign:before, .fa-euro:before {
+  content: "\f153";
+}
+
+.fa-chair:before {
+  content: "\f6c0";
+}
+
+.fa-check-circle:before, .fa-circle-check:before {
+  content: "\f058";
+}
+
+.fa-square-dashed-circle-plus:before {
+  content: "\e5c2";
+}
+
+.fa-hand-holding-circle-dollar:before {
+  content: "\e621";
+}
+
+.fa-money-simple-from-bracket:before {
+  content: "\e313";
+}
+
+.fa-bat:before {
+  content: "\f6b5";
+}
+
+.fa-circle-stop:before, .fa-stop-circle:before {
+  content: "\f28d";
+}
+
+.fa-head-side-headphones:before {
+  content: "\f8c2";
+}
+
+.fa-phone-rotary:before {
+  content: "\f8d3";
+}
+
+.fa-arrow-up-to-bracket:before {
+  content: "\e66a";
+}
+
+.fa-compass-drafting:before, .fa-drafting-compass:before {
+  content: "\f568";
+}
+
+.fa-plate-wheat:before {
+  content: "\e55a";
+}
+
+.fa-calendar-circle-minus:before {
+  content: "\e46f";
+}
+
+.fa-chopsticks:before {
+  content: "\e3f7";
+}
+
+.fa-car-mechanic:before, .fa-car-wrench:before {
+  content: "\f5e3";
+}
+
+.fa-icicles:before {
+  content: "\f7ad";
+}
+
+.fa-person-shelter:before {
+  content: "\e54f";
+}
+
+.fa-neuter:before {
+  content: "\f22c";
+}
+
+.fa-id-badge:before {
+  content: "\f2c1";
+}
+
+.fa-kazoo:before {
+  content: "\f8c7";
+}
+
+.fa-marker:before {
+  content: "\f5a1";
+}
+
+.fa-bin-bottles:before {
+  content: "\e5f5";
+}
+
+.fa-face-laugh-beam:before, .fa-laugh-beam:before {
+  content: "\f59a";
+}
+
+.fa-square-arrow-down-left:before {
+  content: "\e261";
+}
+
+.fa-battery-bolt:before {
+  content: "\f376";
+}
+
+.fa-tree-large:before {
+  content: "\f7dd";
+}
+
+.fa-helicopter-symbol:before {
+  content: "\e502";
+}
+
+.fa-aperture:before {
+  content: "\e2df";
+}
+
+.fa-universal-access:before {
+  content: "\f29a";
+}
+
+.fa-gear-complex:before {
+  content: "\e5e9";
+}
+
+.fa-file-magnifying-glass:before, .fa-file-search:before {
+  content: "\f865";
+}
+
+.fa-up-right:before {
+  content: "\e2be";
+}
+
+.fa-chevron-circle-up:before, .fa-circle-chevron-up:before {
+  content: "\f139";
+}
+
+.fa-user-police:before {
+  content: "\e333";
+}
+
+.fa-lari-sign:before {
+  content: "\e1c8";
+}
+
+.fa-volcano:before {
+  content: "\f770";
+}
+
+.fa-teddy-bear:before {
+  content: "\e3cf";
+}
+
+.fa-stocking:before {
+  content: "\f7d5";
+}
+
+.fa-person-walking-dashed-line-arrow-right:before {
+  content: "\e553";
+}
+
+.fa-image-slash:before {
+  content: "\e1b7";
+}
+
+.fa-mask-snorkel:before {
+  content: "\e3b7";
+}
+
+.fa-smoke:before {
+  content: "\f760";
+}
+
+.fa-gbp:before, .fa-pound-sign:before, .fa-sterling-sign:before {
+  content: "\f154";
+}
+
+.fa-battery-exclamation:before {
+  content: "\e0b0";
+}
+
+.fa-viruses:before {
+  content: "\e076";
+}
+
+.fa-square-person-confined:before {
+  content: "\e577";
+}
+
+.fa-user-tie:before {
+  content: "\f508";
+}
+
+.fa-up-to-bracket:before {
+  content: "\e66e";
+}
+
+.fa-arrow-down-long:before, .fa-long-arrow-down:before {
+  content: "\f175";
+}
+
+.fa-tent-arrow-down-to-line:before {
+  content: "\e57e";
+}
+
+.fa-certificate:before {
+  content: "\f0a3";
+}
+
+.fa-crystal-ball:before {
+  content: "\e362";
+}
+
+.fa-mail-reply-all:before, .fa-reply-all:before {
+  content: "\f122";
+}
+
+.fa-suitcase:before {
+  content: "\f0f2";
+}
+
+.fa-person-skating:before, .fa-skating:before {
+  content: "\f7c5";
+}
+
+.fa-star-shooting:before {
+  content: "\e036";
+}
+
+.fa-binary-lock:before {
+  content: "\e33d";
+}
+
+.fa-filter-circle-dollar:before, .fa-funnel-dollar:before {
+  content: "\f662";
+}
+
+.fa-camera-retro:before {
+  content: "\f083";
+}
+
+.fa-arrow-circle-down:before, .fa-circle-arrow-down:before {
+  content: "\f0ab";
+}
+
+.fa-comment-edit:before, .fa-comment-pen:before {
+  content: "\f4ae";
+}
+
+.fa-arrow-right-to-file:before, .fa-file-import:before {
+  content: "\f56f";
+}
+
+.fa-banjo:before {
+  content: "\f8a3";
+}
+
+.fa-external-link-square:before, .fa-square-arrow-up-right:before {
+  content: "\f14c";
+}
+
+.fa-light-emergency-on:before {
+  content: "\e420";
+}
+
+.fa-kerning:before {
+  content: "\f86f";
+}
+
+.fa-box-open:before {
+  content: "\f49e";
+}
+
+.fa-square-f:before {
+  content: "\e270";
+}
+
+.fa-scroll:before {
+  content: "\f70e";
+}
+
+.fa-spa:before {
+  content: "\f5bb";
+}
+
+.fa-arrow-from-right:before, .fa-arrow-left-from-line:before {
+  content: "\f344";
+}
+
+.fa-strawberry:before {
+  content: "\e32b";
+}
+
+.fa-location-pin-lock:before {
+  content: "\e51f";
+}
+
+.fa-pause:before {
+  content: "\f04c";
+}
+
+.fa-clock-eight-thirty:before {
+  content: "\e346";
+}
+
+.fa-plane-alt:before, .fa-plane-engines:before {
+  content: "\f3de";
+}
+
+.fa-hill-avalanche:before {
+  content: "\e507";
+}
+
+.fa-temperature-0:before, .fa-temperature-empty:before, .fa-thermometer-0:before, .fa-thermometer-empty:before {
+  content: "\f2cb";
+}
+
+.fa-bomb:before {
+  content: "\f1e2";
+}
+
+.fa-gauge-low:before, .fa-tachometer-alt-slow:before {
+  content: "\f627";
+}
+
+.fa-registered:before {
+  content: "\f25d";
+}
+
+.fa-trash-can-plus:before {
+  content: "\e2ac";
+}
+
+.fa-address-card:before, .fa-contact-card:before, .fa-vcard:before {
+  content: "\f2bb";
+}
+
+.fa-balance-scale-right:before, .fa-scale-unbalanced-flip:before {
+  content: "\f516";
+}
+
+.fa-globe-snow:before {
+  content: "\f7a3";
+}
+
+.fa-subscript:before {
+  content: "\f12c";
+}
+
+.fa-diamond-turn-right:before, .fa-directions:before {
+  content: "\f5eb";
+}
+
+.fa-integral:before {
+  content: "\f667";
+}
+
+.fa-burst:before {
+  content: "\e4dc";
+}
+
+.fa-house-laptop:before, .fa-laptop-house:before {
+  content: "\e066";
+}
+
+.fa-face-tired:before, .fa-tired:before {
+  content: "\f5c8";
+}
+
+.fa-money-bills:before {
+  content: "\e1f3";
+}
+
+.fa-blinds-raised:before {
+  content: "\f8fd";
+}
+
+.fa-smog:before {
+  content: "\f75f";
+}
+
+.fa-ufo-beam:before {
+  content: "\e048";
+}
+
+.fa-caret-circle-up:before, .fa-circle-caret-up:before {
+  content: "\f331";
+}
+
+.fa-user-vneck-hair-long:before {
+  content: "\e463";
+}
+
+.fa-square-a-lock:before {
+  content: "\e44d";
+}
+
+.fa-crutch:before {
+  content: "\f7f7";
+}
+
+.fa-gas-pump-slash:before {
+  content: "\f5f4";
+}
+
+.fa-cloud-arrow-up:before, .fa-cloud-upload-alt:before, .fa-cloud-upload:before {
+  content: "\f0ee";
+}
+
+.fa-palette:before {
+  content: "\f53f";
+}
+
+.fa-transporter-4:before {
+  content: "\e2a5";
+}
+
+.fa-chart-mixed-up-circle-currency:before {
+  content: "\e5d8";
+}
+
+.fa-objects-align-right:before {
+  content: "\e3bf";
+}
+
+.fa-arrows-turn-right:before {
+  content: "\e4c0";
+}
+
+.fa-vest:before {
+  content: "\e085";
+}
+
+.fa-pig:before {
+  content: "\f706";
+}
+
+.fa-inbox-full:before {
+  content: "\e1ba";
+}
+
+.fa-circle-envelope:before, .fa-envelope-circle:before {
+  content: "\e10c";
+}
+
+.fa-construction:before, .fa-triangle-person-digging:before {
+  content: "\f85d";
+}
+
+.fa-ferry:before {
+  content: "\e4ea";
+}
+
+.fa-bullseye-arrow:before {
+  content: "\f648";
+}
+
+.fa-arrows-down-to-people:before {
+  content: "\e4b9";
+}
+
+.fa-seedling:before, .fa-sprout:before {
+  content: "\f4d8";
+}
+
+.fa-clock-seven:before {
+  content: "\e350";
+}
+
+.fa-arrows-alt-h:before, .fa-left-right:before {
+  content: "\f337";
+}
+
+.fa-boxes-packing:before {
+  content: "\e4c7";
+}
+
+.fa-arrow-circle-left:before, .fa-circle-arrow-left:before {
+  content: "\f0a8";
+}
+
+.fa-flashlight:before {
+  content: "\f8b8";
+}
+
+.fa-file-jpg:before {
+  content: "\e646";
+}
+
+.fa-group-arrows-rotate:before {
+  content: "\e4f6";
+}
+
+.fa-bowl-food:before {
+  content: "\e4c6";
+}
+
+.fa-square-9:before {
+  content: "\e25e";
+}
+
+.fa-candy-cane:before {
+  content: "\f786";
+}
+
+.fa-arrow-down-wide-short:before, .fa-sort-amount-asc:before, .fa-sort-amount-down:before {
+  content: "\f160";
+}
+
+.fa-dollar-square:before, .fa-square-dollar:before, .fa-usd-square:before {
+  content: "\f2e9";
+}
+
+.fa-phone-arrow-right:before {
+  content: "\e5be";
+}
+
+.fa-hand-holding-seedling:before {
+  content: "\f4bf";
+}
+
+.fa-comment-alt-check:before, .fa-message-check:before {
+  content: "\f4a2";
+}
+
+.fa-cloud-bolt:before, .fa-thunderstorm:before {
+  content: "\f76c";
+}
+
+.fa-chart-line-up-down:before {
+  content: "\e5d7";
+}
+
+.fa-remove-format:before, .fa-text-slash:before {
+  content: "\f87d";
+}
+
+.fa-watch:before {
+  content: "\f2e1";
+}
+
+.fa-circle-down-left:before {
+  content: "\e107";
+}
+
+.fa-text:before {
+  content: "\f893";
+}
+
+.fa-projector:before {
+  content: "\f8d6";
+}
+
+.fa-face-smile-wink:before, .fa-smile-wink:before {
+  content: "\f4da";
+}
+
+.fa-tombstone-alt:before, .fa-tombstone-blank:before {
+  content: "\f721";
+}
+
+.fa-chess-king-alt:before, .fa-chess-king-piece:before {
+  content: "\f440";
+}
+
+.fa-circle-6:before {
+  content: "\e0f3";
+}
+
+.fa-waves-sine:before {
+  content: "\e65d";
+}
+
+.fa-arrow-alt-left:before, .fa-left:before {
+  content: "\f355";
+}
+
+.fa-file-word:before {
+  content: "\f1c2";
+}
+
+.fa-file-powerpoint:before {
+  content: "\f1c4";
+}
+
+.fa-arrow-alt-square-down:before, .fa-square-down:before {
+  content: "\f350";
+}
+
+.fa-objects-align-center-vertical:before {
+  content: "\e3bd";
+}
+
+.fa-arrows-h:before, .fa-arrows-left-right:before {
+  content: "\f07e";
+}
+
+.fa-house-lock:before {
+  content: "\e510";
+}
+
+.fa-cloud-arrow-down:before, .fa-cloud-download-alt:before, .fa-cloud-download:before {
+  content: "\f0ed";
+}
+
+.fa-wreath:before {
+  content: "\f7e2";
+}
+
+.fa-children:before {
+  content: "\e4e1";
+}
+
+.fa-meter-droplet:before {
+  content: "\e1ea";
+}
+
+.fa-blackboard:before, .fa-chalkboard:before {
+  content: "\f51b";
+}
+
+.fa-user-alt-slash:before, .fa-user-large-slash:before {
+  content: "\f4fa";
+}
+
+.fa-signal-4:before, .fa-signal-strong:before {
+  content: "\f68f";
+}
+
+.fa-lollipop:before, .fa-lollypop:before {
+  content: "\e424";
+}
+
+.fa-list-tree:before {
+  content: "\e1d2";
+}
+
+.fa-envelope-open:before {
+  content: "\f2b6";
+}
+
+.fa-draw-circle:before {
+  content: "\f5ed";
+}
+
+.fa-cat-space:before {
+  content: "\e001";
+}
+
+.fa-handshake-alt-slash:before, .fa-handshake-simple-slash:before {
+  content: "\e05f";
+}
+
+.fa-rabbit-fast:before, .fa-rabbit-running:before {
+  content: "\f709";
+}
+
+.fa-memo-pad:before {
+  content: "\e1da";
+}
+
+.fa-mattress-pillow:before {
+  content: "\e525";
+}
+
+.fa-alarm-plus:before {
+  content: "\f844";
+}
+
+.fa-alicorn:before {
+  content: "\f6b0";
+}
+
+.fa-comment-question:before {
+  content: "\e14b";
+}
+
+.fa-gingerbread-man:before {
+  content: "\f79d";
+}
+
+.fa-guarani-sign:before {
+  content: "\e19a";
+}
+
+.fa-burger-fries:before {
+  content: "\e0cd";
+}
+
+.fa-mug-tea:before {
+  content: "\f875";
+}
+
+.fa-border-top:before {
+  content: "\f855";
+}
+
+.fa-arrows-rotate:before, .fa-refresh:before, .fa-sync:before {
+  content: "\f021";
+}
+
+.fa-book-circle:before, .fa-circle-book-open:before {
+  content: "\e0ff";
+}
+
+.fa-arrows-to-dotted-line:before {
+  content: "\e0a6";
+}
+
+.fa-fire-extinguisher:before {
+  content: "\f134";
+}
+
+.fa-magnifying-glass-arrows-rotate:before {
+  content: "\e65e";
+}
+
+.fa-garage-open:before {
+  content: "\e00b";
+}
+
+.fa-shelves-empty:before {
+  content: "\e246";
+}
+
+.fa-cruzeiro-sign:before {
+  content: "\e152";
+}
+
+.fa-watch-apple:before {
+  content: "\e2cb";
+}
+
+.fa-watch-calculator:before {
+  content: "\f8f0";
+}
+
+.fa-list-dropdown:before {
+  content: "\e1cf";
+}
+
+.fa-cabinet-filing:before {
+  content: "\f64b";
+}
+
+.fa-burger-soda:before {
+  content: "\f858";
+}
+
+.fa-arrow-square-up:before, .fa-square-arrow-up:before {
+  content: "\f33c";
+}
+
+.fa-greater-than-equal:before {
+  content: "\f532";
+}
+
+.fa-pallet-box:before {
+  content: "\e208";
+}
+
+.fa-face-confounded:before {
+  content: "\e36c";
+}
+
+.fa-shield-alt:before, .fa-shield-halved:before {
+  content: "\f3ed";
+}
+
+.fa-truck-plow:before {
+  content: "\f7de";
+}
+
+.fa-atlas:before, .fa-book-atlas:before {
+  content: "\f558";
+}
+
+.fa-virus:before {
+  content: "\e074";
+}
+
+.fa-grid-round-2:before {
+  content: "\e5db";
+}
+
+.fa-comment-middle-top:before {
+  content: "\e14a";
+}
+
+.fa-wave:before {
+  content: "\e65b";
+}
+
+.fa-envelope-circle-check:before {
+  content: "\e4e8";
+}
+
+.fa-layer-group:before {
+  content: "\f5fd";
+}
+
+.fa-restroom-simple:before {
+  content: "\e23a";
+}
+
+.fa-arrows-to-dot:before {
+  content: "\e4be";
+}
+
+.fa-border-outer:before {
+  content: "\f851";
+}
+
+.fa-hashtag-lock:before {
+  content: "\e415";
+}
+
+.fa-clock-two-thirty:before {
+  content: "\e35b";
+}
+
+.fa-archway:before {
+  content: "\f557";
+}
+
+.fa-heart-circle-check:before {
+  content: "\e4fd";
+}
+
+.fa-house-chimney-crack:before, .fa-house-damage:before {
+  content: "\f6f1";
+}
+
+.fa-file-archive:before, .fa-file-zipper:before {
+  content: "\f1c6";
+}
+
+.fa-ticket-perforated:before {
+  content: "\e63e";
+}
+
+.fa-heart-half:before {
+  content: "\e1ab";
+}
+
+.fa-comment-check:before {
+  content: "\f4ac";
+}
+
+.fa-square:before {
+  content: "\f0c8";
+}
+
+.fa-memo:before {
+  content: "\e1d8";
+}
+
+.fa-glass-martini:before, .fa-martini-glass-empty:before {
+  content: "\f000";
+}
+
+.fa-couch:before {
+  content: "\f4b8";
+}
+
+.fa-cedi-sign:before {
+  content: "\e0df";
+}
+
+.fa-italic:before {
+  content: "\f033";
+}
+
+.fa-glass-citrus:before {
+  content: "\f869";
+}
+
+.fa-calendar-lines-pen:before {
+  content: "\e472";
+}
+
+.fa-table-cells-column-lock:before {
+  content: "\e678";
+}
+
+.fa-church:before {
+  content: "\f51d";
+}
+
+.fa-person-snowmobiling:before, .fa-snowmobile:before {
+  content: "\f7d1";
+}
+
+.fa-face-hushed:before {
+  content: "\e37b";
+}
+
+.fa-comments-dollar:before {
+  content: "\f653";
+}
+
+.fa-tickets-simple:before {
+  content: "\e659";
+}
+
+.fa-pickaxe:before {
+  content: "\e5bf";
+}
+
+.fa-link-simple-slash:before {
+  content: "\e1ce";
+}
+
+.fa-democrat:before {
+  content: "\f747";
+}
+
+.fa-face-confused:before {
+  content: "\e36d";
+}
+
+.fa-pinball:before {
+  content: "\e229";
+}
+
+.fa-z:before {
+  content: "\5a";
+}
+
+.fa-person-skiing:before, .fa-skiing:before {
+  content: "\f7c9";
+}
+
+.fa-deer:before {
+  content: "\f78e";
+}
+
+.fa-input-pipe:before {
+  content: "\e1be";
+}
+
+.fa-road-lock:before {
+  content: "\e567";
+}
+
+.fa-a:before {
+  content: "\41";
+}
+
+.fa-bookmark-slash:before {
+  content: "\e0c2";
+}
+
+.fa-temperature-arrow-down:before, .fa-temperature-down:before {
+  content: "\e03f";
+}
+
+.fa-mace:before {
+  content: "\f6f8";
+}
+
+.fa-feather-alt:before, .fa-feather-pointed:before {
+  content: "\f56b";
+}
+
+.fa-sausage:before {
+  content: "\f820";
+}
+
+.fa-trash-can-clock:before {
+  content: "\e2aa";
+}
+
+.fa-p:before {
+  content: "\50";
+}
+
+.fa-broom-wide:before {
+  content: "\e5d1";
+}
+
+.fa-snowflake:before {
+  content: "\f2dc";
+}
+
+.fa-stomach:before {
+  content: "\f623";
+}
+
+.fa-newspaper:before {
+  content: "\f1ea";
+}
+
+.fa-ad:before, .fa-rectangle-ad:before {
+  content: "\f641";
+}
+
+.fa-guitar-electric:before {
+  content: "\f8be";
+}
+
+.fa-arrow-turn-down-right:before {
+  content: "\e3d6";
+}
+
+.fa-moon-cloud:before {
+  content: "\f754";
+}
+
+.fa-bread-slice-butter:before {
+  content: "\e3e1";
+}
+
+.fa-arrow-circle-right:before, .fa-circle-arrow-right:before {
+  content: "\f0a9";
+}
+
+.fa-user-group-crown:before, .fa-users-crown:before {
+  content: "\f6a5";
+}
+
+.fa-circle-i:before {
+  content: "\e111";
+}
+
+.fa-toilet-paper-check:before {
+  content: "\e5b2";
+}
+
+.fa-filter-circle-xmark:before {
+  content: "\e17b";
+}
+
+.fa-locust:before {
+  content: "\e520";
+}
+
+.fa-sort:before, .fa-unsorted:before {
+  content: "\f0dc";
+}
+
+.fa-list-1-2:before, .fa-list-numeric:before, .fa-list-ol:before {
+  content: "\f0cb";
+}
+
+.fa-chart-waterfall:before {
+  content: "\e0eb";
+}
+
+.fa-sparkle:before {
+  content: "\e5d6";
+}
+
+.fa-face-party:before {
+  content: "\e383";
+}
+
+.fa-kidneys:before {
+  content: "\f5fb";
+}
+
+.fa-wifi-exclamation:before {
+  content: "\e2cf";
+}
+
+.fa-chart-network:before {
+  content: "\f78a";
+}
+
+.fa-person-dress-burst:before {
+  content: "\e544";
+}
+
+.fa-dice-d4:before {
+  content: "\f6d0";
+}
+
+.fa-money-check-alt:before, .fa-money-check-dollar:before {
+  content: "\f53d";
+}
+
+.fa-vector-square:before {
+  content: "\f5cb";
+}
+
+.fa-bread-slice:before {
+  content: "\f7ec";
+}
+
+.fa-language:before {
+  content: "\f1ab";
+}
+
+.fa-wheat-awn-slash:before {
+  content: "\e338";
+}
+
+.fa-face-kiss-wink-heart:before, .fa-kiss-wink-heart:before {
+  content: "\f598";
+}
+
+.fa-dagger:before {
+  content: "\f6cb";
+}
+
+.fa-podium:before {
+  content: "\f680";
+}
+
+.fa-memo-circle-check:before {
+  content: "\e1d9";
+}
+
+.fa-route-highway:before {
+  content: "\f61a";
+}
+
+.fa-arrow-alt-to-bottom:before, .fa-down-to-line:before {
+  content: "\f34a";
+}
+
+.fa-filter:before {
+  content: "\f0b0";
+}
+
+.fa-square-g:before {
+  content: "\e271";
+}
+
+.fa-circle-phone:before, .fa-phone-circle:before {
+  content: "\e11b";
+}
+
+.fa-clipboard-prescription:before {
+  content: "\f5e8";
+}
+
+.fa-user-nurse-hair:before {
+  content: "\e45d";
+}
+
+.fa-question:before {
+  content: "\3f";
+}
+
+.fa-file-signature:before {
+  content: "\f573";
+}
+
+.fa-toggle-large-on:before {
+  content: "\e5b1";
+}
+
+.fa-arrows-alt:before, .fa-up-down-left-right:before {
+  content: "\f0b2";
+}
+
+.fa-dryer-alt:before, .fa-dryer-heat:before {
+  content: "\f862";
+}
+
+.fa-house-chimney-user:before {
+  content: "\e065";
+}
+
+.fa-hand-holding-heart:before {
+  content: "\f4be";
+}
+
+.fa-arrow-up-small-big:before, .fa-sort-size-up-alt:before {
+  content: "\f88f";
+}
+
+.fa-train-track:before {
+  content: "\e453";
+}
+
+.fa-puzzle-piece:before {
+  content: "\f12e";
+}
+
+.fa-money-check:before {
+  content: "\f53c";
+}
+
+.fa-star-half-alt:before, .fa-star-half-stroke:before {
+  content: "\f5c0";
+}
+
+.fa-file-exclamation:before {
+  content: "\f31a";
+}
+
+.fa-code:before {
+  content: "\f121";
+}
+
+.fa-glass-whiskey:before, .fa-whiskey-glass:before {
+  content: "\f7a0";
+}
+
+.fa-moon-stars:before {
+  content: "\f755";
+}
+
+.fa-building-circle-exclamation:before {
+  content: "\e4d3";
+}
+
+.fa-clothes-hanger:before {
+  content: "\e136";
+}
+
+.fa-mobile-iphone:before, .fa-mobile-notch:before {
+  content: "\e1ee";
+}
+
+.fa-magnifying-glass-chart:before {
+  content: "\e522";
+}
+
+.fa-arrow-up-right-from-square:before, .fa-external-link:before {
+  content: "\f08e";
+}
+
+.fa-cubes-stacked:before {
+  content: "\e4e6";
+}
+
+.fa-images-user:before {
+  content: "\e1b9";
+}
+
+.fa-krw:before, .fa-won-sign:before, .fa-won:before {
+  content: "\f159";
+}
+
+.fa-image-polaroid-user:before {
+  content: "\e1b6";
+}
+
+.fa-virus-covid:before {
+  content: "\e4a8";
+}
+
+.fa-square-ellipsis:before {
+  content: "\e26e";
+}
+
+.fa-pie:before {
+  content: "\f705";
+}
+
+.fa-chess-knight-alt:before, .fa-chess-knight-piece:before {
+  content: "\f442";
+}
+
+.fa-austral-sign:before {
+  content: "\e0a9";
+}
+
+.fa-cloud-plus:before {
+  content: "\e35e";
+}
+
+.fa-f:before {
+  content: "\46";
+}
+
+.fa-leaf:before {
+  content: "\f06c";
+}
+
+.fa-bed-bunk:before {
+  content: "\f8f8";
+}
+
+.fa-road:before {
+  content: "\f018";
+}
+
+.fa-cab:before, .fa-taxi:before {
+  content: "\f1ba";
+}
+
+.fa-person-circle-plus:before {
+  content: "\e541";
+}
+
+.fa-chart-pie:before, .fa-pie-chart:before {
+  content: "\f200";
+}
+
+.fa-bolt-lightning:before {
+  content: "\e0b7";
+}
+
+.fa-clock-eight:before {
+  content: "\e345";
+}
+
+.fa-sack-xmark:before {
+  content: "\e56a";
+}
+
+.fa-file-xls:before {
+  content: "\e64d";
+}
+
+.fa-file-excel:before {
+  content: "\f1c3";
+}
+
+.fa-file-contract:before {
+  content: "\f56c";
+}
+
+.fa-fish-fins:before {
+  content: "\e4f2";
+}
+
+.fa-circle-q:before {
+  content: "\e11e";
+}
+
+.fa-building-flag:before {
+  content: "\e4d5";
+}
+
+.fa-face-grin-beam:before, .fa-grin-beam:before {
+  content: "\f582";
+}
+
+.fa-object-ungroup:before {
+  content: "\f248";
+}
+
+.fa-face-disguise:before {
+  content: "\e370";
+}
+
+.fa-circle-arrow-down-right:before {
+  content: "\e0fa";
+}
+
+.fa-alien-8bit:before, .fa-alien-monster:before {
+  content: "\f8f6";
+}
+
+.fa-hand-point-ribbon:before {
+  content: "\e1a6";
+}
+
+.fa-poop:before {
+  content: "\f619";
+}
+
+.fa-object-exclude:before {
+  content: "\e49c";
+}
+
+.fa-telescope:before {
+  content: "\e03e";
+}
+
+.fa-location-pin:before, .fa-map-marker:before {
+  content: "\f041";
+}
+
+.fa-square-list:before {
+  content: "\e489";
+}
+
+.fa-kaaba:before {
+  content: "\f66b";
+}
+
+.fa-toilet-paper:before {
+  content: "\f71e";
+}
+
+.fa-hard-hat:before, .fa-hat-hard:before, .fa-helmet-safety:before {
+  content: "\f807";
+}
+
+.fa-comment-code:before {
+  content: "\e147";
+}
+
+.fa-sim-cards:before {
+  content: "\e251";
+}
+
+.fa-starship:before {
+  content: "\e039";
+}
+
+.fa-eject:before {
+  content: "\f052";
+}
+
+.fa-arrow-alt-circle-right:before, .fa-circle-right:before {
+  content: "\f35a";
+}
+
+.fa-plane-circle-check:before {
+  content: "\e555";
+}
+
+.fa-seal:before {
+  content: "\e241";
+}
+
+.fa-user-cowboy:before {
+  content: "\f8ea";
+}
+
+.fa-hexagon-vertical-nft:before {
+  content: "\e505";
+}
+
+.fa-face-rolling-eyes:before, .fa-meh-rolling-eyes:before {
+  content: "\f5a5";
+}
+
+.fa-bread-loaf:before {
+  content: "\f7eb";
+}
+
+.fa-rings-wedding:before {
+  content: "\f81b";
+}
+
+.fa-object-group:before {
+  content: "\f247";
+}
+
+.fa-french-fries:before {
+  content: "\f803";
+}
+
+.fa-chart-line:before, .fa-line-chart:before {
+  content: "\f201";
+}
+
+.fa-calendar-arrow-down:before, .fa-calendar-download:before {
+  content: "\e0d0";
+}
+
+.fa-send-back:before {
+  content: "\f87e";
+}
+
+.fa-mask-ventilator:before {
+  content: "\e524";
+}
+
+.fa-tickets:before {
+  content: "\e658";
+}
+
+.fa-signature-lock:before {
+  content: "\e3ca";
+}
+
+.fa-arrow-right:before {
+  content: "\f061";
+}
+
+.fa-map-signs:before, .fa-signs-post:before {
+  content: "\f277";
+}
+
+.fa-octagon-plus:before, .fa-plus-octagon:before {
+  content: "\f301";
+}
+
+.fa-cash-register:before {
+  content: "\f788";
+}
+
+.fa-person-circle-question:before {
+  content: "\e542";
+}
+
+.fa-melon-slice:before {
+  content: "\e311";
+}
+
+.fa-space-station-moon:before {
+  content: "\e033";
+}
+
+.fa-comment-alt-smile:before, .fa-message-smile:before {
+  content: "\f4aa";
+}
+
+.fa-cup-straw:before {
+  content: "\e363";
+}
+
+.fa-arrow-alt-from-right:before, .fa-left-from-line:before {
+  content: "\f348";
+}
+
+.fa-h:before {
+  content: "\48";
+}
+
+.fa-basket-shopping-simple:before, .fa-shopping-basket-alt:before {
+  content: "\e0af";
+}
+
+.fa-hands-heart:before, .fa-hands-holding-heart:before {
+  content: "\f4c3";
+}
+
+.fa-clock-nine:before {
+  content: "\e34c";
+}
+
+.fa-hammer-brush:before {
+  content: "\e620";
+}
+
+.fa-tarp:before {
+  content: "\e57b";
+}
+
+.fa-face-sleepy:before {
+  content: "\e38e";
+}
+
+.fa-hand-horns:before {
+  content: "\e1a9";
+}
+
+.fa-screwdriver-wrench:before, .fa-tools:before {
+  content: "\f7d9";
+}
+
+.fa-arrows-to-eye:before {
+  content: "\e4bf";
+}
+
+.fa-circle-three-quarters:before {
+  content: "\e125";
+}
+
+.fa-trophy-alt:before, .fa-trophy-star:before {
+  content: "\f2eb";
+}
+
+.fa-plug-circle-bolt:before {
+  content: "\e55b";
+}
+
+.fa-face-thermometer:before {
+  content: "\e39a";
+}
+
+.fa-grid-round-4:before {
+  content: "\e5dd";
+}
+
+.fa-sign-posts-wrench:before {
+  content: "\e626";
+}
+
+.fa-shirt-running:before {
+  content: "\e3c8";
+}
+
+.fa-book-circle-arrow-up:before {
+  content: "\e0bd";
+}
+
+.fa-face-nauseated:before {
+  content: "\e381";
+}
+
+.fa-heart:before {
+  content: "\f004";
+}
+
+.fa-file-chart-pie:before {
+  content: "\f65a";
+}
+
+.fa-mars-and-venus:before {
+  content: "\f224";
+}
+
+.fa-home-user:before, .fa-house-user:before {
+  content: "\e1b0";
+}
+
+.fa-circle-arrow-down-left:before {
+  content: "\e0f9";
+}
+
+.fa-dumpster-fire:before {
+  content: "\f794";
+}
+
+.fa-hexagon-minus:before, .fa-minus-hexagon:before {
+  content: "\f307";
+}
+
+.fa-arrow-alt-to-left:before, .fa-left-to-line:before {
+  content: "\f34b";
+}
+
+.fa-house-crack:before {
+  content: "\e3b1";
+}
+
+.fa-paw-alt:before, .fa-paw-simple:before {
+  content: "\f701";
+}
+
+.fa-arrow-left-long-to-line:before {
+  content: "\e3d4";
+}
+
+.fa-brackets-round:before, .fa-parentheses:before {
+  content: "\e0c5";
+}
+
+.fa-cocktail:before, .fa-martini-glass-citrus:before {
+  content: "\f561";
+}
+
+.fa-user-shakespeare:before {
+  content: "\e2c2";
+}
+
+.fa-arrow-right-to-arc:before {
+  content: "\e4b2";
+}
+
+.fa-face-surprise:before, .fa-surprise:before {
+  content: "\f5c2";
+}
+
+.fa-bottle-water:before {
+  content: "\e4c5";
+}
+
+.fa-circle-pause:before, .fa-pause-circle:before {
+  content: "\f28b";
+}
+
+.fa-gauge-circle-plus:before {
+  content: "\e498";
+}
+
+.fa-folders:before {
+  content: "\f660";
+}
+
+.fa-angel:before {
+  content: "\f779";
+}
+
+.fa-value-absolute:before {
+  content: "\f6a6";
+}
+
+.fa-rabbit:before {
+  content: "\f708";
+}
+
+.fa-toilet-paper-slash:before {
+  content: "\e072";
+}
+
+.fa-circle-euro:before {
+  content: "\e5ce";
+}
+
+.fa-apple-alt:before, .fa-apple-whole:before {
+  content: "\f5d1";
+}
+
+.fa-kitchen-set:before {
+  content: "\e51a";
+}
+
+.fa-diamond-half:before {
+  content: "\e5b7";
+}
+
+.fa-lock-alt:before, .fa-lock-keyhole:before {
+  content: "\f30d";
+}
+
+.fa-r:before {
+  content: "\52";
+}
+
+.fa-temperature-1:before, .fa-temperature-quarter:before, .fa-thermometer-1:before, .fa-thermometer-quarter:before {
+  content: "\f2ca";
+}
+
+.fa-info-square:before, .fa-square-info:before {
+  content: "\f30f";
+}
+
+.fa-wifi-slash:before {
+  content: "\f6ac";
+}
+
+.fa-toilet-paper-xmark:before {
+  content: "\e5b3";
+}
+
+.fa-hands-holding-dollar:before, .fa-hands-usd:before {
+  content: "\f4c5";
+}
+
+.fa-cube:before {
+  content: "\f1b2";
+}
+
+.fa-arrow-down-triangle-square:before, .fa-sort-shapes-down:before {
+  content: "\f888";
+}
+
+.fa-bitcoin-sign:before {
+  content: "\e0b4";
+}
+
+.fa-shutters:before {
+  content: "\e449";
+}
+
+.fa-shield-dog:before {
+  content: "\e573";
+}
+
+.fa-solar-panel:before {
+  content: "\f5ba";
+}
+
+.fa-lock-open:before {
+  content: "\f3c1";
+}
+
+.fa-table-tree:before {
+  content: "\e293";
+}
+
+.fa-house-chimney-heart:before {
+  content: "\e1b2";
+}
+
+.fa-tally-3:before {
+  content: "\e296";
+}
+
+.fa-elevator:before {
+  content: "\e16d";
+}
+
+.fa-money-bill-transfer:before {
+  content: "\e528";
+}
+
+.fa-money-bill-trend-up:before {
+  content: "\e529";
+}
+
+.fa-house-flood-water-circle-arrow-right:before {
+  content: "\e50f";
+}
+
+.fa-poll-h:before, .fa-square-poll-horizontal:before {
+  content: "\f682";
+}
+
+.fa-circle:before {
+  content: "\f111";
+}
+
+.fa-left-to-bracket:before {
+  content: "\e66d";
+}
+
+.fa-cart-circle-exclamation:before {
+  content: "\e3f2";
+}
+
+.fa-sword:before {
+  content: "\f71c";
+}
+
+.fa-backward-fast:before, .fa-fast-backward:before {
+  content: "\f049";
+}
+
+.fa-recycle:before {
+  content: "\f1b8";
+}
+
+.fa-user-astronaut:before {
+  content: "\f4fb";
+}
+
+.fa-interrobang:before {
+  content: "\e5ba";
+}
+
+.fa-plane-slash:before {
+  content: "\e069";
+}
+
+.fa-circle-dashed:before {
+  content: "\e105";
+}
+
+.fa-trademark:before {
+  content: "\f25c";
+}
+
+.fa-basketball-ball:before, .fa-basketball:before {
+  content: "\f434";
+}
+
+.fa-fork-knife:before, .fa-utensils-alt:before {
+  content: "\f2e6";
+}
+
+.fa-satellite-dish:before {
+  content: "\f7c0";
+}
+
+.fa-badge-check:before {
+  content: "\f336";
+}
+
+.fa-arrow-alt-circle-up:before, .fa-circle-up:before {
+  content: "\f35b";
+}
+
+.fa-slider:before {
+  content: "\e252";
+}
+
+.fa-mobile-alt:before, .fa-mobile-screen-button:before {
+  content: "\f3cd";
+}
+
+.fa-clock-one-thirty:before {
+  content: "\e34f";
+}
+
+.fa-inbox-arrow-up:before, .fa-inbox-out:before {
+  content: "\f311";
+}
+
+.fa-cloud-slash:before {
+  content: "\e137";
+}
+
+.fa-volume-high:before, .fa-volume-up:before {
+  content: "\f028";
+}
+
+.fa-users-rays:before {
+  content: "\e593";
+}
+
+.fa-wallet:before {
+  content: "\f555";
+}
+
+.fa-octagon-check:before {
+  content: "\e426";
+}
+
+.fa-flatbread-stuffed:before {
+  content: "\e40c";
+}
+
+.fa-clipboard-check:before {
+  content: "\f46c";
+}
+
+.fa-cart-circle-plus:before {
+  content: "\e3f3";
+}
+
+.fa-shipping-timed:before, .fa-truck-clock:before {
+  content: "\f48c";
+}
+
+.fa-pool-8-ball:before {
+  content: "\e3c5";
+}
+
+.fa-file-audio:before {
+  content: "\f1c7";
+}
+
+.fa-turn-down-left:before {
+  content: "\e331";
+}
+
+.fa-lock-hashtag:before {
+  content: "\e423";
+}
+
+.fa-chart-radar:before {
+  content: "\e0e7";
+}
+
+.fa-staff:before {
+  content: "\f71b";
+}
+
+.fa-burger:before, .fa-hamburger:before {
+  content: "\f805";
+}
+
+.fa-utility-pole:before {
+  content: "\e2c3";
+}
+
+.fa-transporter-6:before {
+  content: "\e2a7";
+}
+
+.fa-arrow-turn-left:before {
+  content: "\e632";
+}
+
+.fa-wrench:before {
+  content: "\f0ad";
+}
+
+.fa-bugs:before {
+  content: "\e4d0";
+}
+
+.fa-vector-polygon:before {
+  content: "\e2c7";
+}
+
+.fa-diagram-nested:before {
+  content: "\e157";
+}
+
+.fa-rupee-sign:before, .fa-rupee:before {
+  content: "\f156";
+}
+
+.fa-file-image:before {
+  content: "\f1c5";
+}
+
+.fa-circle-question:before, .fa-question-circle:before {
+  content: "\f059";
+}
+
+.fa-tickets-perforated:before {
+  content: "\e63f";
+}
+
+.fa-image-user:before {
+  content: "\e1b8";
+}
+
+.fa-buoy:before {
+  content: "\e5b5";
+}
+
+.fa-plane-departure:before {
+  content: "\f5b0";
+}
+
+.fa-handshake-slash:before {
+  content: "\e060";
+}
+
+.fa-book-bookmark:before {
+  content: "\e0bb";
+}
+
+.fa-border-center-h:before {
+  content: "\f89c";
+}
+
+.fa-can-food:before {
+  content: "\e3e6";
+}
+
+.fa-typewriter:before {
+  content: "\f8e7";
+}
+
+.fa-arrow-right-from-arc:before {
+  content: "\e4b1";
+}
+
+.fa-circle-k:before {
+  content: "\e113";
+}
+
+.fa-face-hand-over-mouth:before {
+  content: "\e378";
+}
+
+.fa-popcorn:before {
+  content: "\f819";
+}
+
+.fa-house-flood:before, .fa-house-water:before {
+  content: "\f74f";
+}
+
+.fa-object-subtract:before {
+  content: "\e49e";
+}
+
+.fa-code-branch:before {
+  content: "\f126";
+}
+
+.fa-warehouse-alt:before, .fa-warehouse-full:before {
+  content: "\f495";
+}
+
+.fa-hat-cowboy:before {
+  content: "\f8c0";
+}
+
+.fa-bridge:before {
+  content: "\e4c8";
+}
+
+.fa-phone-alt:before, .fa-phone-flip:before {
+  content: "\f879";
+}
+
+.fa-arrow-down-from-dotted-line:before {
+  content: "\e090";
+}
+
+.fa-file-doc:before {
+  content: "\e5ed";
+}
+
+.fa-square-quarters:before {
+  content: "\e44e";
+}
+
+.fa-truck-front:before {
+  content: "\e2b7";
+}
+
+.fa-cat:before {
+  content: "\f6be";
+}
+
+.fa-trash-xmark:before {
+  content: "\e2b4";
+}
+
+.fa-caret-circle-left:before, .fa-circle-caret-left:before {
+  content: "\f32e";
+}
+
+.fa-files:before {
+  content: "\e178";
+}
+
+.fa-anchor-circle-exclamation:before {
+  content: "\e4ab";
+}
+
+.fa-face-clouds:before {
+  content: "\e47d";
+}
+
+.fa-user-crown:before {
+  content: "\f6a4";
+}
+
+.fa-basket-shopping-plus:before {
+  content: "\e653";
+}
+
+.fa-truck-field:before {
+  content: "\e58d";
+}
+
+.fa-route:before {
+  content: "\f4d7";
+}
+
+.fa-cart-circle-check:before {
+  content: "\e3f1";
+}
+
+.fa-clipboard-question:before {
+  content: "\e4e3";
+}
+
+.fa-panorama:before {
+  content: "\e209";
+}
+
+.fa-comment-medical:before {
+  content: "\f7f5";
+}
+
+.fa-teeth-open:before {
+  content: "\f62f";
+}
+
+.fa-user-tie-hair-long:before {
+  content: "\e460";
+}
+
+.fa-file-circle-minus:before {
+  content: "\e4ed";
+}
+
+.fa-head-side-medical:before {
+  content: "\f809";
+}
+
+.fa-arrow-turn-right:before {
+  content: "\e635";
+}
+
+.fa-tags:before {
+  content: "\f02c";
+}
+
+.fa-wine-glass:before {
+  content: "\f4e3";
+}
+
+.fa-fast-forward:before, .fa-forward-fast:before {
+  content: "\f050";
+}
+
+.fa-face-meh-blank:before, .fa-meh-blank:before {
+  content: "\f5a4";
+}
+
+.fa-user-robot:before {
+  content: "\e04b";
+}
+
+.fa-parking:before, .fa-square-parking:before {
+  content: "\f540";
+}
+
+.fa-card-diamond:before {
+  content: "\e3ea";
+}
+
+.fa-face-zipper:before {
+  content: "\e3a5";
+}
+
+.fa-face-raised-eyebrow:before {
+  content: "\e388";
+}
+
+.fa-house-signal:before {
+  content: "\e012";
+}
+
+.fa-chevron-square-up:before, .fa-square-chevron-up:before {
+  content: "\f32c";
+}
+
+.fa-bars-progress:before, .fa-tasks-alt:before {
+  content: "\f828";
+}
+
+.fa-faucet-drip:before {
+  content: "\e006";
+}
+
+.fa-arrows-to-line:before {
+  content: "\e0a7";
+}
+
+.fa-dolphin:before {
+  content: "\e168";
+}
+
+.fa-arrow-up-right:before {
+  content: "\e09f";
+}
+
+.fa-circle-r:before {
+  content: "\e120";
+}
+
+.fa-cart-flatbed:before, .fa-dolly-flatbed:before {
+  content: "\f474";
+}
+
+.fa-ban-smoking:before, .fa-smoking-ban:before {
+  content: "\f54d";
+}
+
+.fa-circle-sort-up:before, .fa-sort-circle-up:before {
+  content: "\e032";
+}
+
+.fa-terminal:before {
+  content: "\f120";
+}
+
+.fa-mobile-button:before {
+  content: "\f10b";
+}
+
+.fa-house-medical-flag:before {
+  content: "\e514";
+}
+
+.fa-basket-shopping:before, .fa-shopping-basket:before {
+  content: "\f291";
+}
+
+.fa-tape:before {
+  content: "\f4db";
+}
+
+.fa-chestnut:before {
+  content: "\e3f6";
+}
+
+.fa-bus-alt:before, .fa-bus-simple:before {
+  content: "\f55e";
+}
+
+.fa-eye:before {
+  content: "\f06e";
+}
+
+.fa-face-sad-cry:before, .fa-sad-cry:before {
+  content: "\f5b3";
+}
+
+.fa-heat:before {
+  content: "\e00c";
+}
+
+.fa-ticket-airline:before, .fa-ticket-perforated-plane:before, .fa-ticket-plane:before {
+  content: "\e29a";
+}
+
+.fa-boot-heeled:before {
+  content: "\e33f";
+}
+
+.fa-arrows-minimize:before, .fa-compress-arrows:before {
+  content: "\e0a5";
+}
+
+.fa-audio-description:before {
+  content: "\f29e";
+}
+
+.fa-person-military-to-person:before {
+  content: "\e54c";
+}
+
+.fa-file-shield:before {
+  content: "\e4f0";
+}
+
+.fa-hexagon:before {
+  content: "\f312";
+}
+
+.fa-manhole:before {
+  content: "\e1d6";
+}
+
+.fa-user-slash:before {
+  content: "\f506";
+}
+
+.fa-pen:before {
+  content: "\f304";
+}
+
+.fa-tower-observation:before {
+  content: "\e586";
+}
+
+.fa-floppy-disks:before {
+  content: "\e183";
+}
+
+.fa-toilet-paper-blank-under:before, .fa-toilet-paper-reverse-alt:before {
+  content: "\e29f";
+}
+
+.fa-file-code:before {
+  content: "\f1c9";
+}
+
+.fa-signal-5:before, .fa-signal-perfect:before, .fa-signal:before {
+  content: "\f012";
+}
+
+.fa-pump:before {
+  content: "\e442";
+}
+
+.fa-bus:before {
+  content: "\f207";
+}
+
+.fa-heart-circle-xmark:before {
+  content: "\e501";
+}
+
+.fa-arrow-up-left-from-circle:before {
+  content: "\e09e";
+}
+
+.fa-home-lg:before, .fa-house-chimney:before {
+  content: "\e3af";
+}
+
+.fa-window-maximize:before {
+  content: "\f2d0";
+}
+
+.fa-dryer:before {
+  content: "\f861";
+}
+
+.fa-face-frown:before, .fa-frown:before {
+  content: "\f119";
+}
+
+.fa-chess-bishop-alt:before, .fa-chess-bishop-piece:before {
+  content: "\f43b";
+}
+
+.fa-shirt-tank-top:before {
+  content: "\e3c9";
+}
+
+.fa-diploma:before, .fa-scroll-ribbon:before {
+  content: "\f5ea";
+}
+
+.fa-screencast:before {
+  content: "\e23e";
+}
+
+.fa-walker:before {
+  content: "\f831";
+}
+
+.fa-prescription:before {
+  content: "\f5b1";
+}
+
+.fa-shop:before, .fa-store-alt:before {
+  content: "\f54f";
+}
+
+.fa-floppy-disk:before, .fa-save:before {
+  content: "\f0c7";
+}
+
+.fa-vihara:before {
+  content: "\f6a7";
+}
+
+.fa-face-kiss-closed-eyes:before {
+  content: "\e37d";
+}
+
+.fa-balance-scale-left:before, .fa-scale-unbalanced:before {
+  content: "\f515";
+}
+
+.fa-file-user:before {
+  content: "\f65c";
+}
+
+.fa-user-police-tie:before {
+  content: "\e334";
+}
+
+.fa-face-tongue-money:before {
+  content: "\e39d";
+}
+
+.fa-tennis-ball:before {
+  content: "\f45e";
+}
+
+.fa-square-l:before {
+  content: "\e275";
+}
+
+.fa-sort-asc:before, .fa-sort-up:before {
+  content: "\f0de";
+}
+
+.fa-calendar-arrow-up:before, .fa-calendar-upload:before {
+  content: "\e0d1";
+}
+
+.fa-comment-dots:before, .fa-commenting:before {
+  content: "\f4ad";
+}
+
+.fa-plant-wilt:before {
+  content: "\e5aa";
+}
+
+.fa-scarf:before {
+  content: "\f7c1";
+}
+
+.fa-album-circle-plus:before {
+  content: "\e48c";
+}
+
+.fa-user-nurse-hair-long:before {
+  content: "\e45e";
+}
+
+.fa-diamond:before {
+  content: "\f219";
+}
+
+.fa-arrow-alt-square-left:before, .fa-square-left:before {
+  content: "\f351";
+}
+
+.fa-face-grin-squint:before, .fa-grin-squint:before {
+  content: "\f585";
+}
+
+.fa-circle-ellipsis-vertical:before {
+  content: "\e10b";
+}
+
+.fa-hand-holding-dollar:before, .fa-hand-holding-usd:before {
+  content: "\f4c0";
+}
+
+.fa-grid-dividers:before {
+  content: "\e3ad";
+}
+
+.fa-bacterium:before {
+  content: "\e05a";
+}
+
+.fa-hand-pointer:before {
+  content: "\f25a";
+}
+
+.fa-drum-steelpan:before {
+  content: "\f56a";
+}
+
+.fa-hand-scissors:before {
+  content: "\f257";
+}
+
+.fa-hands-praying:before, .fa-praying-hands:before {
+  content: "\f684";
+}
+
+.fa-face-pensive:before {
+  content: "\e384";
+}
+
+.fa-user-music:before {
+  content: "\f8eb";
+}
+
+.fa-arrow-right-rotate:before, .fa-arrow-rotate-forward:before, .fa-arrow-rotate-right:before, .fa-redo:before {
+  content: "\f01e";
+}
+
+.fa-comments-alt-dollar:before, .fa-messages-dollar:before {
+  content: "\f652";
+}
+
+.fa-sensor-on:before {
+  content: "\e02b";
+}
+
+.fa-balloon:before {
+  content: "\e2e3";
+}
+
+.fa-biohazard:before {
+  content: "\f780";
+}
+
+.fa-chess-queen-alt:before, .fa-chess-queen-piece:before {
+  content: "\f446";
+}
+
+.fa-location-crosshairs:before, .fa-location:before {
+  content: "\f601";
+}
+
+.fa-mars-double:before {
+  content: "\f227";
+}
+
+.fa-left-from-bracket:before {
+  content: "\e66c";
+}
+
+.fa-house-leave:before, .fa-house-person-depart:before, .fa-house-person-leave:before {
+  content: "\e00f";
+}
+
+.fa-ruler-triangle:before {
+  content: "\f61c";
+}
+
+.fa-card-club:before {
+  content: "\e3e9";
+}
+
+.fa-child-dress:before {
+  content: "\e59c";
+}
+
+.fa-users-between-lines:before {
+  content: "\e591";
+}
+
+.fa-lungs-virus:before {
+  content: "\e067";
+}
+
+.fa-spinner-third:before {
+  content: "\f3f4";
+}
+
+.fa-face-grin-tears:before, .fa-grin-tears:before {
+  content: "\f588";
+}
+
+.fa-phone:before {
+  content: "\f095";
+}
+
+.fa-computer-mouse-scrollwheel:before, .fa-mouse-alt:before {
+  content: "\f8cd";
+}
+
+.fa-calendar-times:before, .fa-calendar-xmark:before {
+  content: "\f273";
+}
+
+.fa-child-reaching:before {
+  content: "\e59d";
+}
+
+.fa-table-layout:before {
+  content: "\e290";
+}
+
+.fa-narwhal:before {
+  content: "\f6fe";
+}
+
+.fa-ramp-loading:before {
+  content: "\f4d4";
+}
+
+.fa-calendar-circle-plus:before {
+  content: "\e470";
+}
+
+.fa-toothbrush:before {
+  content: "\f635";
+}
+
+.fa-border-inner:before {
+  content: "\f84e";
+}
+
+.fa-paw-claws:before {
+  content: "\f702";
+}
+
+.fa-kiwi-fruit:before {
+  content: "\e30c";
+}
+
+.fa-traffic-light-slow:before {
+  content: "\f639";
+}
+
+.fa-rectangle-code:before {
+  content: "\e322";
+}
+
+.fa-head-side-virus:before {
+  content: "\e064";
+}
+
+.fa-keyboard-brightness:before {
+  content: "\e1c0";
+}
+
+.fa-books-medical:before {
+  content: "\f7e8";
+}
+
+.fa-lightbulb-slash:before {
+  content: "\f673";
+}
+
+.fa-home-blank:before, .fa-house-blank:before {
+  content: "\e487";
+}
+
+.fa-square-5:before {
+  content: "\e25a";
+}
+
+.fa-heart-square:before, .fa-square-heart:before {
+  content: "\f4c8";
+}
+
+.fa-puzzle:before {
+  content: "\e443";
+}
+
+.fa-user-cog:before, .fa-user-gear:before {
+  content: "\f4fe";
+}
+
+.fa-pipe-circle-check:before {
+  content: "\e436";
+}
+
+.fa-arrow-up-1-9:before, .fa-sort-numeric-up:before {
+  content: "\f163";
+}
+
+.fa-octagon-exclamation:before {
+  content: "\e204";
+}
+
+.fa-dial-low:before {
+  content: "\e15d";
+}
+
+.fa-door-closed:before {
+  content: "\f52a";
+}
+
+.fa-laptop-mobile:before, .fa-phone-laptop:before {
+  content: "\f87a";
+}
+
+.fa-conveyor-belt-alt:before, .fa-conveyor-belt-boxes:before {
+  content: "\f46f";
+}
+
+.fa-shield-virus:before {
+  content: "\e06c";
+}
+
+.fa-starfighter-alt-advanced:before, .fa-starfighter-twin-ion-engine-advanced:before {
+  content: "\e28e";
+}
+
+.fa-dice-six:before {
+  content: "\f526";
+}
+
+.fa-starfighter-alt:before, .fa-starfighter-twin-ion-engine:before {
+  content: "\e038";
+}
+
+.fa-rocket-launch:before {
+  content: "\e027";
+}
+
+.fa-mosquito-net:before {
+  content: "\e52c";
+}
+
+.fa-vent-damper:before {
+  content: "\e465";
+}
+
+.fa-bridge-water:before {
+  content: "\e4ce";
+}
+
+.fa-ban-bug:before, .fa-debug:before {
+  content: "\f7f9";
+}
+
+.fa-person-booth:before {
+  content: "\f756";
+}
+
+.fa-text-width:before {
+  content: "\f035";
+}
+
+.fa-garage-car:before {
+  content: "\e00a";
+}
+
+.fa-square-kanban:before {
+  content: "\e488";
+}
+
+.fa-hat-wizard:before {
+  content: "\f6e8";
+}
+
+.fa-chart-kanban:before {
+  content: "\e64f";
+}
+
+.fa-pen-fancy:before {
+  content: "\f5ac";
+}
+
+.fa-coffee-pot:before {
+  content: "\e002";
+}
+
+.fa-mouse-field:before {
+  content: "\e5a8";
+}
+
+.fa-digging:before, .fa-person-digging:before {
+  content: "\f85e";
+}
+
+.fa-shower-alt:before, .fa-shower-down:before {
+  content: "\e24d";
+}
+
+.fa-box-circle-check:before {
+  content: "\e0c4";
+}
+
+.fa-brightness:before {
+  content: "\e0c9";
+}
+
+.fa-car-side-bolt:before {
+  content: "\e344";
+}
+
+.fa-file-xml:before {
+  content: "\e654";
+}
+
+.fa-ornament:before {
+  content: "\f7b8";
+}
+
+.fa-phone-arrow-down-left:before, .fa-phone-arrow-down:before, .fa-phone-incoming:before {
+  content: "\e223";
+}
+
+.fa-cloud-word:before {
+  content: "\e138";
+}
+
+.fa-hand-fingers-crossed:before {
+  content: "\e1a3";
+}
+
+.fa-trash:before {
+  content: "\f1f8";
+}
+
+.fa-gauge-simple-med:before, .fa-gauge-simple:before, .fa-tachometer-average:before {
+  content: "\f629";
+}
+
+.fa-arrow-down-small-big:before, .fa-sort-size-down-alt:before {
+  content: "\f88d";
+}
+
+.fa-book-medical:before {
+  content: "\f7e6";
+}
+
+.fa-face-melting:before {
+  content: "\e483";
+}
+
+.fa-poo:before {
+  content: "\f2fe";
+}
+
+.fa-pen-alt-slash:before, .fa-pen-clip-slash:before {
+  content: "\e20f";
+}
+
+.fa-quote-right-alt:before, .fa-quote-right:before {
+  content: "\f10e";
+}
+
+.fa-scroll-old:before {
+  content: "\f70f";
+}
+
+.fa-guitars:before {
+  content: "\f8bf";
+}
+
+.fa-phone-xmark:before {
+  content: "\e227";
+}
+
+.fa-hose:before {
+  content: "\e419";
+}
+
+.fa-clock-six:before {
+  content: "\e352";
+}
+
+.fa-shirt:before, .fa-t-shirt:before, .fa-tshirt:before {
+  content: "\f553";
+}
+
+.fa-billboard:before {
+  content: "\e5cd";
+}
+
+.fa-square-r:before {
+  content: "\e27c";
+}
+
+.fa-cubes:before {
+  content: "\f1b3";
+}
+
+.fa-envelope-open-dollar:before {
+  content: "\f657";
+}
+
+.fa-divide:before {
+  content: "\f529";
+}
+
+.fa-sun-cloud:before {
+  content: "\f763";
+}
+
+.fa-lamp-floor:before {
+  content: "\e015";
+}
+
+.fa-square-7:before {
+  content: "\e25c";
+}
+
+.fa-tenge-sign:before, .fa-tenge:before {
+  content: "\f7d7";
+}
+
+.fa-headphones:before {
+  content: "\f025";
+}
+
+.fa-hands-holding:before {
+  content: "\f4c2";
+}
+
+.fa-campfire:before {
+  content: "\f6ba";
+}
+
+.fa-circle-ampersand:before {
+  content: "\e0f8";
+}
+
+.fa-snowflakes:before {
+  content: "\f7cf";
+}
+
+.fa-hands-clapping:before {
+  content: "\e1a8";
+}
+
+.fa-republican:before {
+  content: "\f75e";
+}
+
+.fa-leaf-maple:before {
+  content: "\f6f6";
+}
+
+.fa-arrow-left:before {
+  content: "\f060";
+}
+
+.fa-person-circle-xmark:before {
+  content: "\e543";
+}
+
+.fa-ruler:before {
+  content: "\f545";
+}
+
+.fa-arrow-left-from-bracket:before {
+  content: "\e668";
+}
+
+.fa-cup-straw-swoosh:before {
+  content: "\e364";
+}
+
+.fa-temperature-hot:before, .fa-temperature-sun:before {
+  content: "\f76a";
+}
+
+.fa-align-left:before {
+  content: "\f036";
+}
+
+.fa-dice-d6:before {
+  content: "\f6d1";
+}
+
+.fa-restroom:before {
+  content: "\f7bd";
+}
+
+.fa-high-definition:before, .fa-rectangle-hd:before {
+  content: "\e1ae";
+}
+
+.fa-j:before {
+  content: "\4a";
+}
+
+.fa-galaxy:before {
+  content: "\e008";
+}
+
+.fa-users-viewfinder:before {
+  content: "\e595";
+}
+
+.fa-file-video:before {
+  content: "\f1c8";
+}
+
+.fa-cherries:before {
+  content: "\e0ec";
+}
+
+.fa-external-link-alt:before, .fa-up-right-from-square:before {
+  content: "\f35d";
+}
+
+.fa-circle-sort:before, .fa-sort-circle:before {
+  content: "\e030";
+}
+
+.fa-table-cells:before, .fa-th:before {
+  content: "\f00a";
+}
+
+.fa-bag-shopping-minus:before {
+  content: "\e650";
+}
+
+.fa-file-pdf:before {
+  content: "\f1c1";
+}
+
+.fa-siren:before {
+  content: "\e02d";
+}
+
+.fa-arrow-up-to-dotted-line:before {
+  content: "\e0a1";
+}
+
+.fa-image-landscape:before, .fa-landscape:before {
+  content: "\e1b5";
+}
+
+.fa-tank-water:before {
+  content: "\e452";
+}
+
+.fa-curling-stone:before, .fa-curling:before {
+  content: "\f44a";
+}
+
+.fa-gamepad-alt:before, .fa-gamepad-modern:before {
+  content: "\e5a2";
+}
+
+.fa-messages-question:before {
+  content: "\e1e7";
+}
+
+.fa-bible:before, .fa-book-bible:before {
+  content: "\f647";
+}
+
+.fa-o:before {
+  content: "\4f";
+}
+
+.fa-medkit:before, .fa-suitcase-medical:before {
+  content: "\f0fa";
+}
+
+.fa-briefcase-arrow-right:before {
+  content: "\e2f2";
+}
+
+.fa-expand-wide:before {
+  content: "\f320";
+}
+
+.fa-clock-eleven-thirty:before {
+  content: "\e348";
+}
+
+.fa-rv:before {
+  content: "\f7be";
+}
+
+.fa-user-secret:before {
+  content: "\f21b";
+}
+
+.fa-otter:before {
+  content: "\f700";
+}
+
+.fa-dreidel:before {
+  content: "\f792";
+}
+
+.fa-female:before, .fa-person-dress:before {
+  content: "\f182";
+}
+
+.fa-comment-dollar:before {
+  content: "\f651";
+}
+
+.fa-briefcase-clock:before, .fa-business-time:before {
+  content: "\f64a";
+}
+
+.fa-flower-tulip:before {
+  content: "\f801";
+}
+
+.fa-people-pants-simple:before {
+  content: "\e21a";
+}
+
+.fa-cloud-drizzle:before {
+  content: "\f738";
+}
+
+.fa-table-cells-large:before, .fa-th-large:before {
+  content: "\f009";
+}
+
+.fa-book-tanakh:before, .fa-tanakh:before {
+  content: "\f827";
+}
+
+.fa-solar-system:before {
+  content: "\e02f";
+}
+
+.fa-seal-question:before {
+  content: "\e243";
+}
+
+.fa-phone-volume:before, .fa-volume-control-phone:before {
+  content: "\f2a0";
+}
+
+.fa-disc-drive:before {
+  content: "\f8b5";
+}
+
+.fa-hat-cowboy-side:before {
+  content: "\f8c1";
+}
+
+.fa-rows:before, .fa-table-rows:before {
+  content: "\e292";
+}
+
+.fa-location-exclamation:before, .fa-map-marker-exclamation:before {
+  content: "\f608";
+}
+
+.fa-face-fearful:before {
+  content: "\e375";
+}
+
+.fa-clipboard-user:before {
+  content: "\f7f3";
+}
+
+.fa-bus-school:before {
+  content: "\f5dd";
+}
+
+.fa-film-slash:before {
+  content: "\e179";
+}
+
+.fa-square-arrow-down-right:before {
+  content: "\e262";
+}
+
+.fa-book-sparkles:before, .fa-book-spells:before {
+  content: "\f6b8";
+}
+
+.fa-washer:before, .fa-washing-machine:before {
+  content: "\f898";
+}
+
+.fa-child:before {
+  content: "\f1ae";
+}
+
+.fa-lira-sign:before {
+  content: "\f195";
+}
+
+.fa-user-visor:before {
+  content: "\e04c";
+}
+
+.fa-file-plus-minus:before {
+  content: "\e177";
+}
+
+.fa-chess-clock-alt:before, .fa-chess-clock-flip:before {
+  content: "\f43e";
+}
+
+.fa-satellite:before {
+  content: "\f7bf";
+}
+
+.fa-truck-fire:before {
+  content: "\e65a";
+}
+
+.fa-plane-lock:before {
+  content: "\e558";
+}
+
+.fa-steering-wheel:before {
+  content: "\f622";
+}
+
+.fa-tag:before {
+  content: "\f02b";
+}
+
+.fa-stretcher:before {
+  content: "\f825";
+}
+
+.fa-book-law:before, .fa-book-section:before {
+  content: "\e0c1";
+}
+
+.fa-inboxes:before {
+  content: "\e1bb";
+}
+
+.fa-coffee-bean:before {
+  content: "\e13e";
+}
+
+.fa-circle-yen:before {
+  content: "\e5d0";
+}
+
+.fa-brackets-curly:before {
+  content: "\f7ea";
+}
+
+.fa-ellipsis-stroke-vertical:before, .fa-ellipsis-v-alt:before {
+  content: "\f39c";
+}
+
+.fa-comment:before {
+  content: "\f075";
+}
+
+.fa-square-1:before {
+  content: "\e256";
+}
+
+.fa-birthday-cake:before, .fa-cake-candles:before, .fa-cake:before {
+  content: "\f1fd";
+}
+
+.fa-head-side:before {
+  content: "\f6e9";
+}
+
+.fa-truck-ladder:before {
+  content: "\e657";
+}
+
+.fa-envelope:before {
+  content: "\f0e0";
+}
+
+.fa-dolly-empty:before {
+  content: "\f473";
+}
+
+.fa-face-tissue:before {
+  content: "\e39c";
+}
+
+.fa-angle-double-up:before, .fa-angles-up:before {
+  content: "\f102";
+}
+
+.fa-bin-recycle:before {
+  content: "\e5f7";
+}
+
+.fa-paperclip:before {
+  content: "\f0c6";
+}
+
+.fa-chart-line-down:before {
+  content: "\f64d";
+}
+
+.fa-arrow-right-to-city:before {
+  content: "\e4b3";
+}
+
+.fa-lock-a:before {
+  content: "\e422";
+}
+
+.fa-ribbon:before {
+  content: "\f4d6";
+}
+
+.fa-lungs:before {
+  content: "\f604";
+}
+
+.fa-person-pinball:before {
+  content: "\e21d";
+}
+
+.fa-arrow-up-9-1:before, .fa-sort-numeric-up-alt:before {
+  content: "\f887";
+}
+
+.fa-apple-core:before {
+  content: "\e08f";
+}
+
+.fa-circle-y:before {
+  content: "\e12f";
+}
+
+.fa-h6:before {
+  content: "\e413";
+}
+
+.fa-litecoin-sign:before {
+  content: "\e1d3";
+}
+
+.fa-bottle-baby:before {
+  content: "\e673";
+}
+
+.fa-circle-small:before {
+  content: "\e122";
+}
+
+.fa-border-none:before {
+  content: "\f850";
+}
+
+.fa-arrow-turn-down-left:before {
+  content: "\e2e1";
+}
+
+.fa-circle-wifi-circle-wifi:before, .fa-circle-wifi-group:before {
+  content: "\e67e";
+}
+
+.fa-circle-nodes:before {
+  content: "\e4e2";
+}
+
+.fa-parachute-box:before {
+  content: "\f4cd";
+}
+
+.fa-reflect-horizontal:before {
+  content: "\e664";
+}
+
+.fa-comment-alt-medical:before, .fa-message-medical:before {
+  content: "\f7f4";
+}
+
+.fa-rugby-ball:before {
+  content: "\e3c6";
+}
+
+.fa-comment-music:before {
+  content: "\f8b0";
+}
+
+.fa-indent:before {
+  content: "\f03c";
+}
+
+.fa-tree-alt:before, .fa-tree-deciduous:before {
+  content: "\f400";
+}
+
+.fa-puzzle-piece-alt:before, .fa-puzzle-piece-simple:before {
+  content: "\e231";
+}
+
+.fa-truck-field-un:before {
+  content: "\e58e";
+}
+
+.fa-nfc-trash:before {
+  content: "\e1fd";
+}
+
+.fa-hourglass-empty:before, .fa-hourglass:before {
+  content: "\f254";
+}
+
+.fa-mountain:before {
+  content: "\f6fc";
+}
+
+.fa-file-times:before, .fa-file-xmark:before {
+  content: "\f317";
+}
+
+.fa-home-heart:before, .fa-house-heart:before {
+  content: "\f4c9";
+}
+
+.fa-house-chimney-blank:before {
+  content: "\e3b0";
+}
+
+.fa-meter-bolt:before {
+  content: "\e1e9";
+}
+
+.fa-user-doctor:before, .fa-user-md:before {
+  content: "\f0f0";
+}
+
+.fa-slash-back:before {
+  content: "\5c";
+}
+
+.fa-circle-info:before, .fa-info-circle:before {
+  content: "\f05a";
+}
+
+.fa-fishing-rod:before {
+  content: "\e3a8";
+}
+
+.fa-hammer-crash:before {
+  content: "\e414";
+}
+
+.fa-message-heart:before {
+  content: "\e5c9";
+}
+
+.fa-cloud-meatball:before {
+  content: "\f73b";
+}
+
+.fa-camera-polaroid:before {
+  content: "\f8aa";
+}
+
+.fa-camera-alt:before, .fa-camera:before {
+  content: "\f030";
+}
+
+.fa-square-virus:before {
+  content: "\e578";
+}
+
+.fa-cart-arrow-up:before {
+  content: "\e3ee";
+}
+
+.fa-meteor:before {
+  content: "\f753";
+}
+
+.fa-car-on:before {
+  content: "\e4dd";
+}
+
+.fa-sleigh:before {
+  content: "\f7cc";
+}
+
+.fa-arrow-down-1-9:before, .fa-sort-numeric-asc:before, .fa-sort-numeric-down:before {
+  content: "\f162";
+}
+
+.fa-buoy-mooring:before {
+  content: "\e5b6";
+}
+
+.fa-square-4:before {
+  content: "\e259";
+}
+
+.fa-hand-holding-droplet:before, .fa-hand-holding-water:before {
+  content: "\f4c1";
+}
+
+.fa-file-eps:before {
+  content: "\e644";
+}
+
+.fa-tricycle-adult:before {
+  content: "\e5c4";
+}
+
+.fa-waveform:before {
+  content: "\f8f1";
+}
+
+.fa-water:before {
+  content: "\f773";
+}
+
+.fa-star-sharp-half-alt:before, .fa-star-sharp-half-stroke:before {
+  content: "\e28d";
+}
+
+.fa-nfc-signal:before {
+  content: "\e1fb";
+}
+
+.fa-plane-prop:before {
+  content: "\e22b";
+}
+
+.fa-calendar-check:before {
+  content: "\f274";
+}
+
+.fa-clock-desk:before {
+  content: "\e134";
+}
+
+.fa-calendar-clock:before, .fa-calendar-time:before {
+  content: "\e0d2";
+}
+
+.fa-braille:before {
+  content: "\f2a1";
+}
+
+.fa-prescription-bottle-alt:before, .fa-prescription-bottle-medical:before {
+  content: "\f486";
+}
+
+.fa-plate-utensils:before {
+  content: "\e43b";
+}
+
+.fa-family-pants:before {
+  content: "\e302";
+}
+
+.fa-hose-reel:before {
+  content: "\e41a";
+}
+
+.fa-house-window:before {
+  content: "\e3b3";
+}
+
+.fa-landmark:before {
+  content: "\f66f";
+}
+
+.fa-truck:before {
+  content: "\f0d1";
+}
+
+.fa-music-magnifying-glass:before {
+  content: "\e662";
+}
+
+.fa-crosshairs:before {
+  content: "\f05b";
+}
+
+.fa-cloud-rainbow:before {
+  content: "\f73e";
+}
+
+.fa-person-cane:before {
+  content: "\e53c";
+}
+
+.fa-alien:before {
+  content: "\f8f5";
+}
+
+.fa-tent:before {
+  content: "\e57d";
+}
+
+.fa-laptop-binary:before {
+  content: "\e5e7";
+}
+
+.fa-vest-patches:before {
+  content: "\e086";
+}
+
+.fa-people-dress-simple:before {
+  content: "\e218";
+}
+
+.fa-check-double:before {
+  content: "\f560";
+}
+
+.fa-arrow-down-a-z:before, .fa-sort-alpha-asc:before, .fa-sort-alpha-down:before {
+  content: "\f15d";
+}
+
+.fa-bowling-ball-pin:before {
+  content: "\e0c3";
+}
+
+.fa-bell-school-slash:before {
+  content: "\f5d6";
+}
+
+.fa-plus-large:before {
+  content: "\e59e";
+}
+
+.fa-money-bill-wheat:before {
+  content: "\e52a";
+}
+
+.fa-camera-viewfinder:before, .fa-screenshot:before {
+  content: "\e0da";
+}
+
+.fa-comment-alt-music:before, .fa-message-music:before {
+  content: "\f8af";
+}
+
+.fa-car-building:before {
+  content: "\f859";
+}
+
+.fa-border-bottom-right:before, .fa-border-style-alt:before {
+  content: "\f854";
+}
+
+.fa-octagon:before {
+  content: "\f306";
+}
+
+.fa-comment-arrow-up-right:before {
+  content: "\e145";
+}
+
+.fa-octagon-divide:before {
+  content: "\e203";
+}
+
+.fa-cookie:before {
+  content: "\f563";
+}
+
+.fa-arrow-left-rotate:before, .fa-arrow-rotate-back:before, .fa-arrow-rotate-backward:before, .fa-arrow-rotate-left:before, .fa-undo:before {
+  content: "\f0e2";
+}
+
+.fa-tv-music:before {
+  content: "\f8e6";
+}
+
+.fa-hard-drive:before, .fa-hdd:before {
+  content: "\f0a0";
+}
+
+.fa-reel:before {
+  content: "\e238";
+}
+
+.fa-face-grin-squint-tears:before, .fa-grin-squint-tears:before {
+  content: "\f586";
+}
+
+.fa-dumbbell:before {
+  content: "\f44b";
+}
+
+.fa-list-alt:before, .fa-rectangle-list:before {
+  content: "\f022";
+}
+
+.fa-tarp-droplet:before {
+  content: "\e57c";
+}
+
+.fa-alarm-exclamation:before {
+  content: "\f843";
+}
+
+.fa-house-medical-circle-check:before {
+  content: "\e511";
+}
+
+.fa-traffic-cone:before {
+  content: "\f636";
+}
+
+.fa-grate:before {
+  content: "\e193";
+}
+
+.fa-arrow-down-right:before {
+  content: "\e093";
+}
+
+.fa-person-skiing-nordic:before, .fa-skiing-nordic:before {
+  content: "\f7ca";
+}
+
+.fa-calendar-plus:before {
+  content: "\f271";
+}
+
+.fa-person-from-portal:before, .fa-portal-exit:before {
+  content: "\e023";
+}
+
+.fa-plane-arrival:before {
+  content: "\f5af";
+}
+
+.fa-cowbell-circle-plus:before, .fa-cowbell-more:before {
+  content: "\f8b4";
+}
+
+.fa-arrow-alt-circle-left:before, .fa-circle-left:before {
+  content: "\f359";
+}
+
+.fa-distribute-spacing-vertical:before {
+  content: "\e366";
+}
+
+.fa-signal-alt-2:before, .fa-signal-bars-fair:before {
+  content: "\f692";
+}
+
+.fa-sportsball:before {
+  content: "\e44b";
+}
+
+.fa-game-console-handheld-crank:before {
+  content: "\e5b9";
+}
+
+.fa-subway:before, .fa-train-subway:before {
+  content: "\f239";
+}
+
+.fa-chart-gantt:before {
+  content: "\e0e4";
+}
+
+.fa-face-smile-upside-down:before {
+  content: "\e395";
+}
+
+.fa-ball-pile:before {
+  content: "\f77e";
+}
+
+.fa-badge-dollar:before {
+  content: "\f645";
+}
+
+.fa-money-bills-alt:before, .fa-money-bills-simple:before {
+  content: "\e1f4";
+}
+
+.fa-list-timeline:before {
+  content: "\e1d1";
+}
+
+.fa-indian-rupee-sign:before, .fa-indian-rupee:before, .fa-inr:before {
+  content: "\e1bc";
+}
+
+.fa-crop-alt:before, .fa-crop-simple:before {
+  content: "\f565";
+}
+
+.fa-money-bill-1:before, .fa-money-bill-alt:before {
+  content: "\f3d1";
+}
+
+.fa-left-long:before, .fa-long-arrow-alt-left:before {
+  content: "\f30a";
+}
+
+.fa-keyboard-down:before {
+  content: "\e1c2";
+}
+
+.fa-circle-up-right:before {
+  content: "\e129";
+}
+
+.fa-cloud-bolt-moon:before, .fa-thunderstorm-moon:before {
+  content: "\f76d";
+}
+
+.fa-turn-left-up:before {
+  content: "\e638";
+}
+
+.fa-dna:before {
+  content: "\f471";
+}
+
+.fa-virus-slash:before {
+  content: "\e075";
+}
+
+.fa-bracket-round-right:before {
+  content: "\29";
+}
+
+.fa-circle-sterling:before {
+  content: "\e5cf";
+}
+
+.fa-circle-5:before {
+  content: "\e0f2";
+}
+
+.fa-minus:before, .fa-subtract:before {
+  content: "\f068";
+}
+
+.fa-fire-flame:before, .fa-flame:before {
+  content: "\f6df";
+}
+
+.fa-arrow-alt-to-right:before, .fa-right-to-line:before {
+  content: "\f34c";
+}
+
+.fa-gif:before {
+  content: "\e190";
+}
+
+.fa-chess:before {
+  content: "\f439";
+}
+
+.fa-trash-slash:before {
+  content: "\e2b3";
+}
+
+.fa-arrow-left-long:before, .fa-long-arrow-left:before {
+  content: "\f177";
+}
+
+.fa-plug-circle-check:before {
+  content: "\e55c";
+}
+
+.fa-font-case:before {
+  content: "\f866";
+}
+
+.fa-street-view:before {
+  content: "\f21d";
+}
+
+.fa-arrow-down-left:before {
+  content: "\e091";
+}
+
+.fa-franc-sign:before {
+  content: "\e18f";
+}
+
+.fa-flask-poison:before, .fa-flask-round-poison:before {
+  content: "\f6e0";
+}
+
+.fa-volume-off:before {
+  content: "\f026";
+}
+
+.fa-book-circle-arrow-right:before {
+  content: "\e0bc";
+}
+
+.fa-chart-user:before, .fa-user-chart:before {
+  content: "\f6a3";
+}
+
+.fa-american-sign-language-interpreting:before, .fa-asl-interpreting:before, .fa-hands-american-sign-language-interpreting:before, .fa-hands-asl-interpreting:before {
+  content: "\f2a3";
+}
+
+.fa-presentation-screen:before, .fa-presentation:before {
+  content: "\f685";
+}
+
+.fa-circle-bolt:before {
+  content: "\e0fe";
+}
+
+.fa-face-smile-halo:before {
+  content: "\e38f";
+}
+
+.fa-cart-circle-arrow-down:before {
+  content: "\e3ef";
+}
+
+.fa-house-person-arrive:before, .fa-house-person-return:before, .fa-house-return:before {
+  content: "\e011";
+}
+
+.fa-comment-alt-times:before, .fa-message-times:before, .fa-message-xmark:before {
+  content: "\f4ab";
+}
+
+.fa-file-award:before, .fa-file-certificate:before {
+  content: "\f5f3";
+}
+
+.fa-user-doctor-hair-long:before {
+  content: "\e459";
+}
+
+.fa-camera-home:before, .fa-camera-security:before {
+  content: "\f8fe";
+}
+
+.fa-cog:before, .fa-gear:before {
+  content: "\f013";
+}
+
+.fa-droplet-slash:before, .fa-tint-slash:before {
+  content: "\f5c7";
+}
+
+.fa-book-heart:before {
+  content: "\f499";
+}
+
+.fa-mosque:before {
+  content: "\f678";
+}
+
+.fa-duck:before {
+  content: "\f6d8";
+}
+
+.fa-mosquito:before {
+  content: "\e52b";
+}
+
+.fa-star-of-david:before {
+  content: "\f69a";
+}
+
+.fa-flag-alt:before, .fa-flag-swallowtail:before {
+  content: "\f74c";
+}
+
+.fa-person-military-rifle:before {
+  content: "\e54b";
+}
+
+.fa-car-garage:before {
+  content: "\f5e2";
+}
+
+.fa-cart-shopping:before, .fa-shopping-cart:before {
+  content: "\f07a";
+}
+
+.fa-book-font:before {
+  content: "\e0bf";
+}
+
+.fa-shield-plus:before {
+  content: "\e24a";
+}
+
+.fa-vials:before {
+  content: "\f493";
+}
+
+.fa-eye-dropper-full:before {
+  content: "\e172";
+}
+
+.fa-distribute-spacing-horizontal:before {
+  content: "\e365";
+}
+
+.fa-tablet-rugged:before {
+  content: "\f48f";
+}
+
+.fa-temperature-frigid:before, .fa-temperature-snow:before {
+  content: "\f768";
+}
+
+.fa-moped:before {
+  content: "\e3b9";
+}
+
+.fa-face-smile-plus:before, .fa-smile-plus:before {
+  content: "\f5b9";
+}
+
+.fa-radio-alt:before, .fa-radio-tuner:before {
+  content: "\f8d8";
+}
+
+.fa-face-swear:before {
+  content: "\e399";
+}
+
+.fa-water-arrow-down:before, .fa-water-lower:before {
+  content: "\f774";
+}
+
+.fa-scanner-touchscreen:before {
+  content: "\f48a";
+}
+
+.fa-circle-7:before {
+  content: "\e0f4";
+}
+
+.fa-plug-circle-plus:before {
+  content: "\e55f";
+}
+
+.fa-person-ski-jumping:before, .fa-ski-jump:before {
+  content: "\f7c7";
+}
+
+.fa-place-of-worship:before {
+  content: "\f67f";
+}
+
+.fa-water-arrow-up:before, .fa-water-rise:before {
+  content: "\f775";
+}
+
+.fa-waveform-lines:before, .fa-waveform-path:before {
+  content: "\f8f2";
+}
+
+.fa-split:before {
+  content: "\e254";
+}
+
+.fa-film-canister:before, .fa-film-cannister:before {
+  content: "\f8b7";
+}
+
+.fa-folder-times:before, .fa-folder-xmark:before {
+  content: "\f65f";
+}
+
+.fa-toilet-paper-alt:before, .fa-toilet-paper-blank:before {
+  content: "\f71f";
+}
+
+.fa-tablet-android-alt:before, .fa-tablet-screen:before {
+  content: "\f3fc";
+}
+
+.fa-hexagon-vertical-nft-slanted:before {
+  content: "\e506";
+}
+
+.fa-folder-music:before {
+  content: "\e18d";
+}
+
+.fa-desktop-medical:before, .fa-display-medical:before {
+  content: "\e166";
+}
+
+.fa-share-all:before {
+  content: "\f367";
+}
+
+.fa-peapod:before {
+  content: "\e31c";
+}
+
+.fa-chess-clock:before {
+  content: "\f43d";
+}
+
+.fa-axe:before {
+  content: "\f6b2";
+}
+
+.fa-square-d:before {
+  content: "\e268";
+}
+
+.fa-grip-vertical:before {
+  content: "\f58e";
+}
+
+.fa-mobile-signal-out:before {
+  content: "\e1f0";
+}
+
+.fa-arrow-turn-up:before, .fa-level-up:before {
+  content: "\f148";
+}
+
+.fa-u:before {
+  content: "\55";
+}
+
+.fa-arrow-up-from-dotted-line:before {
+  content: "\e09b";
+}
+
+.fa-square-root-alt:before, .fa-square-root-variable:before {
+  content: "\f698";
+}
+
+.fa-light-switch-on:before {
+  content: "\e019";
+}
+
+.fa-arrow-down-arrow-up:before, .fa-sort-alt:before {
+  content: "\f883";
+}
+
+.fa-raindrops:before {
+  content: "\f75c";
+}
+
+.fa-dash:before, .fa-minus-large:before {
+  content: "\e404";
+}
+
+.fa-clock-four:before, .fa-clock:before {
+  content: "\f017";
+}
+
+.fa-input-numeric:before {
+  content: "\e1bd";
+}
+
+.fa-truck-tow:before {
+  content: "\e2b8";
+}
+
+.fa-backward-step:before, .fa-step-backward:before {
+  content: "\f048";
+}
+
+.fa-pallet:before {
+  content: "\f482";
+}
+
+.fa-car-bolt:before {
+  content: "\e341";
+}
+
+.fa-arrows-maximize:before, .fa-expand-arrows:before {
+  content: "\f31d";
+}
+
+.fa-faucet:before {
+  content: "\e005";
+}
+
+.fa-cloud-sleet:before {
+  content: "\f741";
+}
+
+.fa-lamp-street:before {
+  content: "\e1c5";
+}
+
+.fa-list-radio:before {
+  content: "\e1d0";
+}
+
+.fa-pen-nib-slash:before {
+  content: "\e4a1";
+}
+
+.fa-baseball-bat-ball:before {
+  content: "\f432";
+}
+
+.fa-square-up-left:before {
+  content: "\e282";
+}
+
+.fa-overline:before {
+  content: "\f876";
+}
+
+.fa-s:before {
+  content: "\53";
+}
+
+.fa-timeline:before {
+  content: "\e29c";
+}
+
+.fa-keyboard:before {
+  content: "\f11c";
+}
+
+.fa-arrows-from-dotted-line:before {
+  content: "\e0a3";
+}
+
+.fa-usb-drive:before {
+  content: "\f8e9";
+}
+
+.fa-ballot:before {
+  content: "\f732";
+}
+
+.fa-caret-down:before {
+  content: "\f0d7";
+}
+
+.fa-location-dot-slash:before, .fa-map-marker-alt-slash:before {
+  content: "\f605";
+}
+
+.fa-cards:before {
+  content: "\e3ed";
+}
+
+.fa-clinic-medical:before, .fa-house-chimney-medical:before {
+  content: "\f7f2";
+}
+
+.fa-boxing-glove:before, .fa-glove-boxing:before {
+  content: "\f438";
+}
+
+.fa-temperature-3:before, .fa-temperature-three-quarters:before, .fa-thermometer-3:before, .fa-thermometer-three-quarters:before {
+  content: "\f2c8";
+}
+
+.fa-bell-school:before {
+  content: "\f5d5";
+}
+
+.fa-mobile-android-alt:before, .fa-mobile-screen:before {
+  content: "\f3cf";
+}
+
+.fa-plane-up:before {
+  content: "\e22d";
+}
+
+.fa-folder-heart:before {
+  content: "\e189";
+}
+
+.fa-circle-location-arrow:before, .fa-location-circle:before {
+  content: "\f602";
+}
+
+.fa-face-head-bandage:before {
+  content: "\e37a";
+}
+
+.fa-maki-roll:before, .fa-makizushi:before, .fa-sushi-roll:before {
+  content: "\e48b";
+}
+
+.fa-car-bump:before {
+  content: "\f5e0";
+}
+
+.fa-piggy-bank:before {
+  content: "\f4d3";
+}
+
+.fa-racquet:before {
+  content: "\f45a";
+}
+
+.fa-car-mirrors:before {
+  content: "\e343";
+}
+
+.fa-industry-alt:before, .fa-industry-windows:before {
+  content: "\f3b3";
+}
+
+.fa-bolt-auto:before {
+  content: "\e0b6";
+}
+
+.fa-battery-3:before, .fa-battery-half:before {
+  content: "\f242";
+}
+
+.fa-flux-capacitor:before {
+  content: "\f8ba";
+}
+
+.fa-mountain-city:before {
+  content: "\e52e";
+}
+
+.fa-coins:before {
+  content: "\f51e";
+}
+
+.fa-honey-pot:before {
+  content: "\e418";
+}
+
+.fa-olive:before {
+  content: "\e316";
+}
+
+.fa-khanda:before {
+  content: "\f66d";
+}
+
+.fa-filter-list:before {
+  content: "\e17c";
+}
+
+.fa-outlet:before {
+  content: "\e01c";
+}
+
+.fa-sliders-h:before, .fa-sliders:before {
+  content: "\f1de";
+}
+
+.fa-cauldron:before {
+  content: "\f6bf";
+}
+
+.fa-people:before {
+  content: "\e216";
+}
+
+.fa-folder-tree:before {
+  content: "\f802";
+}
+
+.fa-network-wired:before {
+  content: "\f6ff";
+}
+
+.fa-croissant:before {
+  content: "\f7f6";
+}
+
+.fa-map-pin:before {
+  content: "\f276";
+}
+
+.fa-hamsa:before {
+  content: "\f665";
+}
+
+.fa-cent-sign:before {
+  content: "\e3f5";
+}
+
+.fa-swords-laser:before {
+  content: "\e03d";
+}
+
+.fa-flask:before {
+  content: "\f0c3";
+}
+
+.fa-person-pregnant:before {
+  content: "\e31e";
+}
+
+.fa-square-u:before {
+  content: "\e281";
+}
+
+.fa-wand-sparkles:before {
+  content: "\f72b";
+}
+
+.fa-router:before {
+  content: "\f8da";
+}
+
+.fa-ellipsis-v:before, .fa-ellipsis-vertical:before {
+  content: "\f142";
+}
+
+.fa-sword-laser-alt:before {
+  content: "\e03c";
+}
+
+.fa-ticket:before {
+  content: "\f145";
+}
+
+.fa-power-off:before {
+  content: "\f011";
+}
+
+.fa-coin:before {
+  content: "\f85c";
+}
+
+.fa-laptop-slash:before {
+  content: "\e1c7";
+}
+
+.fa-long-arrow-alt-right:before, .fa-right-long:before {
+  content: "\f30b";
+}
+
+.fa-circle-b:before {
+  content: "\e0fd";
+}
+
+.fa-person-dress-simple:before {
+  content: "\e21c";
+}
+
+.fa-pipe-collar:before {
+  content: "\e437";
+}
+
+.fa-lights-holiday:before {
+  content: "\f7b2";
+}
+
+.fa-citrus:before {
+  content: "\e2f4";
+}
+
+.fa-flag-usa:before {
+  content: "\f74d";
+}
+
+.fa-laptop-file:before {
+  content: "\e51d";
+}
+
+.fa-teletype:before, .fa-tty:before {
+  content: "\f1e4";
+}
+
+.fa-chart-tree-map:before {
+  content: "\e0ea";
+}
+
+.fa-diagram-next:before {
+  content: "\e476";
+}
+
+.fa-person-rifle:before {
+  content: "\e54e";
+}
+
+.fa-clock-five-thirty:before {
+  content: "\e34a";
+}
+
+.fa-pipe-valve:before {
+  content: "\e439";
+}
+
+.fa-arrow-up-from-arc:before {
+  content: "\e4b4";
+}
+
+.fa-face-spiral-eyes:before {
+  content: "\e485";
+}
+
+.fa-compress-wide:before {
+  content: "\f326";
+}
+
+.fa-circle-phone-hangup:before, .fa-phone-circle-down:before {
+  content: "\e11d";
+}
+
+.fa-gear-complex-code:before {
+  content: "\e5eb";
+}
+
+.fa-house-medical-circle-exclamation:before {
+  content: "\e512";
+}
+
+.fa-badminton:before {
+  content: "\e33a";
+}
+
+.fa-closed-captioning:before {
+  content: "\f20a";
+}
+
+.fa-hiking:before, .fa-person-hiking:before {
+  content: "\f6ec";
+}
+
+.fa-arrow-alt-from-left:before, .fa-right-from-line:before {
+  content: "\f347";
+}
+
+.fa-venus-double:before {
+  content: "\f226";
+}
+
+.fa-images:before {
+  content: "\f302";
+}
+
+.fa-calculator:before {
+  content: "\f1ec";
+}
+
+.fa-shuttlecock:before {
+  content: "\f45b";
+}
+
+.fa-user-hair:before {
+  content: "\e45a";
+}
+
+.fa-eye-evil:before {
+  content: "\f6db";
+}
+
+.fa-people-pulling:before {
+  content: "\e535";
+}
+
+.fa-n:before {
+  content: "\4e";
+}
+
+.fa-swap:before {
+  content: "\e609";
+}
+
+.fa-garage:before {
+  content: "\e009";
+}
+
+.fa-cable-car:before, .fa-tram:before {
+  content: "\f7da";
+}
+
+.fa-shovel-snow:before {
+  content: "\f7c3";
+}
+
+.fa-cloud-rain:before {
+  content: "\f73d";
+}
+
+.fa-face-lying:before {
+  content: "\e37e";
+}
+
+.fa-sprinkler:before {
+  content: "\e035";
+}
+
+.fa-building-circle-xmark:before {
+  content: "\e4d4";
+}
+
+.fa-person-sledding:before, .fa-sledding:before {
+  content: "\f7cb";
+}
+
+.fa-game-console-handheld:before {
+  content: "\f8bb";
+}
+
+.fa-ship:before {
+  content: "\f21a";
+}
+
+.fa-clock-six-thirty:before {
+  content: "\e353";
+}
+
+.fa-battery-slash:before {
+  content: "\f377";
+}
+
+.fa-tugrik-sign:before {
+  content: "\e2ba";
+}
+
+.fa-arrows-down-to-line:before {
+  content: "\e4b8";
+}
+
+.fa-download:before {
+  content: "\f019";
+}
+
+.fa-angles-up-down:before {
+  content: "\e60d";
+}
+
+.fa-inventory:before, .fa-shelves:before {
+  content: "\f480";
+}
+
+.fa-cloud-snow:before {
+  content: "\f742";
+}
+
+.fa-face-grin:before, .fa-grin:before {
+  content: "\f580";
+}
+
+.fa-backspace:before, .fa-delete-left:before {
+  content: "\f55a";
+}
+
+.fa-oven:before {
+  content: "\e01d";
+}
+
+.fa-cloud-binary:before {
+  content: "\e601";
+}
+
+.fa-eye-dropper-empty:before, .fa-eye-dropper:before, .fa-eyedropper:before {
+  content: "\f1fb";
+}
+
+.fa-comment-captions:before {
+  content: "\e146";
+}
+
+.fa-comments-question:before {
+  content: "\e14e";
+}
+
+.fa-scribble:before {
+  content: "\e23f";
+}
+
+.fa-rotate-exclamation:before {
+  content: "\e23c";
+}
+
+.fa-file-circle-check:before {
+  content: "\e5a0";
+}
+
+.fa-glass:before {
+  content: "\f804";
+}
+
+.fa-loader:before {
+  content: "\e1d4";
+}
+
+.fa-forward:before {
+  content: "\f04e";
+}
+
+.fa-user-pilot:before {
+  content: "\e2c0";
+}
+
+.fa-mobile-android:before, .fa-mobile-phone:before, .fa-mobile:before {
+  content: "\f3ce";
+}
+
+.fa-code-pull-request-closed:before {
+  content: "\e3f9";
+}
+
+.fa-face-meh:before, .fa-meh:before {
+  content: "\f11a";
+}
+
+.fa-align-center:before {
+  content: "\f037";
+}
+
+.fa-book-dead:before, .fa-book-skull:before {
+  content: "\f6b7";
+}
+
+.fa-drivers-license:before, .fa-id-card:before {
+  content: "\f2c2";
+}
+
+.fa-face-dotted:before {
+  content: "\e47f";
+}
+
+.fa-face-worried:before {
+  content: "\e3a3";
+}
+
+.fa-dedent:before, .fa-outdent:before {
+  content: "\f03b";
+}
+
+.fa-court-sport:before {
+  content: "\e643";
+}
+
+.fa-heart-circle-exclamation:before {
+  content: "\e4fe";
+}
+
+.fa-home-alt:before, .fa-home-lg-alt:before, .fa-home:before, .fa-house:before {
+  content: "\f015";
+}
+
+.fa-vector-circle:before {
+  content: "\e2c6";
+}
+
+.fa-car-circle-bolt:before {
+  content: "\e342";
+}
+
+.fa-calendar-week:before {
+  content: "\f784";
+}
+
+.fa-flying-disc:before {
+  content: "\e3a9";
+}
+
+.fa-laptop-medical:before {
+  content: "\f812";
+}
+
+.fa-square-down-right:before {
+  content: "\e26c";
+}
+
+.fa-b:before {
+  content: "\42";
+}
+
+.fa-seat-airline:before {
+  content: "\e244";
+}
+
+.fa-eclipse-alt:before, .fa-moon-over-sun:before {
+  content: "\f74a";
+}
+
+.fa-pipe:before {
+  content: "\7c";
+}
+
+.fa-file-medical:before {
+  content: "\f477";
+}
+
+.fa-potato:before {
+  content: "\e440";
+}
+
+.fa-dice-one:before {
+  content: "\f525";
+}
+
+.fa-circle-a:before {
+  content: "\e0f7";
+}
+
+.fa-helmet-battle:before {
+  content: "\f6eb";
+}
+
+.fa-butter:before {
+  content: "\e3e4";
+}
+
+.fa-blanket-fire:before {
+  content: "\e3da";
+}
+
+.fa-kiwi-bird:before {
+  content: "\f535";
+}
+
+.fa-castle:before {
+  content: "\e0de";
+}
+
+.fa-golf-club:before {
+  content: "\f451";
+}
+
+.fa-arrow-right-arrow-left:before, .fa-exchange:before {
+  content: "\f0ec";
+}
+
+.fa-redo-alt:before, .fa-rotate-forward:before, .fa-rotate-right:before {
+  content: "\f2f9";
+}
+
+.fa-cutlery:before, .fa-utensils:before {
+  content: "\f2e7";
+}
+
+.fa-arrow-up-wide-short:before, .fa-sort-amount-up:before {
+  content: "\f161";
+}
+
+.fa-chart-pie-simple-circle-dollar:before {
+  content: "\e605";
+}
+
+.fa-balloons:before {
+  content: "\e2e4";
+}
+
+.fa-mill-sign:before {
+  content: "\e1ed";
+}
+
+.fa-bowl-rice:before {
+  content: "\e2eb";
+}
+
+.fa-timeline-arrow:before {
+  content: "\e29d";
+}
+
+.fa-skull:before {
+  content: "\f54c";
+}
+
+.fa-game-board-alt:before, .fa-game-board-simple:before {
+  content: "\f868";
+}
+
+.fa-circle-video:before, .fa-video-circle:before {
+  content: "\e12b";
+}
+
+.fa-chart-scatter-bubble:before {
+  content: "\e0e9";
+}
+
+.fa-house-turret:before {
+  content: "\e1b4";
+}
+
+.fa-banana:before {
+  content: "\e2e5";
+}
+
+.fa-hand-holding-skull:before {
+  content: "\e1a4";
+}
+
+.fa-people-dress:before {
+  content: "\e217";
+}
+
+.fa-couch-small:before, .fa-loveseat:before {
+  content: "\f4cc";
+}
+
+.fa-broadcast-tower:before, .fa-tower-broadcast:before {
+  content: "\f519";
+}
+
+.fa-truck-pickup:before {
+  content: "\f63c";
+}
+
+.fa-block-quote:before {
+  content: "\e0b5";
+}
+
+.fa-long-arrow-alt-up:before, .fa-up-long:before {
+  content: "\f30c";
+}
+
+.fa-stop:before {
+  content: "\f04d";
+}
+
+.fa-code-merge:before {
+  content: "\f387";
+}
+
+.fa-money-check-dollar-pen:before, .fa-money-check-edit-alt:before {
+  content: "\f873";
+}
+
+.fa-arrow-alt-from-bottom:before, .fa-up-from-line:before {
+  content: "\f346";
+}
+
+.fa-upload:before {
+  content: "\f093";
+}
+
+.fa-hurricane:before {
+  content: "\f751";
+}
+
+.fa-grid-round-2-plus:before {
+  content: "\e5dc";
+}
+
+.fa-people-pants:before {
+  content: "\e219";
+}
+
+.fa-mound:before {
+  content: "\e52d";
+}
+
+.fa-windsock:before {
+  content: "\f777";
+}
+
+.fa-circle-half:before {
+  content: "\e110";
+}
+
+.fa-brake-warning:before {
+  content: "\e0c7";
+}
+
+.fa-toilet-portable:before {
+  content: "\e583";
+}
+
+.fa-compact-disc:before {
+  content: "\f51f";
+}
+
+.fa-file-arrow-down:before, .fa-file-download:before {
+  content: "\f56d";
+}
+
+.fa-sax-hot:before, .fa-saxophone-fire:before {
+  content: "\f8db";
+}
+
+.fa-camera-web-slash:before, .fa-webcam-slash:before {
+  content: "\f833";
+}
+
+.fa-folder-medical:before {
+  content: "\e18c";
+}
+
+.fa-folder-cog:before, .fa-folder-gear:before {
+  content: "\e187";
+}
+
+.fa-hand-wave:before {
+  content: "\e1a7";
+}
+
+.fa-arrow-up-arrow-down:before, .fa-sort-up-down:before {
+  content: "\e099";
+}
+
+.fa-caravan:before {
+  content: "\f8ff";
+}
+
+.fa-shield-cat:before {
+  content: "\e572";
+}
+
+.fa-comment-alt-slash:before, .fa-message-slash:before {
+  content: "\f4a9";
+}
+
+.fa-bolt:before, .fa-zap:before {
+  content: "\f0e7";
+}
+
+.fa-trash-can-check:before {
+  content: "\e2a9";
+}
+
+.fa-glass-water:before {
+  content: "\e4f4";
+}
+
+.fa-oil-well:before {
+  content: "\e532";
+}
+
+.fa-person-simple:before {
+  content: "\e220";
+}
+
+.fa-arrow-turn-left-up:before {
+  content: "\e634";
+}
+
+.fa-vault:before {
+  content: "\e2c5";
+}
+
+.fa-mars:before {
+  content: "\f222";
+}
+
+.fa-toilet:before {
+  content: "\f7d8";
+}
+
+.fa-plane-circle-xmark:before {
+  content: "\e557";
+}
+
+.fa-cny:before, .fa-jpy:before, .fa-rmb:before, .fa-yen-sign:before, .fa-yen:before {
+  content: "\f157";
+}
+
+.fa-gear-code:before {
+  content: "\e5e8";
+}
+
+.fa-notes:before {
+  content: "\e202";
+}
+
+.fa-rouble:before, .fa-rub:before, .fa-ruble-sign:before, .fa-ruble:before {
+  content: "\f158";
+}
+
+.fa-trash-arrow-turn-left:before, .fa-trash-undo:before {
+  content: "\f895";
+}
+
+.fa-champagne-glass:before, .fa-glass-champagne:before {
+  content: "\f79e";
+}
+
+.fa-objects-align-center-horizontal:before {
+  content: "\e3bc";
+}
+
+.fa-sun:before {
+  content: "\f185";
+}
+
+.fa-trash-alt-slash:before, .fa-trash-can-slash:before {
+  content: "\e2ad";
+}
+
+.fa-screen-users:before, .fa-users-class:before {
+  content: "\f63d";
+}
+
+.fa-guitar:before {
+  content: "\f7a6";
+}
+
+.fa-arrow-square-left:before, .fa-square-arrow-left:before {
+  content: "\f33a";
+}
+
+.fa-square-8:before {
+  content: "\e25d";
+}
+
+.fa-face-smile-hearts:before {
+  content: "\e390";
+}
+
+.fa-brackets-square:before, .fa-brackets:before {
+  content: "\f7e9";
+}
+
+.fa-laptop-arrow-down:before {
+  content: "\e1c6";
+}
+
+.fa-hockey-stick-puck:before {
+  content: "\e3ae";
+}
+
+.fa-house-tree:before {
+  content: "\e1b3";
+}
+
+.fa-signal-2:before, .fa-signal-fair:before {
+  content: "\f68d";
+}
+
+.fa-face-laugh-wink:before, .fa-laugh-wink:before {
+  content: "\f59c";
+}
+
+.fa-circle-dollar:before, .fa-dollar-circle:before, .fa-usd-circle:before {
+  content: "\f2e8";
+}
+
+.fa-horse-head:before {
+  content: "\f7ab";
+}
+
+.fa-arrows-repeat:before, .fa-repeat-alt:before {
+  content: "\f364";
+}
+
+.fa-bore-hole:before {
+  content: "\e4c3";
+}
+
+.fa-industry:before {
+  content: "\f275";
+}
+
+.fa-image-polaroid:before {
+  content: "\f8c4";
+}
+
+.fa-wave-triangle:before {
+  content: "\f89a";
+}
+
+.fa-turn-left-down:before {
+  content: "\e637";
+}
+
+.fa-person-running-fast:before {
+  content: "\e5ff";
+}
+
+.fa-arrow-alt-circle-down:before, .fa-circle-down:before {
+  content: "\f358";
+}
+
+.fa-grill:before {
+  content: "\e5a3";
+}
+
+.fa-arrows-turn-to-dots:before {
+  content: "\e4c1";
+}
+
+.fa-analytics:before, .fa-chart-mixed:before {
+  content: "\f643";
+}
+
+.fa-florin-sign:before {
+  content: "\e184";
+}
+
+.fa-arrow-down-short-wide:before, .fa-sort-amount-desc:before, .fa-sort-amount-down-alt:before {
+  content: "\f884";
+}
+
+.fa-less-than:before {
+  content: "\3c";
+}
+
+.fa-desktop-code:before, .fa-display-code:before {
+  content: "\e165";
+}
+
+.fa-face-drooling:before {
+  content: "\e372";
+}
+
+.fa-oil-temp:before, .fa-oil-temperature:before {
+  content: "\f614";
+}
+
+.fa-question-square:before, .fa-square-question:before {
+  content: "\f2fd";
+}
+
+.fa-air-conditioner:before {
+  content: "\f8f4";
+}
+
+.fa-angle-down:before {
+  content: "\f107";
+}
+
+.fa-mountains:before {
+  content: "\f6fd";
+}
+
+.fa-omega:before {
+  content: "\f67a";
+}
+
+.fa-car-tunnel:before {
+  content: "\e4de";
+}
+
+.fa-person-dolly-empty:before {
+  content: "\f4d1";
+}
+
+.fa-pan-food:before {
+  content: "\e42b";
+}
+
+.fa-head-side-cough:before {
+  content: "\e061";
+}
+
+.fa-grip-lines:before {
+  content: "\f7a4";
+}
+
+.fa-thumbs-down:before {
+  content: "\f165";
+}
+
+.fa-user-lock:before {
+  content: "\f502";
+}
+
+.fa-arrow-right-long:before, .fa-long-arrow-right:before {
+  content: "\f178";
+}
+
+.fa-tickets-airline:before, .fa-tickets-perforated-plane:before, .fa-tickets-plane:before {
+  content: "\e29b";
+}
+
+.fa-tent-double-peak:before {
+  content: "\e627";
+}
+
+.fa-anchor-circle-xmark:before {
+  content: "\e4ac";
+}
+
+.fa-ellipsis-h:before, .fa-ellipsis:before {
+  content: "\f141";
+}
+
+.fa-nfc-slash:before {
+  content: "\e1fc";
+}
+
+.fa-chess-pawn:before {
+  content: "\f443";
+}
+
+.fa-first-aid:before, .fa-kit-medical:before {
+  content: "\f479";
+}
+
+.fa-grid-2-plus:before {
+  content: "\e197";
+}
+
+.fa-bells:before {
+  content: "\f77f";
+}
+
+.fa-person-through-window:before {
+  content: "\e5a9";
+}
+
+.fa-toolbox:before {
+  content: "\f552";
+}
+
+.fa-envelope-badge:before, .fa-envelope-dot:before {
+  content: "\e16f";
+}
+
+.fa-magnifying-glass-waveform:before {
+  content: "\e661";
+}
+
+.fa-hands-holding-circle:before {
+  content: "\e4fb";
+}
+
+.fa-bug:before {
+  content: "\f188";
+}
+
+.fa-bowl-chopsticks:before {
+  content: "\e2e9";
+}
+
+.fa-credit-card-alt:before, .fa-credit-card:before {
+  content: "\f09d";
+}
+
+.fa-circle-s:before {
+  content: "\e121";
+}
+
+.fa-box-ballot:before {
+  content: "\f735";
+}
+
+.fa-automobile:before, .fa-car:before {
+  content: "\f1b9";
+}
+
+.fa-hand-holding-hand:before {
+  content: "\e4f7";
+}
+
+.fa-user-tie-hair:before {
+  content: "\e45f";
+}
+
+.fa-podium-star:before {
+  content: "\f758";
+}
+
+.fa-business-front:before, .fa-party-back:before, .fa-trian-balbot:before, .fa-user-hair-mullet:before {
+  content: "\e45c";
+}
+
+.fa-microphone-stand:before {
+  content: "\f8cb";
+}
+
+.fa-book-open-reader:before, .fa-book-reader:before {
+  content: "\f5da";
+}
+
+.fa-family-dress:before {
+  content: "\e301";
+}
+
+.fa-circle-x:before {
+  content: "\e12e";
+}
+
+.fa-cabin:before {
+  content: "\e46d";
+}
+
+.fa-mountain-sun:before {
+  content: "\e52f";
+}
+
+.fa-chart-simple-horizontal:before {
+  content: "\e474";
+}
+
+.fa-arrows-left-right-to-line:before {
+  content: "\e4ba";
+}
+
+.fa-hand-back-point-left:before {
+  content: "\e19f";
+}
+
+.fa-comment-alt-dots:before, .fa-message-dots:before, .fa-messaging:before {
+  content: "\f4a3";
+}
+
+.fa-file-heart:before {
+  content: "\e176";
+}
+
+.fa-beer-foam:before, .fa-beer-mug:before {
+  content: "\e0b3";
+}
+
+.fa-dice-d20:before {
+  content: "\f6cf";
+}
+
+.fa-drone:before {
+  content: "\f85f";
+}
+
+.fa-truck-droplet:before {
+  content: "\e58c";
+}
+
+.fa-file-circle-xmark:before {
+  content: "\e5a1";
+}
+
+.fa-temperature-arrow-up:before, .fa-temperature-up:before {
+  content: "\e040";
+}
+
+.fa-medal:before {
+  content: "\f5a2";
+}
+
+.fa-person-fairy:before {
+  content: "\e608";
+}
+
+.fa-bed:before {
+  content: "\f236";
+}
+
+.fa-book-copy:before {
+  content: "\e0be";
+}
+
+.fa-h-square:before, .fa-square-h:before {
+  content: "\f0fd";
+}
+
+.fa-square-c:before {
+  content: "\e266";
+}
+
+.fa-clock-two:before {
+  content: "\e35a";
+}
+
+.fa-square-ellipsis-vertical:before {
+  content: "\e26f";
+}
+
+.fa-calendar-users:before {
+  content: "\e5e2";
+}
+
+.fa-podcast:before {
+  content: "\f2ce";
+}
+
+.fa-bee:before {
+  content: "\e0b2";
+}
+
+.fa-temperature-4:before, .fa-temperature-full:before, .fa-thermometer-4:before, .fa-thermometer-full:before {
+  content: "\f2c7";
+}
+
+.fa-bell:before {
+  content: "\f0f3";
+}
+
+.fa-candy-bar:before, .fa-chocolate-bar:before {
+  content: "\e3e8";
+}
+
+.fa-xmark-large:before {
+  content: "\e59b";
+}
+
+.fa-pinata:before {
+  content: "\e3c3";
+}
+
+.fa-file-ppt:before {
+  content: "\e64a";
+}
+
+.fa-arrows-from-line:before {
+  content: "\e0a4";
+}
+
+.fa-superscript:before {
+  content: "\f12b";
+}
+
+.fa-bowl-spoon:before {
+  content: "\e3e0";
+}
+
+.fa-hexagon-check:before {
+  content: "\e416";
+}
+
+.fa-plug-circle-xmark:before {
+  content: "\e560";
+}
+
+.fa-star-of-life:before {
+  content: "\f621";
+}
+
+.fa-phone-slash:before {
+  content: "\f3dd";
+}
+
+.fa-traffic-light-stop:before {
+  content: "\f63a";
+}
+
+.fa-paint-roller:before {
+  content: "\f5aa";
+}
+
+.fa-accent-grave:before {
+  content: "\60";
+}
+
+.fa-hands-helping:before, .fa-handshake-angle:before {
+  content: "\f4c4";
+}
+
+.fa-circle-0:before {
+  content: "\e0ed";
+}
+
+.fa-dial-med-low:before {
+  content: "\e160";
+}
+
+.fa-location-dot:before, .fa-map-marker-alt:before {
+  content: "\f3c5";
+}
+
+.fa-crab:before {
+  content: "\e3ff";
+}
+
+.fa-box-full:before, .fa-box-open-full:before {
+  content: "\f49c";
+}
+
+.fa-file:before {
+  content: "\f15b";
+}
+
+.fa-greater-than:before {
+  content: "\3e";
+}
+
+.fa-quotes:before {
+  content: "\e234";
+}
+
+.fa-pretzel:before {
+  content: "\e441";
+}
+
+.fa-t-rex:before {
+  content: "\e629";
+}
+
+.fa-person-swimming:before, .fa-swimmer:before {
+  content: "\f5c4";
+}
+
+.fa-arrow-down:before {
+  content: "\f063";
+}
+
+.fa-user-robot-xmarks:before {
+  content: "\e4a7";
+}
+
+.fa-comment-alt-quote:before, .fa-message-quote:before {
+  content: "\e1e4";
+}
+
+.fa-candy-corn:before {
+  content: "\f6bd";
+}
+
+.fa-folder-magnifying-glass:before, .fa-folder-search:before {
+  content: "\e18b";
+}
+
+.fa-notebook:before {
+  content: "\e201";
+}
+
+.fa-circle-wifi:before {
+  content: "\e67d";
+}
+
+.fa-droplet:before, .fa-tint:before {
+  content: "\f043";
+}
+
+.fa-bullseye-pointer:before {
+  content: "\f649";
+}
+
+.fa-eraser:before {
+  content: "\f12d";
+}
+
+.fa-hexagon-image:before {
+  content: "\e504";
+}
+
+.fa-earth-america:before, .fa-earth-americas:before, .fa-earth:before, .fa-globe-americas:before {
+  content: "\f57d";
+}
+
+.fa-file-svg:before {
+  content: "\e64b";
+}
+
+.fa-crate-apple:before {
+  content: "\f6b1";
+}
+
+.fa-apple-crate:before {
+  content: "\f6b1";
+}
+
+.fa-person-burst:before {
+  content: "\e53b";
+}
+
+.fa-game-board:before {
+  content: "\f867";
+}
+
+.fa-hat-chef:before {
+  content: "\f86b";
+}
+
+.fa-hand-back-point-right:before {
+  content: "\e1a1";
+}
+
+.fa-dove:before {
+  content: "\f4ba";
+}
+
+.fa-snowflake-droplets:before {
+  content: "\e5c1";
+}
+
+.fa-battery-0:before, .fa-battery-empty:before {
+  content: "\f244";
+}
+
+.fa-grid-4:before {
+  content: "\e198";
+}
+
+.fa-socks:before {
+  content: "\f696";
+}
+
+.fa-face-sunglasses:before {
+  content: "\e398";
+}
+
+.fa-inbox:before {
+  content: "\f01c";
+}
+
+.fa-square-0:before {
+  content: "\e255";
+}
+
+.fa-section:before {
+  content: "\e447";
+}
+
+.fa-box-up:before, .fa-square-this-way-up:before {
+  content: "\f49f";
+}
+
+.fa-gauge-high:before, .fa-tachometer-alt-fast:before, .fa-tachometer-alt:before {
+  content: "\f625";
+}
+
+.fa-square-ampersand:before {
+  content: "\e260";
+}
+
+.fa-envelope-open-text:before {
+  content: "\f658";
+}
+
+.fa-lamp-desk:before {
+  content: "\e014";
+}
+
+.fa-hospital-alt:before, .fa-hospital-wide:before, .fa-hospital:before {
+  content: "\f0f8";
+}
+
+.fa-poll-people:before {
+  content: "\f759";
+}
+
+.fa-glass-whiskey-rocks:before, .fa-whiskey-glass-ice:before {
+  content: "\f7a1";
+}
+
+.fa-wine-bottle:before {
+  content: "\f72f";
+}
+
+.fa-chess-rook:before {
+  content: "\f447";
+}
+
+.fa-user-bounty-hunter:before {
+  content: "\e2bf";
+}
+
+.fa-bars-staggered:before, .fa-reorder:before, .fa-stream:before {
+  content: "\f550";
+}
+
+.fa-diagram-sankey:before {
+  content: "\e158";
+}
+
+.fa-cloud-hail-mixed:before {
+  content: "\f73a";
+}
+
+.fa-circle-up-left:before {
+  content: "\e128";
+}
+
+.fa-dharmachakra:before {
+  content: "\f655";
+}
+
+.fa-objects-align-left:before {
+  content: "\e3be";
+}
+
+.fa-oil-can-drip:before {
+  content: "\e205";
+}
+
+.fa-face-smiling-hands:before {
+  content: "\e396";
+}
+
+.fa-broccoli:before {
+  content: "\e3e2";
+}
+
+.fa-route-interstate:before {
+  content: "\f61b";
+}
+
+.fa-ear-muffs:before {
+  content: "\f795";
+}
+
+.fa-hotdog:before {
+  content: "\f80f";
+}
+
+.fa-transporter-empty:before {
+  content: "\e046";
+}
+
+.fa-blind:before, .fa-person-walking-with-cane:before {
+  content: "\f29d";
+}
+
+.fa-angle-90:before {
+  content: "\e08d";
+}
+
+.fa-rectangle-terminal:before {
+  content: "\e236";
+}
+
+.fa-kite:before {
+  content: "\f6f4";
+}
+
+.fa-drum:before {
+  content: "\f569";
+}
+
+.fa-scrubber:before {
+  content: "\f2f8";
+}
+
+.fa-ice-cream:before {
+  content: "\f810";
+}
+
+.fa-heart-circle-bolt:before {
+  content: "\e4fc";
+}
+
+.fa-fish-bones:before {
+  content: "\e304";
+}
+
+.fa-deer-rudolph:before {
+  content: "\f78f";
+}
+
+.fa-fax:before {
+  content: "\f1ac";
+}
+
+.fa-paragraph:before {
+  content: "\f1dd";
+}
+
+.fa-head-side-heart:before {
+  content: "\e1aa";
+}
+
+.fa-square-e:before {
+  content: "\e26d";
+}
+
+.fa-meter-fire:before {
+  content: "\e1eb";
+}
+
+.fa-cloud-hail:before {
+  content: "\f739";
+}
+
+.fa-check-to-slot:before, .fa-vote-yea:before {
+  content: "\f772";
+}
+
+.fa-money-from-bracket:before {
+  content: "\e312";
+}
+
+.fa-star-half:before {
+  content: "\f089";
+}
+
+.fa-car-bus:before {
+  content: "\f85a";
+}
+
+.fa-speaker:before {
+  content: "\f8df";
+}
+
+.fa-timer:before {
+  content: "\e29e";
+}
+
+.fa-boxes-alt:before, .fa-boxes-stacked:before, .fa-boxes:before {
+  content: "\f468";
+}
+
+.fa-landmark-magnifying-glass:before {
+  content: "\e622";
+}
+
+.fa-grill-hot:before {
+  content: "\e5a5";
+}
+
+.fa-ballot-check:before {
+  content: "\f733";
+}
+
+.fa-chain:before, .fa-link:before {
+  content: "\f0c1";
+}
+
+.fa-assistive-listening-systems:before, .fa-ear-listen:before {
+  content: "\f2a2";
+}
+
+.fa-file-minus:before {
+  content: "\f318";
+}
+
+.fa-tree-city:before {
+  content: "\e587";
+}
+
+.fa-play:before {
+  content: "\f04b";
+}
+
+.fa-font:before {
+  content: "\f031";
+}
+
+.fa-coffee-togo:before, .fa-cup-togo:before {
+  content: "\f6c5";
+}
+
+.fa-square-down-left:before {
+  content: "\e26b";
+}
+
+.fa-burger-lettuce:before {
+  content: "\e3e3";
+}
+
+.fa-table-cells-row-lock:before {
+  content: "\e67a";
+}
+
+.fa-rupiah-sign:before {
+  content: "\e23d";
+}
+
+.fa-magnifying-glass:before, .fa-search:before {
+  content: "\f002";
+}
+
+.fa-ping-pong-paddle-ball:before, .fa-table-tennis-paddle-ball:before, .fa-table-tennis:before {
+  content: "\f45d";
+}
+
+.fa-diagnoses:before, .fa-person-dots-from-line:before {
+  content: "\f470";
+}
+
+.fa-chevron-double-down:before, .fa-chevrons-down:before {
+  content: "\f322";
+}
+
+.fa-trash-can-arrow-up:before, .fa-trash-restore-alt:before {
+  content: "\f82a";
+}
+
+.fa-signal-3:before, .fa-signal-good:before {
+  content: "\f68e";
+}
+
+.fa-location-question:before, .fa-map-marker-question:before {
+  content: "\f60b";
+}
+
+.fa-floppy-disk-circle-xmark:before, .fa-floppy-disk-times:before, .fa-save-circle-xmark:before, .fa-save-times:before {
+  content: "\e181";
+}
+
+.fa-naira-sign:before {
+  content: "\e1f6";
+}
+
+.fa-peach:before {
+  content: "\e20b";
+}
+
+.fa-taxi-bus:before {
+  content: "\e298";
+}
+
+.fa-bracket-curly-left:before, .fa-bracket-curly:before {
+  content: "\7b";
+}
+
+.fa-lobster:before {
+  content: "\e421";
+}
+
+.fa-cart-flatbed-empty:before, .fa-dolly-flatbed-empty:before {
+  content: "\f476";
+}
+
+.fa-colon:before {
+  content: "\3a";
+}
+
+.fa-cart-arrow-down:before {
+  content: "\f218";
+}
+
+.fa-wand:before {
+  content: "\f72a";
+}
+
+.fa-walkie-talkie:before {
+  content: "\f8ef";
+}
+
+.fa-file-edit:before, .fa-file-pen:before {
+  content: "\f31c";
+}
+
+.fa-receipt:before {
+  content: "\f543";
+}
+
+.fa-table-picnic:before {
+  content: "\e32d";
+}
+
+.fa-pen-square:before, .fa-pencil-square:before, .fa-square-pen:before {
+  content: "\f14b";
+}
+
+.fa-circle-microphone-lines:before, .fa-microphone-circle-alt:before {
+  content: "\e117";
+}
+
+.fa-desktop-slash:before, .fa-display-slash:before {
+  content: "\e2fa";
+}
+
+.fa-suitcase-rolling:before {
+  content: "\f5c1";
+}
+
+.fa-person-circle-exclamation:before {
+  content: "\e53f";
+}
+
+.fa-transporter-2:before {
+  content: "\e044";
+}
+
+.fa-hand-receiving:before, .fa-hands-holding-diamond:before {
+  content: "\f47c";
+}
+
+.fa-money-bill-simple-wave:before {
+  content: "\e1f2";
+}
+
+.fa-chevron-down:before {
+  content: "\f078";
+}
+
+.fa-battery-5:before, .fa-battery-full:before, .fa-battery:before {
+  content: "\f240";
+}
+
+.fa-bell-plus:before {
+  content: "\f849";
+}
+
+.fa-book-arrow-right:before {
+  content: "\e0b9";
+}
+
+.fa-hospitals:before {
+  content: "\f80e";
+}
+
+.fa-club:before {
+  content: "\f327";
+}
+
+.fa-skull-crossbones:before {
+  content: "\f714";
+}
+
+.fa-dewpoint:before, .fa-droplet-degree:before {
+  content: "\f748";
+}
+
+.fa-code-compare:before {
+  content: "\e13a";
+}
+
+.fa-list-dots:before, .fa-list-ul:before {
+  content: "\f0ca";
+}
+
+.fa-hand-holding-magic:before {
+  content: "\f6e5";
+}
+
+.fa-watermelon-slice:before {
+  content: "\e337";
+}
+
+.fa-circle-ellipsis:before {
+  content: "\e10a";
+}
+
+.fa-school-lock:before {
+  content: "\e56f";
+}
+
+.fa-tower-cell:before {
+  content: "\e585";
+}
+
+.fa-sd-cards:before {
+  content: "\e240";
+}
+
+.fa-jug-bottle:before {
+  content: "\e5fb";
+}
+
+.fa-down-long:before, .fa-long-arrow-alt-down:before {
+  content: "\f309";
+}
+
+.fa-envelopes:before {
+  content: "\e170";
+}
+
+.fa-phone-office:before {
+  content: "\f67d";
+}
+
+.fa-ranking-star:before {
+  content: "\e561";
+}
+
+.fa-chess-king:before {
+  content: "\f43f";
+}
+
+.fa-nfc-pen:before {
+  content: "\e1fa";
+}
+
+.fa-person-harassing:before {
+  content: "\e549";
+}
+
+.fa-magnifying-glass-play:before {
+  content: "\e660";
+}
+
+.fa-hat-winter:before {
+  content: "\f7a8";
+}
+
+.fa-brazilian-real-sign:before {
+  content: "\e46c";
+}
+
+.fa-landmark-alt:before, .fa-landmark-dome:before {
+  content: "\f752";
+}
+
+.fa-bone-break:before {
+  content: "\f5d8";
+}
+
+.fa-arrow-up:before {
+  content: "\f062";
+}
+
+.fa-down-from-dotted-line:before {
+  content: "\e407";
+}
+
+.fa-television:before, .fa-tv-alt:before, .fa-tv:before {
+  content: "\f26c";
+}
+
+.fa-border-left:before {
+  content: "\f84f";
+}
+
+.fa-circle-divide:before {
+  content: "\e106";
+}
+
+.fa-shrimp:before {
+  content: "\e448";
+}
+
+.fa-list-check:before, .fa-tasks:before {
+  content: "\f0ae";
+}
+
+.fa-diagram-subtask:before {
+  content: "\e479";
+}
+
+.fa-jug-detergent:before {
+  content: "\e519";
+}
+
+.fa-circle-user:before, .fa-user-circle:before {
+  content: "\f2bd";
+}
+
+.fa-square-y:before {
+  content: "\e287";
+}
+
+.fa-user-doctor-hair:before {
+  content: "\e458";
+}
+
+.fa-planet-ringed:before {
+  content: "\e020";
+}
+
+.fa-mushroom:before {
+  content: "\e425";
+}
+
+.fa-user-shield:before {
+  content: "\f505";
+}
+
+.fa-megaphone:before {
+  content: "\f675";
+}
+
+.fa-wreath-laurel:before {
+  content: "\e5d2";
+}
+
+.fa-circle-exclamation-check:before {
+  content: "\e10d";
+}
+
+.fa-wind:before {
+  content: "\f72e";
+}
+
+.fa-box-dollar:before, .fa-box-usd:before {
+  content: "\f4a0";
+}
+
+.fa-car-burst:before, .fa-car-crash:before {
+  content: "\f5e1";
+}
+
+.fa-y:before {
+  content: "\59";
+}
+
+.fa-user-headset:before {
+  content: "\f82d";
+}
+
+.fa-arrows-retweet:before, .fa-retweet-alt:before {
+  content: "\f361";
+}
+
+.fa-person-snowboarding:before, .fa-snowboarding:before {
+  content: "\f7ce";
+}
+
+.fa-chevron-square-right:before, .fa-square-chevron-right:before {
+  content: "\f32b";
+}
+
+.fa-lacrosse-stick-ball:before {
+  content: "\e3b6";
+}
+
+.fa-shipping-fast:before, .fa-truck-fast:before {
+  content: "\f48b";
+}
+
+.fa-user-magnifying-glass:before {
+  content: "\e5c5";
+}
+
+.fa-star-sharp:before {
+  content: "\e28b";
+}
+
+.fa-comment-heart:before {
+  content: "\e5c8";
+}
+
+.fa-circle-1:before {
+  content: "\e0ee";
+}
+
+.fa-circle-star:before, .fa-star-circle:before {
+  content: "\e123";
+}
+
+.fa-fish:before {
+  content: "\f578";
+}
+
+.fa-cloud-fog:before, .fa-fog:before {
+  content: "\f74e";
+}
+
+.fa-waffle:before {
+  content: "\e466";
+}
+
+.fa-music-alt:before, .fa-music-note:before {
+  content: "\f8cf";
+}
+
+.fa-hexagon-exclamation:before {
+  content: "\e417";
+}
+
+.fa-cart-shopping-fast:before {
+  content: "\e0dc";
+}
+
+.fa-object-union:before {
+  content: "\e49f";
+}
+
+.fa-user-graduate:before {
+  content: "\f501";
+}
+
+.fa-starfighter:before {
+  content: "\e037";
+}
+
+.fa-adjust:before, .fa-circle-half-stroke:before {
+  content: "\f042";
+}
+
+.fa-arrow-right-long-to-line:before {
+  content: "\e3d5";
+}
+
+.fa-arrow-square-down:before, .fa-square-arrow-down:before {
+  content: "\f339";
+}
+
+.fa-diamond-half-stroke:before {
+  content: "\e5b8";
+}
+
+.fa-clapperboard:before {
+  content: "\e131";
+}
+
+.fa-chevron-square-left:before, .fa-square-chevron-left:before {
+  content: "\f32a";
+}
+
+.fa-phone-intercom:before {
+  content: "\e434";
+}
+
+.fa-chain-horizontal:before, .fa-link-horizontal:before {
+  content: "\e1cb";
+}
+
+.fa-mango:before {
+  content: "\e30f";
+}
+
+.fa-music-alt-slash:before, .fa-music-note-slash:before {
+  content: "\f8d0";
+}
+
+.fa-circle-radiation:before, .fa-radiation-alt:before {
+  content: "\f7ba";
+}
+
+.fa-face-tongue-sweat:before {
+  content: "\e39e";
+}
+
+.fa-globe-stand:before {
+  content: "\f5f6";
+}
+
+.fa-baseball-ball:before, .fa-baseball:before {
+  content: "\f433";
+}
+
+.fa-circle-p:before {
+  content: "\e11a";
+}
+
+.fa-award-simple:before {
+  content: "\e0ab";
+}
+
+.fa-jet-fighter-up:before {
+  content: "\e518";
+}
+
+.fa-diagram-project:before, .fa-project-diagram:before {
+  content: "\f542";
+}
+
+.fa-pedestal:before {
+  content: "\e20d";
+}
+
+.fa-chart-pyramid:before {
+  content: "\e0e6";
+}
+
+.fa-sidebar:before {
+  content: "\e24e";
+}
+
+.fa-frosty-head:before, .fa-snowman-head:before {
+  content: "\f79b";
+}
+
+.fa-copy:before {
+  content: "\f0c5";
+}
+
+.fa-burger-glass:before {
+  content: "\e0ce";
+}
+
+.fa-volume-mute:before, .fa-volume-times:before, .fa-volume-xmark:before {
+  content: "\f6a9";
+}
+
+.fa-hand-sparkles:before {
+  content: "\e05d";
+}
+
+.fa-bars-filter:before {
+  content: "\e0ad";
+}
+
+.fa-paintbrush-pencil:before {
+  content: "\e206";
+}
+
+.fa-party-bell:before {
+  content: "\e31a";
+}
+
+.fa-user-vneck-hair:before {
+  content: "\e462";
+}
+
+.fa-jack-o-lantern:before {
+  content: "\f30e";
+}
+
+.fa-grip-horizontal:before, .fa-grip:before {
+  content: "\f58d";
+}
+
+.fa-share-from-square:before, .fa-share-square:before {
+  content: "\f14d";
+}
+
+.fa-keynote:before {
+  content: "\f66c";
+}
+
+.fa-child-combatant:before, .fa-child-rifle:before {
+  content: "\e4e0";
+}
+
+.fa-gun:before {
+  content: "\e19b";
+}
+
+.fa-phone-square:before, .fa-square-phone:before {
+  content: "\f098";
+}
+
+.fa-hat-beach:before {
+  content: "\e606";
+}
+
+.fa-add:before, .fa-plus:before {
+  content: "\2b";
+}
+
+.fa-expand:before {
+  content: "\f065";
+}
+
+.fa-computer:before {
+  content: "\e4e5";
+}
+
+.fa-fort:before {
+  content: "\e486";
+}
+
+.fa-cloud-check:before {
+  content: "\e35c";
+}
+
+.fa-close:before, .fa-multiply:before, .fa-remove:before, .fa-times:before, .fa-xmark:before {
+  content: "\f00d";
+}
+
+.fa-face-smirking:before {
+  content: "\e397";
+}
+
+.fa-arrows-up-down-left-right:before, .fa-arrows:before {
+  content: "\f047";
+}
+
+.fa-chalkboard-teacher:before, .fa-chalkboard-user:before {
+  content: "\f51c";
+}
+
+.fa-rhombus:before {
+  content: "\e23b";
+}
+
+.fa-claw-marks:before {
+  content: "\f6c2";
+}
+
+.fa-peso-sign:before {
+  content: "\e222";
+}
+
+.fa-face-smile-tongue:before {
+  content: "\e394";
+}
+
+.fa-cart-circle-xmark:before {
+  content: "\e3f4";
+}
+
+.fa-building-shield:before {
+  content: "\e4d8";
+}
+
+.fa-circle-phone-flip:before, .fa-phone-circle-alt:before {
+  content: "\e11c";
+}
+
+.fa-baby:before {
+  content: "\f77c";
+}
+
+.fa-users-line:before {
+  content: "\e592";
+}
+
+.fa-quote-left-alt:before, .fa-quote-left:before {
+  content: "\f10d";
+}
+
+.fa-tractor:before {
+  content: "\f722";
+}
+
+.fa-down-from-bracket:before {
+  content: "\e66b";
+}
+
+.fa-key-skeleton:before {
+  content: "\f6f3";
+}
+
+.fa-trash-arrow-up:before, .fa-trash-restore:before {
+  content: "\f829";
+}
+
+.fa-arrow-down-up-lock:before {
+  content: "\e4b0";
+}
+
+.fa-arrow-down-to-bracket:before {
+  content: "\e094";
+}
+
+.fa-lines-leaning:before {
+  content: "\e51e";
+}
+
+.fa-square-q:before {
+  content: "\e27b";
+}
+
+.fa-ruler-combined:before {
+  content: "\f546";
+}
+
+.fa-icons-alt:before, .fa-symbols:before {
+  content: "\f86e";
+}
+
+.fa-copyright:before {
+  content: "\f1f9";
+}
+
+.fa-flask-gear:before {
+  content: "\e5f1";
+}
+
+.fa-highlighter-line:before {
+  content: "\e1af";
+}
+
+.fa-bracket-left:before, .fa-bracket-square:before, .fa-bracket:before {
+  content: "\5b";
+}
+
+.fa-island-tree-palm:before, .fa-island-tropical:before {
+  content: "\f811";
+}
+
+.fa-arrow-from-left:before, .fa-arrow-right-from-line:before {
+  content: "\f343";
+}
+
+.fa-h2:before {
+  content: "\f314";
+}
+
+.fa-equals:before {
+  content: "\3d";
+}
+
+.fa-cake-slice:before, .fa-shortcake:before {
+  content: "\e3e5";
+}
+
+.fa-building-magnifying-glass:before {
+  content: "\e61c";
+}
+
+.fa-peanut:before {
+  content: "\e430";
+}
+
+.fa-wrench-simple:before {
+  content: "\e2d1";
+}
+
+.fa-blender:before {
+  content: "\f517";
+}
+
+.fa-teeth:before {
+  content: "\f62e";
+}
+
+.fa-tally-2:before {
+  content: "\e295";
+}
+
+.fa-ils:before, .fa-shekel-sign:before, .fa-shekel:before, .fa-sheqel-sign:before, .fa-sheqel:before {
+  content: "\f20b";
+}
+
+.fa-cars:before {
+  content: "\f85b";
+}
+
+.fa-axe-battle:before {
+  content: "\f6b3";
+}
+
+.fa-user-hair-long:before {
+  content: "\e45b";
+}
+
+.fa-map:before {
+  content: "\f279";
+}
+
+.fa-arrow-left-from-arc:before {
+  content: "\e615";
+}
+
+.fa-file-circle-info:before {
+  content: "\e493";
+}
+
+.fa-face-disappointed:before {
+  content: "\e36f";
+}
+
+.fa-lasso-sparkles:before {
+  content: "\e1c9";
+}
+
+.fa-clock-eleven:before {
+  content: "\e347";
+}
+
+.fa-rocket:before {
+  content: "\f135";
+}
+
+.fa-siren-on:before {
+  content: "\e02e";
+}
+
+.fa-clock-ten:before {
+  content: "\e354";
+}
+
+.fa-candle-holder:before {
+  content: "\f6bc";
+}
+
+.fa-video-arrow-down-left:before {
+  content: "\e2c8";
+}
+
+.fa-photo-film:before, .fa-photo-video:before {
+  content: "\f87c";
+}
+
+.fa-floppy-disk-circle-arrow-right:before, .fa-save-circle-arrow-right:before {
+  content: "\e180";
+}
+
+.fa-folder-minus:before {
+  content: "\f65d";
+}
+
+.fa-planet-moon:before {
+  content: "\e01f";
+}
+
+.fa-face-eyes-xmarks:before {
+  content: "\e374";
+}
+
+.fa-chart-scatter:before {
+  content: "\f7ee";
+}
+
+.fa-circle-gf:before {
+  content: "\e67f";
+}
+
+.fa-display-arrow-down:before {
+  content: "\e164";
+}
+
+.fa-store:before {
+  content: "\f54e";
+}
+
+.fa-arrow-trend-up:before {
+  content: "\e098";
+}
+
+.fa-plug-circle-minus:before {
+  content: "\e55e";
+}
+
+.fa-olive-branch:before {
+  content: "\e317";
+}
+
+.fa-angle:before {
+  content: "\e08c";
+}
+
+.fa-vacuum-robot:before {
+  content: "\e04e";
+}
+
+.fa-sign-hanging:before, .fa-sign:before {
+  content: "\f4d9";
+}
+
+.fa-square-divide:before {
+  content: "\e26a";
+}
+
+.fa-folder-check:before {
+  content: "\e64e";
+}
+
+.fa-signal-stream-slash:before {
+  content: "\e250";
+}
+
+.fa-bezier-curve:before {
+  content: "\f55b";
+}
+
+.fa-eye-dropper-half:before {
+  content: "\e173";
+}
+
+.fa-store-lock:before {
+  content: "\e4a6";
+}
+
+.fa-bell-slash:before {
+  content: "\f1f6";
+}
+
+.fa-cloud-bolt-sun:before, .fa-thunderstorm-sun:before {
+  content: "\f76e";
+}
+
+.fa-camera-slash:before {
+  content: "\e0d9";
+}
+
+.fa-comment-quote:before {
+  content: "\e14c";
+}
+
+.fa-tablet-android:before, .fa-tablet:before {
+  content: "\f3fb";
+}
+
+.fa-school-flag:before {
+  content: "\e56e";
+}
+
+.fa-message-code:before {
+  content: "\e1df";
+}
+
+.fa-glass-half-empty:before, .fa-glass-half-full:before, .fa-glass-half:before {
+  content: "\e192";
+}
+
+.fa-fill:before {
+  content: "\f575";
+}
+
+.fa-comment-alt-minus:before, .fa-message-minus:before {
+  content: "\f4a7";
+}
+
+.fa-angle-up:before {
+  content: "\f106";
+}
+
+.fa-dinosaur:before {
+  content: "\e5fe";
+}
+
+.fa-drumstick-bite:before {
+  content: "\f6d7";
+}
+
+.fa-chain-horizontal-slash:before, .fa-link-horizontal-slash:before {
+  content: "\e1cc";
+}
+
+.fa-holly-berry:before {
+  content: "\f7aa";
+}
+
+.fa-nose:before {
+  content: "\e5bd";
+}
+
+.fa-arrow-left-to-arc:before {
+  content: "\e616";
+}
+
+.fa-chevron-left:before {
+  content: "\f053";
+}
+
+.fa-bacteria:before {
+  content: "\e059";
+}
+
+.fa-clouds:before {
+  content: "\f744";
+}
+
+.fa-money-bill-simple:before {
+  content: "\e1f1";
+}
+
+.fa-hand-lizard:before {
+  content: "\f258";
+}
+
+.fa-table-pivot:before {
+  content: "\e291";
+}
+
+.fa-filter-slash:before {
+  content: "\e17d";
+}
+
+.fa-trash-can-arrow-turn-left:before, .fa-trash-can-undo:before, .fa-trash-undo-alt:before {
+  content: "\f896";
+}
+
+.fa-notdef:before {
+  content: "\e1fe";
+}
+
+.fa-disease:before {
+  content: "\f7fa";
+}
+
+.fa-person-to-door:before {
+  content: "\e433";
+}
+
+.fa-turntable:before {
+  content: "\f8e4";
+}
+
+.fa-briefcase-medical:before {
+  content: "\f469";
+}
+
+.fa-genderless:before {
+  content: "\f22d";
+}
+
+.fa-chevron-right:before {
+  content: "\f054";
+}
+
+.fa-signal-1:before, .fa-signal-weak:before {
+  content: "\f68c";
+}
+
+.fa-clock-five:before {
+  content: "\e349";
+}
+
+.fa-retweet:before {
+  content: "\f079";
+}
+
+.fa-car-alt:before, .fa-car-rear:before {
+  content: "\f5de";
+}
+
+.fa-pump-soap:before {
+  content: "\e06b";
+}
+
+.fa-computer-classic:before {
+  content: "\f8b1";
+}
+
+.fa-frame:before {
+  content: "\e495";
+}
+
+.fa-video-slash:before {
+  content: "\f4e2";
+}
+
+.fa-battery-2:before, .fa-battery-quarter:before {
+  content: "\f243";
+}
+
+.fa-ellipsis-h-alt:before, .fa-ellipsis-stroke:before {
+  content: "\f39b";
+}
+
+.fa-radio:before {
+  content: "\f8d7";
+}
+
+.fa-baby-carriage:before, .fa-carriage-baby:before {
+  content: "\f77d";
+}
+
+.fa-face-expressionless:before {
+  content: "\e373";
+}
+
+.fa-down-to-dotted-line:before {
+  content: "\e408";
+}
+
+.fa-cloud-music:before {
+  content: "\f8ae";
+}
+
+.fa-traffic-light:before {
+  content: "\f637";
+}
+
+.fa-cloud-minus:before {
+  content: "\e35d";
+}
+
+.fa-thermometer:before {
+  content: "\f491";
+}
+
+.fa-shield-minus:before {
+  content: "\e249";
+}
+
+.fa-vr-cardboard:before {
+  content: "\f729";
+}
+
+.fa-car-tilt:before {
+  content: "\f5e5";
+}
+
+.fa-gauge-circle-minus:before {
+  content: "\e497";
+}
+
+.fa-brightness-low:before {
+  content: "\e0ca";
+}
+
+.fa-hand-middle-finger:before {
+  content: "\f806";
+}
+
+.fa-percent:before, .fa-percentage:before {
+  content: "\25";
+}
+
+.fa-truck-moving:before {
+  content: "\f4df";
+}
+
+.fa-glass-water-droplet:before {
+  content: "\e4f5";
+}
+
+.fa-conveyor-belt:before {
+  content: "\f46e";
+}
+
+.fa-location-check:before, .fa-map-marker-check:before {
+  content: "\f606";
+}
+
+.fa-coin-vertical:before {
+  content: "\e3fd";
+}
+
+.fa-display:before {
+  content: "\e163";
+}
+
+.fa-person-sign:before {
+  content: "\f757";
+}
+
+.fa-face-smile:before, .fa-smile:before {
+  content: "\f118";
+}
+
+.fa-phone-hangup:before {
+  content: "\e225";
+}
+
+.fa-signature-slash:before {
+  content: "\e3cb";
+}
+
+.fa-thumb-tack:before, .fa-thumbtack:before {
+  content: "\f08d";
+}
+
+.fa-wheat-slash:before {
+  content: "\e339";
+}
+
+.fa-trophy:before {
+  content: "\f091";
+}
+
+.fa-clouds-sun:before {
+  content: "\f746";
+}
+
+.fa-person-praying:before, .fa-pray:before {
+  content: "\f683";
+}
+
+.fa-hammer:before {
+  content: "\f6e3";
+}
+
+.fa-face-vomit:before {
+  content: "\e3a0";
+}
+
+.fa-speakers:before {
+  content: "\f8e0";
+}
+
+.fa-teletype-answer:before, .fa-tty-answer:before {
+  content: "\e2b9";
+}
+
+.fa-mug-tea-saucer:before {
+  content: "\e1f5";
+}
+
+.fa-diagram-lean-canvas:before {
+  content: "\e156";
+}
+
+.fa-alt:before {
+  content: "\e08a";
+}
+
+.fa-dial-med-high:before, .fa-dial:before {
+  content: "\e15b";
+}
+
+.fa-hand-peace:before {
+  content: "\f25b";
+}
+
+.fa-circle-trash:before, .fa-trash-circle:before {
+  content: "\e126";
+}
+
+.fa-rotate:before, .fa-sync-alt:before {
+  content: "\f2f1";
+}
+
+.fa-circle-quarters:before {
+  content: "\e3f8";
+}
+
+.fa-spinner:before {
+  content: "\f110";
+}
+
+.fa-tower-control:before {
+  content: "\e2a2";
+}
+
+.fa-arrow-up-triangle-square:before, .fa-sort-shapes-up:before {
+  content: "\f88a";
+}
+
+.fa-whale:before {
+  content: "\f72c";
+}
+
+.fa-robot:before {
+  content: "\f544";
+}
+
+.fa-peace:before {
+  content: "\f67c";
+}
+
+.fa-party-horn:before {
+  content: "\e31b";
+}
+
+.fa-cogs:before, .fa-gears:before {
+  content: "\f085";
+}
+
+.fa-sun-alt:before, .fa-sun-bright:before {
+  content: "\e28f";
+}
+
+.fa-warehouse:before {
+  content: "\f494";
+}
+
+.fa-conveyor-belt-arm:before {
+  content: "\e5f8";
+}
+
+.fa-lock-keyhole-open:before, .fa-lock-open-alt:before {
+  content: "\f3c2";
+}
+
+.fa-box-fragile:before, .fa-square-fragile:before, .fa-square-wine-glass-crack:before {
+  content: "\f49b";
+}
+
+.fa-arrow-up-right-dots:before {
+  content: "\e4b7";
+}
+
+.fa-square-n:before {
+  content: "\e277";
+}
+
+.fa-splotch:before {
+  content: "\f5bc";
+}
+
+.fa-face-grin-hearts:before, .fa-grin-hearts:before {
+  content: "\f584";
+}
+
+.fa-meter:before {
+  content: "\e1e8";
+}
+
+.fa-mandolin:before {
+  content: "\f6f9";
+}
+
+.fa-dice-four:before {
+  content: "\f524";
+}
+
+.fa-sim-card:before {
+  content: "\f7c4";
+}
+
+.fa-transgender-alt:before, .fa-transgender:before {
+  content: "\f225";
+}
+
+.fa-mercury:before {
+  content: "\f223";
+}
+
+.fa-up-from-bracket:before {
+  content: "\e590";
+}
+
+.fa-knife-kitchen:before {
+  content: "\f6f5";
+}
+
+.fa-border-right:before {
+  content: "\f852";
+}
+
+.fa-arrow-turn-down:before, .fa-level-down:before {
+  content: "\f149";
+}
+
+.fa-spade:before {
+  content: "\f2f4";
+}
+
+.fa-card-spade:before {
+  content: "\e3ec";
+}
+
+.fa-line-columns:before {
+  content: "\f870";
+}
+
+.fa-ant:before {
+  content: "\e680";
+}
+
+.fa-arrow-right-to-line:before, .fa-arrow-to-right:before {
+  content: "\f340";
+}
+
+.fa-person-falling-burst:before {
+  content: "\e547";
+}
+
+.fa-flag-pennant:before, .fa-pennant:before {
+  content: "\f456";
+}
+
+.fa-conveyor-belt-empty:before {
+  content: "\e150";
+}
+
+.fa-user-group-simple:before {
+  content: "\e603";
+}
+
+.fa-award:before {
+  content: "\f559";
+}
+
+.fa-ticket-alt:before, .fa-ticket-simple:before {
+  content: "\f3ff";
+}
+
+.fa-building:before {
+  content: "\f1ad";
+}
+
+.fa-angle-double-left:before, .fa-angles-left:before {
+  content: "\f100";
+}
+
+.fa-camcorder:before, .fa-video-handheld:before {
+  content: "\f8a8";
+}
+
+.fa-pancakes:before {
+  content: "\e42d";
+}
+
+.fa-album-circle-user:before {
+  content: "\e48d";
+}
+
+.fa-subtitles-slash:before {
+  content: "\e610";
+}
+
+.fa-qrcode:before {
+  content: "\f029";
+}
+
+.fa-dice-d10:before {
+  content: "\f6cd";
+}
+
+.fa-fireplace:before {
+  content: "\f79a";
+}
+
+.fa-browser:before {
+  content: "\f37e";
+}
+
+.fa-pen-paintbrush:before, .fa-pencil-paintbrush:before {
+  content: "\f618";
+}
+
+.fa-fish-cooked:before {
+  content: "\f7fe";
+}
+
+.fa-chair-office:before {
+  content: "\f6c1";
+}
+
+.fa-magnifying-glass-music:before {
+  content: "\e65f";
+}
+
+.fa-nesting-dolls:before {
+  content: "\e3ba";
+}
+
+.fa-clock-rotate-left:before, .fa-history:before {
+  content: "\f1da";
+}
+
+.fa-trumpet:before {
+  content: "\f8e3";
+}
+
+.fa-face-grin-beam-sweat:before, .fa-grin-beam-sweat:before {
+  content: "\f583";
+}
+
+.fa-fire-smoke:before {
+  content: "\f74b";
+}
+
+.fa-phone-missed:before {
+  content: "\e226";
+}
+
+.fa-arrow-right-from-file:before, .fa-file-export:before {
+  content: "\f56e";
+}
+
+.fa-shield-blank:before, .fa-shield:before {
+  content: "\f132";
+}
+
+.fa-arrow-up-short-wide:before, .fa-sort-amount-up-alt:before {
+  content: "\f885";
+}
+
+.fa-arrows-repeat-1:before, .fa-repeat-1-alt:before {
+  content: "\f366";
+}
+
+.fa-gun-slash:before {
+  content: "\e19c";
+}
+
+.fa-avocado:before {
+  content: "\e0aa";
+}
+
+.fa-binary:before {
+  content: "\e33b";
+}
+
+.fa-glasses-alt:before, .fa-glasses-round:before {
+  content: "\f5f5";
+}
+
+.fa-phone-plus:before {
+  content: "\f4d2";
+}
+
+.fa-ditto:before {
+  content: "\22";
+}
+
+.fa-person-seat:before {
+  content: "\e21e";
+}
+
+.fa-house-medical:before {
+  content: "\e3b2";
+}
+
+.fa-golf-ball-tee:before, .fa-golf-ball:before {
+  content: "\f450";
+}
+
+.fa-chevron-circle-left:before, .fa-circle-chevron-left:before {
+  content: "\f137";
+}
+
+.fa-house-chimney-window:before {
+  content: "\e00d";
+}
+
+.fa-scythe:before {
+  content: "\f710";
+}
+
+.fa-pen-nib:before {
+  content: "\f5ad";
+}
+
+.fa-ban-parking:before, .fa-parking-circle-slash:before {
+  content: "\f616";
+}
+
+.fa-tent-arrow-turn-left:before {
+  content: "\e580";
+}
+
+.fa-face-diagonal-mouth:before {
+  content: "\e47e";
+}
+
+.fa-diagram-cells:before {
+  content: "\e475";
+}
+
+.fa-cricket-bat-ball:before, .fa-cricket:before {
+  content: "\f449";
+}
+
+.fa-tents:before {
+  content: "\e582";
+}
+
+.fa-magic:before, .fa-wand-magic:before {
+  content: "\f0d0";
+}
+
+.fa-dog:before {
+  content: "\f6d3";
+}
+
+.fa-pen-line:before {
+  content: "\e212";
+}
+
+.fa-atom-alt:before, .fa-atom-simple:before {
+  content: "\f5d3";
+}
+
+.fa-ampersand:before {
+  content: "\26";
+}
+
+.fa-carrot:before {
+  content: "\f787";
+}
+
+.fa-arrow-from-bottom:before, .fa-arrow-up-from-line:before {
+  content: "\f342";
+}
+
+.fa-moon:before {
+  content: "\f186";
+}
+
+.fa-pen-slash:before {
+  content: "\e213";
+}
+
+.fa-wine-glass-alt:before, .fa-wine-glass-empty:before {
+  content: "\f5ce";
+}
+
+.fa-square-star:before {
+  content: "\e27f";
+}
+
+.fa-cheese:before {
+  content: "\f7ef";
+}
+
+.fa-send-backward:before {
+  content: "\f87f";
+}
+
+.fa-yin-yang:before {
+  content: "\f6ad";
+}
+
+.fa-music:before {
+  content: "\f001";
+}
+
+.fa-compass-slash:before {
+  content: "\f5e9";
+}
+
+.fa-clock-one:before {
+  content: "\e34e";
+}
+
+.fa-file-music:before {
+  content: "\f8b6";
+}
+
+.fa-code-commit:before {
+  content: "\f386";
+}
+
+.fa-temperature-low:before {
+  content: "\f76b";
+}
+
+.fa-biking:before, .fa-person-biking:before {
+  content: "\f84a";
+}
+
+.fa-display-chart-up-circle-currency:before {
+  content: "\e5e5";
+}
+
+.fa-skeleton:before {
+  content: "\f620";
+}
+
+.fa-circle-g:before {
+  content: "\e10f";
+}
+
+.fa-circle-arrow-up-left:before {
+  content: "\e0fb";
+}
+
+.fa-coin-blank:before {
+  content: "\e3fb";
+}
+
+.fa-broom:before {
+  content: "\f51a";
+}
+
+.fa-vacuum:before {
+  content: "\e04d";
+}
+
+.fa-shield-heart:before {
+  content: "\e574";
+}
+
+.fa-card-heart:before {
+  content: "\e3eb";
+}
+
+.fa-lightbulb-cfl-on:before {
+  content: "\e5a7";
+}
+
+.fa-melon:before {
+  content: "\e310";
+}
+
+.fa-gopuram:before {
+  content: "\f664";
+}
+
+.fa-earth-oceania:before, .fa-globe-oceania:before {
+  content: "\e47b";
+}
+
+.fa-container-storage:before {
+  content: "\f4b7";
+}
+
+.fa-face-pouting:before {
+  content: "\e387";
+}
+
+.fa-square-xmark:before, .fa-times-square:before, .fa-xmark-square:before {
+  content: "\f2d3";
+}
+
+.fa-exploding-head:before, .fa-face-explode:before {
+  content: "\e2fe";
+}
+
+.fa-hashtag:before {
+  content: "\23";
+}
+
+.fa-expand-alt:before, .fa-up-right-and-down-left-from-center:before {
+  content: "\f424";
+}
+
+.fa-oil-can:before {
+  content: "\f613";
+}
+
+.fa-t:before {
+  content: "\54";
+}
+
+.fa-transformer-bolt:before {
+  content: "\e2a4";
+}
+
+.fa-hippo:before {
+  content: "\f6ed";
+}
+
+.fa-chart-column:before {
+  content: "\e0e3";
+}
+
+.fa-cassette-vhs:before, .fa-vhs:before {
+  content: "\f8ec";
+}
+
+.fa-infinity:before {
+  content: "\f534";
+}
+
+.fa-vial-circle-check:before {
+  content: "\e596";
+}
+
+.fa-chimney:before {
+  content: "\f78b";
+}
+
+.fa-object-intersect:before {
+  content: "\e49d";
+}
+
+.fa-person-arrow-down-to-line:before {
+  content: "\e538";
+}
+
+.fa-voicemail:before {
+  content: "\f897";
+}
+
+.fa-block-brick:before, .fa-wall-brick:before {
+  content: "\e3db";
+}
+
+.fa-fan:before {
+  content: "\f863";
+}
+
+.fa-bags-shopping:before {
+  content: "\f847";
+}
+
+.fa-paragraph-left:before, .fa-paragraph-rtl:before {
+  content: "\f878";
+}
+
+.fa-person-walking-luggage:before {
+  content: "\e554";
+}
+
+.fa-caravan-alt:before, .fa-caravan-simple:before {
+  content: "\e000";
+}
+
+.fa-turtle:before {
+  content: "\f726";
+}
+
+.fa-pencil-mechanical:before {
+  content: "\e5ca";
+}
+
+.fa-arrows-alt-v:before, .fa-up-down:before {
+  content: "\f338";
+}
+
+.fa-cloud-moon-rain:before {
+  content: "\f73c";
+}
+
+.fa-booth-curtain:before {
+  content: "\f734";
+}
+
+.fa-calendar:before {
+  content: "\f133";
+}
+
+.fa-box-heart:before {
+  content: "\f49d";
+}
+
+.fa-trailer:before {
+  content: "\e041";
+}
+
+.fa-user-doctor-message:before, .fa-user-md-chat:before {
+  content: "\f82e";
+}
+
+.fa-bahai:before, .fa-haykal:before {
+  content: "\f666";
+}
+
+.fa-lighthouse:before {
+  content: "\e612";
+}
+
+.fa-amp-guitar:before {
+  content: "\f8a1";
+}
+
+.fa-sd-card:before {
+  content: "\f7c2";
+}
+
+.fa-volume-slash:before {
+  content: "\f2e2";
+}
+
+.fa-border-bottom:before {
+  content: "\f84d";
+}
+
+.fa-wifi-1:before, .fa-wifi-weak:before {
+  content: "\f6aa";
+}
+
+.fa-dragon:before {
+  content: "\f6d5";
+}
+
+.fa-shoe-prints:before {
+  content: "\f54b";
+}
+
+.fa-circle-plus:before, .fa-plus-circle:before {
+  content: "\f055";
+}
+
+.fa-face-grin-tongue-wink:before, .fa-grin-tongue-wink:before {
+  content: "\f58b";
+}
+
+.fa-hand-holding:before {
+  content: "\f4bd";
+}
+
+.fa-plug-circle-exclamation:before {
+  content: "\e55d";
+}
+
+.fa-chain-broken:before, .fa-chain-slash:before, .fa-link-slash:before, .fa-unlink:before {
+  content: "\f127";
+}
+
+.fa-clone:before {
+  content: "\f24d";
+}
+
+.fa-person-walking-arrow-loop-left:before {
+  content: "\e551";
+}
+
+.fa-arrow-up-z-a:before, .fa-sort-alpha-up-alt:before {
+  content: "\f882";
+}
+
+.fa-fire-alt:before, .fa-fire-flame-curved:before {
+  content: "\f7e4";
+}
+
+.fa-tornado:before {
+  content: "\f76f";
+}
+
+.fa-file-circle-plus:before {
+  content: "\e494";
+}
+
+.fa-delete-right:before {
+  content: "\e154";
+}
+
+.fa-book-quran:before, .fa-quran:before {
+  content: "\f687";
+}
+
+.fa-circle-quarter:before {
+  content: "\e11f";
+}
+
+.fa-anchor:before {
+  content: "\f13d";
+}
+
+.fa-border-all:before {
+  content: "\f84c";
+}
+
+.fa-function:before {
+  content: "\f661";
+}
+
+.fa-angry:before, .fa-face-angry:before {
+  content: "\f556";
+}
+
+.fa-people-simple:before {
+  content: "\e21b";
+}
+
+.fa-cookie-bite:before {
+  content: "\f564";
+}
+
+.fa-arrow-trend-down:before {
+  content: "\e097";
+}
+
+.fa-feed:before, .fa-rss:before {
+  content: "\f09e";
+}
+
+.fa-face-monocle:before {
+  content: "\e380";
+}
+
+.fa-draw-polygon:before {
+  content: "\f5ee";
+}
+
+.fa-balance-scale:before, .fa-scale-balanced:before {
+  content: "\f24e";
+}
+
+.fa-calendar-lines:before, .fa-calendar-note:before {
+  content: "\e0d5";
+}
+
+.fa-arrow-down-big-small:before, .fa-sort-size-down:before {
+  content: "\f88c";
+}
+
+.fa-gauge-simple-high:before, .fa-tachometer-fast:before, .fa-tachometer:before {
+  content: "\f62a";
+}
+
+.fa-do-not-enter:before {
+  content: "\f5ec";
+}
+
+.fa-shower:before {
+  content: "\f2cc";
+}
+
+.fa-dice-d8:before {
+  content: "\f6d2";
+}
+
+.fa-desktop-alt:before, .fa-desktop:before {
+  content: "\f390";
+}
+
+.fa-m:before {
+  content: "\4d";
+}
+
+.fa-spinner-scale:before {
+  content: "\e62a";
+}
+
+.fa-grip-dots-vertical:before {
+  content: "\e411";
+}
+
+.fa-face-viewfinder:before {
+  content: "\e2ff";
+}
+
+.fa-creemee:before, .fa-soft-serve:before {
+  content: "\e400";
+}
+
+.fa-h5:before {
+  content: "\e412";
+}
+
+.fa-hand-back-point-down:before {
+  content: "\e19e";
+}
+
+.fa-table-list:before, .fa-th-list:before {
+  content: "\f00b";
+}
+
+.fa-basket-shopping-minus:before {
+  content: "\e652";
+}
+
+.fa-comment-sms:before, .fa-sms:before {
+  content: "\f7cd";
+}
+
+.fa-rectangle-landscape:before, .fa-rectangle:before {
+  content: "\f2fa";
+}
+
+.fa-clipboard-list-check:before {
+  content: "\f737";
+}
+
+.fa-turkey:before {
+  content: "\f725";
+}
+
+.fa-book:before {
+  content: "\f02d";
+}
+
+.fa-user-plus:before {
+  content: "\f234";
+}
+
+.fa-ice-skate:before {
+  content: "\f7ac";
+}
+
+.fa-check:before {
+  content: "\f00c";
+}
+
+.fa-battery-4:before, .fa-battery-three-quarters:before {
+  content: "\f241";
+}
+
+.fa-tomato:before {
+  content: "\e330";
+}
+
+.fa-sword-laser:before {
+  content: "\e03b";
+}
+
+.fa-house-circle-check:before {
+  content: "\e509";
+}
+
+.fa-buildings:before {
+  content: "\e0cc";
+}
+
+.fa-angle-left:before {
+  content: "\f104";
+}
+
+.fa-cart-flatbed-boxes:before, .fa-dolly-flatbed-alt:before {
+  content: "\f475";
+}
+
+.fa-diagram-successor:before {
+  content: "\e47a";
+}
+
+.fa-truck-arrow-right:before {
+  content: "\e58b";
+}
+
+.fa-square-w:before {
+  content: "\e285";
+}
+
+.fa-arrows-split-up-and-left:before {
+  content: "\e4bc";
+}
+
+.fa-lamp:before {
+  content: "\f4ca";
+}
+
+.fa-airplay:before {
+  content: "\e089";
+}
+
+.fa-fist-raised:before, .fa-hand-fist:before {
+  content: "\f6de";
+}
+
+.fa-shield-quartered:before {
+  content: "\e575";
+}
+
+.fa-slash-forward:before {
+  content: "\2f";
+}
+
+.fa-location-pen:before, .fa-map-marker-edit:before {
+  content: "\f607";
+}
+
+.fa-cloud-moon:before {
+  content: "\f6c3";
+}
+
+.fa-pot-food:before {
+  content: "\e43f";
+}
+
+.fa-briefcase:before {
+  content: "\f0b1";
+}
+
+.fa-person-falling:before {
+  content: "\e546";
+}
+
+.fa-image-portrait:before, .fa-portrait:before {
+  content: "\f3e0";
+}
+
+.fa-user-tag:before {
+  content: "\f507";
+}
+
+.fa-rug:before {
+  content: "\e569";
+}
+
+.fa-print-slash:before {
+  content: "\f686";
+}
+
+.fa-earth-europe:before, .fa-globe-europe:before {
+  content: "\f7a2";
+}
+
+.fa-cart-flatbed-suitcase:before, .fa-luggage-cart:before {
+  content: "\f59d";
+}
+
+.fa-hand-back-point-ribbon:before {
+  content: "\e1a0";
+}
+
+.fa-rectangle-times:before, .fa-rectangle-xmark:before, .fa-times-rectangle:before, .fa-window-close:before {
+  content: "\f410";
+}
+
+.fa-tire-rugged:before {
+  content: "\f634";
+}
+
+.fa-lightbulb-dollar:before {
+  content: "\f670";
+}
+
+.fa-cowbell:before {
+  content: "\f8b3";
+}
+
+.fa-baht-sign:before {
+  content: "\e0ac";
+}
+
+.fa-corner:before {
+  content: "\e3fe";
+}
+
+.fa-chevron-double-right:before, .fa-chevrons-right:before {
+  content: "\f324";
+}
+
+.fa-book-open:before {
+  content: "\f518";
+}
+
+.fa-book-journal-whills:before, .fa-journal-whills:before {
+  content: "\f66a";
+}
+
+.fa-inhaler:before {
+  content: "\f5f9";
+}
+
+.fa-handcuffs:before {
+  content: "\e4f8";
+}
+
+.fa-snake:before {
+  content: "\f716";
+}
+
+.fa-exclamation-triangle:before, .fa-triangle-exclamation:before, .fa-warning:before {
+  content: "\f071";
+}
+
+.fa-note-medical:before {
+  content: "\e200";
+}
+
+.fa-database:before {
+  content: "\f1c0";
+}
+
+.fa-down-left:before {
+  content: "\e16a";
+}
+
+.fa-mail-forward:before, .fa-share:before {
+  content: "\f064";
+}
+
+.fa-face-thinking:before {
+  content: "\e39b";
+}
+
+.fa-turn-down-right:before {
+  content: "\e455";
+}
+
+.fa-bottle-droplet:before {
+  content: "\e4c4";
+}
+
+.fa-mask-face:before {
+  content: "\e1d7";
+}
+
+.fa-hill-rockslide:before {
+  content: "\e508";
+}
+
+.fa-scanner-keyboard:before {
+  content: "\f489";
+}
+
+.fa-circle-o:before {
+  content: "\e119";
+}
+
+.fa-grid-horizontal:before {
+  content: "\e307";
+}
+
+.fa-comment-alt-dollar:before, .fa-message-dollar:before {
+  content: "\f650";
+}
+
+.fa-exchange-alt:before, .fa-right-left:before {
+  content: "\f362";
+}
+
+.fa-columns-3:before {
+  content: "\e361";
+}
+
+.fa-paper-plane:before {
+  content: "\f1d8";
+}
+
+.fa-road-circle-exclamation:before {
+  content: "\e565";
+}
+
+.fa-dungeon:before {
+  content: "\f6d9";
+}
+
+.fa-hand-holding-box:before {
+  content: "\f47b";
+}
+
+.fa-input-text:before {
+  content: "\e1bf";
+}
+
+.fa-window-alt:before, .fa-window-flip:before {
+  content: "\f40f";
+}
+
+.fa-align-right:before {
+  content: "\f038";
+}
+
+.fa-scanner-gun:before, .fa-scanner:before {
+  content: "\f488";
+}
+
+.fa-tire:before {
+  content: "\f631";
+}
+
+.fa-engine:before {
+  content: "\e16e";
+}
+
+.fa-money-bill-1-wave:before, .fa-money-bill-wave-alt:before {
+  content: "\f53b";
+}
+
+.fa-life-ring:before {
+  content: "\f1cd";
+}
+
+.fa-hands:before, .fa-sign-language:before, .fa-signing:before {
+  content: "\f2a7";
+}
+
+.fa-caret-circle-right:before, .fa-circle-caret-right:before {
+  content: "\f330";
+}
+
+.fa-turn-left:before {
+  content: "\e636";
+}
+
+.fa-wheat:before {
+  content: "\f72d";
+}
+
+.fa-file-spreadsheet:before {
+  content: "\f65b";
+}
+
+.fa-audio-description-slash:before {
+  content: "\e0a8";
+}
+
+.fa-bell-ring:before {
+  content: "\e62c";
+}
+
+.fa-calendar-day:before {
+  content: "\f783";
+}
+
+.fa-ladder-water:before, .fa-swimming-pool:before, .fa-water-ladder:before {
+  content: "\f5c5";
+}
+
+.fa-arrows-up-down:before, .fa-arrows-v:before {
+  content: "\f07d";
+}
+
+.fa-chess-pawn-alt:before, .fa-chess-pawn-piece:before {
+  content: "\f444";
+}
+
+.fa-face-grimace:before, .fa-grimace:before {
+  content: "\f57f";
+}
+
+.fa-wheelchair-alt:before, .fa-wheelchair-move:before {
+  content: "\e2ce";
+}
+
+.fa-level-down-alt:before, .fa-turn-down:before {
+  content: "\f3be";
+}
+
+.fa-square-s:before {
+  content: "\e27d";
+}
+
+.fa-barcode-alt:before, .fa-rectangle-barcode:before {
+  content: "\f463";
+}
+
+.fa-person-walking-arrow-right:before {
+  content: "\e552";
+}
+
+.fa-envelope-square:before, .fa-square-envelope:before {
+  content: "\f199";
+}
+
+.fa-dice:before {
+  content: "\f522";
+}
+
+.fa-unicorn:before {
+  content: "\f727";
+}
+
+.fa-bowling-ball:before {
+  content: "\f436";
+}
+
+.fa-pompebled:before {
+  content: "\e43d";
+}
+
+.fa-brain:before {
+  content: "\f5dc";
+}
+
+.fa-watch-smart:before {
+  content: "\e2cc";
+}
+
+.fa-book-user:before {
+  content: "\f7e7";
+}
+
+.fa-sensor-cloud:before, .fa-sensor-smoke:before {
+  content: "\e02c";
+}
+
+.fa-clapperboard-play:before {
+  content: "\e132";
+}
+
+.fa-band-aid:before, .fa-bandage:before {
+  content: "\f462";
+}
+
+.fa-calendar-minus:before {
+  content: "\f272";
+}
+
+.fa-circle-xmark:before, .fa-times-circle:before, .fa-xmark-circle:before {
+  content: "\f057";
+}
+
+.fa-circle-4:before {
+  content: "\e0f1";
+}
+
+.fa-gifts:before {
+  content: "\f79c";
+}
+
+.fa-album-collection:before {
+  content: "\f8a0";
+}
+
+.fa-hotel:before {
+  content: "\f594";
+}
+
+.fa-earth-asia:before, .fa-globe-asia:before {
+  content: "\f57e";
+}
+
+.fa-id-card-alt:before, .fa-id-card-clip:before {
+  content: "\f47f";
+}
+
+.fa-magnifying-glass-plus:before, .fa-search-plus:before {
+  content: "\f00e";
+}
+
+.fa-thumbs-up:before {
+  content: "\f164";
+}
+
+.fa-cloud-showers:before {
+  content: "\f73f";
+}
+
+.fa-user-clock:before {
+  content: "\f4fd";
+}
+
+.fa-onion:before {
+  content: "\e427";
+}
+
+.fa-clock-twelve-thirty:before {
+  content: "\e359";
+}
+
+.fa-arrow-down-to-dotted-line:before {
+  content: "\e095";
+}
+
+.fa-allergies:before, .fa-hand-dots:before {
+  content: "\f461";
+}
+
+.fa-file-invoice:before {
+  content: "\f570";
+}
+
+.fa-window-minimize:before {
+  content: "\f2d1";
+}
+
+.fa-rectangle-wide:before {
+  content: "\f2fc";
+}
+
+.fa-comment-arrow-up:before {
+  content: "\e144";
+}
+
+.fa-garlic:before {
+  content: "\e40e";
+}
+
+.fa-coffee:before, .fa-mug-saucer:before {
+  content: "\f0f4";
+}
+
+.fa-brush:before {
+  content: "\f55d";
+}
+
+.fa-tree-decorated:before {
+  content: "\f7dc";
+}
+
+.fa-mask:before {
+  content: "\f6fa";
+}
+
+.fa-calendar-heart:before {
+  content: "\e0d3";
+}
+
+.fa-magnifying-glass-minus:before, .fa-search-minus:before {
+  content: "\f010";
+}
+
+.fa-flower:before {
+  content: "\f7ff";
+}
+
+.fa-arrow-down-from-arc:before {
+  content: "\e614";
+}
+
+.fa-right-left-large:before {
+  content: "\e5e1";
+}
+
+.fa-ruler-vertical:before {
+  content: "\f548";
+}
+
+.fa-circles-overlap:before {
+  content: "\e600";
+}
+
+.fa-user-alt:before, .fa-user-large:before {
+  content: "\f406";
+}
+
+.fa-starship-freighter:before {
+  content: "\e03a";
+}
+
+.fa-train-tram:before {
+  content: "\e5b4";
+}
+
+.fa-bridge-suspension:before {
+  content: "\e4cd";
+}
+
+.fa-trash-check:before {
+  content: "\e2af";
+}
+
+.fa-user-nurse:before {
+  content: "\f82f";
+}
+
+.fa-boombox:before {
+  content: "\f8a5";
+}
+
+.fa-syringe:before {
+  content: "\f48e";
+}
+
+.fa-cloud-sun:before {
+  content: "\f6c4";
+}
+
+.fa-shield-exclamation:before {
+  content: "\e247";
+}
+
+.fa-stopwatch-20:before {
+  content: "\e06f";
+}
+
+.fa-square-full:before {
+  content: "\f45c";
+}
+
+.fa-grip-dots:before {
+  content: "\e410";
+}
+
+.fa-comment-exclamation:before {
+  content: "\f4af";
+}
+
+.fa-pen-swirl:before {
+  content: "\e214";
+}
+
+.fa-falafel:before {
+  content: "\e40a";
+}
+
+.fa-circle-2:before {
+  content: "\e0ef";
+}
+
+.fa-magnet:before {
+  content: "\f076";
+}
+
+.fa-jar:before {
+  content: "\e516";
+}
+
+.fa-gramophone:before {
+  content: "\f8bd";
+}
+
+.fa-dice-d12:before {
+  content: "\f6ce";
+}
+
+.fa-note-sticky:before, .fa-sticky-note:before {
+  content: "\f249";
+}
+
+.fa-arrow-alt-down:before, .fa-down:before {
+  content: "\f354";
+}
+
+.fa-100:before, .fa-hundred-points:before {
+  content: "\e41c";
+}
+
+.fa-paperclip-vertical:before {
+  content: "\e3c2";
+}
+
+.fa-wind-circle-exclamation:before, .fa-wind-warning:before {
+  content: "\f776";
+}
+
+.fa-location-pin-slash:before, .fa-map-marker-slash:before {
+  content: "\f60c";
+}
+
+.fa-face-sad-sweat:before {
+  content: "\e38a";
+}
+
+.fa-bug-slash:before {
+  content: "\e490";
+}
+
+.fa-cupcake:before {
+  content: "\e402";
+}
+
+.fa-light-switch-off:before {
+  content: "\e018";
+}
+
+.fa-toggle-large-off:before {
+  content: "\e5b0";
+}
+
+.fa-pen-fancy-slash:before {
+  content: "\e210";
+}
+
+.fa-truck-container:before {
+  content: "\f4dc";
+}
+
+.fa-boot:before {
+  content: "\f782";
+}
+
+.fa-arrow-up-from-water-pump:before {
+  content: "\e4b6";
+}
+
+.fa-file-check:before {
+  content: "\f316";
+}
+
+.fa-bone:before {
+  content: "\f5d7";
+}
+
+.fa-cards-blank:before {
+  content: "\e4df";
+}
+
+.fa-circle-3:before {
+  content: "\e0f0";
+}
+
+.fa-bench-tree:before {
+  content: "\e2e7";
+}
+
+.fa-keyboard-brightness-low:before {
+  content: "\e1c1";
+}
+
+.fa-ski-boot-ski:before {
+  content: "\e3cd";
+}
+
+.fa-brain-circuit:before {
+  content: "\e0c6";
+}
+
+.fa-user-injured:before {
+  content: "\f728";
+}
+
+.fa-block-brick-fire:before, .fa-firewall:before {
+  content: "\e3dc";
+}
+
+.fa-face-sad-tear:before, .fa-sad-tear:before {
+  content: "\f5b4";
+}
+
+.fa-plane:before {
+  content: "\f072";
+}
+
+.fa-tent-arrows-down:before {
+  content: "\e581";
+}
+
+.fa-exclamation:before {
+  content: "\21";
+}
+
+.fa-arrows-spin:before {
+  content: "\e4bb";
+}
+
+.fa-face-smile-relaxed:before {
+  content: "\e392";
+}
+
+.fa-comment-times:before, .fa-comment-xmark:before {
+  content: "\f4b5";
+}
+
+.fa-print:before {
+  content: "\f02f";
+}
+
+.fa-try:before, .fa-turkish-lira-sign:before, .fa-turkish-lira:before {
+  content: "\e2bb";
+}
+
+.fa-face-nose-steam:before {
+  content: "\e382";
+}
+
+.fa-circle-waveform-lines:before, .fa-waveform-circle:before {
+  content: "\e12d";
+}
+
+.fa-dollar-sign:before, .fa-dollar:before, .fa-usd:before {
+  content: "\24";
+}
+
+.fa-ferris-wheel:before {
+  content: "\e174";
+}
+
+.fa-computer-speaker:before {
+  content: "\f8b2";
+}
+
+.fa-skull-cow:before {
+  content: "\f8de";
+}
+
+.fa-x:before {
+  content: "\58";
+}
+
+.fa-magnifying-glass-dollar:before, .fa-search-dollar:before {
+  content: "\f688";
+}
+
+.fa-users-cog:before, .fa-users-gear:before {
+  content: "\f509";
+}
+
+.fa-person-military-pointing:before {
+  content: "\e54a";
+}
+
+.fa-bank:before, .fa-building-columns:before, .fa-institution:before, .fa-museum:before, .fa-university:before {
+  content: "\f19c";
+}
+
+.fa-circle-t:before {
+  content: "\e124";
+}
+
+.fa-sack:before {
+  content: "\f81c";
+}
+
+.fa-grid-2:before {
+  content: "\e196";
+}
+
+.fa-camera-cctv:before, .fa-cctv:before {
+  content: "\f8ac";
+}
+
+.fa-umbrella:before {
+  content: "\f0e9";
+}
+
+.fa-trowel:before {
+  content: "\e589";
+}
+
+.fa-horizontal-rule:before {
+  content: "\f86c";
+}
+
+.fa-bed-alt:before, .fa-bed-front:before {
+  content: "\f8f7";
+}
+
+.fa-d:before {
+  content: "\44";
+}
+
+.fa-stapler:before {
+  content: "\e5af";
+}
+
+.fa-masks-theater:before, .fa-theater-masks:before {
+  content: "\f630";
+}
+
+.fa-file-gif:before {
+  content: "\e645";
+}
+
+.fa-kip-sign:before {
+  content: "\e1c4";
+}
+
+.fa-face-woozy:before {
+  content: "\e3a2";
+}
+
+.fa-cloud-question:before {
+  content: "\e492";
+}
+
+.fa-pineapple:before {
+  content: "\e31f";
+}
+
+.fa-hand-point-left:before {
+  content: "\f0a5";
+}
+
+.fa-gallery-thumbnails:before {
+  content: "\e3aa";
+}
+
+.fa-circle-j:before {
+  content: "\e112";
+}
+
+.fa-eyes:before {
+  content: "\e367";
+}
+
+.fa-handshake-alt:before, .fa-handshake-simple:before {
+  content: "\f4c6";
+}
+
+.fa-file-caret-up:before, .fa-page-caret-up:before {
+  content: "\e42a";
+}
+
+.fa-fighter-jet:before, .fa-jet-fighter:before {
+  content: "\f0fb";
+}
+
+.fa-comet:before {
+  content: "\e003";
+}
+
+.fa-share-alt-square:before, .fa-square-share-nodes:before {
+  content: "\f1e1";
+}
+
+.fa-reflect-vertical:before {
+  content: "\e665";
+}
+
+.fa-shield-keyhole:before {
+  content: "\e248";
+}
+
+.fa-file-mp4:before {
+  content: "\e649";
+}
+
+.fa-barcode:before {
+  content: "\f02a";
+}
+
+.fa-bulldozer:before {
+  content: "\e655";
+}
+
+.fa-plus-minus:before {
+  content: "\e43c";
+}
+
+.fa-sliders-v-square:before, .fa-square-sliders-vertical:before {
+  content: "\f3f2";
+}
+
+.fa-video-camera:before, .fa-video:before {
+  content: "\f03d";
+}
+
+.fa-comment-middle-alt:before, .fa-message-middle:before {
+  content: "\e1e1";
+}
+
+.fa-graduation-cap:before, .fa-mortar-board:before {
+  content: "\f19d";
+}
+
+.fa-hand-holding-medical:before {
+  content: "\e05c";
+}
+
+.fa-person-circle-check:before {
+  content: "\e53e";
+}
+
+.fa-square-z:before {
+  content: "\e288";
+}
+
+.fa-comment-alt-text:before, .fa-message-text:before {
+  content: "\e1e6";
+}
+
+.fa-level-up-alt:before, .fa-turn-up:before {
+  content: "\f3bf";
+}
+
+.fa-sr-only, .fa-sr-only-focusable:not(:focus), .sr-only, .sr-only-focusable:not(:focus) {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  margin: -1px;
+  overflow: hidden;
+  clip: rect(0,0,0,0);
+  white-space: nowrap;
+  border-width: 0;
+}
+
+:host, :root {
+  --fa-style-family-brands: "Font Awesome 6 Brands";
+  --fa-font-brands: normal 400 1em/1 "Font Awesome 6 Brands";
+}
+
+.fa-brands, .fab {
+  font-weight: 400;
+}
+
+.fa-monero:before {
+  content: "\f3d0";
+}
+
+.fa-hooli:before {
+  content: "\f427";
+}
+
+.fa-yelp:before {
+  content: "\f1e9";
+}
+
+.fa-cc-visa:before {
+  content: "\f1f0";
+}
+
+.fa-lastfm:before {
+  content: "\f202";
+}
+
+.fa-shopware:before {
+  content: "\f5b5";
+}
+
+.fa-creative-commons-nc:before {
+  content: "\f4e8";
+}
+
+.fa-aws:before {
+  content: "\f375";
+}
+
+.fa-redhat:before {
+  content: "\f7bc";
+}
+
+.fa-yoast:before {
+  content: "\f2b1";
+}
+
+.fa-cloudflare:before {
+  content: "\e07d";
+}
+
+.fa-ups:before {
+  content: "\f7e0";
+}
+
+.fa-pixiv:before {
+  content: "\e640";
+}
+
+.fa-wpexplorer:before {
+  content: "\f2de";
+}
+
+.fa-dyalog:before {
+  content: "\f399";
+}
+
+.fa-bity:before {
+  content: "\f37a";
+}
+
+.fa-stackpath:before {
+  content: "\f842";
+}
+
+.fa-buysellads:before {
+  content: "\f20d";
+}
+
+.fa-first-order:before {
+  content: "\f2b0";
+}
+
+.fa-modx:before {
+  content: "\f285";
+}
+
+.fa-guilded:before {
+  content: "\e07e";
+}
+
+.fa-vnv:before {
+  content: "\f40b";
+}
+
+.fa-js-square:before, .fa-square-js:before {
+  content: "\f3b9";
+}
+
+.fa-microsoft:before {
+  content: "\f3ca";
+}
+
+.fa-qq:before {
+  content: "\f1d6";
+}
+
+.fa-orcid:before {
+  content: "\f8d2";
+}
+
+.fa-java:before {
+  content: "\f4e4";
+}
+
+.fa-invision:before {
+  content: "\f7b0";
+}
+
+.fa-creative-commons-pd-alt:before {
+  content: "\f4ed";
+}
+
+.fa-centercode:before {
+  content: "\f380";
+}
+
+.fa-glide-g:before {
+  content: "\f2a6";
+}
+
+.fa-drupal:before {
+  content: "\f1a9";
+}
+
+.fa-jxl:before {
+  content: "\e67b";
+}
+
+.fa-hire-a-helper:before {
+  content: "\f3b0";
+}
+
+.fa-creative-commons-by:before {
+  content: "\f4e7";
+}
+
+.fa-unity:before {
+  content: "\e049";
+}
+
+.fa-whmcs:before {
+  content: "\f40d";
+}
+
+.fa-rocketchat:before {
+  content: "\f3e8";
+}
+
+.fa-vk:before {
+  content: "\f189";
+}
+
+.fa-untappd:before {
+  content: "\f405";
+}
+
+.fa-mailchimp:before {
+  content: "\f59e";
+}
+
+.fa-css3-alt:before {
+  content: "\f38b";
+}
+
+.fa-reddit-square:before, .fa-square-reddit:before {
+  content: "\f1a2";
+}
+
+.fa-vimeo-v:before {
+  content: "\f27d";
+}
+
+.fa-contao:before {
+  content: "\f26d";
+}
+
+.fa-square-font-awesome:before {
+  content: "\e5ad";
+}
+
+.fa-deskpro:before {
+  content: "\f38f";
+}
+
+.fa-brave:before {
+  content: "\e63c";
+}
+
+.fa-sistrix:before {
+  content: "\f3ee";
+}
+
+.fa-instagram-square:before, .fa-square-instagram:before {
+  content: "\e055";
+}
+
+.fa-battle-net:before {
+  content: "\f835";
+}
+
+.fa-the-red-yeti:before {
+  content: "\f69d";
+}
+
+.fa-hacker-news-square:before, .fa-square-hacker-news:before {
+  content: "\f3af";
+}
+
+.fa-edge:before {
+  content: "\f282";
+}
+
+.fa-threads:before {
+  content: "\e618";
+}
+
+.fa-napster:before {
+  content: "\f3d2";
+}
+
+.fa-snapchat-square:before, .fa-square-snapchat:before {
+  content: "\f2ad";
+}
+
+.fa-google-plus-g:before {
+  content: "\f0d5";
+}
+
+.fa-artstation:before {
+  content: "\f77a";
+}
+
+.fa-markdown:before {
+  content: "\f60f";
+}
+
+.fa-sourcetree:before {
+  content: "\f7d3";
+}
+
+.fa-google-plus:before {
+  content: "\f2b3";
+}
+
+.fa-diaspora:before {
+  content: "\f791";
+}
+
+.fa-foursquare:before {
+  content: "\f180";
+}
+
+.fa-stack-overflow:before {
+  content: "\f16c";
+}
+
+.fa-github-alt:before {
+  content: "\f113";
+}
+
+.fa-phoenix-squadron:before {
+  content: "\f511";
+}
+
+.fa-pagelines:before {
+  content: "\f18c";
+}
+
+.fa-algolia:before {
+  content: "\f36c";
+}
+
+.fa-red-river:before {
+  content: "\f3e3";
+}
+
+.fa-creative-commons-sa:before {
+  content: "\f4ef";
+}
+
+.fa-safari:before {
+  content: "\f267";
+}
+
+.fa-google:before {
+  content: "\f1a0";
+}
+
+.fa-font-awesome-alt:before, .fa-square-font-awesome-stroke:before {
+  content: "\f35c";
+}
+
+.fa-atlassian:before {
+  content: "\f77b";
+}
+
+.fa-linkedin-in:before {
+  content: "\f0e1";
+}
+
+.fa-digital-ocean:before {
+  content: "\f391";
+}
+
+.fa-nimblr:before {
+  content: "\f5a8";
+}
+
+.fa-chromecast:before {
+  content: "\f838";
+}
+
+.fa-evernote:before {
+  content: "\f839";
+}
+
+.fa-hacker-news:before {
+  content: "\f1d4";
+}
+
+.fa-creative-commons-sampling:before {
+  content: "\f4f0";
+}
+
+.fa-adversal:before {
+  content: "\f36a";
+}
+
+.fa-creative-commons:before {
+  content: "\f25e";
+}
+
+.fa-watchman-monitoring:before {
+  content: "\e087";
+}
+
+.fa-fonticons:before {
+  content: "\f280";
+}
+
+.fa-weixin:before {
+  content: "\f1d7";
+}
+
+.fa-shirtsinbulk:before {
+  content: "\f214";
+}
+
+.fa-codepen:before {
+  content: "\f1cb";
+}
+
+.fa-git-alt:before {
+  content: "\f841";
+}
+
+.fa-lyft:before {
+  content: "\f3c3";
+}
+
+.fa-rev:before {
+  content: "\f5b2";
+}
+
+.fa-windows:before {
+  content: "\f17a";
+}
+
+.fa-wizards-of-the-coast:before {
+  content: "\f730";
+}
+
+.fa-square-viadeo:before, .fa-viadeo-square:before {
+  content: "\f2aa";
+}
+
+.fa-meetup:before {
+  content: "\f2e0";
+}
+
+.fa-centos:before {
+  content: "\f789";
+}
+
+.fa-adn:before {
+  content: "\f170";
+}
+
+.fa-cloudsmith:before {
+  content: "\f384";
+}
+
+.fa-opensuse:before {
+  content: "\e62b";
+}
+
+.fa-pied-piper-alt:before {
+  content: "\f1a8";
+}
+
+.fa-dribbble-square:before, .fa-square-dribbble:before {
+  content: "\f397";
+}
+
+.fa-codiepie:before {
+  content: "\f284";
+}
+
+.fa-node:before {
+  content: "\f419";
+}
+
+.fa-mix:before {
+  content: "\f3cb";
+}
+
+.fa-steam:before {
+  content: "\f1b6";
+}
+
+.fa-cc-apple-pay:before {
+  content: "\f416";
+}
+
+.fa-scribd:before {
+  content: "\f28a";
+}
+
+.fa-debian:before {
+  content: "\e60b";
+}
+
+.fa-openid:before {
+  content: "\f19b";
+}
+
+.fa-instalod:before {
+  content: "\e081";
+}
+
+.fa-expeditedssl:before {
+  content: "\f23e";
+}
+
+.fa-sellcast:before {
+  content: "\f2da";
+}
+
+.fa-square-twitter:before, .fa-twitter-square:before {
+  content: "\f081";
+}
+
+.fa-r-project:before {
+  content: "\f4f7";
+}
+
+.fa-delicious:before {
+  content: "\f1a5";
+}
+
+.fa-freebsd:before {
+  content: "\f3a4";
+}
+
+.fa-vuejs:before {
+  content: "\f41f";
+}
+
+.fa-accusoft:before {
+  content: "\f369";
+}
+
+.fa-ioxhost:before {
+  content: "\f208";
+}
+
+.fa-fonticons-fi:before {
+  content: "\f3a2";
+}
+
+.fa-app-store:before {
+  content: "\f36f";
+}
+
+.fa-cc-mastercard:before {
+  content: "\f1f1";
+}
+
+.fa-itunes-note:before {
+  content: "\f3b5";
+}
+
+.fa-golang:before {
+  content: "\e40f";
+}
+
+.fa-kickstarter:before, .fa-square-kickstarter:before {
+  content: "\f3bb";
+}
+
+.fa-grav:before {
+  content: "\f2d6";
+}
+
+.fa-weibo:before {
+  content: "\f18a";
+}
+
+.fa-uncharted:before {
+  content: "\e084";
+}
+
+.fa-firstdraft:before {
+  content: "\f3a1";
+}
+
+.fa-square-youtube:before, .fa-youtube-square:before {
+  content: "\f431";
+}
+
+.fa-wikipedia-w:before {
+  content: "\f266";
+}
+
+.fa-rendact:before, .fa-wpressr:before {
+  content: "\f3e4";
+}
+
+.fa-angellist:before {
+  content: "\f209";
+}
+
+.fa-galactic-republic:before {
+  content: "\f50c";
+}
+
+.fa-nfc-directional:before {
+  content: "\e530";
+}
+
+.fa-skype:before {
+  content: "\f17e";
+}
+
+.fa-joget:before {
+  content: "\f3b7";
+}
+
+.fa-fedora:before {
+  content: "\f798";
+}
+
+.fa-stripe-s:before {
+  content: "\f42a";
+}
+
+.fa-meta:before {
+  content: "\e49b";
+}
+
+.fa-laravel:before {
+  content: "\f3bd";
+}
+
+.fa-hotjar:before {
+  content: "\f3b1";
+}
+
+.fa-bluetooth-b:before {
+  content: "\f294";
+}
+
+.fa-square-letterboxd:before {
+  content: "\e62e";
+}
+
+.fa-sticker-mule:before {
+  content: "\f3f7";
+}
+
+.fa-creative-commons-zero:before {
+  content: "\f4f3";
+}
+
+.fa-hips:before {
+  content: "\f452";
+}
+
+.fa-behance:before {
+  content: "\f1b4";
+}
+
+.fa-reddit:before {
+  content: "\f1a1";
+}
+
+.fa-discord:before {
+  content: "\f392";
+}
+
+.fa-chrome:before {
+  content: "\f268";
+}
+
+.fa-app-store-ios:before {
+  content: "\f370";
+}
+
+.fa-cc-discover:before {
+  content: "\f1f2";
+}
+
+.fa-wpbeginner:before {
+  content: "\f297";
+}
+
+.fa-confluence:before {
+  content: "\f78d";
+}
+
+.fa-shoelace:before {
+  content: "\e60c";
+}
+
+.fa-mdb:before {
+  content: "\f8ca";
+}
+
+.fa-dochub:before {
+  content: "\f394";
+}
+
+.fa-accessible-icon:before {
+  content: "\f368";
+}
+
+.fa-ebay:before {
+  content: "\f4f4";
+}
+
+.fa-amazon:before {
+  content: "\f270";
+}
+
+.fa-unsplash:before {
+  content: "\e07c";
+}
+
+.fa-yarn:before {
+  content: "\f7e3";
+}
+
+.fa-square-steam:before, .fa-steam-square:before {
+  content: "\f1b7";
+}
+
+.fa-500px:before {
+  content: "\f26e";
+}
+
+.fa-square-vimeo:before, .fa-vimeo-square:before {
+  content: "\f194";
+}
+
+.fa-asymmetrik:before {
+  content: "\f372";
+}
+
+.fa-font-awesome-flag:before, .fa-font-awesome-logo-full:before, .fa-font-awesome:before {
+  content: "\f2b4";
+}
+
+.fa-gratipay:before {
+  content: "\f184";
+}
+
+.fa-apple:before {
+  content: "\f179";
+}
+
+.fa-hive:before {
+  content: "\e07f";
+}
+
+.fa-gitkraken:before {
+  content: "\f3a6";
+}
+
+.fa-keybase:before {
+  content: "\f4f5";
+}
+
+.fa-apple-pay:before {
+  content: "\f415";
+}
+
+.fa-padlet:before {
+  content: "\e4a0";
+}
+
+.fa-amazon-pay:before {
+  content: "\f42c";
+}
+
+.fa-github-square:before, .fa-square-github:before {
+  content: "\f092";
+}
+
+.fa-stumbleupon:before {
+  content: "\f1a4";
+}
+
+.fa-fedex:before {
+  content: "\f797";
+}
+
+.fa-phoenix-framework:before {
+  content: "\f3dc";
+}
+
+.fa-shopify:before {
+  content: "\e057";
+}
+
+.fa-neos:before {
+  content: "\f612";
+}
+
+.fa-square-threads:before {
+  content: "\e619";
+}
+
+.fa-hackerrank:before {
+  content: "\f5f7";
+}
+
+.fa-researchgate:before {
+  content: "\f4f8";
+}
+
+.fa-swift:before {
+  content: "\f8e1";
+}
+
+.fa-angular:before {
+  content: "\f420";
+}
+
+.fa-speakap:before {
+  content: "\f3f3";
+}
+
+.fa-angrycreative:before {
+  content: "\f36e";
+}
+
+.fa-y-combinator:before {
+  content: "\f23b";
+}
+
+.fa-empire:before {
+  content: "\f1d1";
+}
+
+.fa-envira:before {
+  content: "\f299";
+}
+
+.fa-google-scholar:before {
+  content: "\e63b";
+}
+
+.fa-gitlab-square:before, .fa-square-gitlab:before {
+  content: "\e5ae";
+}
+
+.fa-studiovinari:before {
+  content: "\f3f8";
+}
+
+.fa-pied-piper:before {
+  content: "\f2ae";
+}
+
+.fa-wordpress:before {
+  content: "\f19a";
+}
+
+.fa-product-hunt:before {
+  content: "\f288";
+}
+
+.fa-firefox:before {
+  content: "\f269";
+}
+
+.fa-linode:before {
+  content: "\f2b8";
+}
+
+.fa-goodreads:before {
+  content: "\f3a8";
+}
+
+.fa-odnoklassniki-square:before, .fa-square-odnoklassniki:before {
+  content: "\f264";
+}
+
+.fa-jsfiddle:before {
+  content: "\f1cc";
+}
+
+.fa-sith:before {
+  content: "\f512";
+}
+
+.fa-themeisle:before {
+  content: "\f2b2";
+}
+
+.fa-page4:before {
+  content: "\f3d7";
+}
+
+.fa-hashnode:before {
+  content: "\e499";
+}
+
+.fa-react:before {
+  content: "\f41b";
+}
+
+.fa-cc-paypal:before {
+  content: "\f1f4";
+}
+
+.fa-squarespace:before {
+  content: "\f5be";
+}
+
+.fa-cc-stripe:before {
+  content: "\f1f5";
+}
+
+.fa-creative-commons-share:before {
+  content: "\f4f2";
+}
+
+.fa-bitcoin:before {
+  content: "\f379";
+}
+
+.fa-keycdn:before {
+  content: "\f3ba";
+}
+
+.fa-opera:before {
+  content: "\f26a";
+}
+
+.fa-itch-io:before {
+  content: "\f83a";
+}
+
+.fa-umbraco:before {
+  content: "\f8e8";
+}
+
+.fa-galactic-senate:before {
+  content: "\f50d";
+}
+
+.fa-ubuntu:before {
+  content: "\f7df";
+}
+
+.fa-draft2digital:before {
+  content: "\f396";
+}
+
+.fa-stripe:before {
+  content: "\f429";
+}
+
+.fa-houzz:before {
+  content: "\f27c";
+}
+
+.fa-gg:before {
+  content: "\f260";
+}
+
+.fa-dhl:before {
+  content: "\f790";
+}
+
+.fa-pinterest-square:before, .fa-square-pinterest:before {
+  content: "\f0d3";
+}
+
+.fa-xing:before {
+  content: "\f168";
+}
+
+.fa-blackberry:before {
+  content: "\f37b";
+}
+
+.fa-creative-commons-pd:before {
+  content: "\f4ec";
+}
+
+.fa-playstation:before {
+  content: "\f3df";
+}
+
+.fa-quinscape:before {
+  content: "\f459";
+}
+
+.fa-less:before {
+  content: "\f41d";
+}
+
+.fa-blogger-b:before {
+  content: "\f37d";
+}
+
+.fa-opencart:before {
+  content: "\f23d";
+}
+
+.fa-vine:before {
+  content: "\f1ca";
+}
+
+.fa-signal-messenger:before {
+  content: "\e663";
+}
+
+.fa-paypal:before {
+  content: "\f1ed";
+}
+
+.fa-gitlab:before {
+  content: "\f296";
+}
+
+.fa-typo3:before {
+  content: "\f42b";
+}
+
+.fa-reddit-alien:before {
+  content: "\f281";
+}
+
+.fa-yahoo:before {
+  content: "\f19e";
+}
+
+.fa-dailymotion:before {
+  content: "\e052";
+}
+
+.fa-affiliatetheme:before {
+  content: "\f36b";
+}
+
+.fa-pied-piper-pp:before {
+  content: "\f1a7";
+}
+
+.fa-bootstrap:before {
+  content: "\f836";
+}
+
+.fa-odnoklassniki:before {
+  content: "\f263";
+}
+
+.fa-nfc-symbol:before {
+  content: "\e531";
+}
+
+.fa-mintbit:before {
+  content: "\e62f";
+}
+
+.fa-ethereum:before {
+  content: "\f42e";
+}
+
+.fa-speaker-deck:before {
+  content: "\f83c";
+}
+
+.fa-creative-commons-nc-eu:before {
+  content: "\f4e9";
+}
+
+.fa-patreon:before {
+  content: "\f3d9";
+}
+
+.fa-avianex:before {
+  content: "\f374";
+}
+
+.fa-ello:before {
+  content: "\f5f1";
+}
+
+.fa-gofore:before {
+  content: "\f3a7";
+}
+
+.fa-bimobject:before {
+  content: "\f378";
+}
+
+.fa-brave-reverse:before {
+  content: "\e63d";
+}
+
+.fa-facebook-f:before {
+  content: "\f39e";
+}
+
+.fa-google-plus-square:before, .fa-square-google-plus:before {
+  content: "\f0d4";
+}
+
+.fa-web-awesome:before {
+  content: "\e682";
+}
+
+.fa-mandalorian:before {
+  content: "\f50f";
+}
+
+.fa-first-order-alt:before {
+  content: "\f50a";
+}
+
+.fa-osi:before {
+  content: "\f41a";
+}
+
+.fa-google-wallet:before {
+  content: "\f1ee";
+}
+
+.fa-d-and-d-beyond:before {
+  content: "\f6ca";
+}
+
+.fa-periscope:before {
+  content: "\f3da";
+}
+
+.fa-fulcrum:before {
+  content: "\f50b";
+}
+
+.fa-cloudscale:before {
+  content: "\f383";
+}
+
+.fa-forumbee:before {
+  content: "\f211";
+}
+
+.fa-mizuni:before {
+  content: "\f3cc";
+}
+
+.fa-schlix:before {
+  content: "\f3ea";
+}
+
+.fa-square-xing:before, .fa-xing-square:before {
+  content: "\f169";
+}
+
+.fa-bandcamp:before {
+  content: "\f2d5";
+}
+
+.fa-wpforms:before {
+  content: "\f298";
+}
+
+.fa-cloudversify:before {
+  content: "\f385";
+}
+
+.fa-usps:before {
+  content: "\f7e1";
+}
+
+.fa-megaport:before {
+  content: "\f5a3";
+}
+
+.fa-magento:before {
+  content: "\f3c4";
+}
+
+.fa-spotify:before {
+  content: "\f1bc";
+}
+
+.fa-optin-monster:before {
+  content: "\f23c";
+}
+
+.fa-fly:before {
+  content: "\f417";
+}
+
+.fa-aviato:before {
+  content: "\f421";
+}
+
+.fa-itunes:before {
+  content: "\f3b4";
+}
+
+.fa-cuttlefish:before {
+  content: "\f38c";
+}
+
+.fa-blogger:before {
+  content: "\f37c";
+}
+
+.fa-flickr:before {
+  content: "\f16e";
+}
+
+.fa-viber:before {
+  content: "\f409";
+}
+
+.fa-soundcloud:before {
+  content: "\f1be";
+}
+
+.fa-digg:before {
+  content: "\f1a6";
+}
+
+.fa-tencent-weibo:before {
+  content: "\f1d5";
+}
+
+.fa-letterboxd:before {
+  content: "\e62d";
+}
+
+.fa-symfony:before {
+  content: "\f83d";
+}
+
+.fa-maxcdn:before {
+  content: "\f136";
+}
+
+.fa-etsy:before {
+  content: "\f2d7";
+}
+
+.fa-facebook-messenger:before {
+  content: "\f39f";
+}
+
+.fa-audible:before {
+  content: "\f373";
+}
+
+.fa-think-peaks:before {
+  content: "\f731";
+}
+
+.fa-bilibili:before {
+  content: "\e3d9";
+}
+
+.fa-erlang:before {
+  content: "\f39d";
+}
+
+.fa-x-twitter:before {
+  content: "\e61b";
+}
+
+.fa-cotton-bureau:before {
+  content: "\f89e";
+}
+
+.fa-dashcube:before {
+  content: "\f210";
+}
+
+.fa-42-group:before, .fa-innosoft:before {
+  content: "\e080";
+}
+
+.fa-stack-exchange:before {
+  content: "\f18d";
+}
+
+.fa-elementor:before {
+  content: "\f430";
+}
+
+.fa-pied-piper-square:before, .fa-square-pied-piper:before {
+  content: "\e01e";
+}
+
+.fa-creative-commons-nd:before {
+  content: "\f4eb";
+}
+
+.fa-palfed:before {
+  content: "\f3d8";
+}
+
+.fa-superpowers:before {
+  content: "\f2dd";
+}
+
+.fa-resolving:before {
+  content: "\f3e7";
+}
+
+.fa-xbox:before {
+  content: "\f412";
+}
+
+.fa-square-web-awesome-stroke:before {
+  content: "\e684";
+}
+
+.fa-searchengin:before {
+  content: "\f3eb";
+}
+
+.fa-tiktok:before {
+  content: "\e07b";
+}
+
+.fa-facebook-square:before, .fa-square-facebook:before {
+  content: "\f082";
+}
+
+.fa-renren:before {
+  content: "\f18b";
+}
+
+.fa-linux:before {
+  content: "\f17c";
+}
+
+.fa-glide:before {
+  content: "\f2a5";
+}
+
+.fa-linkedin:before {
+  content: "\f08c";
+}
+
+.fa-hubspot:before {
+  content: "\f3b2";
+}
+
+.fa-deploydog:before {
+  content: "\f38e";
+}
+
+.fa-twitch:before {
+  content: "\f1e8";
+}
+
+.fa-ravelry:before {
+  content: "\f2d9";
+}
+
+.fa-mixer:before {
+  content: "\e056";
+}
+
+.fa-lastfm-square:before, .fa-square-lastfm:before {
+  content: "\f203";
+}
+
+.fa-vimeo:before {
+  content: "\f40a";
+}
+
+.fa-mendeley:before {
+  content: "\f7b3";
+}
+
+.fa-uniregistry:before {
+  content: "\f404";
+}
+
+.fa-figma:before {
+  content: "\f799";
+}
+
+.fa-creative-commons-remix:before {
+  content: "\f4ee";
+}
+
+.fa-cc-amazon-pay:before {
+  content: "\f42d";
+}
+
+.fa-dropbox:before {
+  content: "\f16b";
+}
+
+.fa-instagram:before {
+  content: "\f16d";
+}
+
+.fa-cmplid:before {
+  content: "\e360";
+}
+
+.fa-upwork:before {
+  content: "\e641";
+}
+
+.fa-facebook:before {
+  content: "\f09a";
+}
+
+.fa-gripfire:before {
+  content: "\f3ac";
+}
+
+.fa-jedi-order:before {
+  content: "\f50e";
+}
+
+.fa-uikit:before {
+  content: "\f403";
+}
+
+.fa-fort-awesome-alt:before {
+  content: "\f3a3";
+}
+
+.fa-phabricator:before {
+  content: "\f3db";
+}
+
+.fa-ussunnah:before {
+  content: "\f407";
+}
+
+.fa-earlybirds:before {
+  content: "\f39a";
+}
+
+.fa-trade-federation:before {
+  content: "\f513";
+}
+
+.fa-autoprefixer:before {
+  content: "\f41c";
+}
+
+.fa-whatsapp:before {
+  content: "\f232";
+}
+
+.fa-square-upwork:before {
+  content: "\e67c";
+}
+
+.fa-slideshare:before {
+  content: "\f1e7";
+}
+
+.fa-google-play:before {
+  content: "\f3ab";
+}
+
+.fa-viadeo:before {
+  content: "\f2a9";
+}
+
+.fa-line:before {
+  content: "\f3c0";
+}
+
+.fa-google-drive:before {
+  content: "\f3aa";
+}
+
+.fa-servicestack:before {
+  content: "\f3ec";
+}
+
+.fa-simplybuilt:before {
+  content: "\f215";
+}
+
+.fa-bitbucket:before {
+  content: "\f171";
+}
+
+.fa-imdb:before {
+  content: "\f2d8";
+}
+
+.fa-deezer:before {
+  content: "\e077";
+}
+
+.fa-raspberry-pi:before {
+  content: "\f7bb";
+}
+
+.fa-jira:before {
+  content: "\f7b1";
+}
+
+.fa-docker:before {
+  content: "\f395";
+}
+
+.fa-screenpal:before {
+  content: "\e570";
+}
+
+.fa-bluetooth:before {
+  content: "\f293";
+}
+
+.fa-gitter:before {
+  content: "\f426";
+}
+
+.fa-d-and-d:before {
+  content: "\f38d";
+}
+
+.fa-microblog:before {
+  content: "\e01a";
+}
+
+.fa-cc-diners-club:before {
+  content: "\f24c";
+}
+
+.fa-gg-circle:before {
+  content: "\f261";
+}
+
+.fa-pied-piper-hat:before {
+  content: "\f4e5";
+}
+
+.fa-kickstarter-k:before {
+  content: "\f3bc";
+}
+
+.fa-yandex:before {
+  content: "\f413";
+}
+
+.fa-readme:before {
+  content: "\f4d5";
+}
+
+.fa-html5:before {
+  content: "\f13b";
+}
+
+.fa-sellsy:before {
+  content: "\f213";
+}
+
+.fa-square-web-awesome:before {
+  content: "\e683";
+}
+
+.fa-sass:before {
+  content: "\f41e";
+}
+
+.fa-wirsindhandwerk:before, .fa-wsh:before {
+  content: "\e2d0";
+}
+
+.fa-buromobelexperte:before {
+  content: "\f37f";
+}
+
+.fa-salesforce:before {
+  content: "\f83b";
+}
+
+.fa-octopus-deploy:before {
+  content: "\e082";
+}
+
+.fa-medapps:before {
+  content: "\f3c6";
+}
+
+.fa-ns8:before {
+  content: "\f3d5";
+}
+
+.fa-pinterest-p:before {
+  content: "\f231";
+}
+
+.fa-apper:before {
+  content: "\f371";
+}
+
+.fa-fort-awesome:before {
+  content: "\f286";
+}
+
+.fa-waze:before {
+  content: "\f83f";
+}
+
+.fa-bluesky:before {
+  content: "\e671";
+}
+
+.fa-cc-jcb:before {
+  content: "\f24b";
+}
+
+.fa-snapchat-ghost:before, .fa-snapchat:before {
+  content: "\f2ab";
+}
+
+.fa-fantasy-flight-games:before {
+  content: "\f6dc";
+}
+
+.fa-rust:before {
+  content: "\e07a";
+}
+
+.fa-wix:before {
+  content: "\f5cf";
+}
+
+.fa-behance-square:before, .fa-square-behance:before {
+  content: "\f1b5";
+}
+
+.fa-supple:before {
+  content: "\f3f9";
+}
+
+.fa-webflow:before {
+  content: "\e65c";
+}
+
+.fa-rebel:before {
+  content: "\f1d0";
+}
+
+.fa-css3:before {
+  content: "\f13c";
+}
+
+.fa-staylinked:before {
+  content: "\f3f5";
+}
+
+.fa-kaggle:before {
+  content: "\f5fa";
+}
+
+.fa-space-awesome:before {
+  content: "\e5ac";
+}
+
+.fa-deviantart:before {
+  content: "\f1bd";
+}
+
+.fa-cpanel:before {
+  content: "\f388";
+}
+
+.fa-goodreads-g:before {
+  content: "\f3a9";
+}
+
+.fa-git-square:before, .fa-square-git:before {
+  content: "\f1d2";
+}
+
+.fa-square-tumblr:before, .fa-tumblr-square:before {
+  content: "\f174";
+}
+
+.fa-trello:before {
+  content: "\f181";
+}
+
+.fa-creative-commons-nc-jp:before {
+  content: "\f4ea";
+}
+
+.fa-get-pocket:before {
+  content: "\f265";
+}
+
+.fa-perbyte:before {
+  content: "\e083";
+}
+
+.fa-grunt:before {
+  content: "\f3ad";
+}
+
+.fa-weebly:before {
+  content: "\f5cc";
+}
+
+.fa-connectdevelop:before {
+  content: "\f20e";
+}
+
+.fa-leanpub:before {
+  content: "\f212";
+}
+
+.fa-black-tie:before {
+  content: "\f27e";
+}
+
+.fa-themeco:before {
+  content: "\f5c6";
+}
+
+.fa-python:before {
+  content: "\f3e2";
+}
+
+.fa-android:before {
+  content: "\f17b";
+}
+
+.fa-bots:before {
+  content: "\e340";
+}
+
+.fa-free-code-camp:before {
+  content: "\f2c5";
+}
+
+.fa-hornbill:before {
+  content: "\f592";
+}
+
+.fa-js:before {
+  content: "\f3b8";
+}
+
+.fa-ideal:before {
+  content: "\e013";
+}
+
+.fa-git:before {
+  content: "\f1d3";
+}
+
+.fa-dev:before {
+  content: "\f6cc";
+}
+
+.fa-sketch:before {
+  content: "\f7c6";
+}
+
+.fa-yandex-international:before {
+  content: "\f414";
+}
+
+.fa-cc-amex:before {
+  content: "\f1f3";
+}
+
+.fa-uber:before {
+  content: "\f402";
+}
+
+.fa-github:before {
+  content: "\f09b";
+}
+
+.fa-php:before {
+  content: "\f457";
+}
+
+.fa-alipay:before {
+  content: "\f642";
+}
+
+.fa-youtube:before {
+  content: "\f167";
+}
+
+.fa-skyatlas:before {
+  content: "\f216";
+}
+
+.fa-firefox-browser:before {
+  content: "\e007";
+}
+
+.fa-replyd:before {
+  content: "\f3e6";
+}
+
+.fa-suse:before {
+  content: "\f7d6";
+}
+
+.fa-jenkins:before {
+  content: "\f3b6";
+}
+
+.fa-twitter:before {
+  content: "\f099";
+}
+
+.fa-rockrms:before {
+  content: "\f3e9";
+}
+
+.fa-pinterest:before {
+  content: "\f0d2";
+}
+
+.fa-buffer:before {
+  content: "\f837";
+}
+
+.fa-npm:before {
+  content: "\f3d4";
+}
+
+.fa-yammer:before {
+  content: "\f840";
+}
+
+.fa-btc:before {
+  content: "\f15a";
+}
+
+.fa-dribbble:before {
+  content: "\f17d";
+}
+
+.fa-stumbleupon-circle:before {
+  content: "\f1a3";
+}
+
+.fa-internet-explorer:before {
+  content: "\f26b";
+}
+
+.fa-stubber:before {
+  content: "\e5c7";
+}
+
+.fa-telegram-plane:before, .fa-telegram:before {
+  content: "\f2c6";
+}
+
+.fa-old-republic:before {
+  content: "\f510";
+}
+
+.fa-odysee:before {
+  content: "\e5c6";
+}
+
+.fa-square-whatsapp:before, .fa-whatsapp-square:before {
+  content: "\f40c";
+}
+
+.fa-node-js:before {
+  content: "\f3d3";
+}
+
+.fa-edge-legacy:before {
+  content: "\e078";
+}
+
+.fa-slack-hash:before, .fa-slack:before {
+  content: "\f198";
+}
+
+.fa-medrt:before {
+  content: "\f3c8";
+}
+
+.fa-usb:before {
+  content: "\f287";
+}
+
+.fa-tumblr:before {
+  content: "\f173";
+}
+
+.fa-vaadin:before {
+  content: "\f408";
+}
+
+.fa-quora:before {
+  content: "\f2c4";
+}
+
+.fa-square-x-twitter:before {
+  content: "\e61a";
+}
+
+.fa-reacteurope:before {
+  content: "\f75d";
+}
+
+.fa-medium-m:before, .fa-medium:before {
+  content: "\f23a";
+}
+
+.fa-amilia:before {
+  content: "\f36d";
+}
+
+.fa-mixcloud:before {
+  content: "\f289";
+}
+
+.fa-flipboard:before {
+  content: "\f44d";
+}
+
+.fa-viacoin:before {
+  content: "\f237";
+}
+
+.fa-critical-role:before {
+  content: "\f6c9";
+}
+
+.fa-sitrox:before {
+  content: "\e44a";
+}
+
+.fa-discourse:before {
+  content: "\f393";
+}
+
+.fa-joomla:before {
+  content: "\f1aa";
+}
+
+.fa-mastodon:before {
+  content: "\f4f6";
+}
+
+.fa-airbnb:before {
+  content: "\f834";
+}
+
+.fa-wolf-pack-battalion:before {
+  content: "\f514";
+}
+
+.fa-buy-n-large:before {
+  content: "\f8a6";
+}
+
+.fa-gulp:before {
+  content: "\f3ae";
+}
+
+.fa-creative-commons-sampling-plus:before {
+  content: "\f4f1";
+}
+
+.fa-strava:before {
+  content: "\f428";
+}
+
+.fa-ember:before {
+  content: "\f423";
+}
+
+.fa-canadian-maple-leaf:before {
+  content: "\f785";
+}
+
+.fa-teamspeak:before {
+  content: "\f4f9";
+}
+
+.fa-pushed:before {
+  content: "\f3e1";
+}
+
+.fa-wordpress-simple:before {
+  content: "\f411";
+}
+
+.fa-nutritionix:before {
+  content: "\f3d6";
+}
+
+.fa-wodu:before {
+  content: "\e088";
+}
+
+.fa-google-pay:before {
+  content: "\e079";
+}
+
+.fa-intercom:before {
+  content: "\f7af";
+}
+
+.fa-zhihu:before {
+  content: "\f63f";
+}
+
+.fa-korvue:before {
+  content: "\f42f";
+}
+
+.fa-pix:before {
+  content: "\e43a";
+}
+
+.fa-steam-symbol:before {
+  content: "\f3f6";
+}
+
+:host, :root {
+  --fa-style-family-duotone: "Font Awesome 6 Duotone";
+  --fa-font-duotone: normal 900 1em/1 "Font Awesome 6 Duotone";
+}
+
+.fa-duotone, .fad {
+  position: relative;
+  font-weight: 900;
+  letter-spacing: normal;
+}
+
+.fa-duotone:before, .fad:before {
+  position: absolute;
+  color: var(--fa-primary-color,inherit);
+  opacity: var(--fa-primary-opacity,1);
+}
+
+.fa-duotone:after, .fad:after {
+  color: var(--fa-secondary-color,inherit);
+}
+
+.fa-duotone.fa-swap-opacity:before, .fa-duotone:after, .fa-swap-opacity .fa-duotone:before, .fa-swap-opacity .fad:before, .fad.fa-swap-opacity:before, .fad:after {
+  opacity: var(--fa-secondary-opacity,.4);
+}
+
+.fa-duotone.fa-swap-opacity:after, .fa-swap-opacity .fa-duotone:after, .fa-swap-opacity .fad:after, .fad.fa-swap-opacity:after {
+  opacity: var(--fa-primary-opacity,1);
+}
+
+.fa-duotone.fa-inverse, .fad.fa-inverse {
+  color: var(--fa-inverse,#fff);
+}
+
+.fa-duotone.fa-stack-1x, .fa-duotone.fa-stack-2x, .fad.fa-stack-1x, .fad.fa-stack-2x {
+  position: absolute;
+}
+
+.fa-duotone.fa-0:after, .fad.fa-0:after {
+  content: "\30\30";
+}
+
+.fa-duotone.fa-1:after, .fad.fa-1:after {
+  content: "\31\31";
+}
+
+.fa-duotone.fa-2:after, .fad.fa-2:after {
+  content: "\32\32";
+}
+
+.fa-duotone.fa-3:after, .fad.fa-3:after {
+  content: "\33\33";
+}
+
+.fa-duotone.fa-4:after, .fad.fa-4:after {
+  content: "\34\34";
+}
+
+.fa-duotone.fa-5:after, .fad.fa-5:after {
+  content: "\35\35";
+}
+
+.fa-duotone.fa-6:after, .fad.fa-6:after {
+  content: "\36\36";
+}
+
+.fa-duotone.fa-7:after, .fad.fa-7:after {
+  content: "\37\37";
+}
+
+.fa-duotone.fa-8:after, .fad.fa-8:after {
+  content: "\38\38";
+}
+
+.fa-duotone.fa-9:after, .fad.fa-9:after {
+  content: "\39\39";
+}
+
+.fa-duotone.fa-fill-drip:after, .fad.fa-fill-drip:after {
+  content: "\f576\f576";
+}
+
+.fa-duotone.fa-arrows-to-circle:after, .fad.fa-arrows-to-circle:after {
+  content: "\e4bd\e4bd";
+}
+
+.fa-duotone.fa-chevron-circle-right:after, .fa-duotone.fa-circle-chevron-right:after, .fad.fa-chevron-circle-right:after, .fad.fa-circle-chevron-right:after {
+  content: "\f138\f138";
+}
+
+.fa-duotone.fa-wagon-covered:after, .fad.fa-wagon-covered:after {
+  content: "\f8ee\f8ee";
+}
+
+.fa-duotone.fa-line-height:after, .fad.fa-line-height:after {
+  content: "\f871\f871";
+}
+
+.fa-duotone.fa-bagel:after, .fad.fa-bagel:after {
+  content: "\e3d7\e3d7";
+}
+
+.fa-duotone.fa-transporter-7:after, .fad.fa-transporter-7:after {
+  content: "\e2a8\e2a8";
+}
+
+.fa-duotone.fa-at:after, .fad.fa-at:after {
+  content: "\40\40";
+}
+
+.fa-duotone.fa-rectangles-mixed:after, .fad.fa-rectangles-mixed:after {
+  content: "\e323\e323";
+}
+
+.fa-duotone.fa-phone-arrow-up-right:after, .fa-duotone.fa-phone-arrow-up:after, .fa-duotone.fa-phone-outgoing:after, .fad.fa-phone-arrow-up-right:after, .fad.fa-phone-arrow-up:after, .fad.fa-phone-outgoing:after {
+  content: "\e224\e224";
+}
+
+.fa-duotone.fa-trash-alt:after, .fa-duotone.fa-trash-can:after, .fad.fa-trash-alt:after, .fad.fa-trash-can:after {
+  content: "\f2ed\f2ed";
+}
+
+.fa-duotone.fa-circle-l:after, .fad.fa-circle-l:after {
+  content: "\e114\e114";
+}
+
+.fa-duotone.fa-head-side-goggles:after, .fa-duotone.fa-head-vr:after, .fad.fa-head-side-goggles:after, .fad.fa-head-vr:after {
+  content: "\f6ea\f6ea";
+}
+
+.fa-duotone.fa-text-height:after, .fad.fa-text-height:after {
+  content: "\f034\f034";
+}
+
+.fa-duotone.fa-user-times:after, .fa-duotone.fa-user-xmark:after, .fad.fa-user-times:after, .fad.fa-user-xmark:after {
+  content: "\f235\f235";
+}
+
+.fa-duotone.fa-face-hand-yawn:after, .fad.fa-face-hand-yawn:after {
+  content: "\e379\e379";
+}
+
+.fa-duotone.fa-gauge-simple-min:after, .fa-duotone.fa-tachometer-slowest:after, .fad.fa-gauge-simple-min:after, .fad.fa-tachometer-slowest:after {
+  content: "\f62d\f62d";
+}
+
+.fa-duotone.fa-stethoscope:after, .fad.fa-stethoscope:after {
+  content: "\f0f1\f0f1";
+}
+
+.fa-duotone.fa-coffin:after, .fad.fa-coffin:after {
+  content: "\f6c6\f6c6";
+}
+
+.fa-duotone.fa-comment-alt:after, .fa-duotone.fa-message:after, .fad.fa-comment-alt:after, .fad.fa-message:after {
+  content: "\f27a\f27a";
+}
+
+.fa-duotone.fa-bowl-salad:after, .fa-duotone.fa-salad:after, .fad.fa-bowl-salad:after, .fad.fa-salad:after {
+  content: "\f81e\f81e";
+}
+
+.fa-duotone.fa-info:after, .fad.fa-info:after {
+  content: "\f129\f129";
+}
+
+.fa-duotone.fa-robot-astromech:after, .fad.fa-robot-astromech:after {
+  content: "\e2d2\e2d2";
+}
+
+.fa-duotone.fa-ring-diamond:after, .fad.fa-ring-diamond:after {
+  content: "\e5ab\e5ab";
+}
+
+.fa-duotone.fa-fondue-pot:after, .fad.fa-fondue-pot:after {
+  content: "\e40d\e40d";
+}
+
+.fa-duotone.fa-theta:after, .fad.fa-theta:after {
+  content: "\f69e\f69e";
+}
+
+.fa-duotone.fa-face-hand-peeking:after, .fad.fa-face-hand-peeking:after {
+  content: "\e481\e481";
+}
+
+.fa-duotone.fa-square-user:after, .fad.fa-square-user:after {
+  content: "\e283\e283";
+}
+
+.fa-duotone.fa-compress-alt:after, .fa-duotone.fa-down-left-and-up-right-to-center:after, .fad.fa-compress-alt:after, .fad.fa-down-left-and-up-right-to-center:after {
+  content: "\f422\f422";
+}
+
+.fa-duotone.fa-explosion:after, .fad.fa-explosion:after {
+  content: "\e4e9\e4e9";
+}
+
+.fa-duotone.fa-file-alt:after, .fa-duotone.fa-file-lines:after, .fa-duotone.fa-file-text:after, .fad.fa-file-alt:after, .fad.fa-file-lines:after, .fad.fa-file-text:after {
+  content: "\f15c\f15c";
+}
+
+.fa-duotone.fa-wave-square:after, .fad.fa-wave-square:after {
+  content: "\f83e\f83e";
+}
+
+.fa-duotone.fa-ring:after, .fad.fa-ring:after {
+  content: "\f70b\f70b";
+}
+
+.fa-duotone.fa-building-un:after, .fad.fa-building-un:after {
+  content: "\e4d9\e4d9";
+}
+
+.fa-duotone.fa-dice-three:after, .fad.fa-dice-three:after {
+  content: "\f527\f527";
+}
+
+.fa-duotone.fa-tire-pressure-warning:after, .fad.fa-tire-pressure-warning:after {
+  content: "\f633\f633";
+}
+
+.fa-duotone.fa-wifi-2:after, .fa-duotone.fa-wifi-fair:after, .fad.fa-wifi-2:after, .fad.fa-wifi-fair:after {
+  content: "\f6ab\f6ab";
+}
+
+.fa-duotone.fa-calendar-alt:after, .fa-duotone.fa-calendar-days:after, .fad.fa-calendar-alt:after, .fad.fa-calendar-days:after {
+  content: "\f073\f073";
+}
+
+.fa-duotone.fa-mp3-player:after, .fad.fa-mp3-player:after {
+  content: "\f8ce\f8ce";
+}
+
+.fa-duotone.fa-anchor-circle-check:after, .fad.fa-anchor-circle-check:after {
+  content: "\e4aa\e4aa";
+}
+
+.fa-duotone.fa-tally-4:after, .fad.fa-tally-4:after {
+  content: "\e297\e297";
+}
+
+.fa-duotone.fa-rectangle-history:after, .fad.fa-rectangle-history:after {
+  content: "\e4a2\e4a2";
+}
+
+.fa-duotone.fa-building-circle-arrow-right:after, .fad.fa-building-circle-arrow-right:after {
+  content: "\e4d1\e4d1";
+}
+
+.fa-duotone.fa-volleyball-ball:after, .fa-duotone.fa-volleyball:after, .fad.fa-volleyball-ball:after, .fad.fa-volleyball:after {
+  content: "\f45f\f45f";
+}
+
+.fa-duotone.fa-sun-haze:after, .fad.fa-sun-haze:after {
+  content: "\f765\f765";
+}
+
+.fa-duotone.fa-text-size:after, .fad.fa-text-size:after {
+  content: "\f894\f894";
+}
+
+.fa-duotone.fa-ufo:after, .fad.fa-ufo:after {
+  content: "\e047\e047";
+}
+
+.fa-duotone.fa-fork:after, .fa-duotone.fa-utensil-fork:after, .fad.fa-fork:after, .fad.fa-utensil-fork:after {
+  content: "\f2e3\f2e3";
+}
+
+.fa-duotone.fa-arrows-up-to-line:after, .fad.fa-arrows-up-to-line:after {
+  content: "\e4c2\e4c2";
+}
+
+.fa-duotone.fa-mobile-signal:after, .fad.fa-mobile-signal:after {
+  content: "\e1ef\e1ef";
+}
+
+.fa-duotone.fa-barcode-scan:after, .fad.fa-barcode-scan:after {
+  content: "\f465\f465";
+}
+
+.fa-duotone.fa-sort-desc:after, .fa-duotone.fa-sort-down:after, .fad.fa-sort-desc:after, .fad.fa-sort-down:after {
+  content: "\f0dd\f0dd";
+}
+
+.fa-duotone.fa-folder-arrow-down:after, .fa-duotone.fa-folder-download:after, .fad.fa-folder-arrow-down:after, .fad.fa-folder-download:after {
+  content: "\e053\e053";
+}
+
+.fa-duotone.fa-circle-minus:after, .fa-duotone.fa-minus-circle:after, .fad.fa-circle-minus:after, .fad.fa-minus-circle:after {
+  content: "\f056\f056";
+}
+
+.fa-duotone.fa-face-icicles:after, .fad.fa-face-icicles:after {
+  content: "\e37c\e37c";
+}
+
+.fa-duotone.fa-shovel:after, .fad.fa-shovel:after {
+  content: "\f713\f713";
+}
+
+.fa-duotone.fa-door-open:after, .fad.fa-door-open:after {
+  content: "\f52b\f52b";
+}
+
+.fa-duotone.fa-films:after, .fad.fa-films:after {
+  content: "\e17a\e17a";
+}
+
+.fa-duotone.fa-right-from-bracket:after, .fa-duotone.fa-sign-out-alt:after, .fad.fa-right-from-bracket:after, .fad.fa-sign-out-alt:after {
+  content: "\f2f5\f2f5";
+}
+
+.fa-duotone.fa-face-glasses:after, .fad.fa-face-glasses:after {
+  content: "\e377\e377";
+}
+
+.fa-duotone.fa-nfc:after, .fad.fa-nfc:after {
+  content: "\e1f7\e1f7";
+}
+
+.fa-duotone.fa-atom:after, .fad.fa-atom:after {
+  content: "\f5d2\f5d2";
+}
+
+.fa-duotone.fa-soap:after, .fad.fa-soap:after {
+  content: "\e06e\e06e";
+}
+
+.fa-duotone.fa-heart-music-camera-bolt:after, .fa-duotone.fa-icons:after, .fad.fa-heart-music-camera-bolt:after, .fad.fa-icons:after {
+  content: "\f86d\f86d";
+}
+
+.fa-duotone.fa-microphone-alt-slash:after, .fa-duotone.fa-microphone-lines-slash:after, .fad.fa-microphone-alt-slash:after, .fad.fa-microphone-lines-slash:after {
+  content: "\f539\f539";
+}
+
+.fa-duotone.fa-closed-captioning-slash:after, .fad.fa-closed-captioning-slash:after {
+  content: "\e135\e135";
+}
+
+.fa-duotone.fa-calculator-alt:after, .fa-duotone.fa-calculator-simple:after, .fad.fa-calculator-alt:after, .fad.fa-calculator-simple:after {
+  content: "\f64c\f64c";
+}
+
+.fa-duotone.fa-bridge-circle-check:after, .fad.fa-bridge-circle-check:after {
+  content: "\e4c9\e4c9";
+}
+
+.fa-duotone.fa-sliders-up:after, .fa-duotone.fa-sliders-v:after, .fad.fa-sliders-up:after, .fad.fa-sliders-v:after {
+  content: "\f3f1\f3f1";
+}
+
+.fa-duotone.fa-location-minus:after, .fa-duotone.fa-map-marker-minus:after, .fad.fa-location-minus:after, .fad.fa-map-marker-minus:after {
+  content: "\f609\f609";
+}
+
+.fa-duotone.fa-pump-medical:after, .fad.fa-pump-medical:after {
+  content: "\e06a\e06a";
+}
+
+.fa-duotone.fa-fingerprint:after, .fad.fa-fingerprint:after {
+  content: "\f577\f577";
+}
+
+.fa-duotone.fa-ski-boot:after, .fad.fa-ski-boot:after {
+  content: "\e3cc\e3cc";
+}
+
+.fa-duotone.fa-rectangle-sd:after, .fa-duotone.fa-standard-definition:after, .fad.fa-rectangle-sd:after, .fad.fa-standard-definition:after {
+  content: "\e28a\e28a";
+}
+
+.fa-duotone.fa-h1:after, .fad.fa-h1:after {
+  content: "\f313\f313";
+}
+
+.fa-duotone.fa-hand-point-right:after, .fad.fa-hand-point-right:after {
+  content: "\f0a4\f0a4";
+}
+
+.fa-duotone.fa-magnifying-glass-location:after, .fa-duotone.fa-search-location:after, .fad.fa-magnifying-glass-location:after, .fad.fa-search-location:after {
+  content: "\f689\f689";
+}
+
+.fa-duotone.fa-message-bot:after, .fad.fa-message-bot:after {
+  content: "\e3b8\e3b8";
+}
+
+.fa-duotone.fa-forward-step:after, .fa-duotone.fa-step-forward:after, .fad.fa-forward-step:after, .fad.fa-step-forward:after {
+  content: "\f051\f051";
+}
+
+.fa-duotone.fa-face-smile-beam:after, .fa-duotone.fa-smile-beam:after, .fad.fa-face-smile-beam:after, .fad.fa-smile-beam:after {
+  content: "\f5b8\f5b8";
+}
+
+.fa-duotone.fa-light-ceiling:after, .fad.fa-light-ceiling:after {
+  content: "\e016\e016";
+}
+
+.fa-duotone.fa-comment-alt-exclamation:after, .fa-duotone.fa-message-exclamation:after, .fad.fa-comment-alt-exclamation:after, .fad.fa-message-exclamation:after {
+  content: "\f4a5\f4a5";
+}
+
+.fa-duotone.fa-bowl-scoop:after, .fa-duotone.fa-bowl-shaved-ice:after, .fad.fa-bowl-scoop:after, .fad.fa-bowl-shaved-ice:after {
+  content: "\e3de\e3de";
+}
+
+.fa-duotone.fa-square-x:after, .fad.fa-square-x:after {
+  content: "\e286\e286";
+}
+
+.fa-duotone.fa-building-memo:after, .fad.fa-building-memo:after {
+  content: "\e61e\e61e";
+}
+
+.fa-duotone.fa-utility-pole-double:after, .fad.fa-utility-pole-double:after {
+  content: "\e2c4\e2c4";
+}
+
+.fa-duotone.fa-flag-checkered:after, .fad.fa-flag-checkered:after {
+  content: "\f11e\f11e";
+}
+
+.fa-duotone.fa-chevron-double-up:after, .fa-duotone.fa-chevrons-up:after, .fad.fa-chevron-double-up:after, .fad.fa-chevrons-up:after {
+  content: "\f325\f325";
+}
+
+.fa-duotone.fa-football-ball:after, .fa-duotone.fa-football:after, .fad.fa-football-ball:after, .fad.fa-football:after {
+  content: "\f44e\f44e";
+}
+
+.fa-duotone.fa-user-vneck:after, .fad.fa-user-vneck:after {
+  content: "\e461\e461";
+}
+
+.fa-duotone.fa-school-circle-exclamation:after, .fad.fa-school-circle-exclamation:after {
+  content: "\e56c\e56c";
+}
+
+.fa-duotone.fa-crop:after, .fad.fa-crop:after {
+  content: "\f125\f125";
+}
+
+.fa-duotone.fa-angle-double-down:after, .fa-duotone.fa-angles-down:after, .fad.fa-angle-double-down:after, .fad.fa-angles-down:after {
+  content: "\f103\f103";
+}
+
+.fa-duotone.fa-users-rectangle:after, .fad.fa-users-rectangle:after {
+  content: "\e594\e594";
+}
+
+.fa-duotone.fa-people-roof:after, .fad.fa-people-roof:after {
+  content: "\e537\e537";
+}
+
+.fa-duotone.fa-arrow-square-right:after, .fa-duotone.fa-square-arrow-right:after, .fad.fa-arrow-square-right:after, .fad.fa-square-arrow-right:after {
+  content: "\f33b\f33b";
+}
+
+.fa-duotone.fa-location-plus:after, .fa-duotone.fa-map-marker-plus:after, .fad.fa-location-plus:after, .fad.fa-map-marker-plus:after {
+  content: "\f60a\f60a";
+}
+
+.fa-duotone.fa-lightbulb-exclamation-on:after, .fad.fa-lightbulb-exclamation-on:after {
+  content: "\e1ca\e1ca";
+}
+
+.fa-duotone.fa-people-line:after, .fad.fa-people-line:after {
+  content: "\e534\e534";
+}
+
+.fa-duotone.fa-beer-mug-empty:after, .fa-duotone.fa-beer:after, .fad.fa-beer-mug-empty:after, .fad.fa-beer:after {
+  content: "\f0fc\f0fc";
+}
+
+.fa-duotone.fa-crate-empty:after, .fad.fa-crate-empty:after {
+  content: "\e151\e151";
+}
+
+.fa-duotone.fa-diagram-predecessor:after, .fad.fa-diagram-predecessor:after {
+  content: "\e477\e477";
+}
+
+.fa-duotone.fa-transporter:after, .fad.fa-transporter:after {
+  content: "\e042\e042";
+}
+
+.fa-duotone.fa-calendar-circle-user:after, .fad.fa-calendar-circle-user:after {
+  content: "\e471\e471";
+}
+
+.fa-duotone.fa-arrow-up-long:after, .fa-duotone.fa-long-arrow-up:after, .fad.fa-arrow-up-long:after, .fad.fa-long-arrow-up:after {
+  content: "\f176\f176";
+}
+
+.fa-duotone.fa-person-carry-box:after, .fa-duotone.fa-person-carry:after, .fad.fa-person-carry-box:after, .fad.fa-person-carry:after {
+  content: "\f4cf\f4cf";
+}
+
+.fa-duotone.fa-burn:after, .fa-duotone.fa-fire-flame-simple:after, .fad.fa-burn:after, .fad.fa-fire-flame-simple:after {
+  content: "\f46a\f46a";
+}
+
+.fa-duotone.fa-male:after, .fa-duotone.fa-person:after, .fad.fa-male:after, .fad.fa-person:after {
+  content: "\f183\f183";
+}
+
+.fa-duotone.fa-laptop:after, .fad.fa-laptop:after {
+  content: "\f109\f109";
+}
+
+.fa-duotone.fa-file-csv:after, .fad.fa-file-csv:after {
+  content: "\f6dd\f6dd";
+}
+
+.fa-duotone.fa-menorah:after, .fad.fa-menorah:after {
+  content: "\f676\f676";
+}
+
+.fa-duotone.fa-union:after, .fad.fa-union:after {
+  content: "\f6a2\f6a2";
+}
+
+.fa-duotone.fa-chevron-double-left:after, .fa-duotone.fa-chevrons-left:after, .fad.fa-chevron-double-left:after, .fad.fa-chevrons-left:after {
+  content: "\f323\f323";
+}
+
+.fa-duotone.fa-circle-heart:after, .fa-duotone.fa-heart-circle:after, .fad.fa-circle-heart:after, .fad.fa-heart-circle:after {
+  content: "\f4c7\f4c7";
+}
+
+.fa-duotone.fa-truck-plane:after, .fad.fa-truck-plane:after {
+  content: "\e58f\e58f";
+}
+
+.fa-duotone.fa-record-vinyl:after, .fad.fa-record-vinyl:after {
+  content: "\f8d9\f8d9";
+}
+
+.fa-duotone.fa-bring-forward:after, .fad.fa-bring-forward:after {
+  content: "\f856\f856";
+}
+
+.fa-duotone.fa-square-p:after, .fad.fa-square-p:after {
+  content: "\e279\e279";
+}
+
+.fa-duotone.fa-face-grin-stars:after, .fa-duotone.fa-grin-stars:after, .fad.fa-face-grin-stars:after, .fad.fa-grin-stars:after {
+  content: "\f587\f587";
+}
+
+.fa-duotone.fa-sigma:after, .fad.fa-sigma:after {
+  content: "\f68b\f68b";
+}
+
+.fa-duotone.fa-camera-movie:after, .fad.fa-camera-movie:after {
+  content: "\f8a9\f8a9";
+}
+
+.fa-duotone.fa-bong:after, .fad.fa-bong:after {
+  content: "\f55c\f55c";
+}
+
+.fa-duotone.fa-clarinet:after, .fad.fa-clarinet:after {
+  content: "\f8ad\f8ad";
+}
+
+.fa-duotone.fa-truck-flatbed:after, .fad.fa-truck-flatbed:after {
+  content: "\e2b6\e2b6";
+}
+
+.fa-duotone.fa-pastafarianism:after, .fa-duotone.fa-spaghetti-monster-flying:after, .fad.fa-pastafarianism:after, .fad.fa-spaghetti-monster-flying:after {
+  content: "\f67b\f67b";
+}
+
+.fa-duotone.fa-arrow-down-up-across-line:after, .fad.fa-arrow-down-up-across-line:after {
+  content: "\e4af\e4af";
+}
+
+.fa-duotone.fa-arrows-rotate-reverse:after, .fad.fa-arrows-rotate-reverse:after {
+  content: "\e630\e630";
+}
+
+.fa-duotone.fa-leaf-heart:after, .fad.fa-leaf-heart:after {
+  content: "\f4cb\f4cb";
+}
+
+.fa-duotone.fa-house-building:after, .fad.fa-house-building:after {
+  content: "\e1b1\e1b1";
+}
+
+.fa-duotone.fa-cheese-swiss:after, .fad.fa-cheese-swiss:after {
+  content: "\f7f0\f7f0";
+}
+
+.fa-duotone.fa-spoon:after, .fa-duotone.fa-utensil-spoon:after, .fad.fa-spoon:after, .fad.fa-utensil-spoon:after {
+  content: "\f2e5\f2e5";
+}
+
+.fa-duotone.fa-jar-wheat:after, .fad.fa-jar-wheat:after {
+  content: "\e517\e517";
+}
+
+.fa-duotone.fa-envelopes-bulk:after, .fa-duotone.fa-mail-bulk:after, .fad.fa-envelopes-bulk:after, .fad.fa-mail-bulk:after {
+  content: "\f674\f674";
+}
+
+.fa-duotone.fa-file-circle-exclamation:after, .fad.fa-file-circle-exclamation:after {
+  content: "\e4eb\e4eb";
+}
+
+.fa-duotone.fa-bow-arrow:after, .fad.fa-bow-arrow:after {
+  content: "\f6b9\f6b9";
+}
+
+.fa-duotone.fa-cart-xmark:after, .fad.fa-cart-xmark:after {
+  content: "\e0dd\e0dd";
+}
+
+.fa-duotone.fa-hexagon-xmark:after, .fa-duotone.fa-times-hexagon:after, .fa-duotone.fa-xmark-hexagon:after, .fad.fa-hexagon-xmark:after, .fad.fa-times-hexagon:after, .fad.fa-xmark-hexagon:after {
+  content: "\f2ee\f2ee";
+}
+
+.fa-duotone.fa-circle-h:after, .fa-duotone.fa-hospital-symbol:after, .fad.fa-circle-h:after, .fad.fa-hospital-symbol:after {
+  content: "\f47e\f47e";
+}
+
+.fa-duotone.fa-merge:after, .fad.fa-merge:after {
+  content: "\e526\e526";
+}
+
+.fa-duotone.fa-pager:after, .fad.fa-pager:after {
+  content: "\f815\f815";
+}
+
+.fa-duotone.fa-cart-minus:after, .fad.fa-cart-minus:after {
+  content: "\e0db\e0db";
+}
+
+.fa-duotone.fa-address-book:after, .fa-duotone.fa-contact-book:after, .fad.fa-address-book:after, .fad.fa-contact-book:after {
+  content: "\f2b9\f2b9";
+}
+
+.fa-duotone.fa-pan-frying:after, .fad.fa-pan-frying:after {
+  content: "\e42c\e42c";
+}
+
+.fa-duotone.fa-grid-3:after, .fa-duotone.fa-grid:after, .fad.fa-grid-3:after, .fad.fa-grid:after {
+  content: "\e195\e195";
+}
+
+.fa-duotone.fa-football-helmet:after, .fad.fa-football-helmet:after {
+  content: "\f44f\f44f";
+}
+
+.fa-duotone.fa-hand-love:after, .fad.fa-hand-love:after {
+  content: "\e1a5\e1a5";
+}
+
+.fa-duotone.fa-trees:after, .fad.fa-trees:after {
+  content: "\f724\f724";
+}
+
+.fa-duotone.fa-strikethrough:after, .fad.fa-strikethrough:after {
+  content: "\f0cc\f0cc";
+}
+
+.fa-duotone.fa-page:after, .fad.fa-page:after {
+  content: "\e428\e428";
+}
+
+.fa-duotone.fa-k:after, .fad.fa-k:after {
+  content: "\4b\4b";
+}
+
+.fa-duotone.fa-diagram-previous:after, .fad.fa-diagram-previous:after {
+  content: "\e478\e478";
+}
+
+.fa-duotone.fa-gauge-min:after, .fa-duotone.fa-tachometer-alt-slowest:after, .fad.fa-gauge-min:after, .fad.fa-tachometer-alt-slowest:after {
+  content: "\f628\f628";
+}
+
+.fa-duotone.fa-folder-grid:after, .fad.fa-folder-grid:after {
+  content: "\e188\e188";
+}
+
+.fa-duotone.fa-eggplant:after, .fad.fa-eggplant:after {
+  content: "\e16c\e16c";
+}
+
+.fa-duotone.fa-excavator:after, .fad.fa-excavator:after {
+  content: "\e656\e656";
+}
+
+.fa-duotone.fa-ram:after, .fad.fa-ram:after {
+  content: "\f70a\f70a";
+}
+
+.fa-duotone.fa-landmark-flag:after, .fad.fa-landmark-flag:after {
+  content: "\e51c\e51c";
+}
+
+.fa-duotone.fa-lips:after, .fad.fa-lips:after {
+  content: "\f600\f600";
+}
+
+.fa-duotone.fa-pencil-alt:after, .fa-duotone.fa-pencil:after, .fad.fa-pencil-alt:after, .fad.fa-pencil:after {
+  content: "\f303\f303";
+}
+
+.fa-duotone.fa-backward:after, .fad.fa-backward:after {
+  content: "\f04a\f04a";
+}
+
+.fa-duotone.fa-caret-right:after, .fad.fa-caret-right:after {
+  content: "\f0da\f0da";
+}
+
+.fa-duotone.fa-comments:after, .fad.fa-comments:after {
+  content: "\f086\f086";
+}
+
+.fa-duotone.fa-file-clipboard:after, .fa-duotone.fa-paste:after, .fad.fa-file-clipboard:after, .fad.fa-paste:after {
+  content: "\f0ea\f0ea";
+}
+
+.fa-duotone.fa-desktop-arrow-down:after, .fad.fa-desktop-arrow-down:after {
+  content: "\e155\e155";
+}
+
+.fa-duotone.fa-code-pull-request:after, .fad.fa-code-pull-request:after {
+  content: "\e13c\e13c";
+}
+
+.fa-duotone.fa-pumpkin:after, .fad.fa-pumpkin:after {
+  content: "\f707\f707";
+}
+
+.fa-duotone.fa-clipboard-list:after, .fad.fa-clipboard-list:after {
+  content: "\f46d\f46d";
+}
+
+.fa-duotone.fa-pen-field:after, .fad.fa-pen-field:after {
+  content: "\e211\e211";
+}
+
+.fa-duotone.fa-blueberries:after, .fad.fa-blueberries:after {
+  content: "\e2e8\e2e8";
+}
+
+.fa-duotone.fa-truck-loading:after, .fa-duotone.fa-truck-ramp-box:after, .fad.fa-truck-loading:after, .fad.fa-truck-ramp-box:after {
+  content: "\f4de\f4de";
+}
+
+.fa-duotone.fa-note:after, .fad.fa-note:after {
+  content: "\e1ff\e1ff";
+}
+
+.fa-duotone.fa-arrow-down-to-square:after, .fad.fa-arrow-down-to-square:after {
+  content: "\e096\e096";
+}
+
+.fa-duotone.fa-user-check:after, .fad.fa-user-check:after {
+  content: "\f4fc\f4fc";
+}
+
+.fa-duotone.fa-cloud-xmark:after, .fad.fa-cloud-xmark:after {
+  content: "\e35f\e35f";
+}
+
+.fa-duotone.fa-vial-virus:after, .fad.fa-vial-virus:after {
+  content: "\e597\e597";
+}
+
+.fa-duotone.fa-book-alt:after, .fa-duotone.fa-book-blank:after, .fad.fa-book-alt:after, .fad.fa-book-blank:after {
+  content: "\f5d9\f5d9";
+}
+
+.fa-duotone.fa-golf-flag-hole:after, .fad.fa-golf-flag-hole:after {
+  content: "\e3ac\e3ac";
+}
+
+.fa-duotone.fa-comment-alt-arrow-down:after, .fa-duotone.fa-message-arrow-down:after, .fad.fa-comment-alt-arrow-down:after, .fad.fa-message-arrow-down:after {
+  content: "\e1db\e1db";
+}
+
+.fa-duotone.fa-face-unamused:after, .fad.fa-face-unamused:after {
+  content: "\e39f\e39f";
+}
+
+.fa-duotone.fa-sheet-plastic:after, .fad.fa-sheet-plastic:after {
+  content: "\e571\e571";
+}
+
+.fa-duotone.fa-circle-9:after, .fad.fa-circle-9:after {
+  content: "\e0f6\e0f6";
+}
+
+.fa-duotone.fa-blog:after, .fad.fa-blog:after {
+  content: "\f781\f781";
+}
+
+.fa-duotone.fa-user-ninja:after, .fad.fa-user-ninja:after {
+  content: "\f504\f504";
+}
+
+.fa-duotone.fa-pencil-slash:after, .fad.fa-pencil-slash:after {
+  content: "\e215\e215";
+}
+
+.fa-duotone.fa-bowling-pins:after, .fad.fa-bowling-pins:after {
+  content: "\f437\f437";
+}
+
+.fa-duotone.fa-person-arrow-up-from-line:after, .fad.fa-person-arrow-up-from-line:after {
+  content: "\e539\e539";
+}
+
+.fa-duotone.fa-down-right:after, .fad.fa-down-right:after {
+  content: "\e16b\e16b";
+}
+
+.fa-duotone.fa-scroll-torah:after, .fa-duotone.fa-torah:after, .fad.fa-scroll-torah:after, .fad.fa-torah:after {
+  content: "\f6a0\f6a0";
+}
+
+.fa-duotone.fa-webhook:after, .fad.fa-webhook:after {
+  content: "\e5d5\e5d5";
+}
+
+.fa-duotone.fa-blinds-open:after, .fad.fa-blinds-open:after {
+  content: "\f8fc\f8fc";
+}
+
+.fa-duotone.fa-fence:after, .fad.fa-fence:after {
+  content: "\e303\e303";
+}
+
+.fa-duotone.fa-arrow-alt-up:after, .fa-duotone.fa-up:after, .fad.fa-arrow-alt-up:after, .fad.fa-up:after {
+  content: "\f357\f357";
+}
+
+.fa-duotone.fa-broom-ball:after, .fa-duotone.fa-quidditch-broom-ball:after, .fa-duotone.fa-quidditch:after, .fad.fa-broom-ball:after, .fad.fa-quidditch-broom-ball:after, .fad.fa-quidditch:after {
+  content: "\f458\f458";
+}
+
+.fa-duotone.fa-drumstick:after, .fad.fa-drumstick:after {
+  content: "\f6d6\f6d6";
+}
+
+.fa-duotone.fa-square-v:after, .fad.fa-square-v:after {
+  content: "\e284\e284";
+}
+
+.fa-duotone.fa-face-awesome:after, .fa-duotone.fa-gave-dandy:after, .fad.fa-face-awesome:after, .fad.fa-gave-dandy:after {
+  content: "\e409\e409";
+}
+
+.fa-duotone.fa-dial-off:after, .fad.fa-dial-off:after {
+  content: "\e162\e162";
+}
+
+.fa-duotone.fa-toggle-off:after, .fad.fa-toggle-off:after {
+  content: "\f204\f204";
+}
+
+.fa-duotone.fa-face-smile-horns:after, .fad.fa-face-smile-horns:after {
+  content: "\e391\e391";
+}
+
+.fa-duotone.fa-archive:after, .fa-duotone.fa-box-archive:after, .fad.fa-archive:after, .fad.fa-box-archive:after {
+  content: "\f187\f187";
+}
+
+.fa-duotone.fa-grapes:after, .fad.fa-grapes:after {
+  content: "\e306\e306";
+}
+
+.fa-duotone.fa-person-drowning:after, .fad.fa-person-drowning:after {
+  content: "\e545\e545";
+}
+
+.fa-duotone.fa-dial-max:after, .fad.fa-dial-max:after {
+  content: "\e15e\e15e";
+}
+
+.fa-duotone.fa-circle-m:after, .fad.fa-circle-m:after {
+  content: "\e115\e115";
+}
+
+.fa-duotone.fa-calendar-image:after, .fad.fa-calendar-image:after {
+  content: "\e0d4\e0d4";
+}
+
+.fa-duotone.fa-caret-circle-down:after, .fa-duotone.fa-circle-caret-down:after, .fad.fa-caret-circle-down:after, .fad.fa-circle-caret-down:after {
+  content: "\f32d\f32d";
+}
+
+.fa-duotone.fa-arrow-down-9-1:after, .fa-duotone.fa-sort-numeric-desc:after, .fa-duotone.fa-sort-numeric-down-alt:after, .fad.fa-arrow-down-9-1:after, .fad.fa-sort-numeric-desc:after, .fad.fa-sort-numeric-down-alt:after {
+  content: "\f886\f886";
+}
+
+.fa-duotone.fa-face-grin-tongue-squint:after, .fa-duotone.fa-grin-tongue-squint:after, .fad.fa-face-grin-tongue-squint:after, .fad.fa-grin-tongue-squint:after {
+  content: "\f58a\f58a";
+}
+
+.fa-duotone.fa-shish-kebab:after, .fad.fa-shish-kebab:after {
+  content: "\f821\f821";
+}
+
+.fa-duotone.fa-spray-can:after, .fad.fa-spray-can:after {
+  content: "\f5bd\f5bd";
+}
+
+.fa-duotone.fa-alarm-snooze:after, .fad.fa-alarm-snooze:after {
+  content: "\f845\f845";
+}
+
+.fa-duotone.fa-scarecrow:after, .fad.fa-scarecrow:after {
+  content: "\f70d\f70d";
+}
+
+.fa-duotone.fa-truck-monster:after, .fad.fa-truck-monster:after {
+  content: "\f63b\f63b";
+}
+
+.fa-duotone.fa-gift-card:after, .fad.fa-gift-card:after {
+  content: "\f663\f663";
+}
+
+.fa-duotone.fa-w:after, .fad.fa-w:after {
+  content: "\57\57";
+}
+
+.fa-duotone.fa-code-pull-request-draft:after, .fad.fa-code-pull-request-draft:after {
+  content: "\e3fa\e3fa";
+}
+
+.fa-duotone.fa-square-b:after, .fad.fa-square-b:after {
+  content: "\e264\e264";
+}
+
+.fa-duotone.fa-elephant:after, .fad.fa-elephant:after {
+  content: "\f6da\f6da";
+}
+
+.fa-duotone.fa-earth-africa:after, .fa-duotone.fa-globe-africa:after, .fad.fa-earth-africa:after, .fad.fa-globe-africa:after {
+  content: "\f57c\f57c";
+}
+
+.fa-duotone.fa-rainbow:after, .fad.fa-rainbow:after {
+  content: "\f75b\f75b";
+}
+
+.fa-duotone.fa-circle-notch:after, .fad.fa-circle-notch:after {
+  content: "\f1ce\f1ce";
+}
+
+.fa-duotone.fa-tablet-alt:after, .fa-duotone.fa-tablet-screen-button:after, .fad.fa-tablet-alt:after, .fad.fa-tablet-screen-button:after {
+  content: "\f3fa\f3fa";
+}
+
+.fa-duotone.fa-paw:after, .fad.fa-paw:after {
+  content: "\f1b0\f1b0";
+}
+
+.fa-duotone.fa-message-question:after, .fad.fa-message-question:after {
+  content: "\e1e3\e1e3";
+}
+
+.fa-duotone.fa-cloud:after, .fad.fa-cloud:after {
+  content: "\f0c2\f0c2";
+}
+
+.fa-duotone.fa-trowel-bricks:after, .fad.fa-trowel-bricks:after {
+  content: "\e58a\e58a";
+}
+
+.fa-duotone.fa-square-3:after, .fad.fa-square-3:after {
+  content: "\e258\e258";
+}
+
+.fa-duotone.fa-face-flushed:after, .fa-duotone.fa-flushed:after, .fad.fa-face-flushed:after, .fad.fa-flushed:after {
+  content: "\f579\f579";
+}
+
+.fa-duotone.fa-hospital-user:after, .fad.fa-hospital-user:after {
+  content: "\f80d\f80d";
+}
+
+.fa-duotone.fa-microwave:after, .fad.fa-microwave:after {
+  content: "\e01b\e01b";
+}
+
+.fa-duotone.fa-chf-sign:after, .fad.fa-chf-sign:after {
+  content: "\e602\e602";
+}
+
+.fa-duotone.fa-tent-arrow-left-right:after, .fad.fa-tent-arrow-left-right:after {
+  content: "\e57f\e57f";
+}
+
+.fa-duotone.fa-cart-circle-arrow-up:after, .fad.fa-cart-circle-arrow-up:after {
+  content: "\e3f0\e3f0";
+}
+
+.fa-duotone.fa-trash-clock:after, .fad.fa-trash-clock:after {
+  content: "\e2b0\e2b0";
+}
+
+.fa-duotone.fa-reflect-both:after, .fad.fa-reflect-both:after {
+  content: "\e66f\e66f";
+}
+
+.fa-duotone.fa-gavel:after, .fa-duotone.fa-legal:after, .fad.fa-gavel:after, .fad.fa-legal:after {
+  content: "\f0e3\f0e3";
+}
+
+.fa-duotone.fa-sprinkler-ceiling:after, .fad.fa-sprinkler-ceiling:after {
+  content: "\e44c\e44c";
+}
+
+.fa-duotone.fa-browsers:after, .fad.fa-browsers:after {
+  content: "\e0cb\e0cb";
+}
+
+.fa-duotone.fa-trillium:after, .fad.fa-trillium:after {
+  content: "\e588\e588";
+}
+
+.fa-duotone.fa-music-slash:after, .fad.fa-music-slash:after {
+  content: "\f8d1\f8d1";
+}
+
+.fa-duotone.fa-truck-ramp:after, .fad.fa-truck-ramp:after {
+  content: "\f4e0\f4e0";
+}
+
+.fa-duotone.fa-binoculars:after, .fad.fa-binoculars:after {
+  content: "\f1e5\f1e5";
+}
+
+.fa-duotone.fa-microphone-slash:after, .fad.fa-microphone-slash:after {
+  content: "\f131\f131";
+}
+
+.fa-duotone.fa-box-tissue:after, .fad.fa-box-tissue:after {
+  content: "\e05b\e05b";
+}
+
+.fa-duotone.fa-circle-c:after, .fad.fa-circle-c:after {
+  content: "\e101\e101";
+}
+
+.fa-duotone.fa-star-christmas:after, .fad.fa-star-christmas:after {
+  content: "\f7d4\f7d4";
+}
+
+.fa-duotone.fa-chart-bullet:after, .fad.fa-chart-bullet:after {
+  content: "\e0e1\e0e1";
+}
+
+.fa-duotone.fa-motorcycle:after, .fad.fa-motorcycle:after {
+  content: "\f21c\f21c";
+}
+
+.fa-duotone.fa-tree-christmas:after, .fad.fa-tree-christmas:after {
+  content: "\f7db\f7db";
+}
+
+.fa-duotone.fa-tire-flat:after, .fad.fa-tire-flat:after {
+  content: "\f632\f632";
+}
+
+.fa-duotone.fa-sunglasses:after, .fad.fa-sunglasses:after {
+  content: "\f892\f892";
+}
+
+.fa-duotone.fa-badge:after, .fad.fa-badge:after {
+  content: "\f335\f335";
+}
+
+.fa-duotone.fa-comment-alt-edit:after, .fa-duotone.fa-message-edit:after, .fa-duotone.fa-message-pen:after, .fad.fa-comment-alt-edit:after, .fad.fa-message-edit:after, .fad.fa-message-pen:after {
+  content: "\f4a4\f4a4";
+}
+
+.fa-duotone.fa-bell-concierge:after, .fa-duotone.fa-concierge-bell:after, .fad.fa-bell-concierge:after, .fad.fa-concierge-bell:after {
+  content: "\f562\f562";
+}
+
+.fa-duotone.fa-pen-ruler:after, .fa-duotone.fa-pencil-ruler:after, .fad.fa-pen-ruler:after, .fad.fa-pencil-ruler:after {
+  content: "\f5ae\f5ae";
+}
+
+.fa-duotone.fa-file-mp3:after, .fad.fa-file-mp3:after {
+  content: "\e648\e648";
+}
+
+.fa-duotone.fa-arrow-progress:after, .fad.fa-arrow-progress:after {
+  content: "\e5df\e5df";
+}
+
+.fa-duotone.fa-chess-rook-alt:after, .fa-duotone.fa-chess-rook-piece:after, .fad.fa-chess-rook-alt:after, .fad.fa-chess-rook-piece:after {
+  content: "\f448\f448";
+}
+
+.fa-duotone.fa-square-root:after, .fad.fa-square-root:after {
+  content: "\f697\f697";
+}
+
+.fa-duotone.fa-album-collection-circle-plus:after, .fad.fa-album-collection-circle-plus:after {
+  content: "\e48e\e48e";
+}
+
+.fa-duotone.fa-people-arrows-left-right:after, .fa-duotone.fa-people-arrows:after, .fad.fa-people-arrows-left-right:after, .fad.fa-people-arrows:after {
+  content: "\e068\e068";
+}
+
+.fa-duotone.fa-sign-post:after, .fad.fa-sign-post:after {
+  content: "\e624\e624";
+}
+
+.fa-duotone.fa-face-angry-horns:after, .fad.fa-face-angry-horns:after {
+  content: "\e368\e368";
+}
+
+.fa-duotone.fa-mars-and-venus-burst:after, .fad.fa-mars-and-venus-burst:after {
+  content: "\e523\e523";
+}
+
+.fa-duotone.fa-tombstone:after, .fad.fa-tombstone:after {
+  content: "\f720\f720";
+}
+
+.fa-duotone.fa-caret-square-right:after, .fa-duotone.fa-square-caret-right:after, .fad.fa-caret-square-right:after, .fad.fa-square-caret-right:after {
+  content: "\f152\f152";
+}
+
+.fa-duotone.fa-cut:after, .fa-duotone.fa-scissors:after, .fad.fa-cut:after, .fad.fa-scissors:after {
+  content: "\f0c4\f0c4";
+}
+
+.fa-duotone.fa-list-music:after, .fad.fa-list-music:after {
+  content: "\f8c9\f8c9";
+}
+
+.fa-duotone.fa-sun-plant-wilt:after, .fad.fa-sun-plant-wilt:after {
+  content: "\e57a\e57a";
+}
+
+.fa-duotone.fa-toilets-portable:after, .fad.fa-toilets-portable:after {
+  content: "\e584\e584";
+}
+
+.fa-duotone.fa-hockey-puck:after, .fad.fa-hockey-puck:after {
+  content: "\f453\f453";
+}
+
+.fa-duotone.fa-mustache:after, .fad.fa-mustache:after {
+  content: "\e5bc\e5bc";
+}
+
+.fa-duotone.fa-hyphen:after, .fad.fa-hyphen:after {
+  content: "\2d\2d";
+}
+
+.fa-duotone.fa-table:after, .fad.fa-table:after {
+  content: "\f0ce\f0ce";
+}
+
+.fa-duotone.fa-user-chef:after, .fad.fa-user-chef:after {
+  content: "\e3d2\e3d2";
+}
+
+.fa-duotone.fa-comment-alt-image:after, .fa-duotone.fa-message-image:after, .fad.fa-comment-alt-image:after, .fad.fa-message-image:after {
+  content: "\e1e0\e1e0";
+}
+
+.fa-duotone.fa-users-medical:after, .fad.fa-users-medical:after {
+  content: "\f830\f830";
+}
+
+.fa-duotone.fa-sensor-alert:after, .fa-duotone.fa-sensor-triangle-exclamation:after, .fad.fa-sensor-alert:after, .fad.fa-sensor-triangle-exclamation:after {
+  content: "\e029\e029";
+}
+
+.fa-duotone.fa-magnifying-glass-arrow-right:after, .fad.fa-magnifying-glass-arrow-right:after {
+  content: "\e521\e521";
+}
+
+.fa-duotone.fa-digital-tachograph:after, .fa-duotone.fa-tachograph-digital:after, .fad.fa-digital-tachograph:after, .fad.fa-tachograph-digital:after {
+  content: "\f566\f566";
+}
+
+.fa-duotone.fa-face-mask:after, .fad.fa-face-mask:after {
+  content: "\e37f\e37f";
+}
+
+.fa-duotone.fa-pickleball:after, .fad.fa-pickleball:after {
+  content: "\e435\e435";
+}
+
+.fa-duotone.fa-star-sharp-half:after, .fad.fa-star-sharp-half:after {
+  content: "\e28c\e28c";
+}
+
+.fa-duotone.fa-users-slash:after, .fad.fa-users-slash:after {
+  content: "\e073\e073";
+}
+
+.fa-duotone.fa-clover:after, .fad.fa-clover:after {
+  content: "\e139\e139";
+}
+
+.fa-duotone.fa-meat:after, .fad.fa-meat:after {
+  content: "\f814\f814";
+}
+
+.fa-duotone.fa-mail-reply:after, .fa-duotone.fa-reply:after, .fad.fa-mail-reply:after, .fad.fa-reply:after {
+  content: "\f3e5\f3e5";
+}
+
+.fa-duotone.fa-star-and-crescent:after, .fad.fa-star-and-crescent:after {
+  content: "\f699\f699";
+}
+
+.fa-duotone.fa-empty-set:after, .fad.fa-empty-set:after {
+  content: "\f656\f656";
+}
+
+.fa-duotone.fa-house-fire:after, .fad.fa-house-fire:after {
+  content: "\e50c\e50c";
+}
+
+.fa-duotone.fa-minus-square:after, .fa-duotone.fa-square-minus:after, .fad.fa-minus-square:after, .fad.fa-square-minus:after {
+  content: "\f146\f146";
+}
+
+.fa-duotone.fa-helicopter:after, .fad.fa-helicopter:after {
+  content: "\f533\f533";
+}
+
+.fa-duotone.fa-bird:after, .fad.fa-bird:after {
+  content: "\e469\e469";
+}
+
+.fa-duotone.fa-compass:after, .fad.fa-compass:after {
+  content: "\f14e\f14e";
+}
+
+.fa-duotone.fa-caret-square-down:after, .fa-duotone.fa-square-caret-down:after, .fad.fa-caret-square-down:after, .fad.fa-square-caret-down:after {
+  content: "\f150\f150";
+}
+
+.fa-duotone.fa-heart-half-alt:after, .fa-duotone.fa-heart-half-stroke:after, .fad.fa-heart-half-alt:after, .fad.fa-heart-half-stroke:after {
+  content: "\e1ac\e1ac";
+}
+
+.fa-duotone.fa-file-circle-question:after, .fad.fa-file-circle-question:after {
+  content: "\e4ef\e4ef";
+}
+
+.fa-duotone.fa-truck-utensils:after, .fad.fa-truck-utensils:after {
+  content: "\e628\e628";
+}
+
+.fa-duotone.fa-laptop-code:after, .fad.fa-laptop-code:after {
+  content: "\f5fc\f5fc";
+}
+
+.fa-duotone.fa-joystick:after, .fad.fa-joystick:after {
+  content: "\f8c5\f8c5";
+}
+
+.fa-duotone.fa-grill-fire:after, .fad.fa-grill-fire:after {
+  content: "\e5a4\e5a4";
+}
+
+.fa-duotone.fa-rectangle-vertical-history:after, .fad.fa-rectangle-vertical-history:after {
+  content: "\e237\e237";
+}
+
+.fa-duotone.fa-swatchbook:after, .fad.fa-swatchbook:after {
+  content: "\f5c3\f5c3";
+}
+
+.fa-duotone.fa-prescription-bottle:after, .fad.fa-prescription-bottle:after {
+  content: "\f485\f485";
+}
+
+.fa-duotone.fa-bars:after, .fa-duotone.fa-navicon:after, .fad.fa-bars:after, .fad.fa-navicon:after {
+  content: "\f0c9\f0c9";
+}
+
+.fa-duotone.fa-keyboard-left:after, .fad.fa-keyboard-left:after {
+  content: "\e1c3\e1c3";
+}
+
+.fa-duotone.fa-people-group:after, .fad.fa-people-group:after {
+  content: "\e533\e533";
+}
+
+.fa-duotone.fa-hourglass-3:after, .fa-duotone.fa-hourglass-end:after, .fad.fa-hourglass-3:after, .fad.fa-hourglass-end:after {
+  content: "\f253\f253";
+}
+
+.fa-duotone.fa-heart-broken:after, .fa-duotone.fa-heart-crack:after, .fad.fa-heart-broken:after, .fad.fa-heart-crack:after {
+  content: "\f7a9\f7a9";
+}
+
+.fa-duotone.fa-face-beam-hand-over-mouth:after, .fad.fa-face-beam-hand-over-mouth:after {
+  content: "\e47c\e47c";
+}
+
+.fa-duotone.fa-droplet-percent:after, .fa-duotone.fa-humidity:after, .fad.fa-droplet-percent:after, .fad.fa-humidity:after {
+  content: "\f750\f750";
+}
+
+.fa-duotone.fa-external-link-square-alt:after, .fa-duotone.fa-square-up-right:after, .fad.fa-external-link-square-alt:after, .fad.fa-square-up-right:after {
+  content: "\f360\f360";
+}
+
+.fa-duotone.fa-face-kiss-beam:after, .fa-duotone.fa-kiss-beam:after, .fad.fa-face-kiss-beam:after, .fad.fa-kiss-beam:after {
+  content: "\f597\f597";
+}
+
+.fa-duotone.fa-corn:after, .fad.fa-corn:after {
+  content: "\f6c7\f6c7";
+}
+
+.fa-duotone.fa-roller-coaster:after, .fad.fa-roller-coaster:after {
+  content: "\e324\e324";
+}
+
+.fa-duotone.fa-photo-film-music:after, .fad.fa-photo-film-music:after {
+  content: "\e228\e228";
+}
+
+.fa-duotone.fa-radar:after, .fad.fa-radar:after {
+  content: "\e024\e024";
+}
+
+.fa-duotone.fa-sickle:after, .fad.fa-sickle:after {
+  content: "\f822\f822";
+}
+
+.fa-duotone.fa-film:after, .fad.fa-film:after {
+  content: "\f008\f008";
+}
+
+.fa-duotone.fa-coconut:after, .fad.fa-coconut:after {
+  content: "\e2f6\e2f6";
+}
+
+.fa-duotone.fa-ruler-horizontal:after, .fad.fa-ruler-horizontal:after {
+  content: "\f547\f547";
+}
+
+.fa-duotone.fa-shield-cross:after, .fad.fa-shield-cross:after {
+  content: "\f712\f712";
+}
+
+.fa-duotone.fa-cassette-tape:after, .fad.fa-cassette-tape:after {
+  content: "\f8ab\f8ab";
+}
+
+.fa-duotone.fa-square-terminal:after, .fad.fa-square-terminal:after {
+  content: "\e32a\e32a";
+}
+
+.fa-duotone.fa-people-robbery:after, .fad.fa-people-robbery:after {
+  content: "\e536\e536";
+}
+
+.fa-duotone.fa-lightbulb:after, .fad.fa-lightbulb:after {
+  content: "\f0eb\f0eb";
+}
+
+.fa-duotone.fa-caret-left:after, .fad.fa-caret-left:after {
+  content: "\f0d9\f0d9";
+}
+
+.fa-duotone.fa-comment-middle:after, .fad.fa-comment-middle:after {
+  content: "\e149\e149";
+}
+
+.fa-duotone.fa-trash-can-list:after, .fad.fa-trash-can-list:after {
+  content: "\e2ab\e2ab";
+}
+
+.fa-duotone.fa-block:after, .fad.fa-block:after {
+  content: "\e46a\e46a";
+}
+
+.fa-duotone.fa-circle-exclamation:after, .fa-duotone.fa-exclamation-circle:after, .fad.fa-circle-exclamation:after, .fad.fa-exclamation-circle:after {
+  content: "\f06a\f06a";
+}
+
+.fa-duotone.fa-school-circle-xmark:after, .fad.fa-school-circle-xmark:after {
+  content: "\e56d\e56d";
+}
+
+.fa-duotone.fa-arrow-right-from-bracket:after, .fa-duotone.fa-sign-out:after, .fad.fa-arrow-right-from-bracket:after, .fad.fa-sign-out:after {
+  content: "\f08b\f08b";
+}
+
+.fa-duotone.fa-face-frown-slight:after, .fad.fa-face-frown-slight:after {
+  content: "\e376\e376";
+}
+
+.fa-duotone.fa-chevron-circle-down:after, .fa-duotone.fa-circle-chevron-down:after, .fad.fa-chevron-circle-down:after, .fad.fa-circle-chevron-down:after {
+  content: "\f13a\f13a";
+}
+
+.fa-duotone.fa-sidebar-flip:after, .fad.fa-sidebar-flip:after {
+  content: "\e24f\e24f";
+}
+
+.fa-duotone.fa-unlock-alt:after, .fa-duotone.fa-unlock-keyhole:after, .fad.fa-unlock-alt:after, .fad.fa-unlock-keyhole:after {
+  content: "\f13e\f13e";
+}
+
+.fa-duotone.fa-temperature-list:after, .fad.fa-temperature-list:after {
+  content: "\e299\e299";
+}
+
+.fa-duotone.fa-cloud-showers-heavy:after, .fad.fa-cloud-showers-heavy:after {
+  content: "\f740\f740";
+}
+
+.fa-duotone.fa-headphones-alt:after, .fa-duotone.fa-headphones-simple:after, .fad.fa-headphones-alt:after, .fad.fa-headphones-simple:after {
+  content: "\f58f\f58f";
+}
+
+.fa-duotone.fa-sitemap:after, .fad.fa-sitemap:after {
+  content: "\f0e8\f0e8";
+}
+
+.fa-duotone.fa-pipe-section:after, .fad.fa-pipe-section:after {
+  content: "\e438\e438";
+}
+
+.fa-duotone.fa-space-station-moon-alt:after, .fa-duotone.fa-space-station-moon-construction:after, .fad.fa-space-station-moon-alt:after, .fad.fa-space-station-moon-construction:after {
+  content: "\e034\e034";
+}
+
+.fa-duotone.fa-circle-dollar-to-slot:after, .fa-duotone.fa-donate:after, .fad.fa-circle-dollar-to-slot:after, .fad.fa-donate:after {
+  content: "\f4b9\f4b9";
+}
+
+.fa-duotone.fa-memory:after, .fad.fa-memory:after {
+  content: "\f538\f538";
+}
+
+.fa-duotone.fa-face-sleeping:after, .fad.fa-face-sleeping:after {
+  content: "\e38d\e38d";
+}
+
+.fa-duotone.fa-road-spikes:after, .fad.fa-road-spikes:after {
+  content: "\e568\e568";
+}
+
+.fa-duotone.fa-fire-burner:after, .fad.fa-fire-burner:after {
+  content: "\e4f1\e4f1";
+}
+
+.fa-duotone.fa-squirrel:after, .fad.fa-squirrel:after {
+  content: "\f71a\f71a";
+}
+
+.fa-duotone.fa-arrow-to-top:after, .fa-duotone.fa-arrow-up-to-line:after, .fad.fa-arrow-to-top:after, .fad.fa-arrow-up-to-line:after {
+  content: "\f341\f341";
+}
+
+.fa-duotone.fa-flag:after, .fad.fa-flag:after {
+  content: "\f024\f024";
+}
+
+.fa-duotone.fa-face-cowboy-hat:after, .fad.fa-face-cowboy-hat:after {
+  content: "\e36e\e36e";
+}
+
+.fa-duotone.fa-hanukiah:after, .fad.fa-hanukiah:after {
+  content: "\f6e6\f6e6";
+}
+
+.fa-duotone.fa-chart-scatter-3d:after, .fad.fa-chart-scatter-3d:after {
+  content: "\e0e8\e0e8";
+}
+
+.fa-duotone.fa-display-chart-up:after, .fad.fa-display-chart-up:after {
+  content: "\e5e3\e5e3";
+}
+
+.fa-duotone.fa-square-code:after, .fad.fa-square-code:after {
+  content: "\e267\e267";
+}
+
+.fa-duotone.fa-feather:after, .fad.fa-feather:after {
+  content: "\f52d\f52d";
+}
+
+.fa-duotone.fa-volume-down:after, .fa-duotone.fa-volume-low:after, .fad.fa-volume-down:after, .fad.fa-volume-low:after {
+  content: "\f027\f027";
+}
+
+.fa-duotone.fa-times-to-slot:after, .fa-duotone.fa-vote-nay:after, .fa-duotone.fa-xmark-to-slot:after, .fad.fa-times-to-slot:after, .fad.fa-vote-nay:after, .fad.fa-xmark-to-slot:after {
+  content: "\f771\f771";
+}
+
+.fa-duotone.fa-box-alt:after, .fa-duotone.fa-box-taped:after, .fad.fa-box-alt:after, .fad.fa-box-taped:after {
+  content: "\f49a\f49a";
+}
+
+.fa-duotone.fa-comment-slash:after, .fad.fa-comment-slash:after {
+  content: "\f4b3\f4b3";
+}
+
+.fa-duotone.fa-swords:after, .fad.fa-swords:after {
+  content: "\f71d\f71d";
+}
+
+.fa-duotone.fa-cloud-sun-rain:after, .fad.fa-cloud-sun-rain:after {
+  content: "\f743\f743";
+}
+
+.fa-duotone.fa-album:after, .fad.fa-album:after {
+  content: "\f89f\f89f";
+}
+
+.fa-duotone.fa-circle-n:after, .fad.fa-circle-n:after {
+  content: "\e118\e118";
+}
+
+.fa-duotone.fa-compress:after, .fad.fa-compress:after {
+  content: "\f066\f066";
+}
+
+.fa-duotone.fa-wheat-alt:after, .fa-duotone.fa-wheat-awn:after, .fad.fa-wheat-alt:after, .fad.fa-wheat-awn:after {
+  content: "\e2cd\e2cd";
+}
+
+.fa-duotone.fa-ankh:after, .fad.fa-ankh:after {
+  content: "\f644\f644";
+}
+
+.fa-duotone.fa-hands-holding-child:after, .fad.fa-hands-holding-child:after {
+  content: "\e4fa\e4fa";
+}
+
+.fa-duotone.fa-asterisk:after, .fad.fa-asterisk:after {
+  content: "\2a\2a";
+}
+
+.fa-duotone.fa-key-skeleton-left-right:after, .fad.fa-key-skeleton-left-right:after {
+  content: "\e3b4\e3b4";
+}
+
+.fa-duotone.fa-comment-lines:after, .fad.fa-comment-lines:after {
+  content: "\f4b0\f4b0";
+}
+
+.fa-duotone.fa-luchador-mask:after, .fa-duotone.fa-luchador:after, .fa-duotone.fa-mask-luchador:after, .fad.fa-luchador-mask:after, .fad.fa-luchador:after, .fad.fa-mask-luchador:after {
+  content: "\f455\f455";
+}
+
+.fa-duotone.fa-check-square:after, .fa-duotone.fa-square-check:after, .fad.fa-check-square:after, .fad.fa-square-check:after {
+  content: "\f14a\f14a";
+}
+
+.fa-duotone.fa-shredder:after, .fad.fa-shredder:after {
+  content: "\f68a\f68a";
+}
+
+.fa-duotone.fa-book-open-alt:after, .fa-duotone.fa-book-open-cover:after, .fad.fa-book-open-alt:after, .fad.fa-book-open-cover:after {
+  content: "\e0c0\e0c0";
+}
+
+.fa-duotone.fa-sandwich:after, .fad.fa-sandwich:after {
+  content: "\f81f\f81f";
+}
+
+.fa-duotone.fa-peseta-sign:after, .fad.fa-peseta-sign:after {
+  content: "\e221\e221";
+}
+
+.fa-duotone.fa-parking-slash:after, .fa-duotone.fa-square-parking-slash:after, .fad.fa-parking-slash:after, .fad.fa-square-parking-slash:after {
+  content: "\f617\f617";
+}
+
+.fa-duotone.fa-train-tunnel:after, .fad.fa-train-tunnel:after {
+  content: "\e454\e454";
+}
+
+.fa-duotone.fa-header:after, .fa-duotone.fa-heading:after, .fad.fa-header:after, .fad.fa-heading:after {
+  content: "\f1dc\f1dc";
+}
+
+.fa-duotone.fa-ghost:after, .fad.fa-ghost:after {
+  content: "\f6e2\f6e2";
+}
+
+.fa-duotone.fa-face-anguished:after, .fad.fa-face-anguished:after {
+  content: "\e369\e369";
+}
+
+.fa-duotone.fa-hockey-sticks:after, .fad.fa-hockey-sticks:after {
+  content: "\f454\f454";
+}
+
+.fa-duotone.fa-abacus:after, .fad.fa-abacus:after {
+  content: "\f640\f640";
+}
+
+.fa-duotone.fa-film-alt:after, .fa-duotone.fa-film-simple:after, .fad.fa-film-alt:after, .fad.fa-film-simple:after {
+  content: "\f3a0\f3a0";
+}
+
+.fa-duotone.fa-list-squares:after, .fa-duotone.fa-list:after, .fad.fa-list-squares:after, .fad.fa-list:after {
+  content: "\f03a\f03a";
+}
+
+.fa-duotone.fa-tree-palm:after, .fad.fa-tree-palm:after {
+  content: "\f82b\f82b";
+}
+
+.fa-duotone.fa-phone-square-alt:after, .fa-duotone.fa-square-phone-flip:after, .fad.fa-phone-square-alt:after, .fad.fa-square-phone-flip:after {
+  content: "\f87b\f87b";
+}
+
+.fa-duotone.fa-cart-plus:after, .fad.fa-cart-plus:after {
+  content: "\f217\f217";
+}
+
+.fa-duotone.fa-gamepad:after, .fad.fa-gamepad:after {
+  content: "\f11b\f11b";
+}
+
+.fa-duotone.fa-border-center-v:after, .fad.fa-border-center-v:after {
+  content: "\f89d\f89d";
+}
+
+.fa-duotone.fa-circle-dot:after, .fa-duotone.fa-dot-circle:after, .fad.fa-circle-dot:after, .fad.fa-dot-circle:after {
+  content: "\f192\f192";
+}
+
+.fa-duotone.fa-clipboard-medical:after, .fad.fa-clipboard-medical:after {
+  content: "\e133\e133";
+}
+
+.fa-duotone.fa-dizzy:after, .fa-duotone.fa-face-dizzy:after, .fad.fa-dizzy:after, .fad.fa-face-dizzy:after {
+  content: "\f567\f567";
+}
+
+.fa-duotone.fa-egg:after, .fad.fa-egg:after {
+  content: "\f7fb\f7fb";
+}
+
+.fa-duotone.fa-arrow-alt-to-top:after, .fa-duotone.fa-up-to-line:after, .fad.fa-arrow-alt-to-top:after, .fad.fa-up-to-line:after {
+  content: "\f34d\f34d";
+}
+
+.fa-duotone.fa-house-medical-circle-xmark:after, .fad.fa-house-medical-circle-xmark:after {
+  content: "\e513\e513";
+}
+
+.fa-duotone.fa-watch-fitness:after, .fad.fa-watch-fitness:after {
+  content: "\f63e\f63e";
+}
+
+.fa-duotone.fa-clock-nine-thirty:after, .fad.fa-clock-nine-thirty:after {
+  content: "\e34d\e34d";
+}
+
+.fa-duotone.fa-campground:after, .fad.fa-campground:after {
+  content: "\f6bb\f6bb";
+}
+
+.fa-duotone.fa-folder-plus:after, .fad.fa-folder-plus:after {
+  content: "\f65e\f65e";
+}
+
+.fa-duotone.fa-jug:after, .fad.fa-jug:after {
+  content: "\f8c6\f8c6";
+}
+
+.fa-duotone.fa-futbol-ball:after, .fa-duotone.fa-futbol:after, .fa-duotone.fa-soccer-ball:after, .fad.fa-futbol-ball:after, .fad.fa-futbol:after, .fad.fa-soccer-ball:after {
+  content: "\f1e3\f1e3";
+}
+
+.fa-duotone.fa-snow-blowing:after, .fad.fa-snow-blowing:after {
+  content: "\f761\f761";
+}
+
+.fa-duotone.fa-paint-brush:after, .fa-duotone.fa-paintbrush:after, .fad.fa-paint-brush:after, .fad.fa-paintbrush:after {
+  content: "\f1fc\f1fc";
+}
+
+.fa-duotone.fa-lock:after, .fad.fa-lock:after {
+  content: "\f023\f023";
+}
+
+.fa-duotone.fa-arrow-down-from-line:after, .fa-duotone.fa-arrow-from-top:after, .fad.fa-arrow-down-from-line:after, .fad.fa-arrow-from-top:after {
+  content: "\f345\f345";
+}
+
+.fa-duotone.fa-gas-pump:after, .fad.fa-gas-pump:after {
+  content: "\f52f\f52f";
+}
+
+.fa-duotone.fa-signal-alt-slash:after, .fa-duotone.fa-signal-bars-slash:after, .fad.fa-signal-alt-slash:after, .fad.fa-signal-bars-slash:after {
+  content: "\f694\f694";
+}
+
+.fa-duotone.fa-monkey:after, .fad.fa-monkey:after {
+  content: "\f6fb\f6fb";
+}
+
+.fa-duotone.fa-pro:after, .fa-duotone.fa-rectangle-pro:after, .fad.fa-pro:after, .fad.fa-rectangle-pro:after {
+  content: "\e235\e235";
+}
+
+.fa-duotone.fa-house-night:after, .fad.fa-house-night:after {
+  content: "\e010\e010";
+}
+
+.fa-duotone.fa-hot-tub-person:after, .fa-duotone.fa-hot-tub:after, .fad.fa-hot-tub-person:after, .fad.fa-hot-tub:after {
+  content: "\f593\f593";
+}
+
+.fa-duotone.fa-globe-pointer:after, .fad.fa-globe-pointer:after {
+  content: "\e60e\e60e";
+}
+
+.fa-duotone.fa-blanket:after, .fad.fa-blanket:after {
+  content: "\f498\f498";
+}
+
+.fa-duotone.fa-map-location:after, .fa-duotone.fa-map-marked:after, .fad.fa-map-location:after, .fad.fa-map-marked:after {
+  content: "\f59f\f59f";
+}
+
+.fa-duotone.fa-house-flood-water:after, .fad.fa-house-flood-water:after {
+  content: "\e50e\e50e";
+}
+
+.fa-duotone.fa-comments-question-check:after, .fad.fa-comments-question-check:after {
+  content: "\e14f\e14f";
+}
+
+.fa-duotone.fa-tree:after, .fad.fa-tree:after {
+  content: "\f1bb\f1bb";
+}
+
+.fa-duotone.fa-arrows-cross:after, .fad.fa-arrows-cross:after {
+  content: "\e0a2\e0a2";
+}
+
+.fa-duotone.fa-backpack:after, .fad.fa-backpack:after {
+  content: "\f5d4\f5d4";
+}
+
+.fa-duotone.fa-square-small:after, .fad.fa-square-small:after {
+  content: "\e27e\e27e";
+}
+
+.fa-duotone.fa-folder-arrow-up:after, .fa-duotone.fa-folder-upload:after, .fad.fa-folder-arrow-up:after, .fad.fa-folder-upload:after {
+  content: "\e054\e054";
+}
+
+.fa-duotone.fa-bridge-lock:after, .fad.fa-bridge-lock:after {
+  content: "\e4cc\e4cc";
+}
+
+.fa-duotone.fa-crosshairs-simple:after, .fad.fa-crosshairs-simple:after {
+  content: "\e59f\e59f";
+}
+
+.fa-duotone.fa-sack-dollar:after, .fad.fa-sack-dollar:after {
+  content: "\f81d\f81d";
+}
+
+.fa-duotone.fa-edit:after, .fa-duotone.fa-pen-to-square:after, .fad.fa-edit:after, .fad.fa-pen-to-square:after {
+  content: "\f044\f044";
+}
+
+.fa-duotone.fa-sliders-h-square:after, .fa-duotone.fa-square-sliders:after, .fad.fa-sliders-h-square:after, .fad.fa-square-sliders:after {
+  content: "\f3f0\f3f0";
+}
+
+.fa-duotone.fa-car-side:after, .fad.fa-car-side:after {
+  content: "\f5e4\f5e4";
+}
+
+.fa-duotone.fa-comment-middle-top-alt:after, .fa-duotone.fa-message-middle-top:after, .fad.fa-comment-middle-top-alt:after, .fad.fa-message-middle-top:after {
+  content: "\e1e2\e1e2";
+}
+
+.fa-duotone.fa-lightbulb-on:after, .fad.fa-lightbulb-on:after {
+  content: "\f672\f672";
+}
+
+.fa-duotone.fa-knife:after, .fa-duotone.fa-utensil-knife:after, .fad.fa-knife:after, .fad.fa-utensil-knife:after {
+  content: "\f2e4\f2e4";
+}
+
+.fa-duotone.fa-share-alt:after, .fa-duotone.fa-share-nodes:after, .fad.fa-share-alt:after, .fad.fa-share-nodes:after {
+  content: "\f1e0\f1e0";
+}
+
+.fa-duotone.fa-display-chart-up-circle-dollar:after, .fad.fa-display-chart-up-circle-dollar:after {
+  content: "\e5e6\e5e6";
+}
+
+.fa-duotone.fa-wave-sine:after, .fad.fa-wave-sine:after {
+  content: "\f899\f899";
+}
+
+.fa-duotone.fa-heart-circle-minus:after, .fad.fa-heart-circle-minus:after {
+  content: "\e4ff\e4ff";
+}
+
+.fa-duotone.fa-circle-w:after, .fad.fa-circle-w:after {
+  content: "\e12c\e12c";
+}
+
+.fa-duotone.fa-calendar-circle:after, .fa-duotone.fa-circle-calendar:after, .fad.fa-calendar-circle:after, .fad.fa-circle-calendar:after {
+  content: "\e102\e102";
+}
+
+.fa-duotone.fa-hourglass-2:after, .fa-duotone.fa-hourglass-half:after, .fad.fa-hourglass-2:after, .fad.fa-hourglass-half:after {
+  content: "\f252\f252";
+}
+
+.fa-duotone.fa-microscope:after, .fad.fa-microscope:after {
+  content: "\f610\f610";
+}
+
+.fa-duotone.fa-sunset:after, .fad.fa-sunset:after {
+  content: "\f767\f767";
+}
+
+.fa-duotone.fa-sink:after, .fad.fa-sink:after {
+  content: "\e06d\e06d";
+}
+
+.fa-duotone.fa-calendar-exclamation:after, .fad.fa-calendar-exclamation:after {
+  content: "\f334\f334";
+}
+
+.fa-duotone.fa-truck-container-empty:after, .fad.fa-truck-container-empty:after {
+  content: "\e2b5\e2b5";
+}
+
+.fa-duotone.fa-hand-heart:after, .fad.fa-hand-heart:after {
+  content: "\f4bc\f4bc";
+}
+
+.fa-duotone.fa-bag-shopping:after, .fa-duotone.fa-shopping-bag:after, .fad.fa-bag-shopping:after, .fad.fa-shopping-bag:after {
+  content: "\f290\f290";
+}
+
+.fa-duotone.fa-arrow-down-z-a:after, .fa-duotone.fa-sort-alpha-desc:after, .fa-duotone.fa-sort-alpha-down-alt:after, .fad.fa-arrow-down-z-a:after, .fad.fa-sort-alpha-desc:after, .fad.fa-sort-alpha-down-alt:after {
+  content: "\f881\f881";
+}
+
+.fa-duotone.fa-mitten:after, .fad.fa-mitten:after {
+  content: "\f7b5\f7b5";
+}
+
+.fa-duotone.fa-reply-clock:after, .fa-duotone.fa-reply-time:after, .fad.fa-reply-clock:after, .fad.fa-reply-time:after {
+  content: "\e239\e239";
+}
+
+.fa-duotone.fa-person-rays:after, .fad.fa-person-rays:after {
+  content: "\e54d\e54d";
+}
+
+.fa-duotone.fa-arrow-alt-right:after, .fa-duotone.fa-right:after, .fad.fa-arrow-alt-right:after, .fad.fa-right:after {
+  content: "\f356\f356";
+}
+
+.fa-duotone.fa-circle-f:after, .fad.fa-circle-f:after {
+  content: "\e10e\e10e";
+}
+
+.fa-duotone.fa-users:after, .fad.fa-users:after {
+  content: "\f0c0\f0c0";
+}
+
+.fa-duotone.fa-face-pleading:after, .fad.fa-face-pleading:after {
+  content: "\e386\e386";
+}
+
+.fa-duotone.fa-eye-slash:after, .fad.fa-eye-slash:after {
+  content: "\f070\f070";
+}
+
+.fa-duotone.fa-flask-vial:after, .fad.fa-flask-vial:after {
+  content: "\e4f3\e4f3";
+}
+
+.fa-duotone.fa-police-box:after, .fad.fa-police-box:after {
+  content: "\e021\e021";
+}
+
+.fa-duotone.fa-cucumber:after, .fad.fa-cucumber:after {
+  content: "\e401\e401";
+}
+
+.fa-duotone.fa-head-side-brain:after, .fad.fa-head-side-brain:after {
+  content: "\f808\f808";
+}
+
+.fa-duotone.fa-hand-paper:after, .fa-duotone.fa-hand:after, .fad.fa-hand-paper:after, .fad.fa-hand:after {
+  content: "\f256\f256";
+}
+
+.fa-duotone.fa-biking-mountain:after, .fa-duotone.fa-person-biking-mountain:after, .fad.fa-biking-mountain:after, .fad.fa-person-biking-mountain:after {
+  content: "\f84b\f84b";
+}
+
+.fa-duotone.fa-utensils-slash:after, .fad.fa-utensils-slash:after {
+  content: "\e464\e464";
+}
+
+.fa-duotone.fa-print-magnifying-glass:after, .fa-duotone.fa-print-search:after, .fad.fa-print-magnifying-glass:after, .fad.fa-print-search:after {
+  content: "\f81a\f81a";
+}
+
+.fa-duotone.fa-turn-right:after, .fad.fa-turn-right:after {
+  content: "\e639\e639";
+}
+
+.fa-duotone.fa-folder-bookmark:after, .fad.fa-folder-bookmark:after {
+  content: "\e186\e186";
+}
+
+.fa-duotone.fa-arrow-turn-left-down:after, .fad.fa-arrow-turn-left-down:after {
+  content: "\e633\e633";
+}
+
+.fa-duotone.fa-om:after, .fad.fa-om:after {
+  content: "\f679\f679";
+}
+
+.fa-duotone.fa-pi:after, .fad.fa-pi:after {
+  content: "\f67e\f67e";
+}
+
+.fa-duotone.fa-flask-potion:after, .fa-duotone.fa-flask-round-potion:after, .fad.fa-flask-potion:after, .fad.fa-flask-round-potion:after {
+  content: "\f6e1\f6e1";
+}
+
+.fa-duotone.fa-face-shush:after, .fad.fa-face-shush:after {
+  content: "\e38c\e38c";
+}
+
+.fa-duotone.fa-worm:after, .fad.fa-worm:after {
+  content: "\e599\e599";
+}
+
+.fa-duotone.fa-house-circle-xmark:after, .fad.fa-house-circle-xmark:after {
+  content: "\e50b\e50b";
+}
+
+.fa-duotone.fa-plug:after, .fad.fa-plug:after {
+  content: "\f1e6\f1e6";
+}
+
+.fa-duotone.fa-calendar-circle-exclamation:after, .fad.fa-calendar-circle-exclamation:after {
+  content: "\e46e\e46e";
+}
+
+.fa-duotone.fa-square-i:after, .fad.fa-square-i:after {
+  content: "\e272\e272";
+}
+
+.fa-duotone.fa-chevron-up:after, .fad.fa-chevron-up:after {
+  content: "\f077\f077";
+}
+
+.fa-duotone.fa-face-saluting:after, .fad.fa-face-saluting:after {
+  content: "\e484\e484";
+}
+
+.fa-duotone.fa-gauge-simple-low:after, .fa-duotone.fa-tachometer-slow:after, .fad.fa-gauge-simple-low:after, .fad.fa-tachometer-slow:after {
+  content: "\f62c\f62c";
+}
+
+.fa-duotone.fa-face-persevering:after, .fad.fa-face-persevering:after {
+  content: "\e385\e385";
+}
+
+.fa-duotone.fa-camera-circle:after, .fa-duotone.fa-circle-camera:after, .fad.fa-camera-circle:after, .fad.fa-circle-camera:after {
+  content: "\e103\e103";
+}
+
+.fa-duotone.fa-hand-spock:after, .fad.fa-hand-spock:after {
+  content: "\f259\f259";
+}
+
+.fa-duotone.fa-spider-web:after, .fad.fa-spider-web:after {
+  content: "\f719\f719";
+}
+
+.fa-duotone.fa-circle-microphone:after, .fa-duotone.fa-microphone-circle:after, .fad.fa-circle-microphone:after, .fad.fa-microphone-circle:after {
+  content: "\e116\e116";
+}
+
+.fa-duotone.fa-book-arrow-up:after, .fad.fa-book-arrow-up:after {
+  content: "\e0ba\e0ba";
+}
+
+.fa-duotone.fa-popsicle:after, .fad.fa-popsicle:after {
+  content: "\e43e\e43e";
+}
+
+.fa-duotone.fa-command:after, .fad.fa-command:after {
+  content: "\e142\e142";
+}
+
+.fa-duotone.fa-blinds:after, .fad.fa-blinds:after {
+  content: "\f8fb\f8fb";
+}
+
+.fa-duotone.fa-stopwatch:after, .fad.fa-stopwatch:after {
+  content: "\f2f2\f2f2";
+}
+
+.fa-duotone.fa-saxophone:after, .fad.fa-saxophone:after {
+  content: "\f8dc\f8dc";
+}
+
+.fa-duotone.fa-square-2:after, .fad.fa-square-2:after {
+  content: "\e257\e257";
+}
+
+.fa-duotone.fa-field-hockey-stick-ball:after, .fa-duotone.fa-field-hockey:after, .fad.fa-field-hockey-stick-ball:after, .fad.fa-field-hockey:after {
+  content: "\f44c\f44c";
+}
+
+.fa-duotone.fa-arrow-up-square-triangle:after, .fa-duotone.fa-sort-shapes-up-alt:after, .fad.fa-arrow-up-square-triangle:after, .fad.fa-sort-shapes-up-alt:after {
+  content: "\f88b\f88b";
+}
+
+.fa-duotone.fa-face-scream:after, .fad.fa-face-scream:after {
+  content: "\e38b\e38b";
+}
+
+.fa-duotone.fa-square-m:after, .fad.fa-square-m:after {
+  content: "\e276\e276";
+}
+
+.fa-duotone.fa-camera-web:after, .fa-duotone.fa-webcam:after, .fad.fa-camera-web:after, .fad.fa-webcam:after {
+  content: "\f832\f832";
+}
+
+.fa-duotone.fa-comment-arrow-down:after, .fad.fa-comment-arrow-down:after {
+  content: "\e143\e143";
+}
+
+.fa-duotone.fa-lightbulb-cfl:after, .fad.fa-lightbulb-cfl:after {
+  content: "\e5a6\e5a6";
+}
+
+.fa-duotone.fa-window-frame-open:after, .fad.fa-window-frame-open:after {
+  content: "\e050\e050";
+}
+
+.fa-duotone.fa-face-kiss:after, .fa-duotone.fa-kiss:after, .fad.fa-face-kiss:after, .fad.fa-kiss:after {
+  content: "\f596\f596";
+}
+
+.fa-duotone.fa-bridge-circle-xmark:after, .fad.fa-bridge-circle-xmark:after {
+  content: "\e4cb\e4cb";
+}
+
+.fa-duotone.fa-period:after, .fad.fa-period:after {
+  content: "\2e\2e";
+}
+
+.fa-duotone.fa-face-grin-tongue:after, .fa-duotone.fa-grin-tongue:after, .fad.fa-face-grin-tongue:after, .fad.fa-grin-tongue:after {
+  content: "\f589\f589";
+}
+
+.fa-duotone.fa-up-to-dotted-line:after, .fad.fa-up-to-dotted-line:after {
+  content: "\e457\e457";
+}
+
+.fa-duotone.fa-thought-bubble:after, .fad.fa-thought-bubble:after {
+  content: "\e32e\e32e";
+}
+
+.fa-duotone.fa-skeleton-ribs:after, .fad.fa-skeleton-ribs:after {
+  content: "\e5cb\e5cb";
+}
+
+.fa-duotone.fa-raygun:after, .fad.fa-raygun:after {
+  content: "\e025\e025";
+}
+
+.fa-duotone.fa-flute:after, .fad.fa-flute:after {
+  content: "\f8b9\f8b9";
+}
+
+.fa-duotone.fa-acorn:after, .fad.fa-acorn:after {
+  content: "\f6ae\f6ae";
+}
+
+.fa-duotone.fa-video-arrow-up-right:after, .fad.fa-video-arrow-up-right:after {
+  content: "\e2c9\e2c9";
+}
+
+.fa-duotone.fa-grate-droplet:after, .fad.fa-grate-droplet:after {
+  content: "\e194\e194";
+}
+
+.fa-duotone.fa-seal-exclamation:after, .fad.fa-seal-exclamation:after {
+  content: "\e242\e242";
+}
+
+.fa-duotone.fa-chess-bishop:after, .fad.fa-chess-bishop:after {
+  content: "\f43a\f43a";
+}
+
+.fa-duotone.fa-message-sms:after, .fad.fa-message-sms:after {
+  content: "\e1e5\e1e5";
+}
+
+.fa-duotone.fa-coffee-beans:after, .fad.fa-coffee-beans:after {
+  content: "\e13f\e13f";
+}
+
+.fa-duotone.fa-hat-witch:after, .fad.fa-hat-witch:after {
+  content: "\f6e7\f6e7";
+}
+
+.fa-duotone.fa-face-grin-wink:after, .fa-duotone.fa-grin-wink:after, .fad.fa-face-grin-wink:after, .fad.fa-grin-wink:after {
+  content: "\f58c\f58c";
+}
+
+.fa-duotone.fa-clock-three-thirty:after, .fad.fa-clock-three-thirty:after {
+  content: "\e357\e357";
+}
+
+.fa-duotone.fa-deaf:after, .fa-duotone.fa-deafness:after, .fa-duotone.fa-ear-deaf:after, .fa-duotone.fa-hard-of-hearing:after, .fad.fa-deaf:after, .fad.fa-deafness:after, .fad.fa-ear-deaf:after, .fad.fa-hard-of-hearing:after {
+  content: "\f2a4\f2a4";
+}
+
+.fa-duotone.fa-alarm-clock:after, .fad.fa-alarm-clock:after {
+  content: "\f34e\f34e";
+}
+
+.fa-duotone.fa-eclipse:after, .fad.fa-eclipse:after {
+  content: "\f749\f749";
+}
+
+.fa-duotone.fa-face-relieved:after, .fad.fa-face-relieved:after {
+  content: "\e389\e389";
+}
+
+.fa-duotone.fa-road-circle-check:after, .fad.fa-road-circle-check:after {
+  content: "\e564\e564";
+}
+
+.fa-duotone.fa-dice-five:after, .fad.fa-dice-five:after {
+  content: "\f523\f523";
+}
+
+.fa-duotone.fa-minus-octagon:after, .fa-duotone.fa-octagon-minus:after, .fad.fa-minus-octagon:after, .fad.fa-octagon-minus:after {
+  content: "\f308\f308";
+}
+
+.fa-duotone.fa-rss-square:after, .fa-duotone.fa-square-rss:after, .fad.fa-rss-square:after, .fad.fa-square-rss:after {
+  content: "\f143\f143";
+}
+
+.fa-duotone.fa-face-zany:after, .fad.fa-face-zany:after {
+  content: "\e3a4\e3a4";
+}
+
+.fa-duotone.fa-tricycle:after, .fad.fa-tricycle:after {
+  content: "\e5c3\e5c3";
+}
+
+.fa-duotone.fa-land-mine-on:after, .fad.fa-land-mine-on:after {
+  content: "\e51b\e51b";
+}
+
+.fa-duotone.fa-square-arrow-up-left:after, .fad.fa-square-arrow-up-left:after {
+  content: "\e263\e263";
+}
+
+.fa-duotone.fa-i-cursor:after, .fad.fa-i-cursor:after {
+  content: "\f246\f246";
+}
+
+.fa-duotone.fa-chart-mixed-up-circle-dollar:after, .fad.fa-chart-mixed-up-circle-dollar:after {
+  content: "\e5d9\e5d9";
+}
+
+.fa-duotone.fa-salt-shaker:after, .fad.fa-salt-shaker:after {
+  content: "\e446\e446";
+}
+
+.fa-duotone.fa-stamp:after, .fad.fa-stamp:after {
+  content: "\f5bf\f5bf";
+}
+
+.fa-duotone.fa-file-plus:after, .fad.fa-file-plus:after {
+  content: "\f319\f319";
+}
+
+.fa-duotone.fa-draw-square:after, .fad.fa-draw-square:after {
+  content: "\f5ef\f5ef";
+}
+
+.fa-duotone.fa-toilet-paper-reverse-slash:after, .fa-duotone.fa-toilet-paper-under-slash:after, .fad.fa-toilet-paper-reverse-slash:after, .fad.fa-toilet-paper-under-slash:after {
+  content: "\e2a1\e2a1";
+}
+
+.fa-duotone.fa-stairs:after, .fad.fa-stairs:after {
+  content: "\e289\e289";
+}
+
+.fa-duotone.fa-drone-alt:after, .fa-duotone.fa-drone-front:after, .fad.fa-drone-alt:after, .fad.fa-drone-front:after {
+  content: "\f860\f860";
+}
+
+.fa-duotone.fa-glass-empty:after, .fad.fa-glass-empty:after {
+  content: "\e191\e191";
+}
+
+.fa-duotone.fa-dial-high:after, .fad.fa-dial-high:after {
+  content: "\e15c\e15c";
+}
+
+.fa-duotone.fa-user-construction:after, .fa-duotone.fa-user-hard-hat:after, .fa-duotone.fa-user-helmet-safety:after, .fad.fa-user-construction:after, .fad.fa-user-hard-hat:after, .fad.fa-user-helmet-safety:after {
+  content: "\f82c\f82c";
+}
+
+.fa-duotone.fa-i:after, .fad.fa-i:after {
+  content: "\49\49";
+}
+
+.fa-duotone.fa-hryvnia-sign:after, .fa-duotone.fa-hryvnia:after, .fad.fa-hryvnia-sign:after, .fad.fa-hryvnia:after {
+  content: "\f6f2\f6f2";
+}
+
+.fa-duotone.fa-arrow-down-left-and-arrow-up-right-to-center:after, .fad.fa-arrow-down-left-and-arrow-up-right-to-center:after {
+  content: "\e092\e092";
+}
+
+.fa-duotone.fa-pills:after, .fad.fa-pills:after {
+  content: "\f484\f484";
+}
+
+.fa-duotone.fa-face-grin-wide:after, .fa-duotone.fa-grin-alt:after, .fad.fa-face-grin-wide:after, .fad.fa-grin-alt:after {
+  content: "\f581\f581";
+}
+
+.fa-duotone.fa-tooth:after, .fad.fa-tooth:after {
+  content: "\f5c9\f5c9";
+}
+
+.fa-duotone.fa-basketball-hoop:after, .fad.fa-basketball-hoop:after {
+  content: "\f435\f435";
+}
+
+.fa-duotone.fa-objects-align-bottom:after, .fad.fa-objects-align-bottom:after {
+  content: "\e3bb\e3bb";
+}
+
+.fa-duotone.fa-v:after, .fad.fa-v:after {
+  content: "\56\56";
+}
+
+.fa-duotone.fa-sparkles:after, .fad.fa-sparkles:after {
+  content: "\f890\f890";
+}
+
+.fa-duotone.fa-squid:after, .fad.fa-squid:after {
+  content: "\e450\e450";
+}
+
+.fa-duotone.fa-leafy-green:after, .fad.fa-leafy-green:after {
+  content: "\e41d\e41d";
+}
+
+.fa-duotone.fa-circle-arrow-up-right:after, .fad.fa-circle-arrow-up-right:after {
+  content: "\e0fc\e0fc";
+}
+
+.fa-duotone.fa-calendars:after, .fad.fa-calendars:after {
+  content: "\e0d7\e0d7";
+}
+
+.fa-duotone.fa-bangladeshi-taka-sign:after, .fad.fa-bangladeshi-taka-sign:after {
+  content: "\e2e6\e2e6";
+}
+
+.fa-duotone.fa-bicycle:after, .fad.fa-bicycle:after {
+  content: "\f206\f206";
+}
+
+.fa-duotone.fa-hammer-war:after, .fad.fa-hammer-war:after {
+  content: "\f6e4\f6e4";
+}
+
+.fa-duotone.fa-circle-d:after, .fad.fa-circle-d:after {
+  content: "\e104\e104";
+}
+
+.fa-duotone.fa-spider-black-widow:after, .fad.fa-spider-black-widow:after {
+  content: "\f718\f718";
+}
+
+.fa-duotone.fa-rod-asclepius:after, .fa-duotone.fa-rod-snake:after, .fa-duotone.fa-staff-aesculapius:after, .fa-duotone.fa-staff-snake:after, .fad.fa-rod-asclepius:after, .fad.fa-rod-snake:after, .fad.fa-staff-aesculapius:after, .fad.fa-staff-snake:after {
+  content: "\e579\e579";
+}
+
+.fa-duotone.fa-pear:after, .fad.fa-pear:after {
+  content: "\e20c\e20c";
+}
+
+.fa-duotone.fa-head-side-cough-slash:after, .fad.fa-head-side-cough-slash:after {
+  content: "\e062\e062";
+}
+
+.fa-duotone.fa-file-mov:after, .fad.fa-file-mov:after {
+  content: "\e647\e647";
+}
+
+.fa-duotone.fa-triangle:after, .fad.fa-triangle:after {
+  content: "\f2ec\f2ec";
+}
+
+.fa-duotone.fa-apartment:after, .fad.fa-apartment:after {
+  content: "\e468\e468";
+}
+
+.fa-duotone.fa-ambulance:after, .fa-duotone.fa-truck-medical:after, .fad.fa-ambulance:after, .fad.fa-truck-medical:after {
+  content: "\f0f9\f0f9";
+}
+
+.fa-duotone.fa-pepper:after, .fad.fa-pepper:after {
+  content: "\e432\e432";
+}
+
+.fa-duotone.fa-piano:after, .fad.fa-piano:after {
+  content: "\f8d4\f8d4";
+}
+
+.fa-duotone.fa-gun-squirt:after, .fad.fa-gun-squirt:after {
+  content: "\e19d\e19d";
+}
+
+.fa-duotone.fa-wheat-awn-circle-exclamation:after, .fad.fa-wheat-awn-circle-exclamation:after {
+  content: "\e598\e598";
+}
+
+.fa-duotone.fa-snowman:after, .fad.fa-snowman:after {
+  content: "\f7d0\f7d0";
+}
+
+.fa-duotone.fa-user-alien:after, .fad.fa-user-alien:after {
+  content: "\e04a\e04a";
+}
+
+.fa-duotone.fa-shield-check:after, .fad.fa-shield-check:after {
+  content: "\f2f7\f2f7";
+}
+
+.fa-duotone.fa-mortar-pestle:after, .fad.fa-mortar-pestle:after {
+  content: "\f5a7\f5a7";
+}
+
+.fa-duotone.fa-road-barrier:after, .fad.fa-road-barrier:after {
+  content: "\e562\e562";
+}
+
+.fa-duotone.fa-chart-candlestick:after, .fad.fa-chart-candlestick:after {
+  content: "\e0e2\e0e2";
+}
+
+.fa-duotone.fa-briefcase-blank:after, .fad.fa-briefcase-blank:after {
+  content: "\e0c8\e0c8";
+}
+
+.fa-duotone.fa-school:after, .fad.fa-school:after {
+  content: "\f549\f549";
+}
+
+.fa-duotone.fa-igloo:after, .fad.fa-igloo:after {
+  content: "\f7ae\f7ae";
+}
+
+.fa-duotone.fa-bracket-round:after, .fa-duotone.fa-parenthesis:after, .fad.fa-bracket-round:after, .fad.fa-parenthesis:after {
+  content: "\28\28";
+}
+
+.fa-duotone.fa-joint:after, .fad.fa-joint:after {
+  content: "\f595\f595";
+}
+
+.fa-duotone.fa-horse-saddle:after, .fad.fa-horse-saddle:after {
+  content: "\f8c3\f8c3";
+}
+
+.fa-duotone.fa-mug-marshmallows:after, .fad.fa-mug-marshmallows:after {
+  content: "\f7b7\f7b7";
+}
+
+.fa-duotone.fa-filters:after, .fad.fa-filters:after {
+  content: "\e17e\e17e";
+}
+
+.fa-duotone.fa-bell-on:after, .fad.fa-bell-on:after {
+  content: "\f8fa\f8fa";
+}
+
+.fa-duotone.fa-angle-right:after, .fad.fa-angle-right:after {
+  content: "\f105\f105";
+}
+
+.fa-duotone.fa-dial-med:after, .fad.fa-dial-med:after {
+  content: "\e15f\e15f";
+}
+
+.fa-duotone.fa-horse:after, .fad.fa-horse:after {
+  content: "\f6f0\f6f0";
+}
+
+.fa-duotone.fa-q:after, .fad.fa-q:after {
+  content: "\51\51";
+}
+
+.fa-duotone.fa-monitor-heart-rate:after, .fa-duotone.fa-monitor-waveform:after, .fad.fa-monitor-heart-rate:after, .fad.fa-monitor-waveform:after {
+  content: "\f611\f611";
+}
+
+.fa-duotone.fa-link-simple:after, .fad.fa-link-simple:after {
+  content: "\e1cd\e1cd";
+}
+
+.fa-duotone.fa-whistle:after, .fad.fa-whistle:after {
+  content: "\f460\f460";
+}
+
+.fa-duotone.fa-g:after, .fad.fa-g:after {
+  content: "\47\47";
+}
+
+.fa-duotone.fa-fragile:after, .fa-duotone.fa-wine-glass-crack:after, .fad.fa-fragile:after, .fad.fa-wine-glass-crack:after {
+  content: "\f4bb\f4bb";
+}
+
+.fa-duotone.fa-slot-machine:after, .fad.fa-slot-machine:after {
+  content: "\e3ce\e3ce";
+}
+
+.fa-duotone.fa-notes-medical:after, .fad.fa-notes-medical:after {
+  content: "\f481\f481";
+}
+
+.fa-duotone.fa-car-wash:after, .fad.fa-car-wash:after {
+  content: "\f5e6\f5e6";
+}
+
+.fa-duotone.fa-escalator:after, .fad.fa-escalator:after {
+  content: "\e171\e171";
+}
+
+.fa-duotone.fa-comment-image:after, .fad.fa-comment-image:after {
+  content: "\e148\e148";
+}
+
+.fa-duotone.fa-temperature-2:after, .fa-duotone.fa-temperature-half:after, .fa-duotone.fa-thermometer-2:after, .fa-duotone.fa-thermometer-half:after, .fad.fa-temperature-2:after, .fad.fa-temperature-half:after, .fad.fa-thermometer-2:after, .fad.fa-thermometer-half:after {
+  content: "\f2c9\f2c9";
+}
+
+.fa-duotone.fa-dong-sign:after, .fad.fa-dong-sign:after {
+  content: "\e169\e169";
+}
+
+.fa-duotone.fa-donut:after, .fa-duotone.fa-doughnut:after, .fad.fa-donut:after, .fad.fa-doughnut:after {
+  content: "\e406\e406";
+}
+
+.fa-duotone.fa-capsules:after, .fad.fa-capsules:after {
+  content: "\f46b\f46b";
+}
+
+.fa-duotone.fa-poo-bolt:after, .fa-duotone.fa-poo-storm:after, .fad.fa-poo-bolt:after, .fad.fa-poo-storm:after {
+  content: "\f75a\f75a";
+}
+
+.fa-duotone.fa-tally-1:after, .fad.fa-tally-1:after {
+  content: "\e294\e294";
+}
+
+.fa-duotone.fa-file-vector:after, .fad.fa-file-vector:after {
+  content: "\e64c\e64c";
+}
+
+.fa-duotone.fa-face-frown-open:after, .fa-duotone.fa-frown-open:after, .fad.fa-face-frown-open:after, .fad.fa-frown-open:after {
+  content: "\f57a\f57a";
+}
+
+.fa-duotone.fa-square-dashed:after, .fad.fa-square-dashed:after {
+  content: "\e269\e269";
+}
+
+.fa-duotone.fa-bag-shopping-plus:after, .fad.fa-bag-shopping-plus:after {
+  content: "\e651\e651";
+}
+
+.fa-duotone.fa-square-j:after, .fad.fa-square-j:after {
+  content: "\e273\e273";
+}
+
+.fa-duotone.fa-hand-point-up:after, .fad.fa-hand-point-up:after {
+  content: "\f0a6\f0a6";
+}
+
+.fa-duotone.fa-money-bill:after, .fad.fa-money-bill:after {
+  content: "\f0d6\f0d6";
+}
+
+.fa-duotone.fa-arrow-up-big-small:after, .fa-duotone.fa-sort-size-up:after, .fad.fa-arrow-up-big-small:after, .fad.fa-sort-size-up:after {
+  content: "\f88e\f88e";
+}
+
+.fa-duotone.fa-barcode-read:after, .fad.fa-barcode-read:after {
+  content: "\f464\f464";
+}
+
+.fa-duotone.fa-baguette:after, .fad.fa-baguette:after {
+  content: "\e3d8\e3d8";
+}
+
+.fa-duotone.fa-bowl-soft-serve:after, .fad.fa-bowl-soft-serve:after {
+  content: "\e46b\e46b";
+}
+
+.fa-duotone.fa-face-holding-back-tears:after, .fad.fa-face-holding-back-tears:after {
+  content: "\e482\e482";
+}
+
+.fa-duotone.fa-arrow-alt-square-up:after, .fa-duotone.fa-square-up:after, .fad.fa-arrow-alt-square-up:after, .fad.fa-square-up:after {
+  content: "\f353\f353";
+}
+
+.fa-duotone.fa-subway-tunnel:after, .fa-duotone.fa-train-subway-tunnel:after, .fad.fa-subway-tunnel:after, .fad.fa-train-subway-tunnel:after {
+  content: "\e2a3\e2a3";
+}
+
+.fa-duotone.fa-exclamation-square:after, .fa-duotone.fa-square-exclamation:after, .fad.fa-exclamation-square:after, .fad.fa-square-exclamation:after {
+  content: "\f321\f321";
+}
+
+.fa-duotone.fa-semicolon:after, .fad.fa-semicolon:after {
+  content: "\3b\3b";
+}
+
+.fa-duotone.fa-bookmark:after, .fad.fa-bookmark:after {
+  content: "\f02e\f02e";
+}
+
+.fa-duotone.fa-fan-table:after, .fad.fa-fan-table:after {
+  content: "\e004\e004";
+}
+
+.fa-duotone.fa-align-justify:after, .fad.fa-align-justify:after {
+  content: "\f039\f039";
+}
+
+.fa-duotone.fa-battery-1:after, .fa-duotone.fa-battery-low:after, .fad.fa-battery-1:after, .fad.fa-battery-low:after {
+  content: "\e0b1\e0b1";
+}
+
+.fa-duotone.fa-credit-card-front:after, .fad.fa-credit-card-front:after {
+  content: "\f38a\f38a";
+}
+
+.fa-duotone.fa-brain-arrow-curved-right:after, .fa-duotone.fa-mind-share:after, .fad.fa-brain-arrow-curved-right:after, .fad.fa-mind-share:after {
+  content: "\f677\f677";
+}
+
+.fa-duotone.fa-umbrella-beach:after, .fad.fa-umbrella-beach:after {
+  content: "\f5ca\f5ca";
+}
+
+.fa-duotone.fa-helmet-un:after, .fad.fa-helmet-un:after {
+  content: "\e503\e503";
+}
+
+.fa-duotone.fa-location-smile:after, .fa-duotone.fa-map-marker-smile:after, .fad.fa-location-smile:after, .fad.fa-map-marker-smile:after {
+  content: "\f60d\f60d";
+}
+
+.fa-duotone.fa-arrow-left-to-line:after, .fa-duotone.fa-arrow-to-left:after, .fad.fa-arrow-left-to-line:after, .fad.fa-arrow-to-left:after {
+  content: "\f33e\f33e";
+}
+
+.fa-duotone.fa-bullseye:after, .fad.fa-bullseye:after {
+  content: "\f140\f140";
+}
+
+.fa-duotone.fa-nigiri:after, .fa-duotone.fa-sushi:after, .fad.fa-nigiri:after, .fad.fa-sushi:after {
+  content: "\e48a\e48a";
+}
+
+.fa-duotone.fa-comment-alt-captions:after, .fa-duotone.fa-message-captions:after, .fad.fa-comment-alt-captions:after, .fad.fa-message-captions:after {
+  content: "\e1de\e1de";
+}
+
+.fa-duotone.fa-trash-list:after, .fad.fa-trash-list:after {
+  content: "\e2b1\e2b1";
+}
+
+.fa-duotone.fa-bacon:after, .fad.fa-bacon:after {
+  content: "\f7e5\f7e5";
+}
+
+.fa-duotone.fa-option:after, .fad.fa-option:after {
+  content: "\e318\e318";
+}
+
+.fa-duotone.fa-raccoon:after, .fad.fa-raccoon:after {
+  content: "\e613\e613";
+}
+
+.fa-duotone.fa-hand-point-down:after, .fad.fa-hand-point-down:after {
+  content: "\f0a7\f0a7";
+}
+
+.fa-duotone.fa-arrow-up-from-bracket:after, .fad.fa-arrow-up-from-bracket:after {
+  content: "\e09a\e09a";
+}
+
+.fa-duotone.fa-head-side-gear:after, .fad.fa-head-side-gear:after {
+  content: "\e611\e611";
+}
+
+.fa-duotone.fa-trash-plus:after, .fad.fa-trash-plus:after {
+  content: "\e2b2\e2b2";
+}
+
+.fa-duotone.fa-file-cad:after, .fad.fa-file-cad:after {
+  content: "\e672\e672";
+}
+
+.fa-duotone.fa-objects-align-top:after, .fad.fa-objects-align-top:after {
+  content: "\e3c0\e3c0";
+}
+
+.fa-duotone.fa-folder-blank:after, .fa-duotone.fa-folder:after, .fad.fa-folder-blank:after, .fad.fa-folder:after {
+  content: "\f07b\f07b";
+}
+
+.fa-duotone.fa-face-anxious-sweat:after, .fad.fa-face-anxious-sweat:after {
+  content: "\e36a\e36a";
+}
+
+.fa-duotone.fa-credit-card-blank:after, .fad.fa-credit-card-blank:after {
+  content: "\f389\f389";
+}
+
+.fa-duotone.fa-file-medical-alt:after, .fa-duotone.fa-file-waveform:after, .fad.fa-file-medical-alt:after, .fad.fa-file-waveform:after {
+  content: "\f478\f478";
+}
+
+.fa-duotone.fa-microchip-ai:after, .fad.fa-microchip-ai:after {
+  content: "\e1ec\e1ec";
+}
+
+.fa-duotone.fa-mug:after, .fad.fa-mug:after {
+  content: "\f874\f874";
+}
+
+.fa-duotone.fa-plane-up-slash:after, .fad.fa-plane-up-slash:after {
+  content: "\e22e\e22e";
+}
+
+.fa-duotone.fa-radiation:after, .fad.fa-radiation:after {
+  content: "\f7b9\f7b9";
+}
+
+.fa-duotone.fa-pen-circle:after, .fad.fa-pen-circle:after {
+  content: "\e20e\e20e";
+}
+
+.fa-duotone.fa-bag-seedling:after, .fad.fa-bag-seedling:after {
+  content: "\e5f2\e5f2";
+}
+
+.fa-duotone.fa-chart-simple:after, .fad.fa-chart-simple:after {
+  content: "\e473\e473";
+}
+
+.fa-duotone.fa-crutches:after, .fad.fa-crutches:after {
+  content: "\f7f8\f7f8";
+}
+
+.fa-duotone.fa-circle-parking:after, .fa-duotone.fa-parking-circle:after, .fad.fa-circle-parking:after, .fad.fa-parking-circle:after {
+  content: "\f615\f615";
+}
+
+.fa-duotone.fa-mars-stroke:after, .fad.fa-mars-stroke:after {
+  content: "\f229\f229";
+}
+
+.fa-duotone.fa-leaf-oak:after, .fad.fa-leaf-oak:after {
+  content: "\f6f7\f6f7";
+}
+
+.fa-duotone.fa-square-bolt:after, .fad.fa-square-bolt:after {
+  content: "\e265\e265";
+}
+
+.fa-duotone.fa-vial:after, .fad.fa-vial:after {
+  content: "\f492\f492";
+}
+
+.fa-duotone.fa-dashboard:after, .fa-duotone.fa-gauge-med:after, .fa-duotone.fa-gauge:after, .fa-duotone.fa-tachometer-alt-average:after, .fad.fa-dashboard:after, .fad.fa-gauge-med:after, .fad.fa-gauge:after, .fad.fa-tachometer-alt-average:after {
+  content: "\f624\f624";
+}
+
+.fa-duotone.fa-magic-wand-sparkles:after, .fa-duotone.fa-wand-magic-sparkles:after, .fad.fa-magic-wand-sparkles:after, .fad.fa-wand-magic-sparkles:after {
+  content: "\e2ca\e2ca";
+}
+
+.fa-duotone.fa-lambda:after, .fad.fa-lambda:after {
+  content: "\f66e\f66e";
+}
+
+.fa-duotone.fa-e:after, .fad.fa-e:after {
+  content: "\45\45";
+}
+
+.fa-duotone.fa-pizza:after, .fad.fa-pizza:after {
+  content: "\f817\f817";
+}
+
+.fa-duotone.fa-bowl-chopsticks-noodles:after, .fad.fa-bowl-chopsticks-noodles:after {
+  content: "\e2ea\e2ea";
+}
+
+.fa-duotone.fa-h3:after, .fad.fa-h3:after {
+  content: "\f315\f315";
+}
+
+.fa-duotone.fa-pen-alt:after, .fa-duotone.fa-pen-clip:after, .fad.fa-pen-alt:after, .fad.fa-pen-clip:after {
+  content: "\f305\f305";
+}
+
+.fa-duotone.fa-bridge-circle-exclamation:after, .fad.fa-bridge-circle-exclamation:after {
+  content: "\e4ca\e4ca";
+}
+
+.fa-duotone.fa-badge-percent:after, .fad.fa-badge-percent:after {
+  content: "\f646\f646";
+}
+
+.fa-duotone.fa-rotate-reverse:after, .fad.fa-rotate-reverse:after {
+  content: "\e631\e631";
+}
+
+.fa-duotone.fa-user:after, .fad.fa-user:after {
+  content: "\f007\f007";
+}
+
+.fa-duotone.fa-sensor:after, .fad.fa-sensor:after {
+  content: "\e028\e028";
+}
+
+.fa-duotone.fa-comma:after, .fad.fa-comma:after {
+  content: "\2c\2c";
+}
+
+.fa-duotone.fa-school-circle-check:after, .fad.fa-school-circle-check:after {
+  content: "\e56b\e56b";
+}
+
+.fa-duotone.fa-toilet-paper-reverse:after, .fa-duotone.fa-toilet-paper-under:after, .fad.fa-toilet-paper-reverse:after, .fad.fa-toilet-paper-under:after {
+  content: "\e2a0\e2a0";
+}
+
+.fa-duotone.fa-light-emergency:after, .fad.fa-light-emergency:after {
+  content: "\e41f\e41f";
+}
+
+.fa-duotone.fa-arrow-down-to-arc:after, .fad.fa-arrow-down-to-arc:after {
+  content: "\e4ae\e4ae";
+}
+
+.fa-duotone.fa-dumpster:after, .fad.fa-dumpster:after {
+  content: "\f793\f793";
+}
+
+.fa-duotone.fa-shuttle-van:after, .fa-duotone.fa-van-shuttle:after, .fad.fa-shuttle-van:after, .fad.fa-van-shuttle:after {
+  content: "\f5b6\f5b6";
+}
+
+.fa-duotone.fa-building-user:after, .fad.fa-building-user:after {
+  content: "\e4da\e4da";
+}
+
+.fa-duotone.fa-light-switch:after, .fad.fa-light-switch:after {
+  content: "\e017\e017";
+}
+
+.fa-duotone.fa-caret-square-left:after, .fa-duotone.fa-square-caret-left:after, .fad.fa-caret-square-left:after, .fad.fa-square-caret-left:after {
+  content: "\f191\f191";
+}
+
+.fa-duotone.fa-highlighter:after, .fad.fa-highlighter:after {
+  content: "\f591\f591";
+}
+
+.fa-duotone.fa-heart-rate:after, .fa-duotone.fa-wave-pulse:after, .fad.fa-heart-rate:after, .fad.fa-wave-pulse:after {
+  content: "\f5f8\f5f8";
+}
+
+.fa-duotone.fa-key:after, .fad.fa-key:after {
+  content: "\f084\f084";
+}
+
+.fa-duotone.fa-arrow-left-to-bracket:after, .fad.fa-arrow-left-to-bracket:after {
+  content: "\e669\e669";
+}
+
+.fa-duotone.fa-hat-santa:after, .fad.fa-hat-santa:after {
+  content: "\f7a7\f7a7";
+}
+
+.fa-duotone.fa-tamale:after, .fad.fa-tamale:after {
+  content: "\e451\e451";
+}
+
+.fa-duotone.fa-box-check:after, .fad.fa-box-check:after {
+  content: "\f467\f467";
+}
+
+.fa-duotone.fa-bullhorn:after, .fad.fa-bullhorn:after {
+  content: "\f0a1\f0a1";
+}
+
+.fa-duotone.fa-steak:after, .fad.fa-steak:after {
+  content: "\f824\f824";
+}
+
+.fa-duotone.fa-location-crosshairs-slash:after, .fa-duotone.fa-location-slash:after, .fad.fa-location-crosshairs-slash:after, .fad.fa-location-slash:after {
+  content: "\f603\f603";
+}
+
+.fa-duotone.fa-person-dolly:after, .fad.fa-person-dolly:after {
+  content: "\f4d0\f4d0";
+}
+
+.fa-duotone.fa-globe:after, .fad.fa-globe:after {
+  content: "\f0ac\f0ac";
+}
+
+.fa-duotone.fa-synagogue:after, .fad.fa-synagogue:after {
+  content: "\f69b\f69b";
+}
+
+.fa-duotone.fa-file-chart-column:after, .fa-duotone.fa-file-chart-line:after, .fad.fa-file-chart-column:after, .fad.fa-file-chart-line:after {
+  content: "\f659\f659";
+}
+
+.fa-duotone.fa-person-half-dress:after, .fad.fa-person-half-dress:after {
+  content: "\e548\e548";
+}
+
+.fa-duotone.fa-folder-image:after, .fad.fa-folder-image:after {
+  content: "\e18a\e18a";
+}
+
+.fa-duotone.fa-calendar-edit:after, .fa-duotone.fa-calendar-pen:after, .fad.fa-calendar-edit:after, .fad.fa-calendar-pen:after {
+  content: "\f333\f333";
+}
+
+.fa-duotone.fa-road-bridge:after, .fad.fa-road-bridge:after {
+  content: "\e563\e563";
+}
+
+.fa-duotone.fa-face-smile-tear:after, .fad.fa-face-smile-tear:after {
+  content: "\e393\e393";
+}
+
+.fa-duotone.fa-comment-alt-plus:after, .fa-duotone.fa-message-plus:after, .fad.fa-comment-alt-plus:after, .fad.fa-message-plus:after {
+  content: "\f4a8\f4a8";
+}
+
+.fa-duotone.fa-location-arrow:after, .fad.fa-location-arrow:after {
+  content: "\f124\f124";
+}
+
+.fa-duotone.fa-c:after, .fad.fa-c:after {
+  content: "\43\43";
+}
+
+.fa-duotone.fa-tablet-button:after, .fad.fa-tablet-button:after {
+  content: "\f10a\f10a";
+}
+
+.fa-duotone.fa-person-dress-fairy:after, .fad.fa-person-dress-fairy:after {
+  content: "\e607\e607";
+}
+
+.fa-duotone.fa-rectangle-history-circle-user:after, .fad.fa-rectangle-history-circle-user:after {
+  content: "\e4a4\e4a4";
+}
+
+.fa-duotone.fa-building-lock:after, .fad.fa-building-lock:after {
+  content: "\e4d6\e4d6";
+}
+
+.fa-duotone.fa-chart-line-up:after, .fad.fa-chart-line-up:after {
+  content: "\e0e5\e0e5";
+}
+
+.fa-duotone.fa-mailbox:after, .fad.fa-mailbox:after {
+  content: "\f813\f813";
+}
+
+.fa-duotone.fa-sign-posts:after, .fad.fa-sign-posts:after {
+  content: "\e625\e625";
+}
+
+.fa-duotone.fa-truck-bolt:after, .fad.fa-truck-bolt:after {
+  content: "\e3d0\e3d0";
+}
+
+.fa-duotone.fa-pizza-slice:after, .fad.fa-pizza-slice:after {
+  content: "\f818\f818";
+}
+
+.fa-duotone.fa-money-bill-wave:after, .fad.fa-money-bill-wave:after {
+  content: "\f53a\f53a";
+}
+
+.fa-duotone.fa-area-chart:after, .fa-duotone.fa-chart-area:after, .fad.fa-area-chart:after, .fad.fa-chart-area:after {
+  content: "\f1fe\f1fe";
+}
+
+.fa-duotone.fa-house-flag:after, .fad.fa-house-flag:after {
+  content: "\e50d\e50d";
+}
+
+.fa-duotone.fa-circle-three-quarters-stroke:after, .fad.fa-circle-three-quarters-stroke:after {
+  content: "\e5d4\e5d4";
+}
+
+.fa-duotone.fa-person-circle-minus:after, .fad.fa-person-circle-minus:after {
+  content: "\e540\e540";
+}
+
+.fa-duotone.fa-scalpel:after, .fad.fa-scalpel:after {
+  content: "\f61d\f61d";
+}
+
+.fa-duotone.fa-ban:after, .fa-duotone.fa-cancel:after, .fad.fa-ban:after, .fad.fa-cancel:after {
+  content: "\f05e\f05e";
+}
+
+.fa-duotone.fa-bell-exclamation:after, .fad.fa-bell-exclamation:after {
+  content: "\f848\f848";
+}
+
+.fa-duotone.fa-bookmark-circle:after, .fa-duotone.fa-circle-bookmark:after, .fad.fa-bookmark-circle:after, .fad.fa-circle-bookmark:after {
+  content: "\e100\e100";
+}
+
+.fa-duotone.fa-egg-fried:after, .fad.fa-egg-fried:after {
+  content: "\f7fc\f7fc";
+}
+
+.fa-duotone.fa-face-weary:after, .fad.fa-face-weary:after {
+  content: "\e3a1\e3a1";
+}
+
+.fa-duotone.fa-uniform-martial-arts:after, .fad.fa-uniform-martial-arts:after {
+  content: "\e3d1\e3d1";
+}
+
+.fa-duotone.fa-camera-rotate:after, .fad.fa-camera-rotate:after {
+  content: "\e0d8\e0d8";
+}
+
+.fa-duotone.fa-sun-dust:after, .fad.fa-sun-dust:after {
+  content: "\f764\f764";
+}
+
+.fa-duotone.fa-comment-text:after, .fad.fa-comment-text:after {
+  content: "\e14d\e14d";
+}
+
+.fa-duotone.fa-air-freshener:after, .fa-duotone.fa-spray-can-sparkles:after, .fad.fa-air-freshener:after, .fad.fa-spray-can-sparkles:after {
+  content: "\f5d0\f5d0";
+}
+
+.fa-duotone.fa-signal-alt-4:after, .fa-duotone.fa-signal-alt:after, .fa-duotone.fa-signal-bars-strong:after, .fa-duotone.fa-signal-bars:after, .fad.fa-signal-alt-4:after, .fad.fa-signal-alt:after, .fad.fa-signal-bars-strong:after, .fad.fa-signal-bars:after {
+  content: "\f690\f690";
+}
+
+.fa-duotone.fa-diamond-exclamation:after, .fad.fa-diamond-exclamation:after {
+  content: "\e405\e405";
+}
+
+.fa-duotone.fa-star:after, .fad.fa-star:after {
+  content: "\f005\f005";
+}
+
+.fa-duotone.fa-dial-min:after, .fad.fa-dial-min:after {
+  content: "\e161\e161";
+}
+
+.fa-duotone.fa-repeat:after, .fad.fa-repeat:after {
+  content: "\f363\f363";
+}
+
+.fa-duotone.fa-cross:after, .fad.fa-cross:after {
+  content: "\f654\f654";
+}
+
+.fa-duotone.fa-file-caret-down:after, .fa-duotone.fa-page-caret-down:after, .fad.fa-file-caret-down:after, .fad.fa-page-caret-down:after {
+  content: "\e429\e429";
+}
+
+.fa-duotone.fa-box:after, .fad.fa-box:after {
+  content: "\f466\f466";
+}
+
+.fa-duotone.fa-venus-mars:after, .fad.fa-venus-mars:after {
+  content: "\f228\f228";
+}
+
+.fa-duotone.fa-clock-seven-thirty:after, .fad.fa-clock-seven-thirty:after {
+  content: "\e351\e351";
+}
+
+.fa-duotone.fa-arrow-pointer:after, .fa-duotone.fa-mouse-pointer:after, .fad.fa-arrow-pointer:after, .fad.fa-mouse-pointer:after {
+  content: "\f245\f245";
+}
+
+.fa-duotone.fa-clock-four-thirty:after, .fad.fa-clock-four-thirty:after {
+  content: "\e34b\e34b";
+}
+
+.fa-duotone.fa-signal-alt-3:after, .fa-duotone.fa-signal-bars-good:after, .fad.fa-signal-alt-3:after, .fad.fa-signal-bars-good:after {
+  content: "\f693\f693";
+}
+
+.fa-duotone.fa-cactus:after, .fad.fa-cactus:after {
+  content: "\f8a7\f8a7";
+}
+
+.fa-duotone.fa-lightbulb-gear:after, .fad.fa-lightbulb-gear:after {
+  content: "\e5fd\e5fd";
+}
+
+.fa-duotone.fa-expand-arrows-alt:after, .fa-duotone.fa-maximize:after, .fad.fa-expand-arrows-alt:after, .fad.fa-maximize:after {
+  content: "\f31e\f31e";
+}
+
+.fa-duotone.fa-charging-station:after, .fad.fa-charging-station:after {
+  content: "\f5e7\f5e7";
+}
+
+.fa-duotone.fa-shapes:after, .fa-duotone.fa-triangle-circle-square:after, .fad.fa-shapes:after, .fad.fa-triangle-circle-square:after {
+  content: "\f61f\f61f";
+}
+
+.fa-duotone.fa-plane-tail:after, .fad.fa-plane-tail:after {
+  content: "\e22c\e22c";
+}
+
+.fa-duotone.fa-gauge-simple-max:after, .fa-duotone.fa-tachometer-fastest:after, .fad.fa-gauge-simple-max:after, .fad.fa-tachometer-fastest:after {
+  content: "\f62b\f62b";
+}
+
+.fa-duotone.fa-circle-u:after, .fad.fa-circle-u:after {
+  content: "\e127\e127";
+}
+
+.fa-duotone.fa-shield-slash:after, .fad.fa-shield-slash:after {
+  content: "\e24b\e24b";
+}
+
+.fa-duotone.fa-phone-square-down:after, .fa-duotone.fa-square-phone-hangup:after, .fad.fa-phone-square-down:after, .fad.fa-square-phone-hangup:after {
+  content: "\e27a\e27a";
+}
+
+.fa-duotone.fa-arrow-up-left:after, .fad.fa-arrow-up-left:after {
+  content: "\e09d\e09d";
+}
+
+.fa-duotone.fa-transporter-1:after, .fad.fa-transporter-1:after {
+  content: "\e043\e043";
+}
+
+.fa-duotone.fa-peanuts:after, .fad.fa-peanuts:after {
+  content: "\e431\e431";
+}
+
+.fa-duotone.fa-random:after, .fa-duotone.fa-shuffle:after, .fad.fa-random:after, .fad.fa-shuffle:after {
+  content: "\f074\f074";
+}
+
+.fa-duotone.fa-person-running:after, .fa-duotone.fa-running:after, .fad.fa-person-running:after, .fad.fa-running:after {
+  content: "\f70c\f70c";
+}
+
+.fa-duotone.fa-mobile-retro:after, .fad.fa-mobile-retro:after {
+  content: "\e527\e527";
+}
+
+.fa-duotone.fa-grip-lines-vertical:after, .fad.fa-grip-lines-vertical:after {
+  content: "\f7a5\f7a5";
+}
+
+.fa-duotone.fa-bin-bottles-recycle:after, .fad.fa-bin-bottles-recycle:after {
+  content: "\e5f6\e5f6";
+}
+
+.fa-duotone.fa-arrow-up-from-square:after, .fad.fa-arrow-up-from-square:after {
+  content: "\e09c\e09c";
+}
+
+.fa-duotone.fa-file-dashed-line:after, .fa-duotone.fa-page-break:after, .fad.fa-file-dashed-line:after, .fad.fa-page-break:after {
+  content: "\f877\f877";
+}
+
+.fa-duotone.fa-bracket-curly-right:after, .fad.fa-bracket-curly-right:after {
+  content: "\7d\7d";
+}
+
+.fa-duotone.fa-spider:after, .fad.fa-spider:after {
+  content: "\f717\f717";
+}
+
+.fa-duotone.fa-clock-three:after, .fad.fa-clock-three:after {
+  content: "\e356\e356";
+}
+
+.fa-duotone.fa-hands-bound:after, .fad.fa-hands-bound:after {
+  content: "\e4f9\e4f9";
+}
+
+.fa-duotone.fa-scalpel-line-dashed:after, .fa-duotone.fa-scalpel-path:after, .fad.fa-scalpel-line-dashed:after, .fad.fa-scalpel-path:after {
+  content: "\f61e\f61e";
+}
+
+.fa-duotone.fa-file-invoice-dollar:after, .fad.fa-file-invoice-dollar:after {
+  content: "\f571\f571";
+}
+
+.fa-duotone.fa-pipe-smoking:after, .fad.fa-pipe-smoking:after {
+  content: "\e3c4\e3c4";
+}
+
+.fa-duotone.fa-face-astonished:after, .fad.fa-face-astonished:after {
+  content: "\e36b\e36b";
+}
+
+.fa-duotone.fa-window:after, .fad.fa-window:after {
+  content: "\f40e\f40e";
+}
+
+.fa-duotone.fa-plane-circle-exclamation:after, .fad.fa-plane-circle-exclamation:after {
+  content: "\e556\e556";
+}
+
+.fa-duotone.fa-ear:after, .fad.fa-ear:after {
+  content: "\f5f0\f5f0";
+}
+
+.fa-duotone.fa-file-lock:after, .fad.fa-file-lock:after {
+  content: "\e3a6\e3a6";
+}
+
+.fa-duotone.fa-diagram-venn:after, .fad.fa-diagram-venn:after {
+  content: "\e15a\e15a";
+}
+
+.fa-duotone.fa-arrow-down-from-bracket:after, .fad.fa-arrow-down-from-bracket:after {
+  content: "\e667\e667";
+}
+
+.fa-duotone.fa-x-ray:after, .fad.fa-x-ray:after {
+  content: "\f497\f497";
+}
+
+.fa-duotone.fa-goal-net:after, .fad.fa-goal-net:after {
+  content: "\e3ab\e3ab";
+}
+
+.fa-duotone.fa-coffin-cross:after, .fad.fa-coffin-cross:after {
+  content: "\e051\e051";
+}
+
+.fa-duotone.fa-spell-check:after, .fad.fa-spell-check:after {
+  content: "\f891\f891";
+}
+
+.fa-duotone.fa-location-xmark:after, .fa-duotone.fa-map-marker-times:after, .fa-duotone.fa-map-marker-xmark:after, .fad.fa-location-xmark:after, .fad.fa-map-marker-times:after, .fad.fa-map-marker-xmark:after {
+  content: "\f60e\f60e";
+}
+
+.fa-duotone.fa-circle-quarter-stroke:after, .fad.fa-circle-quarter-stroke:after {
+  content: "\e5d3\e5d3";
+}
+
+.fa-duotone.fa-lasso:after, .fad.fa-lasso:after {
+  content: "\f8c8\f8c8";
+}
+
+.fa-duotone.fa-slash:after, .fad.fa-slash:after {
+  content: "\f715\f715";
+}
+
+.fa-duotone.fa-person-to-portal:after, .fa-duotone.fa-portal-enter:after, .fad.fa-person-to-portal:after, .fad.fa-portal-enter:after {
+  content: "\e022\e022";
+}
+
+.fa-duotone.fa-calendar-star:after, .fad.fa-calendar-star:after {
+  content: "\f736\f736";
+}
+
+.fa-duotone.fa-computer-mouse:after, .fa-duotone.fa-mouse:after, .fad.fa-computer-mouse:after, .fad.fa-mouse:after {
+  content: "\f8cc\f8cc";
+}
+
+.fa-duotone.fa-arrow-right-to-bracket:after, .fa-duotone.fa-sign-in:after, .fad.fa-arrow-right-to-bracket:after, .fad.fa-sign-in:after {
+  content: "\f090\f090";
+}
+
+.fa-duotone.fa-pegasus:after, .fad.fa-pegasus:after {
+  content: "\f703\f703";
+}
+
+.fa-duotone.fa-files-medical:after, .fad.fa-files-medical:after {
+  content: "\f7fd\f7fd";
+}
+
+.fa-duotone.fa-cannon:after, .fad.fa-cannon:after {
+  content: "\e642\e642";
+}
+
+.fa-duotone.fa-nfc-lock:after, .fad.fa-nfc-lock:after {
+  content: "\e1f8\e1f8";
+}
+
+.fa-duotone.fa-person-ski-lift:after, .fa-duotone.fa-ski-lift:after, .fad.fa-person-ski-lift:after, .fad.fa-ski-lift:after {
+  content: "\f7c8\f7c8";
+}
+
+.fa-duotone.fa-square-6:after, .fad.fa-square-6:after {
+  content: "\e25b\e25b";
+}
+
+.fa-duotone.fa-shop-slash:after, .fa-duotone.fa-store-alt-slash:after, .fad.fa-shop-slash:after, .fad.fa-store-alt-slash:after {
+  content: "\e070\e070";
+}
+
+.fa-duotone.fa-wind-turbine:after, .fad.fa-wind-turbine:after {
+  content: "\f89b\f89b";
+}
+
+.fa-duotone.fa-sliders-simple:after, .fad.fa-sliders-simple:after {
+  content: "\e253\e253";
+}
+
+.fa-duotone.fa-grid-round:after, .fad.fa-grid-round:after {
+  content: "\e5da\e5da";
+}
+
+.fa-duotone.fa-badge-sheriff:after, .fad.fa-badge-sheriff:after {
+  content: "\f8a2\f8a2";
+}
+
+.fa-duotone.fa-server:after, .fad.fa-server:after {
+  content: "\f233\f233";
+}
+
+.fa-duotone.fa-virus-covid-slash:after, .fad.fa-virus-covid-slash:after {
+  content: "\e4a9\e4a9";
+}
+
+.fa-duotone.fa-intersection:after, .fad.fa-intersection:after {
+  content: "\f668\f668";
+}
+
+.fa-duotone.fa-shop-lock:after, .fad.fa-shop-lock:after {
+  content: "\e4a5\e4a5";
+}
+
+.fa-duotone.fa-family:after, .fad.fa-family:after {
+  content: "\e300\e300";
+}
+
+.fa-duotone.fa-hourglass-1:after, .fa-duotone.fa-hourglass-start:after, .fad.fa-hourglass-1:after, .fad.fa-hourglass-start:after {
+  content: "\f251\f251";
+}
+
+.fa-duotone.fa-user-hair-buns:after, .fad.fa-user-hair-buns:after {
+  content: "\e3d3\e3d3";
+}
+
+.fa-duotone.fa-blender-phone:after, .fad.fa-blender-phone:after {
+  content: "\f6b6\f6b6";
+}
+
+.fa-duotone.fa-hourglass-clock:after, .fad.fa-hourglass-clock:after {
+  content: "\e41b\e41b";
+}
+
+.fa-duotone.fa-person-seat-reclined:after, .fad.fa-person-seat-reclined:after {
+  content: "\e21f\e21f";
+}
+
+.fa-duotone.fa-paper-plane-alt:after, .fa-duotone.fa-paper-plane-top:after, .fa-duotone.fa-send:after, .fad.fa-paper-plane-alt:after, .fad.fa-paper-plane-top:after, .fad.fa-send:after {
+  content: "\e20a\e20a";
+}
+
+.fa-duotone.fa-comment-alt-arrow-up:after, .fa-duotone.fa-message-arrow-up:after, .fad.fa-comment-alt-arrow-up:after, .fad.fa-message-arrow-up:after {
+  content: "\e1dc\e1dc";
+}
+
+.fa-duotone.fa-lightbulb-exclamation:after, .fad.fa-lightbulb-exclamation:after {
+  content: "\f671\f671";
+}
+
+.fa-duotone.fa-layer-group-minus:after, .fa-duotone.fa-layer-minus:after, .fad.fa-layer-group-minus:after, .fad.fa-layer-minus:after {
+  content: "\f5fe\f5fe";
+}
+
+.fa-duotone.fa-chart-pie-simple-circle-currency:after, .fad.fa-chart-pie-simple-circle-currency:after {
+  content: "\e604\e604";
+}
+
+.fa-duotone.fa-circle-e:after, .fad.fa-circle-e:after {
+  content: "\e109\e109";
+}
+
+.fa-duotone.fa-building-wheat:after, .fad.fa-building-wheat:after {
+  content: "\e4db\e4db";
+}
+
+.fa-duotone.fa-gauge-max:after, .fa-duotone.fa-tachometer-alt-fastest:after, .fad.fa-gauge-max:after, .fad.fa-tachometer-alt-fastest:after {
+  content: "\f626\f626";
+}
+
+.fa-duotone.fa-person-breastfeeding:after, .fad.fa-person-breastfeeding:after {
+  content: "\e53a\e53a";
+}
+
+.fa-duotone.fa-apostrophe:after, .fad.fa-apostrophe:after {
+  content: "\27\27";
+}
+
+.fa-duotone.fa-file-png:after, .fad.fa-file-png:after {
+  content: "\e666\e666";
+}
+
+.fa-duotone.fa-fire-hydrant:after, .fad.fa-fire-hydrant:after {
+  content: "\e17f\e17f";
+}
+
+.fa-duotone.fa-right-to-bracket:after, .fa-duotone.fa-sign-in-alt:after, .fad.fa-right-to-bracket:after, .fad.fa-sign-in-alt:after {
+  content: "\f2f6\f2f6";
+}
+
+.fa-duotone.fa-video-plus:after, .fad.fa-video-plus:after {
+  content: "\f4e1\f4e1";
+}
+
+.fa-duotone.fa-arrow-alt-square-right:after, .fa-duotone.fa-square-right:after, .fad.fa-arrow-alt-square-right:after, .fad.fa-square-right:after {
+  content: "\f352\f352";
+}
+
+.fa-duotone.fa-comment-smile:after, .fad.fa-comment-smile:after {
+  content: "\f4b4\f4b4";
+}
+
+.fa-duotone.fa-venus:after, .fad.fa-venus:after {
+  content: "\f221\f221";
+}
+
+.fa-duotone.fa-passport:after, .fad.fa-passport:after {
+  content: "\f5ab\f5ab";
+}
+
+.fa-duotone.fa-inbox-arrow-down:after, .fa-duotone.fa-inbox-in:after, .fad.fa-inbox-arrow-down:after, .fad.fa-inbox-in:after {
+  content: "\f310\f310";
+}
+
+.fa-duotone.fa-heart-pulse:after, .fa-duotone.fa-heartbeat:after, .fad.fa-heart-pulse:after, .fad.fa-heartbeat:after {
+  content: "\f21e\f21e";
+}
+
+.fa-duotone.fa-circle-8:after, .fad.fa-circle-8:after {
+  content: "\e0f5\e0f5";
+}
+
+.fa-duotone.fa-clouds-moon:after, .fad.fa-clouds-moon:after {
+  content: "\f745\f745";
+}
+
+.fa-duotone.fa-clock-ten-thirty:after, .fad.fa-clock-ten-thirty:after {
+  content: "\e355\e355";
+}
+
+.fa-duotone.fa-people-carry-box:after, .fa-duotone.fa-people-carry:after, .fad.fa-people-carry-box:after, .fad.fa-people-carry:after {
+  content: "\f4ce\f4ce";
+}
+
+.fa-duotone.fa-folder-user:after, .fad.fa-folder-user:after {
+  content: "\e18e\e18e";
+}
+
+.fa-duotone.fa-trash-can-xmark:after, .fad.fa-trash-can-xmark:after {
+  content: "\e2ae\e2ae";
+}
+
+.fa-duotone.fa-temperature-high:after, .fad.fa-temperature-high:after {
+  content: "\f769\f769";
+}
+
+.fa-duotone.fa-microchip:after, .fad.fa-microchip:after {
+  content: "\f2db\f2db";
+}
+
+.fa-duotone.fa-left-long-to-line:after, .fad.fa-left-long-to-line:after {
+  content: "\e41e\e41e";
+}
+
+.fa-duotone.fa-crown:after, .fad.fa-crown:after {
+  content: "\f521\f521";
+}
+
+.fa-duotone.fa-weight-hanging:after, .fad.fa-weight-hanging:after {
+  content: "\f5cd\f5cd";
+}
+
+.fa-duotone.fa-xmarks-lines:after, .fad.fa-xmarks-lines:after {
+  content: "\e59a\e59a";
+}
+
+.fa-duotone.fa-file-prescription:after, .fad.fa-file-prescription:after {
+  content: "\f572\f572";
+}
+
+.fa-duotone.fa-table-cells-lock:after, .fad.fa-table-cells-lock:after {
+  content: "\e679\e679";
+}
+
+.fa-duotone.fa-calendar-range:after, .fad.fa-calendar-range:after {
+  content: "\e0d6\e0d6";
+}
+
+.fa-duotone.fa-flower-daffodil:after, .fad.fa-flower-daffodil:after {
+  content: "\f800\f800";
+}
+
+.fa-duotone.fa-hand-back-point-up:after, .fad.fa-hand-back-point-up:after {
+  content: "\e1a2\e1a2";
+}
+
+.fa-duotone.fa-weight-scale:after, .fa-duotone.fa-weight:after, .fad.fa-weight-scale:after, .fad.fa-weight:after {
+  content: "\f496\f496";
+}
+
+.fa-duotone.fa-arrow-up-to-arc:after, .fad.fa-arrow-up-to-arc:after {
+  content: "\e617\e617";
+}
+
+.fa-duotone.fa-star-exclamation:after, .fad.fa-star-exclamation:after {
+  content: "\f2f3\f2f3";
+}
+
+.fa-duotone.fa-books:after, .fad.fa-books:after {
+  content: "\f5db\f5db";
+}
+
+.fa-duotone.fa-user-friends:after, .fa-duotone.fa-user-group:after, .fad.fa-user-friends:after, .fad.fa-user-group:after {
+  content: "\f500\f500";
+}
+
+.fa-duotone.fa-arrow-up-a-z:after, .fa-duotone.fa-sort-alpha-up:after, .fad.fa-arrow-up-a-z:after, .fad.fa-sort-alpha-up:after {
+  content: "\f15e\f15e";
+}
+
+.fa-duotone.fa-layer-group-plus:after, .fa-duotone.fa-layer-plus:after, .fad.fa-layer-group-plus:after, .fad.fa-layer-plus:after {
+  content: "\f5ff\f5ff";
+}
+
+.fa-duotone.fa-play-pause:after, .fad.fa-play-pause:after {
+  content: "\e22f\e22f";
+}
+
+.fa-duotone.fa-block-question:after, .fad.fa-block-question:after {
+  content: "\e3dd\e3dd";
+}
+
+.fa-duotone.fa-snooze:after, .fa-duotone.fa-zzz:after, .fad.fa-snooze:after, .fad.fa-zzz:after {
+  content: "\f880\f880";
+}
+
+.fa-duotone.fa-scanner-image:after, .fad.fa-scanner-image:after {
+  content: "\f8f3\f8f3";
+}
+
+.fa-duotone.fa-tv-retro:after, .fad.fa-tv-retro:after {
+  content: "\f401\f401";
+}
+
+.fa-duotone.fa-square-t:after, .fad.fa-square-t:after {
+  content: "\e280\e280";
+}
+
+.fa-duotone.fa-barn-silo:after, .fa-duotone.fa-farm:after, .fad.fa-barn-silo:after, .fad.fa-farm:after {
+  content: "\f864\f864";
+}
+
+.fa-duotone.fa-chess-knight:after, .fad.fa-chess-knight:after {
+  content: "\f441\f441";
+}
+
+.fa-duotone.fa-bars-sort:after, .fad.fa-bars-sort:after {
+  content: "\e0ae\e0ae";
+}
+
+.fa-duotone.fa-palette-boxes:after, .fa-duotone.fa-pallet-alt:after, .fa-duotone.fa-pallet-boxes:after, .fad.fa-palette-boxes:after, .fad.fa-pallet-alt:after, .fad.fa-pallet-boxes:after {
+  content: "\f483\f483";
+}
+
+.fa-duotone.fa-face-laugh-squint:after, .fa-duotone.fa-laugh-squint:after, .fad.fa-face-laugh-squint:after, .fad.fa-laugh-squint:after {
+  content: "\f59b\f59b";
+}
+
+.fa-duotone.fa-code-simple:after, .fad.fa-code-simple:after {
+  content: "\e13d\e13d";
+}
+
+.fa-duotone.fa-bolt-slash:after, .fad.fa-bolt-slash:after {
+  content: "\e0b8\e0b8";
+}
+
+.fa-duotone.fa-panel-fire:after, .fad.fa-panel-fire:after {
+  content: "\e42f\e42f";
+}
+
+.fa-duotone.fa-binary-circle-check:after, .fad.fa-binary-circle-check:after {
+  content: "\e33c\e33c";
+}
+
+.fa-duotone.fa-comment-minus:after, .fad.fa-comment-minus:after {
+  content: "\f4b1\f4b1";
+}
+
+.fa-duotone.fa-burrito:after, .fad.fa-burrito:after {
+  content: "\f7ed\f7ed";
+}
+
+.fa-duotone.fa-violin:after, .fad.fa-violin:after {
+  content: "\f8ed\f8ed";
+}
+
+.fa-duotone.fa-objects-column:after, .fad.fa-objects-column:after {
+  content: "\e3c1\e3c1";
+}
+
+.fa-duotone.fa-chevron-square-down:after, .fa-duotone.fa-square-chevron-down:after, .fad.fa-chevron-square-down:after, .fad.fa-square-chevron-down:after {
+  content: "\f329\f329";
+}
+
+.fa-duotone.fa-comment-plus:after, .fad.fa-comment-plus:after {
+  content: "\f4b2\f4b2";
+}
+
+.fa-duotone.fa-triangle-instrument:after, .fa-duotone.fa-triangle-music:after, .fad.fa-triangle-instrument:after, .fad.fa-triangle-music:after {
+  content: "\f8e2\f8e2";
+}
+
+.fa-duotone.fa-wheelchair:after, .fad.fa-wheelchair:after {
+  content: "\f193\f193";
+}
+
+.fa-duotone.fa-user-pilot-tie:after, .fad.fa-user-pilot-tie:after {
+  content: "\e2c1\e2c1";
+}
+
+.fa-duotone.fa-piano-keyboard:after, .fad.fa-piano-keyboard:after {
+  content: "\f8d5\f8d5";
+}
+
+.fa-duotone.fa-bed-empty:after, .fad.fa-bed-empty:after {
+  content: "\f8f9\f8f9";
+}
+
+.fa-duotone.fa-arrow-circle-up:after, .fa-duotone.fa-circle-arrow-up:after, .fad.fa-arrow-circle-up:after, .fad.fa-circle-arrow-up:after {
+  content: "\f0aa\f0aa";
+}
+
+.fa-duotone.fa-toggle-on:after, .fad.fa-toggle-on:after {
+  content: "\f205\f205";
+}
+
+.fa-duotone.fa-rectangle-portrait:after, .fa-duotone.fa-rectangle-vertical:after, .fad.fa-rectangle-portrait:after, .fad.fa-rectangle-vertical:after {
+  content: "\f2fb\f2fb";
+}
+
+.fa-duotone.fa-person-walking:after, .fa-duotone.fa-walking:after, .fad.fa-person-walking:after, .fad.fa-walking:after {
+  content: "\f554\f554";
+}
+
+.fa-duotone.fa-l:after, .fad.fa-l:after {
+  content: "\4c\4c";
+}
+
+.fa-duotone.fa-signal-stream:after, .fad.fa-signal-stream:after {
+  content: "\f8dd\f8dd";
+}
+
+.fa-duotone.fa-down-to-bracket:after, .fad.fa-down-to-bracket:after {
+  content: "\e4e7\e4e7";
+}
+
+.fa-duotone.fa-circle-z:after, .fad.fa-circle-z:after {
+  content: "\e130\e130";
+}
+
+.fa-duotone.fa-stars:after, .fad.fa-stars:after {
+  content: "\f762\f762";
+}
+
+.fa-duotone.fa-fire:after, .fad.fa-fire:after {
+  content: "\f06d\f06d";
+}
+
+.fa-duotone.fa-bed-pulse:after, .fa-duotone.fa-procedures:after, .fad.fa-bed-pulse:after, .fad.fa-procedures:after {
+  content: "\f487\f487";
+}
+
+.fa-duotone.fa-house-day:after, .fad.fa-house-day:after {
+  content: "\e00e\e00e";
+}
+
+.fa-duotone.fa-shuttle-space:after, .fa-duotone.fa-space-shuttle:after, .fad.fa-shuttle-space:after, .fad.fa-space-shuttle:after {
+  content: "\f197\f197";
+}
+
+.fa-duotone.fa-shirt-long-sleeve:after, .fad.fa-shirt-long-sleeve:after {
+  content: "\e3c7\e3c7";
+}
+
+.fa-duotone.fa-chart-pie-alt:after, .fa-duotone.fa-chart-pie-simple:after, .fad.fa-chart-pie-alt:after, .fad.fa-chart-pie-simple:after {
+  content: "\f64e\f64e";
+}
+
+.fa-duotone.fa-face-laugh:after, .fa-duotone.fa-laugh:after, .fad.fa-face-laugh:after, .fad.fa-laugh:after {
+  content: "\f599\f599";
+}
+
+.fa-duotone.fa-folder-open:after, .fad.fa-folder-open:after {
+  content: "\f07c\f07c";
+}
+
+.fa-duotone.fa-album-collection-circle-user:after, .fad.fa-album-collection-circle-user:after {
+  content: "\e48f\e48f";
+}
+
+.fa-duotone.fa-candy:after, .fad.fa-candy:after {
+  content: "\e3e7\e3e7";
+}
+
+.fa-duotone.fa-bowl-hot:after, .fa-duotone.fa-soup:after, .fad.fa-bowl-hot:after, .fad.fa-soup:after {
+  content: "\f823\f823";
+}
+
+.fa-duotone.fa-flatbread:after, .fad.fa-flatbread:after {
+  content: "\e40b\e40b";
+}
+
+.fa-duotone.fa-heart-circle-plus:after, .fad.fa-heart-circle-plus:after {
+  content: "\e500\e500";
+}
+
+.fa-duotone.fa-code-fork:after, .fad.fa-code-fork:after {
+  content: "\e13b\e13b";
+}
+
+.fa-duotone.fa-city:after, .fad.fa-city:after {
+  content: "\f64f\f64f";
+}
+
+.fa-duotone.fa-signal-alt-1:after, .fa-duotone.fa-signal-bars-weak:after, .fad.fa-signal-alt-1:after, .fad.fa-signal-bars-weak:after {
+  content: "\f691\f691";
+}
+
+.fa-duotone.fa-microphone-alt:after, .fa-duotone.fa-microphone-lines:after, .fad.fa-microphone-alt:after, .fad.fa-microphone-lines:after {
+  content: "\f3c9\f3c9";
+}
+
+.fa-duotone.fa-clock-twelve:after, .fad.fa-clock-twelve:after {
+  content: "\e358\e358";
+}
+
+.fa-duotone.fa-pepper-hot:after, .fad.fa-pepper-hot:after {
+  content: "\f816\f816";
+}
+
+.fa-duotone.fa-citrus-slice:after, .fad.fa-citrus-slice:after {
+  content: "\e2f5\e2f5";
+}
+
+.fa-duotone.fa-sheep:after, .fad.fa-sheep:after {
+  content: "\f711\f711";
+}
+
+.fa-duotone.fa-unlock:after, .fad.fa-unlock:after {
+  content: "\f09c\f09c";
+}
+
+.fa-duotone.fa-colon-sign:after, .fad.fa-colon-sign:after {
+  content: "\e140\e140";
+}
+
+.fa-duotone.fa-headset:after, .fad.fa-headset:after {
+  content: "\f590\f590";
+}
+
+.fa-duotone.fa-badger-honey:after, .fad.fa-badger-honey:after {
+  content: "\f6b4\f6b4";
+}
+
+.fa-duotone.fa-h4:after, .fad.fa-h4:after {
+  content: "\f86a\f86a";
+}
+
+.fa-duotone.fa-store-slash:after, .fad.fa-store-slash:after {
+  content: "\e071\e071";
+}
+
+.fa-duotone.fa-road-circle-xmark:after, .fad.fa-road-circle-xmark:after {
+  content: "\e566\e566";
+}
+
+.fa-duotone.fa-signal-slash:after, .fad.fa-signal-slash:after {
+  content: "\f695\f695";
+}
+
+.fa-duotone.fa-user-minus:after, .fad.fa-user-minus:after {
+  content: "\f503\f503";
+}
+
+.fa-duotone.fa-mars-stroke-up:after, .fa-duotone.fa-mars-stroke-v:after, .fad.fa-mars-stroke-up:after, .fad.fa-mars-stroke-v:after {
+  content: "\f22a\f22a";
+}
+
+.fa-duotone.fa-champagne-glasses:after, .fa-duotone.fa-glass-cheers:after, .fad.fa-champagne-glasses:after, .fad.fa-glass-cheers:after {
+  content: "\f79f\f79f";
+}
+
+.fa-duotone.fa-taco:after, .fad.fa-taco:after {
+  content: "\f826\f826";
+}
+
+.fa-duotone.fa-hexagon-plus:after, .fa-duotone.fa-plus-hexagon:after, .fad.fa-hexagon-plus:after, .fad.fa-plus-hexagon:after {
+  content: "\f300\f300";
+}
+
+.fa-duotone.fa-clipboard:after, .fad.fa-clipboard:after {
+  content: "\f328\f328";
+}
+
+.fa-duotone.fa-house-circle-exclamation:after, .fad.fa-house-circle-exclamation:after {
+  content: "\e50a\e50a";
+}
+
+.fa-duotone.fa-file-arrow-up:after, .fa-duotone.fa-file-upload:after, .fad.fa-file-arrow-up:after, .fad.fa-file-upload:after {
+  content: "\f574\f574";
+}
+
+.fa-duotone.fa-wifi-3:after, .fa-duotone.fa-wifi-strong:after, .fa-duotone.fa-wifi:after, .fad.fa-wifi-3:after, .fad.fa-wifi-strong:after, .fad.fa-wifi:after {
+  content: "\f1eb\f1eb";
+}
+
+.fa-duotone.fa-comments-alt:after, .fa-duotone.fa-messages:after, .fad.fa-comments-alt:after, .fad.fa-messages:after {
+  content: "\f4b6\f4b6";
+}
+
+.fa-duotone.fa-bath:after, .fa-duotone.fa-bathtub:after, .fad.fa-bath:after, .fad.fa-bathtub:after {
+  content: "\f2cd\f2cd";
+}
+
+.fa-duotone.fa-umbrella-alt:after, .fa-duotone.fa-umbrella-simple:after, .fad.fa-umbrella-alt:after, .fad.fa-umbrella-simple:after {
+  content: "\e2bc\e2bc";
+}
+
+.fa-duotone.fa-rectangle-history-circle-plus:after, .fad.fa-rectangle-history-circle-plus:after {
+  content: "\e4a3\e4a3";
+}
+
+.fa-duotone.fa-underline:after, .fad.fa-underline:after {
+  content: "\f0cd\f0cd";
+}
+
+.fa-duotone.fa-prescription-bottle-pill:after, .fad.fa-prescription-bottle-pill:after {
+  content: "\e5c0\e5c0";
+}
+
+.fa-duotone.fa-user-edit:after, .fa-duotone.fa-user-pen:after, .fad.fa-user-edit:after, .fad.fa-user-pen:after {
+  content: "\f4ff\f4ff";
+}
+
+.fa-duotone.fa-binary-slash:after, .fad.fa-binary-slash:after {
+  content: "\e33e\e33e";
+}
+
+.fa-duotone.fa-square-o:after, .fad.fa-square-o:after {
+  content: "\e278\e278";
+}
+
+.fa-duotone.fa-caduceus:after, .fad.fa-caduceus:after {
+  content: "\e681\e681";
+}
+
+.fa-duotone.fa-signature:after, .fad.fa-signature:after {
+  content: "\f5b7\f5b7";
+}
+
+.fa-duotone.fa-stroopwafel:after, .fad.fa-stroopwafel:after {
+  content: "\f551\f551";
+}
+
+.fa-duotone.fa-bold:after, .fad.fa-bold:after {
+  content: "\f032\f032";
+}
+
+.fa-duotone.fa-anchor-lock:after, .fad.fa-anchor-lock:after {
+  content: "\e4ad\e4ad";
+}
+
+.fa-duotone.fa-building-ngo:after, .fad.fa-building-ngo:after {
+  content: "\e4d7\e4d7";
+}
+
+.fa-duotone.fa-transporter-3:after, .fad.fa-transporter-3:after {
+  content: "\e045\e045";
+}
+
+.fa-duotone.fa-engine-exclamation:after, .fa-duotone.fa-engine-warning:after, .fad.fa-engine-exclamation:after, .fad.fa-engine-warning:after {
+  content: "\f5f2\f5f2";
+}
+
+.fa-duotone.fa-circle-down-right:after, .fad.fa-circle-down-right:after {
+  content: "\e108\e108";
+}
+
+.fa-duotone.fa-square-k:after, .fad.fa-square-k:after {
+  content: "\e274\e274";
+}
+
+.fa-duotone.fa-manat-sign:after, .fad.fa-manat-sign:after {
+  content: "\e1d5\e1d5";
+}
+
+.fa-duotone.fa-money-check-edit:after, .fa-duotone.fa-money-check-pen:after, .fad.fa-money-check-edit:after, .fad.fa-money-check-pen:after {
+  content: "\f872\f872";
+}
+
+.fa-duotone.fa-not-equal:after, .fad.fa-not-equal:after {
+  content: "\f53e\f53e";
+}
+
+.fa-duotone.fa-border-style:after, .fa-duotone.fa-border-top-left:after, .fad.fa-border-style:after, .fad.fa-border-top-left:after {
+  content: "\f853\f853";
+}
+
+.fa-duotone.fa-map-location-dot:after, .fa-duotone.fa-map-marked-alt:after, .fad.fa-map-location-dot:after, .fad.fa-map-marked-alt:after {
+  content: "\f5a0\f5a0";
+}
+
+.fa-duotone.fa-tilde:after, .fad.fa-tilde:after {
+  content: "\7e\7e";
+}
+
+.fa-duotone.fa-jedi:after, .fad.fa-jedi:after {
+  content: "\f669\f669";
+}
+
+.fa-duotone.fa-poll:after, .fa-duotone.fa-square-poll-vertical:after, .fad.fa-poll:after, .fad.fa-square-poll-vertical:after {
+  content: "\f681\f681";
+}
+
+.fa-duotone.fa-arrow-down-square-triangle:after, .fa-duotone.fa-sort-shapes-down-alt:after, .fad.fa-arrow-down-square-triangle:after, .fad.fa-sort-shapes-down-alt:after {
+  content: "\f889\f889";
+}
+
+.fa-duotone.fa-mug-hot:after, .fad.fa-mug-hot:after {
+  content: "\f7b6\f7b6";
+}
+
+.fa-duotone.fa-dog-leashed:after, .fad.fa-dog-leashed:after {
+  content: "\f6d4\f6d4";
+}
+
+.fa-duotone.fa-battery-car:after, .fa-duotone.fa-car-battery:after, .fad.fa-battery-car:after, .fad.fa-car-battery:after {
+  content: "\f5df\f5df";
+}
+
+.fa-duotone.fa-face-downcast-sweat:after, .fad.fa-face-downcast-sweat:after {
+  content: "\e371\e371";
+}
+
+.fa-duotone.fa-mailbox-flag-up:after, .fad.fa-mailbox-flag-up:after {
+  content: "\e5bb\e5bb";
+}
+
+.fa-duotone.fa-memo-circle-info:after, .fad.fa-memo-circle-info:after {
+  content: "\e49a\e49a";
+}
+
+.fa-duotone.fa-gift:after, .fad.fa-gift:after {
+  content: "\f06b\f06b";
+}
+
+.fa-duotone.fa-dice-two:after, .fad.fa-dice-two:after {
+  content: "\f528\f528";
+}
+
+.fa-duotone.fa-volume-medium:after, .fa-duotone.fa-volume:after, .fad.fa-volume-medium:after, .fad.fa-volume:after {
+  content: "\f6a8\f6a8";
+}
+
+.fa-duotone.fa-transporter-5:after, .fad.fa-transporter-5:after {
+  content: "\e2a6\e2a6";
+}
+
+.fa-duotone.fa-gauge-circle-bolt:after, .fad.fa-gauge-circle-bolt:after {
+  content: "\e496\e496";
+}
+
+.fa-duotone.fa-coin-front:after, .fad.fa-coin-front:after {
+  content: "\e3fc\e3fc";
+}
+
+.fa-duotone.fa-file-slash:after, .fad.fa-file-slash:after {
+  content: "\e3a7\e3a7";
+}
+
+.fa-duotone.fa-message-arrow-up-right:after, .fad.fa-message-arrow-up-right:after {
+  content: "\e1dd\e1dd";
+}
+
+.fa-duotone.fa-treasure-chest:after, .fad.fa-treasure-chest:after {
+  content: "\f723\f723";
+}
+
+.fa-duotone.fa-chess-queen:after, .fad.fa-chess-queen:after {
+  content: "\f445\f445";
+}
+
+.fa-duotone.fa-paint-brush-alt:after, .fa-duotone.fa-paint-brush-fine:after, .fa-duotone.fa-paintbrush-alt:after, .fa-duotone.fa-paintbrush-fine:after, .fad.fa-paint-brush-alt:after, .fad.fa-paint-brush-fine:after, .fad.fa-paintbrush-alt:after, .fad.fa-paintbrush-fine:after {
+  content: "\f5a9\f5a9";
+}
+
+.fa-duotone.fa-glasses:after, .fad.fa-glasses:after {
+  content: "\f530\f530";
+}
+
+.fa-duotone.fa-hood-cloak:after, .fad.fa-hood-cloak:after {
+  content: "\f6ef\f6ef";
+}
+
+.fa-duotone.fa-square-quote:after, .fad.fa-square-quote:after {
+  content: "\e329\e329";
+}
+
+.fa-duotone.fa-up-left:after, .fad.fa-up-left:after {
+  content: "\e2bd\e2bd";
+}
+
+.fa-duotone.fa-bring-front:after, .fad.fa-bring-front:after {
+  content: "\f857\f857";
+}
+
+.fa-duotone.fa-chess-board:after, .fad.fa-chess-board:after {
+  content: "\f43c\f43c";
+}
+
+.fa-duotone.fa-burger-cheese:after, .fa-duotone.fa-cheeseburger:after, .fad.fa-burger-cheese:after, .fad.fa-cheeseburger:after {
+  content: "\f7f1\f7f1";
+}
+
+.fa-duotone.fa-building-circle-check:after, .fad.fa-building-circle-check:after {
+  content: "\e4d2\e4d2";
+}
+
+.fa-duotone.fa-repeat-1:after, .fad.fa-repeat-1:after {
+  content: "\f365\f365";
+}
+
+.fa-duotone.fa-arrow-down-to-line:after, .fa-duotone.fa-arrow-to-bottom:after, .fad.fa-arrow-down-to-line:after, .fad.fa-arrow-to-bottom:after {
+  content: "\f33d\f33d";
+}
+
+.fa-duotone.fa-grid-5:after, .fad.fa-grid-5:after {
+  content: "\e199\e199";
+}
+
+.fa-duotone.fa-swap-arrows:after, .fad.fa-swap-arrows:after {
+  content: "\e60a\e60a";
+}
+
+.fa-duotone.fa-right-long-to-line:after, .fad.fa-right-long-to-line:after {
+  content: "\e444\e444";
+}
+
+.fa-duotone.fa-person-chalkboard:after, .fad.fa-person-chalkboard:after {
+  content: "\e53d\e53d";
+}
+
+.fa-duotone.fa-mars-stroke-h:after, .fa-duotone.fa-mars-stroke-right:after, .fad.fa-mars-stroke-h:after, .fad.fa-mars-stroke-right:after {
+  content: "\f22b\f22b";
+}
+
+.fa-duotone.fa-hand-back-fist:after, .fa-duotone.fa-hand-rock:after, .fad.fa-hand-back-fist:after, .fad.fa-hand-rock:after {
+  content: "\f255\f255";
+}
+
+.fa-duotone.fa-grid-round-5:after, .fad.fa-grid-round-5:after {
+  content: "\e5de\e5de";
+}
+
+.fa-duotone.fa-tally-5:after, .fa-duotone.fa-tally:after, .fad.fa-tally-5:after, .fad.fa-tally:after {
+  content: "\f69c\f69c";
+}
+
+.fa-duotone.fa-caret-square-up:after, .fa-duotone.fa-square-caret-up:after, .fad.fa-caret-square-up:after, .fad.fa-square-caret-up:after {
+  content: "\f151\f151";
+}
+
+.fa-duotone.fa-cloud-showers-water:after, .fad.fa-cloud-showers-water:after {
+  content: "\e4e4\e4e4";
+}
+
+.fa-duotone.fa-bar-chart:after, .fa-duotone.fa-chart-bar:after, .fad.fa-bar-chart:after, .fad.fa-chart-bar:after {
+  content: "\f080\f080";
+}
+
+.fa-duotone.fa-hands-bubbles:after, .fa-duotone.fa-hands-wash:after, .fad.fa-hands-bubbles:after, .fad.fa-hands-wash:after {
+  content: "\e05e\e05e";
+}
+
+.fa-duotone.fa-less-than-equal:after, .fad.fa-less-than-equal:after {
+  content: "\f537\f537";
+}
+
+.fa-duotone.fa-train:after, .fad.fa-train:after {
+  content: "\f238\f238";
+}
+
+.fa-duotone.fa-up-from-dotted-line:after, .fad.fa-up-from-dotted-line:after {
+  content: "\e456\e456";
+}
+
+.fa-duotone.fa-eye-low-vision:after, .fa-duotone.fa-low-vision:after, .fad.fa-eye-low-vision:after, .fad.fa-low-vision:after {
+  content: "\f2a8\f2a8";
+}
+
+.fa-duotone.fa-traffic-light-go:after, .fad.fa-traffic-light-go:after {
+  content: "\f638\f638";
+}
+
+.fa-duotone.fa-face-exhaling:after, .fad.fa-face-exhaling:after {
+  content: "\e480\e480";
+}
+
+.fa-duotone.fa-sensor-fire:after, .fad.fa-sensor-fire:after {
+  content: "\e02a\e02a";
+}
+
+.fa-duotone.fa-user-unlock:after, .fad.fa-user-unlock:after {
+  content: "\e058\e058";
+}
+
+.fa-duotone.fa-hexagon-divide:after, .fad.fa-hexagon-divide:after {
+  content: "\e1ad\e1ad";
+}
+
+.fa-duotone.fa-00:after, .fad.fa-00:after {
+  content: "\e467\e467";
+}
+
+.fa-duotone.fa-crow:after, .fad.fa-crow:after {
+  content: "\f520\f520";
+}
+
+.fa-duotone.fa-betamax:after, .fa-duotone.fa-cassette-betamax:after, .fad.fa-betamax:after, .fad.fa-cassette-betamax:after {
+  content: "\f8a4\f8a4";
+}
+
+.fa-duotone.fa-sailboat:after, .fad.fa-sailboat:after {
+  content: "\e445\e445";
+}
+
+.fa-duotone.fa-window-restore:after, .fad.fa-window-restore:after {
+  content: "\f2d2\f2d2";
+}
+
+.fa-duotone.fa-nfc-magnifying-glass:after, .fad.fa-nfc-magnifying-glass:after {
+  content: "\e1f9\e1f9";
+}
+
+.fa-duotone.fa-file-binary:after, .fad.fa-file-binary:after {
+  content: "\e175\e175";
+}
+
+.fa-duotone.fa-circle-v:after, .fad.fa-circle-v:after {
+  content: "\e12a\e12a";
+}
+
+.fa-duotone.fa-plus-square:after, .fa-duotone.fa-square-plus:after, .fad.fa-plus-square:after, .fad.fa-square-plus:after {
+  content: "\f0fe\f0fe";
+}
+
+.fa-duotone.fa-bowl-scoops:after, .fad.fa-bowl-scoops:after {
+  content: "\e3df\e3df";
+}
+
+.fa-duotone.fa-mistletoe:after, .fad.fa-mistletoe:after {
+  content: "\f7b4\f7b4";
+}
+
+.fa-duotone.fa-custard:after, .fad.fa-custard:after {
+  content: "\e403\e403";
+}
+
+.fa-duotone.fa-lacrosse-stick:after, .fad.fa-lacrosse-stick:after {
+  content: "\e3b5\e3b5";
+}
+
+.fa-duotone.fa-hockey-mask:after, .fad.fa-hockey-mask:after {
+  content: "\f6ee\f6ee";
+}
+
+.fa-duotone.fa-sunrise:after, .fad.fa-sunrise:after {
+  content: "\f766\f766";
+}
+
+.fa-duotone.fa-subtitles:after, .fad.fa-subtitles:after {
+  content: "\e60f\e60f";
+}
+
+.fa-duotone.fa-panel-ews:after, .fad.fa-panel-ews:after {
+  content: "\e42e\e42e";
+}
+
+.fa-duotone.fa-torii-gate:after, .fad.fa-torii-gate:after {
+  content: "\f6a1\f6a1";
+}
+
+.fa-duotone.fa-cloud-exclamation:after, .fad.fa-cloud-exclamation:after {
+  content: "\e491\e491";
+}
+
+.fa-duotone.fa-comment-alt-lines:after, .fa-duotone.fa-message-lines:after, .fad.fa-comment-alt-lines:after, .fad.fa-message-lines:after {
+  content: "\f4a6\f4a6";
+}
+
+.fa-duotone.fa-frog:after, .fad.fa-frog:after {
+  content: "\f52e\f52e";
+}
+
+.fa-duotone.fa-bucket:after, .fad.fa-bucket:after {
+  content: "\e4cf\e4cf";
+}
+
+.fa-duotone.fa-floppy-disk-pen:after, .fad.fa-floppy-disk-pen:after {
+  content: "\e182\e182";
+}
+
+.fa-duotone.fa-image:after, .fad.fa-image:after {
+  content: "\f03e\f03e";
+}
+
+.fa-duotone.fa-window-frame:after, .fad.fa-window-frame:after {
+  content: "\e04f\e04f";
+}
+
+.fa-duotone.fa-microphone:after, .fad.fa-microphone:after {
+  content: "\f130\f130";
+}
+
+.fa-duotone.fa-cow:after, .fad.fa-cow:after {
+  content: "\f6c8\f6c8";
+}
+
+.fa-duotone.fa-file-zip:after, .fad.fa-file-zip:after {
+  content: "\e5ee\e5ee";
+}
+
+.fa-duotone.fa-square-ring:after, .fad.fa-square-ring:after {
+  content: "\e44f\e44f";
+}
+
+.fa-duotone.fa-arrow-alt-from-top:after, .fa-duotone.fa-down-from-line:after, .fad.fa-arrow-alt-from-top:after, .fad.fa-down-from-line:after {
+  content: "\f349\f349";
+}
+
+.fa-duotone.fa-caret-up:after, .fad.fa-caret-up:after {
+  content: "\f0d8\f0d8";
+}
+
+.fa-duotone.fa-shield-times:after, .fa-duotone.fa-shield-xmark:after, .fad.fa-shield-times:after, .fad.fa-shield-xmark:after {
+  content: "\e24c\e24c";
+}
+
+.fa-duotone.fa-screwdriver:after, .fad.fa-screwdriver:after {
+  content: "\f54a\f54a";
+}
+
+.fa-duotone.fa-circle-sort-down:after, .fa-duotone.fa-sort-circle-down:after, .fad.fa-circle-sort-down:after, .fad.fa-sort-circle-down:after {
+  content: "\e031\e031";
+}
+
+.fa-duotone.fa-folder-closed:after, .fad.fa-folder-closed:after {
+  content: "\e185\e185";
+}
+
+.fa-duotone.fa-house-tsunami:after, .fad.fa-house-tsunami:after {
+  content: "\e515\e515";
+}
+
+.fa-duotone.fa-square-nfi:after, .fad.fa-square-nfi:after {
+  content: "\e576\e576";
+}
+
+.fa-duotone.fa-forklift:after, .fad.fa-forklift:after {
+  content: "\f47a\f47a";
+}
+
+.fa-duotone.fa-arrow-up-from-ground-water:after, .fad.fa-arrow-up-from-ground-water:after {
+  content: "\e4b5\e4b5";
+}
+
+.fa-duotone.fa-bracket-square-right:after, .fad.fa-bracket-square-right:after {
+  content: "\5d\5d";
+}
+
+.fa-duotone.fa-glass-martini-alt:after, .fa-duotone.fa-martini-glass:after, .fad.fa-glass-martini-alt:after, .fad.fa-martini-glass:after {
+  content: "\f57b\f57b";
+}
+
+.fa-duotone.fa-rotate-back:after, .fa-duotone.fa-rotate-backward:after, .fa-duotone.fa-rotate-left:after, .fa-duotone.fa-undo-alt:after, .fad.fa-rotate-back:after, .fad.fa-rotate-backward:after, .fad.fa-rotate-left:after, .fad.fa-undo-alt:after {
+  content: "\f2ea\f2ea";
+}
+
+.fa-duotone.fa-columns:after, .fa-duotone.fa-table-columns:after, .fad.fa-columns:after, .fad.fa-table-columns:after {
+  content: "\f0db\f0db";
+}
+
+.fa-duotone.fa-square-a:after, .fad.fa-square-a:after {
+  content: "\e25f\e25f";
+}
+
+.fa-duotone.fa-tick:after, .fad.fa-tick:after {
+  content: "\e32f\e32f";
+}
+
+.fa-duotone.fa-lemon:after, .fad.fa-lemon:after {
+  content: "\f094\f094";
+}
+
+.fa-duotone.fa-head-side-mask:after, .fad.fa-head-side-mask:after {
+  content: "\e063\e063";
+}
+
+.fa-duotone.fa-handshake:after, .fad.fa-handshake:after {
+  content: "\f2b5\f2b5";
+}
+
+.fa-duotone.fa-gem:after, .fad.fa-gem:after {
+  content: "\f3a5\f3a5";
+}
+
+.fa-duotone.fa-dolly-box:after, .fa-duotone.fa-dolly:after, .fad.fa-dolly-box:after, .fad.fa-dolly:after {
+  content: "\f472\f472";
+}
+
+.fa-duotone.fa-smoking:after, .fad.fa-smoking:after {
+  content: "\f48d\f48d";
+}
+
+.fa-duotone.fa-compress-arrows-alt:after, .fa-duotone.fa-minimize:after, .fad.fa-compress-arrows-alt:after, .fad.fa-minimize:after {
+  content: "\f78c\f78c";
+}
+
+.fa-duotone.fa-refrigerator:after, .fad.fa-refrigerator:after {
+  content: "\e026\e026";
+}
+
+.fa-duotone.fa-monument:after, .fad.fa-monument:after {
+  content: "\f5a6\f5a6";
+}
+
+.fa-duotone.fa-octagon-xmark:after, .fa-duotone.fa-times-octagon:after, .fa-duotone.fa-xmark-octagon:after, .fad.fa-octagon-xmark:after, .fad.fa-times-octagon:after, .fad.fa-xmark-octagon:after {
+  content: "\f2f0\f2f0";
+}
+
+.fa-duotone.fa-align-slash:after, .fad.fa-align-slash:after {
+  content: "\f846\f846";
+}
+
+.fa-duotone.fa-snowplow:after, .fad.fa-snowplow:after {
+  content: "\f7d2\f7d2";
+}
+
+.fa-duotone.fa-angle-double-right:after, .fa-duotone.fa-angles-right:after, .fad.fa-angle-double-right:after, .fad.fa-angles-right:after {
+  content: "\f101\f101";
+}
+
+.fa-duotone.fa-truck-couch:after, .fa-duotone.fa-truck-ramp-couch:after, .fad.fa-truck-couch:after, .fad.fa-truck-ramp-couch:after {
+  content: "\f4dd\f4dd";
+}
+
+.fa-duotone.fa-cannabis:after, .fad.fa-cannabis:after {
+  content: "\f55f\f55f";
+}
+
+.fa-duotone.fa-circle-play:after, .fa-duotone.fa-play-circle:after, .fad.fa-circle-play:after, .fad.fa-play-circle:after {
+  content: "\f144\f144";
+}
+
+.fa-duotone.fa-arrow-up-right-and-arrow-down-left-from-center:after, .fad.fa-arrow-up-right-and-arrow-down-left-from-center:after {
+  content: "\e0a0\e0a0";
+}
+
+.fa-duotone.fa-location-arrow-up:after, .fad.fa-location-arrow-up:after {
+  content: "\e63a\e63a";
+}
+
+.fa-duotone.fa-tablets:after, .fad.fa-tablets:after {
+  content: "\f490\f490";
+}
+
+.fa-duotone.fa-360-degrees:after, .fad.fa-360-degrees:after {
+  content: "\e2dc\e2dc";
+}
+
+.fa-duotone.fa-ethernet:after, .fad.fa-ethernet:after {
+  content: "\f796\f796";
+}
+
+.fa-duotone.fa-eur:after, .fa-duotone.fa-euro-sign:after, .fa-duotone.fa-euro:after, .fad.fa-eur:after, .fad.fa-euro-sign:after, .fad.fa-euro:after {
+  content: "\f153\f153";
+}
+
+.fa-duotone.fa-chair:after, .fad.fa-chair:after {
+  content: "\f6c0\f6c0";
+}
+
+.fa-duotone.fa-check-circle:after, .fa-duotone.fa-circle-check:after, .fad.fa-check-circle:after, .fad.fa-circle-check:after {
+  content: "\f058\f058";
+}
+
+.fa-duotone.fa-square-dashed-circle-plus:after, .fad.fa-square-dashed-circle-plus:after {
+  content: "\e5c2\e5c2";
+}
+
+.fa-duotone.fa-hand-holding-circle-dollar:after, .fad.fa-hand-holding-circle-dollar:after {
+  content: "\e621\e621";
+}
+
+.fa-duotone.fa-money-simple-from-bracket:after, .fad.fa-money-simple-from-bracket:after {
+  content: "\e313\e313";
+}
+
+.fa-duotone.fa-bat:after, .fad.fa-bat:after {
+  content: "\f6b5\f6b5";
+}
+
+.fa-duotone.fa-circle-stop:after, .fa-duotone.fa-stop-circle:after, .fad.fa-circle-stop:after, .fad.fa-stop-circle:after {
+  content: "\f28d\f28d";
+}
+
+.fa-duotone.fa-head-side-headphones:after, .fad.fa-head-side-headphones:after {
+  content: "\f8c2\f8c2";
+}
+
+.fa-duotone.fa-phone-rotary:after, .fad.fa-phone-rotary:after {
+  content: "\f8d3\f8d3";
+}
+
+.fa-duotone.fa-arrow-up-to-bracket:after, .fad.fa-arrow-up-to-bracket:after {
+  content: "\e66a\e66a";
+}
+
+.fa-duotone.fa-compass-drafting:after, .fa-duotone.fa-drafting-compass:after, .fad.fa-compass-drafting:after, .fad.fa-drafting-compass:after {
+  content: "\f568\f568";
+}
+
+.fa-duotone.fa-plate-wheat:after, .fad.fa-plate-wheat:after {
+  content: "\e55a\e55a";
+}
+
+.fa-duotone.fa-calendar-circle-minus:after, .fad.fa-calendar-circle-minus:after {
+  content: "\e46f\e46f";
+}
+
+.fa-duotone.fa-chopsticks:after, .fad.fa-chopsticks:after {
+  content: "\e3f7\e3f7";
+}
+
+.fa-duotone.fa-car-mechanic:after, .fa-duotone.fa-car-wrench:after, .fad.fa-car-mechanic:after, .fad.fa-car-wrench:after {
+  content: "\f5e3\f5e3";
+}
+
+.fa-duotone.fa-icicles:after, .fad.fa-icicles:after {
+  content: "\f7ad\f7ad";
+}
+
+.fa-duotone.fa-person-shelter:after, .fad.fa-person-shelter:after {
+  content: "\e54f\e54f";
+}
+
+.fa-duotone.fa-neuter:after, .fad.fa-neuter:after {
+  content: "\f22c\f22c";
+}
+
+.fa-duotone.fa-id-badge:after, .fad.fa-id-badge:after {
+  content: "\f2c1\f2c1";
+}
+
+.fa-duotone.fa-kazoo:after, .fad.fa-kazoo:after {
+  content: "\f8c7\f8c7";
+}
+
+.fa-duotone.fa-marker:after, .fad.fa-marker:after {
+  content: "\f5a1\f5a1";
+}
+
+.fa-duotone.fa-bin-bottles:after, .fad.fa-bin-bottles:after {
+  content: "\e5f5\e5f5";
+}
+
+.fa-duotone.fa-face-laugh-beam:after, .fa-duotone.fa-laugh-beam:after, .fad.fa-face-laugh-beam:after, .fad.fa-laugh-beam:after {
+  content: "\f59a\f59a";
+}
+
+.fa-duotone.fa-square-arrow-down-left:after, .fad.fa-square-arrow-down-left:after {
+  content: "\e261\e261";
+}
+
+.fa-duotone.fa-battery-bolt:after, .fad.fa-battery-bolt:after {
+  content: "\f376\f376";
+}
+
+.fa-duotone.fa-tree-large:after, .fad.fa-tree-large:after {
+  content: "\f7dd\f7dd";
+}
+
+.fa-duotone.fa-helicopter-symbol:after, .fad.fa-helicopter-symbol:after {
+  content: "\e502\e502";
+}
+
+.fa-duotone.fa-aperture:after, .fad.fa-aperture:after {
+  content: "\e2df\e2df";
+}
+
+.fa-duotone.fa-universal-access:after, .fad.fa-universal-access:after {
+  content: "\f29a\f29a";
+}
+
+.fa-duotone.fa-gear-complex:after, .fad.fa-gear-complex:after {
+  content: "\e5e9\e5e9";
+}
+
+.fa-duotone.fa-file-magnifying-glass:after, .fa-duotone.fa-file-search:after, .fad.fa-file-magnifying-glass:after, .fad.fa-file-search:after {
+  content: "\f865\f865";
+}
+
+.fa-duotone.fa-up-right:after, .fad.fa-up-right:after {
+  content: "\e2be\e2be";
+}
+
+.fa-duotone.fa-chevron-circle-up:after, .fa-duotone.fa-circle-chevron-up:after, .fad.fa-chevron-circle-up:after, .fad.fa-circle-chevron-up:after {
+  content: "\f139\f139";
+}
+
+.fa-duotone.fa-user-police:after, .fad.fa-user-police:after {
+  content: "\e333\e333";
+}
+
+.fa-duotone.fa-lari-sign:after, .fad.fa-lari-sign:after {
+  content: "\e1c8\e1c8";
+}
+
+.fa-duotone.fa-volcano:after, .fad.fa-volcano:after {
+  content: "\f770\f770";
+}
+
+.fa-duotone.fa-teddy-bear:after, .fad.fa-teddy-bear:after {
+  content: "\e3cf\e3cf";
+}
+
+.fa-duotone.fa-stocking:after, .fad.fa-stocking:after {
+  content: "\f7d5\f7d5";
+}
+
+.fa-duotone.fa-person-walking-dashed-line-arrow-right:after, .fad.fa-person-walking-dashed-line-arrow-right:after {
+  content: "\e553\e553";
+}
+
+.fa-duotone.fa-image-slash:after, .fad.fa-image-slash:after {
+  content: "\e1b7\e1b7";
+}
+
+.fa-duotone.fa-mask-snorkel:after, .fad.fa-mask-snorkel:after {
+  content: "\e3b7\e3b7";
+}
+
+.fa-duotone.fa-smoke:after, .fad.fa-smoke:after {
+  content: "\f760\f760";
+}
+
+.fa-duotone.fa-gbp:after, .fa-duotone.fa-pound-sign:after, .fa-duotone.fa-sterling-sign:after, .fad.fa-gbp:after, .fad.fa-pound-sign:after, .fad.fa-sterling-sign:after {
+  content: "\f154\f154";
+}
+
+.fa-duotone.fa-battery-exclamation:after, .fad.fa-battery-exclamation:after {
+  content: "\e0b0\e0b0";
+}
+
+.fa-duotone.fa-viruses:after, .fad.fa-viruses:after {
+  content: "\e076\e076";
+}
+
+.fa-duotone.fa-square-person-confined:after, .fad.fa-square-person-confined:after {
+  content: "\e577\e577";
+}
+
+.fa-duotone.fa-user-tie:after, .fad.fa-user-tie:after {
+  content: "\f508\f508";
+}
+
+.fa-duotone.fa-up-to-bracket:after, .fad.fa-up-to-bracket:after {
+  content: "\e66e\e66e";
+}
+
+.fa-duotone.fa-arrow-down-long:after, .fa-duotone.fa-long-arrow-down:after, .fad.fa-arrow-down-long:after, .fad.fa-long-arrow-down:after {
+  content: "\f175\f175";
+}
+
+.fa-duotone.fa-tent-arrow-down-to-line:after, .fad.fa-tent-arrow-down-to-line:after {
+  content: "\e57e\e57e";
+}
+
+.fa-duotone.fa-certificate:after, .fad.fa-certificate:after {
+  content: "\f0a3\f0a3";
+}
+
+.fa-duotone.fa-crystal-ball:after, .fad.fa-crystal-ball:after {
+  content: "\e362\e362";
+}
+
+.fa-duotone.fa-mail-reply-all:after, .fa-duotone.fa-reply-all:after, .fad.fa-mail-reply-all:after, .fad.fa-reply-all:after {
+  content: "\f122\f122";
+}
+
+.fa-duotone.fa-suitcase:after, .fad.fa-suitcase:after {
+  content: "\f0f2\f0f2";
+}
+
+.fa-duotone.fa-person-skating:after, .fa-duotone.fa-skating:after, .fad.fa-person-skating:after, .fad.fa-skating:after {
+  content: "\f7c5\f7c5";
+}
+
+.fa-duotone.fa-star-shooting:after, .fad.fa-star-shooting:after {
+  content: "\e036\e036";
+}
+
+.fa-duotone.fa-binary-lock:after, .fad.fa-binary-lock:after {
+  content: "\e33d\e33d";
+}
+
+.fa-duotone.fa-filter-circle-dollar:after, .fa-duotone.fa-funnel-dollar:after, .fad.fa-filter-circle-dollar:after, .fad.fa-funnel-dollar:after {
+  content: "\f662\f662";
+}
+
+.fa-duotone.fa-camera-retro:after, .fad.fa-camera-retro:after {
+  content: "\f083\f083";
+}
+
+.fa-duotone.fa-arrow-circle-down:after, .fa-duotone.fa-circle-arrow-down:after, .fad.fa-arrow-circle-down:after, .fad.fa-circle-arrow-down:after {
+  content: "\f0ab\f0ab";
+}
+
+.fa-duotone.fa-comment-edit:after, .fa-duotone.fa-comment-pen:after, .fad.fa-comment-edit:after, .fad.fa-comment-pen:after {
+  content: "\f4ae\f4ae";
+}
+
+.fa-duotone.fa-arrow-right-to-file:after, .fa-duotone.fa-file-import:after, .fad.fa-arrow-right-to-file:after, .fad.fa-file-import:after {
+  content: "\f56f\f56f";
+}
+
+.fa-duotone.fa-banjo:after, .fad.fa-banjo:after {
+  content: "\f8a3\f8a3";
+}
+
+.fa-duotone.fa-external-link-square:after, .fa-duotone.fa-square-arrow-up-right:after, .fad.fa-external-link-square:after, .fad.fa-square-arrow-up-right:after {
+  content: "\f14c\f14c";
+}
+
+.fa-duotone.fa-light-emergency-on:after, .fad.fa-light-emergency-on:after {
+  content: "\e420\e420";
+}
+
+.fa-duotone.fa-kerning:after, .fad.fa-kerning:after {
+  content: "\f86f\f86f";
+}
+
+.fa-duotone.fa-box-open:after, .fad.fa-box-open:after {
+  content: "\f49e\f49e";
+}
+
+.fa-duotone.fa-square-f:after, .fad.fa-square-f:after {
+  content: "\e270\e270";
+}
+
+.fa-duotone.fa-scroll:after, .fad.fa-scroll:after {
+  content: "\f70e\f70e";
+}
+
+.fa-duotone.fa-spa:after, .fad.fa-spa:after {
+  content: "\f5bb\f5bb";
+}
+
+.fa-duotone.fa-arrow-from-right:after, .fa-duotone.fa-arrow-left-from-line:after, .fad.fa-arrow-from-right:after, .fad.fa-arrow-left-from-line:after {
+  content: "\f344\f344";
+}
+
+.fa-duotone.fa-strawberry:after, .fad.fa-strawberry:after {
+  content: "\e32b\e32b";
+}
+
+.fa-duotone.fa-location-pin-lock:after, .fad.fa-location-pin-lock:after {
+  content: "\e51f\e51f";
+}
+
+.fa-duotone.fa-pause:after, .fad.fa-pause:after {
+  content: "\f04c\f04c";
+}
+
+.fa-duotone.fa-clock-eight-thirty:after, .fad.fa-clock-eight-thirty:after {
+  content: "\e346\e346";
+}
+
+.fa-duotone.fa-plane-alt:after, .fa-duotone.fa-plane-engines:after, .fad.fa-plane-alt:after, .fad.fa-plane-engines:after {
+  content: "\f3de\f3de";
+}
+
+.fa-duotone.fa-hill-avalanche:after, .fad.fa-hill-avalanche:after {
+  content: "\e507\e507";
+}
+
+.fa-duotone.fa-temperature-0:after, .fa-duotone.fa-temperature-empty:after, .fa-duotone.fa-thermometer-0:after, .fa-duotone.fa-thermometer-empty:after, .fad.fa-temperature-0:after, .fad.fa-temperature-empty:after, .fad.fa-thermometer-0:after, .fad.fa-thermometer-empty:after {
+  content: "\f2cb\f2cb";
+}
+
+.fa-duotone.fa-bomb:after, .fad.fa-bomb:after {
+  content: "\f1e2\f1e2";
+}
+
+.fa-duotone.fa-gauge-low:after, .fa-duotone.fa-tachometer-alt-slow:after, .fad.fa-gauge-low:after, .fad.fa-tachometer-alt-slow:after {
+  content: "\f627\f627";
+}
+
+.fa-duotone.fa-registered:after, .fad.fa-registered:after {
+  content: "\f25d\f25d";
+}
+
+.fa-duotone.fa-trash-can-plus:after, .fad.fa-trash-can-plus:after {
+  content: "\e2ac\e2ac";
+}
+
+.fa-duotone.fa-address-card:after, .fa-duotone.fa-contact-card:after, .fa-duotone.fa-vcard:after, .fad.fa-address-card:after, .fad.fa-contact-card:after, .fad.fa-vcard:after {
+  content: "\f2bb\f2bb";
+}
+
+.fa-duotone.fa-balance-scale-right:after, .fa-duotone.fa-scale-unbalanced-flip:after, .fad.fa-balance-scale-right:after, .fad.fa-scale-unbalanced-flip:after {
+  content: "\f516\f516";
+}
+
+.fa-duotone.fa-globe-snow:after, .fad.fa-globe-snow:after {
+  content: "\f7a3\f7a3";
+}
+
+.fa-duotone.fa-subscript:after, .fad.fa-subscript:after {
+  content: "\f12c\f12c";
+}
+
+.fa-duotone.fa-diamond-turn-right:after, .fa-duotone.fa-directions:after, .fad.fa-diamond-turn-right:after, .fad.fa-directions:after {
+  content: "\f5eb\f5eb";
+}
+
+.fa-duotone.fa-integral:after, .fad.fa-integral:after {
+  content: "\f667\f667";
+}
+
+.fa-duotone.fa-burst:after, .fad.fa-burst:after {
+  content: "\e4dc\e4dc";
+}
+
+.fa-duotone.fa-house-laptop:after, .fa-duotone.fa-laptop-house:after, .fad.fa-house-laptop:after, .fad.fa-laptop-house:after {
+  content: "\e066\e066";
+}
+
+.fa-duotone.fa-face-tired:after, .fa-duotone.fa-tired:after, .fad.fa-face-tired:after, .fad.fa-tired:after {
+  content: "\f5c8\f5c8";
+}
+
+.fa-duotone.fa-money-bills:after, .fad.fa-money-bills:after {
+  content: "\e1f3\e1f3";
+}
+
+.fa-duotone.fa-blinds-raised:after, .fad.fa-blinds-raised:after {
+  content: "\f8fd\f8fd";
+}
+
+.fa-duotone.fa-smog:after, .fad.fa-smog:after {
+  content: "\f75f\f75f";
+}
+
+.fa-duotone.fa-ufo-beam:after, .fad.fa-ufo-beam:after {
+  content: "\e048\e048";
+}
+
+.fa-duotone.fa-caret-circle-up:after, .fa-duotone.fa-circle-caret-up:after, .fad.fa-caret-circle-up:after, .fad.fa-circle-caret-up:after {
+  content: "\f331\f331";
+}
+
+.fa-duotone.fa-user-vneck-hair-long:after, .fad.fa-user-vneck-hair-long:after {
+  content: "\e463\e463";
+}
+
+.fa-duotone.fa-square-a-lock:after, .fad.fa-square-a-lock:after {
+  content: "\e44d\e44d";
+}
+
+.fa-duotone.fa-crutch:after, .fad.fa-crutch:after {
+  content: "\f7f7\f7f7";
+}
+
+.fa-duotone.fa-gas-pump-slash:after, .fad.fa-gas-pump-slash:after {
+  content: "\f5f4\f5f4";
+}
+
+.fa-duotone.fa-cloud-arrow-up:after, .fa-duotone.fa-cloud-upload-alt:after, .fa-duotone.fa-cloud-upload:after, .fad.fa-cloud-arrow-up:after, .fad.fa-cloud-upload-alt:after, .fad.fa-cloud-upload:after {
+  content: "\f0ee\f0ee";
+}
+
+.fa-duotone.fa-palette:after, .fad.fa-palette:after {
+  content: "\f53f\f53f";
+}
+
+.fa-duotone.fa-transporter-4:after, .fad.fa-transporter-4:after {
+  content: "\e2a5\e2a5";
+}
+
+.fa-duotone.fa-chart-mixed-up-circle-currency:after, .fad.fa-chart-mixed-up-circle-currency:after {
+  content: "\e5d8\e5d8";
+}
+
+.fa-duotone.fa-objects-align-right:after, .fad.fa-objects-align-right:after {
+  content: "\e3bf\e3bf";
+}
+
+.fa-duotone.fa-arrows-turn-right:after, .fad.fa-arrows-turn-right:after {
+  content: "\e4c0\e4c0";
+}
+
+.fa-duotone.fa-vest:after, .fad.fa-vest:after {
+  content: "\e085\e085";
+}
+
+.fa-duotone.fa-pig:after, .fad.fa-pig:after {
+  content: "\f706\f706";
+}
+
+.fa-duotone.fa-inbox-full:after, .fad.fa-inbox-full:after {
+  content: "\e1ba\e1ba";
+}
+
+.fa-duotone.fa-circle-envelope:after, .fa-duotone.fa-envelope-circle:after, .fad.fa-circle-envelope:after, .fad.fa-envelope-circle:after {
+  content: "\e10c\e10c";
+}
+
+.fa-duotone.fa-construction:after, .fa-duotone.fa-triangle-person-digging:after, .fad.fa-construction:after, .fad.fa-triangle-person-digging:after {
+  content: "\f85d\f85d";
+}
+
+.fa-duotone.fa-ferry:after, .fad.fa-ferry:after {
+  content: "\e4ea\e4ea";
+}
+
+.fa-duotone.fa-bullseye-arrow:after, .fad.fa-bullseye-arrow:after {
+  content: "\f648\f648";
+}
+
+.fa-duotone.fa-arrows-down-to-people:after, .fad.fa-arrows-down-to-people:after {
+  content: "\e4b9\e4b9";
+}
+
+.fa-duotone.fa-seedling:after, .fa-duotone.fa-sprout:after, .fad.fa-seedling:after, .fad.fa-sprout:after {
+  content: "\f4d8\f4d8";
+}
+
+.fa-duotone.fa-clock-seven:after, .fad.fa-clock-seven:after {
+  content: "\e350\e350";
+}
+
+.fa-duotone.fa-arrows-alt-h:after, .fa-duotone.fa-left-right:after, .fad.fa-arrows-alt-h:after, .fad.fa-left-right:after {
+  content: "\f337\f337";
+}
+
+.fa-duotone.fa-boxes-packing:after, .fad.fa-boxes-packing:after {
+  content: "\e4c7\e4c7";
+}
+
+.fa-duotone.fa-arrow-circle-left:after, .fa-duotone.fa-circle-arrow-left:after, .fad.fa-arrow-circle-left:after, .fad.fa-circle-arrow-left:after {
+  content: "\f0a8\f0a8";
+}
+
+.fa-duotone.fa-flashlight:after, .fad.fa-flashlight:after {
+  content: "\f8b8\f8b8";
+}
+
+.fa-duotone.fa-file-jpg:after, .fad.fa-file-jpg:after {
+  content: "\e646\e646";
+}
+
+.fa-duotone.fa-group-arrows-rotate:after, .fad.fa-group-arrows-rotate:after {
+  content: "\e4f6\e4f6";
+}
+
+.fa-duotone.fa-bowl-food:after, .fad.fa-bowl-food:after {
+  content: "\e4c6\e4c6";
+}
+
+.fa-duotone.fa-square-9:after, .fad.fa-square-9:after {
+  content: "\e25e\e25e";
+}
+
+.fa-duotone.fa-candy-cane:after, .fad.fa-candy-cane:after {
+  content: "\f786\f786";
+}
+
+.fa-duotone.fa-arrow-down-wide-short:after, .fa-duotone.fa-sort-amount-asc:after, .fa-duotone.fa-sort-amount-down:after, .fad.fa-arrow-down-wide-short:after, .fad.fa-sort-amount-asc:after, .fad.fa-sort-amount-down:after {
+  content: "\f160\f160";
+}
+
+.fa-duotone.fa-dollar-square:after, .fa-duotone.fa-square-dollar:after, .fa-duotone.fa-usd-square:after, .fad.fa-dollar-square:after, .fad.fa-square-dollar:after, .fad.fa-usd-square:after {
+  content: "\f2e9\f2e9";
+}
+
+.fa-duotone.fa-phone-arrow-right:after, .fad.fa-phone-arrow-right:after {
+  content: "\e5be\e5be";
+}
+
+.fa-duotone.fa-hand-holding-seedling:after, .fad.fa-hand-holding-seedling:after {
+  content: "\f4bf\f4bf";
+}
+
+.fa-duotone.fa-comment-alt-check:after, .fa-duotone.fa-message-check:after, .fad.fa-comment-alt-check:after, .fad.fa-message-check:after {
+  content: "\f4a2\f4a2";
+}
+
+.fa-duotone.fa-cloud-bolt:after, .fa-duotone.fa-thunderstorm:after, .fad.fa-cloud-bolt:after, .fad.fa-thunderstorm:after {
+  content: "\f76c\f76c";
+}
+
+.fa-duotone.fa-chart-line-up-down:after, .fad.fa-chart-line-up-down:after {
+  content: "\e5d7\e5d7";
+}
+
+.fa-duotone.fa-remove-format:after, .fa-duotone.fa-text-slash:after, .fad.fa-remove-format:after, .fad.fa-text-slash:after {
+  content: "\f87d\f87d";
+}
+
+.fa-duotone.fa-watch:after, .fad.fa-watch:after {
+  content: "\f2e1\f2e1";
+}
+
+.fa-duotone.fa-circle-down-left:after, .fad.fa-circle-down-left:after {
+  content: "\e107\e107";
+}
+
+.fa-duotone.fa-text:after, .fad.fa-text:after {
+  content: "\f893\f893";
+}
+
+.fa-duotone.fa-projector:after, .fad.fa-projector:after {
+  content: "\f8d6\f8d6";
+}
+
+.fa-duotone.fa-face-smile-wink:after, .fa-duotone.fa-smile-wink:after, .fad.fa-face-smile-wink:after, .fad.fa-smile-wink:after {
+  content: "\f4da\f4da";
+}
+
+.fa-duotone.fa-tombstone-alt:after, .fa-duotone.fa-tombstone-blank:after, .fad.fa-tombstone-alt:after, .fad.fa-tombstone-blank:after {
+  content: "\f721\f721";
+}
+
+.fa-duotone.fa-chess-king-alt:after, .fa-duotone.fa-chess-king-piece:after, .fad.fa-chess-king-alt:after, .fad.fa-chess-king-piece:after {
+  content: "\f440\f440";
+}
+
+.fa-duotone.fa-circle-6:after, .fad.fa-circle-6:after {
+  content: "\e0f3\e0f3";
+}
+
+.fa-duotone.fa-waves-sine:after, .fad.fa-waves-sine:after {
+  content: "\e65d\e65d";
+}
+
+.fa-duotone.fa-arrow-alt-left:after, .fa-duotone.fa-left:after, .fad.fa-arrow-alt-left:after, .fad.fa-left:after {
+  content: "\f355\f355";
+}
+
+.fa-duotone.fa-file-word:after, .fad.fa-file-word:after {
+  content: "\f1c2\f1c2";
+}
+
+.fa-duotone.fa-file-powerpoint:after, .fad.fa-file-powerpoint:after {
+  content: "\f1c4\f1c4";
+}
+
+.fa-duotone.fa-arrow-alt-square-down:after, .fa-duotone.fa-square-down:after, .fad.fa-arrow-alt-square-down:after, .fad.fa-square-down:after {
+  content: "\f350\f350";
+}
+
+.fa-duotone.fa-objects-align-center-vertical:after, .fad.fa-objects-align-center-vertical:after {
+  content: "\e3bd\e3bd";
+}
+
+.fa-duotone.fa-arrows-h:after, .fa-duotone.fa-arrows-left-right:after, .fad.fa-arrows-h:after, .fad.fa-arrows-left-right:after {
+  content: "\f07e\f07e";
+}
+
+.fa-duotone.fa-house-lock:after, .fad.fa-house-lock:after {
+  content: "\e510\e510";
+}
+
+.fa-duotone.fa-cloud-arrow-down:after, .fa-duotone.fa-cloud-download-alt:after, .fa-duotone.fa-cloud-download:after, .fad.fa-cloud-arrow-down:after, .fad.fa-cloud-download-alt:after, .fad.fa-cloud-download:after {
+  content: "\f0ed\f0ed";
+}
+
+.fa-duotone.fa-wreath:after, .fad.fa-wreath:after {
+  content: "\f7e2\f7e2";
+}
+
+.fa-duotone.fa-children:after, .fad.fa-children:after {
+  content: "\e4e1\e4e1";
+}
+
+.fa-duotone.fa-meter-droplet:after, .fad.fa-meter-droplet:after {
+  content: "\e1ea\e1ea";
+}
+
+.fa-duotone.fa-blackboard:after, .fa-duotone.fa-chalkboard:after, .fad.fa-blackboard:after, .fad.fa-chalkboard:after {
+  content: "\f51b\f51b";
+}
+
+.fa-duotone.fa-user-alt-slash:after, .fa-duotone.fa-user-large-slash:after, .fad.fa-user-alt-slash:after, .fad.fa-user-large-slash:after {
+  content: "\f4fa\f4fa";
+}
+
+.fa-duotone.fa-signal-4:after, .fa-duotone.fa-signal-strong:after, .fad.fa-signal-4:after, .fad.fa-signal-strong:after {
+  content: "\f68f\f68f";
+}
+
+.fa-duotone.fa-lollipop:after, .fa-duotone.fa-lollypop:after, .fad.fa-lollipop:after, .fad.fa-lollypop:after {
+  content: "\e424\e424";
+}
+
+.fa-duotone.fa-list-tree:after, .fad.fa-list-tree:after {
+  content: "\e1d2\e1d2";
+}
+
+.fa-duotone.fa-envelope-open:after, .fad.fa-envelope-open:after {
+  content: "\f2b6\f2b6";
+}
+
+.fa-duotone.fa-draw-circle:after, .fad.fa-draw-circle:after {
+  content: "\f5ed\f5ed";
+}
+
+.fa-duotone.fa-cat-space:after, .fad.fa-cat-space:after {
+  content: "\e001\e001";
+}
+
+.fa-duotone.fa-handshake-alt-slash:after, .fa-duotone.fa-handshake-simple-slash:after, .fad.fa-handshake-alt-slash:after, .fad.fa-handshake-simple-slash:after {
+  content: "\e05f\e05f";
+}
+
+.fa-duotone.fa-rabbit-fast:after, .fa-duotone.fa-rabbit-running:after, .fad.fa-rabbit-fast:after, .fad.fa-rabbit-running:after {
+  content: "\f709\f709";
+}
+
+.fa-duotone.fa-memo-pad:after, .fad.fa-memo-pad:after {
+  content: "\e1da\e1da";
+}
+
+.fa-duotone.fa-mattress-pillow:after, .fad.fa-mattress-pillow:after {
+  content: "\e525\e525";
+}
+
+.fa-duotone.fa-alarm-plus:after, .fad.fa-alarm-plus:after {
+  content: "\f844\f844";
+}
+
+.fa-duotone.fa-alicorn:after, .fad.fa-alicorn:after {
+  content: "\f6b0\f6b0";
+}
+
+.fa-duotone.fa-comment-question:after, .fad.fa-comment-question:after {
+  content: "\e14b\e14b";
+}
+
+.fa-duotone.fa-gingerbread-man:after, .fad.fa-gingerbread-man:after {
+  content: "\f79d\f79d";
+}
+
+.fa-duotone.fa-guarani-sign:after, .fad.fa-guarani-sign:after {
+  content: "\e19a\e19a";
+}
+
+.fa-duotone.fa-burger-fries:after, .fad.fa-burger-fries:after {
+  content: "\e0cd\e0cd";
+}
+
+.fa-duotone.fa-mug-tea:after, .fad.fa-mug-tea:after {
+  content: "\f875\f875";
+}
+
+.fa-duotone.fa-border-top:after, .fad.fa-border-top:after {
+  content: "\f855\f855";
+}
+
+.fa-duotone.fa-arrows-rotate:after, .fa-duotone.fa-refresh:after, .fa-duotone.fa-sync:after, .fad.fa-arrows-rotate:after, .fad.fa-refresh:after, .fad.fa-sync:after {
+  content: "\f021\f021";
+}
+
+.fa-duotone.fa-book-circle:after, .fa-duotone.fa-circle-book-open:after, .fad.fa-book-circle:after, .fad.fa-circle-book-open:after {
+  content: "\e0ff\e0ff";
+}
+
+.fa-duotone.fa-arrows-to-dotted-line:after, .fad.fa-arrows-to-dotted-line:after {
+  content: "\e0a6\e0a6";
+}
+
+.fa-duotone.fa-fire-extinguisher:after, .fad.fa-fire-extinguisher:after {
+  content: "\f134\f134";
+}
+
+.fa-duotone.fa-magnifying-glass-arrows-rotate:after, .fad.fa-magnifying-glass-arrows-rotate:after {
+  content: "\e65e\e65e";
+}
+
+.fa-duotone.fa-garage-open:after, .fad.fa-garage-open:after {
+  content: "\e00b\e00b";
+}
+
+.fa-duotone.fa-shelves-empty:after, .fad.fa-shelves-empty:after {
+  content: "\e246\e246";
+}
+
+.fa-duotone.fa-cruzeiro-sign:after, .fad.fa-cruzeiro-sign:after {
+  content: "\e152\e152";
+}
+
+.fa-duotone.fa-watch-apple:after, .fad.fa-watch-apple:after {
+  content: "\e2cb\e2cb";
+}
+
+.fa-duotone.fa-watch-calculator:after, .fad.fa-watch-calculator:after {
+  content: "\f8f0\f8f0";
+}
+
+.fa-duotone.fa-list-dropdown:after, .fad.fa-list-dropdown:after {
+  content: "\e1cf\e1cf";
+}
+
+.fa-duotone.fa-cabinet-filing:after, .fad.fa-cabinet-filing:after {
+  content: "\f64b\f64b";
+}
+
+.fa-duotone.fa-burger-soda:after, .fad.fa-burger-soda:after {
+  content: "\f858\f858";
+}
+
+.fa-duotone.fa-arrow-square-up:after, .fa-duotone.fa-square-arrow-up:after, .fad.fa-arrow-square-up:after, .fad.fa-square-arrow-up:after {
+  content: "\f33c\f33c";
+}
+
+.fa-duotone.fa-greater-than-equal:after, .fad.fa-greater-than-equal:after {
+  content: "\f532\f532";
+}
+
+.fa-duotone.fa-pallet-box:after, .fad.fa-pallet-box:after {
+  content: "\e208\e208";
+}
+
+.fa-duotone.fa-face-confounded:after, .fad.fa-face-confounded:after {
+  content: "\e36c\e36c";
+}
+
+.fa-duotone.fa-shield-alt:after, .fa-duotone.fa-shield-halved:after, .fad.fa-shield-alt:after, .fad.fa-shield-halved:after {
+  content: "\f3ed\f3ed";
+}
+
+.fa-duotone.fa-truck-plow:after, .fad.fa-truck-plow:after {
+  content: "\f7de\f7de";
+}
+
+.fa-duotone.fa-atlas:after, .fa-duotone.fa-book-atlas:after, .fad.fa-atlas:after, .fad.fa-book-atlas:after {
+  content: "\f558\f558";
+}
+
+.fa-duotone.fa-virus:after, .fad.fa-virus:after {
+  content: "\e074\e074";
+}
+
+.fa-duotone.fa-grid-round-2:after, .fad.fa-grid-round-2:after {
+  content: "\e5db\e5db";
+}
+
+.fa-duotone.fa-comment-middle-top:after, .fad.fa-comment-middle-top:after {
+  content: "\e14a\e14a";
+}
+
+.fa-duotone.fa-wave:after, .fad.fa-wave:after {
+  content: "\e65b\e65b";
+}
+
+.fa-duotone.fa-envelope-circle-check:after, .fad.fa-envelope-circle-check:after {
+  content: "\e4e8\e4e8";
+}
+
+.fa-duotone.fa-layer-group:after, .fad.fa-layer-group:after {
+  content: "\f5fd\f5fd";
+}
+
+.fa-duotone.fa-restroom-simple:after, .fad.fa-restroom-simple:after {
+  content: "\e23a\e23a";
+}
+
+.fa-duotone.fa-arrows-to-dot:after, .fad.fa-arrows-to-dot:after {
+  content: "\e4be\e4be";
+}
+
+.fa-duotone.fa-border-outer:after, .fad.fa-border-outer:after {
+  content: "\f851\f851";
+}
+
+.fa-duotone.fa-hashtag-lock:after, .fad.fa-hashtag-lock:after {
+  content: "\e415\e415";
+}
+
+.fa-duotone.fa-clock-two-thirty:after, .fad.fa-clock-two-thirty:after {
+  content: "\e35b\e35b";
+}
+
+.fa-duotone.fa-archway:after, .fad.fa-archway:after {
+  content: "\f557\f557";
+}
+
+.fa-duotone.fa-heart-circle-check:after, .fad.fa-heart-circle-check:after {
+  content: "\e4fd\e4fd";
+}
+
+.fa-duotone.fa-house-chimney-crack:after, .fa-duotone.fa-house-damage:after, .fad.fa-house-chimney-crack:after, .fad.fa-house-damage:after {
+  content: "\f6f1\f6f1";
+}
+
+.fa-duotone.fa-file-archive:after, .fa-duotone.fa-file-zipper:after, .fad.fa-file-archive:after, .fad.fa-file-zipper:after {
+  content: "\f1c6\f1c6";
+}
+
+.fa-duotone.fa-ticket-perforated:after, .fad.fa-ticket-perforated:after {
+  content: "\e63e\e63e";
+}
+
+.fa-duotone.fa-heart-half:after, .fad.fa-heart-half:after {
+  content: "\e1ab\e1ab";
+}
+
+.fa-duotone.fa-comment-check:after, .fad.fa-comment-check:after {
+  content: "\f4ac\f4ac";
+}
+
+.fa-duotone.fa-square:after, .fad.fa-square:after {
+  content: "\f0c8\f0c8";
+}
+
+.fa-duotone.fa-memo:after, .fad.fa-memo:after {
+  content: "\e1d8\e1d8";
+}
+
+.fa-duotone.fa-glass-martini:after, .fa-duotone.fa-martini-glass-empty:after, .fad.fa-glass-martini:after, .fad.fa-martini-glass-empty:after {
+  content: "\f000\f000";
+}
+
+.fa-duotone.fa-couch:after, .fad.fa-couch:after {
+  content: "\f4b8\f4b8";
+}
+
+.fa-duotone.fa-cedi-sign:after, .fad.fa-cedi-sign:after {
+  content: "\e0df\e0df";
+}
+
+.fa-duotone.fa-italic:after, .fad.fa-italic:after {
+  content: "\f033\f033";
+}
+
+.fa-duotone.fa-glass-citrus:after, .fad.fa-glass-citrus:after {
+  content: "\f869\f869";
+}
+
+.fa-duotone.fa-calendar-lines-pen:after, .fad.fa-calendar-lines-pen:after {
+  content: "\e472\e472";
+}
+
+.fa-duotone.fa-table-cells-column-lock:after, .fad.fa-table-cells-column-lock:after {
+  content: "\e678\e678";
+}
+
+.fa-duotone.fa-church:after, .fad.fa-church:after {
+  content: "\f51d\f51d";
+}
+
+.fa-duotone.fa-person-snowmobiling:after, .fa-duotone.fa-snowmobile:after, .fad.fa-person-snowmobiling:after, .fad.fa-snowmobile:after {
+  content: "\f7d1\f7d1";
+}
+
+.fa-duotone.fa-face-hushed:after, .fad.fa-face-hushed:after {
+  content: "\e37b\e37b";
+}
+
+.fa-duotone.fa-comments-dollar:after, .fad.fa-comments-dollar:after {
+  content: "\f653\f653";
+}
+
+.fa-duotone.fa-tickets-simple:after, .fad.fa-tickets-simple:after {
+  content: "\e659\e659";
+}
+
+.fa-duotone.fa-pickaxe:after, .fad.fa-pickaxe:after {
+  content: "\e5bf\e5bf";
+}
+
+.fa-duotone.fa-link-simple-slash:after, .fad.fa-link-simple-slash:after {
+  content: "\e1ce\e1ce";
+}
+
+.fa-duotone.fa-democrat:after, .fad.fa-democrat:after {
+  content: "\f747\f747";
+}
+
+.fa-duotone.fa-face-confused:after, .fad.fa-face-confused:after {
+  content: "\e36d\e36d";
+}
+
+.fa-duotone.fa-pinball:after, .fad.fa-pinball:after {
+  content: "\e229\e229";
+}
+
+.fa-duotone.fa-z:after, .fad.fa-z:after {
+  content: "\5a\5a";
+}
+
+.fa-duotone.fa-person-skiing:after, .fa-duotone.fa-skiing:after, .fad.fa-person-skiing:after, .fad.fa-skiing:after {
+  content: "\f7c9\f7c9";
+}
+
+.fa-duotone.fa-deer:after, .fad.fa-deer:after {
+  content: "\f78e\f78e";
+}
+
+.fa-duotone.fa-input-pipe:after, .fad.fa-input-pipe:after {
+  content: "\e1be\e1be";
+}
+
+.fa-duotone.fa-road-lock:after, .fad.fa-road-lock:after {
+  content: "\e567\e567";
+}
+
+.fa-duotone.fa-a:after, .fad.fa-a:after {
+  content: "\41\41";
+}
+
+.fa-duotone.fa-bookmark-slash:after, .fad.fa-bookmark-slash:after {
+  content: "\e0c2\e0c2";
+}
+
+.fa-duotone.fa-temperature-arrow-down:after, .fa-duotone.fa-temperature-down:after, .fad.fa-temperature-arrow-down:after, .fad.fa-temperature-down:after {
+  content: "\e03f\e03f";
+}
+
+.fa-duotone.fa-mace:after, .fad.fa-mace:after {
+  content: "\f6f8\f6f8";
+}
+
+.fa-duotone.fa-feather-alt:after, .fa-duotone.fa-feather-pointed:after, .fad.fa-feather-alt:after, .fad.fa-feather-pointed:after {
+  content: "\f56b\f56b";
+}
+
+.fa-duotone.fa-sausage:after, .fad.fa-sausage:after {
+  content: "\f820\f820";
+}
+
+.fa-duotone.fa-trash-can-clock:after, .fad.fa-trash-can-clock:after {
+  content: "\e2aa\e2aa";
+}
+
+.fa-duotone.fa-p:after, .fad.fa-p:after {
+  content: "\50\50";
+}
+
+.fa-duotone.fa-broom-wide:after, .fad.fa-broom-wide:after {
+  content: "\e5d1\e5d1";
+}
+
+.fa-duotone.fa-snowflake:after, .fad.fa-snowflake:after {
+  content: "\f2dc\f2dc";
+}
+
+.fa-duotone.fa-stomach:after, .fad.fa-stomach:after {
+  content: "\f623\f623";
+}
+
+.fa-duotone.fa-newspaper:after, .fad.fa-newspaper:after {
+  content: "\f1ea\f1ea";
+}
+
+.fa-duotone.fa-ad:after, .fa-duotone.fa-rectangle-ad:after, .fad.fa-ad:after, .fad.fa-rectangle-ad:after {
+  content: "\f641\f641";
+}
+
+.fa-duotone.fa-guitar-electric:after, .fad.fa-guitar-electric:after {
+  content: "\f8be\f8be";
+}
+
+.fa-duotone.fa-arrow-turn-down-right:after, .fad.fa-arrow-turn-down-right:after {
+  content: "\e3d6\e3d6";
+}
+
+.fa-duotone.fa-moon-cloud:after, .fad.fa-moon-cloud:after {
+  content: "\f754\f754";
+}
+
+.fa-duotone.fa-bread-slice-butter:after, .fad.fa-bread-slice-butter:after {
+  content: "\e3e1\e3e1";
+}
+
+.fa-duotone.fa-arrow-circle-right:after, .fa-duotone.fa-circle-arrow-right:after, .fad.fa-arrow-circle-right:after, .fad.fa-circle-arrow-right:after {
+  content: "\f0a9\f0a9";
+}
+
+.fa-duotone.fa-user-group-crown:after, .fa-duotone.fa-users-crown:after, .fad.fa-user-group-crown:after, .fad.fa-users-crown:after {
+  content: "\f6a5\f6a5";
+}
+
+.fa-duotone.fa-circle-i:after, .fad.fa-circle-i:after {
+  content: "\e111\e111";
+}
+
+.fa-duotone.fa-toilet-paper-check:after, .fad.fa-toilet-paper-check:after {
+  content: "\e5b2\e5b2";
+}
+
+.fa-duotone.fa-filter-circle-xmark:after, .fad.fa-filter-circle-xmark:after {
+  content: "\e17b\e17b";
+}
+
+.fa-duotone.fa-locust:after, .fad.fa-locust:after {
+  content: "\e520\e520";
+}
+
+.fa-duotone.fa-sort:after, .fa-duotone.fa-unsorted:after, .fad.fa-sort:after, .fad.fa-unsorted:after {
+  content: "\f0dc\f0dc";
+}
+
+.fa-duotone.fa-list-1-2:after, .fa-duotone.fa-list-numeric:after, .fa-duotone.fa-list-ol:after, .fad.fa-list-1-2:after, .fad.fa-list-numeric:after, .fad.fa-list-ol:after {
+  content: "\f0cb\f0cb";
+}
+
+.fa-duotone.fa-chart-waterfall:after, .fad.fa-chart-waterfall:after {
+  content: "\e0eb\e0eb";
+}
+
+.fa-duotone.fa-sparkle:after, .fad.fa-sparkle:after {
+  content: "\e5d6\e5d6";
+}
+
+.fa-duotone.fa-face-party:after, .fad.fa-face-party:after {
+  content: "\e383\e383";
+}
+
+.fa-duotone.fa-kidneys:after, .fad.fa-kidneys:after {
+  content: "\f5fb\f5fb";
+}
+
+.fa-duotone.fa-wifi-exclamation:after, .fad.fa-wifi-exclamation:after {
+  content: "\e2cf\e2cf";
+}
+
+.fa-duotone.fa-chart-network:after, .fad.fa-chart-network:after {
+  content: "\f78a\f78a";
+}
+
+.fa-duotone.fa-person-dress-burst:after, .fad.fa-person-dress-burst:after {
+  content: "\e544\e544";
+}
+
+.fa-duotone.fa-dice-d4:after, .fad.fa-dice-d4:after {
+  content: "\f6d0\f6d0";
+}
+
+.fa-duotone.fa-money-check-alt:after, .fa-duotone.fa-money-check-dollar:after, .fad.fa-money-check-alt:after, .fad.fa-money-check-dollar:after {
+  content: "\f53d\f53d";
+}
+
+.fa-duotone.fa-vector-square:after, .fad.fa-vector-square:after {
+  content: "\f5cb\f5cb";
+}
+
+.fa-duotone.fa-bread-slice:after, .fad.fa-bread-slice:after {
+  content: "\f7ec\f7ec";
+}
+
+.fa-duotone.fa-language:after, .fad.fa-language:after {
+  content: "\f1ab\f1ab";
+}
+
+.fa-duotone.fa-wheat-awn-slash:after, .fad.fa-wheat-awn-slash:after {
+  content: "\e338\e338";
+}
+
+.fa-duotone.fa-face-kiss-wink-heart:after, .fa-duotone.fa-kiss-wink-heart:after, .fad.fa-face-kiss-wink-heart:after, .fad.fa-kiss-wink-heart:after {
+  content: "\f598\f598";
+}
+
+.fa-duotone.fa-dagger:after, .fad.fa-dagger:after {
+  content: "\f6cb\f6cb";
+}
+
+.fa-duotone.fa-podium:after, .fad.fa-podium:after {
+  content: "\f680\f680";
+}
+
+.fa-duotone.fa-memo-circle-check:after, .fad.fa-memo-circle-check:after {
+  content: "\e1d9\e1d9";
+}
+
+.fa-duotone.fa-route-highway:after, .fad.fa-route-highway:after {
+  content: "\f61a\f61a";
+}
+
+.fa-duotone.fa-arrow-alt-to-bottom:after, .fa-duotone.fa-down-to-line:after, .fad.fa-arrow-alt-to-bottom:after, .fad.fa-down-to-line:after {
+  content: "\f34a\f34a";
+}
+
+.fa-duotone.fa-filter:after, .fad.fa-filter:after {
+  content: "\f0b0\f0b0";
+}
+
+.fa-duotone.fa-square-g:after, .fad.fa-square-g:after {
+  content: "\e271\e271";
+}
+
+.fa-duotone.fa-circle-phone:after, .fa-duotone.fa-phone-circle:after, .fad.fa-circle-phone:after, .fad.fa-phone-circle:after {
+  content: "\e11b\e11b";
+}
+
+.fa-duotone.fa-clipboard-prescription:after, .fad.fa-clipboard-prescription:after {
+  content: "\f5e8\f5e8";
+}
+
+.fa-duotone.fa-user-nurse-hair:after, .fad.fa-user-nurse-hair:after {
+  content: "\e45d\e45d";
+}
+
+.fa-duotone.fa-question:after, .fad.fa-question:after {
+  content: "\3f\3f";
+}
+
+.fa-duotone.fa-file-signature:after, .fad.fa-file-signature:after {
+  content: "\f573\f573";
+}
+
+.fa-duotone.fa-toggle-large-on:after, .fad.fa-toggle-large-on:after {
+  content: "\e5b1\e5b1";
+}
+
+.fa-duotone.fa-arrows-alt:after, .fa-duotone.fa-up-down-left-right:after, .fad.fa-arrows-alt:after, .fad.fa-up-down-left-right:after {
+  content: "\f0b2\f0b2";
+}
+
+.fa-duotone.fa-dryer-alt:after, .fa-duotone.fa-dryer-heat:after, .fad.fa-dryer-alt:after, .fad.fa-dryer-heat:after {
+  content: "\f862\f862";
+}
+
+.fa-duotone.fa-house-chimney-user:after, .fad.fa-house-chimney-user:after {
+  content: "\e065\e065";
+}
+
+.fa-duotone.fa-hand-holding-heart:after, .fad.fa-hand-holding-heart:after {
+  content: "\f4be\f4be";
+}
+
+.fa-duotone.fa-arrow-up-small-big:after, .fa-duotone.fa-sort-size-up-alt:after, .fad.fa-arrow-up-small-big:after, .fad.fa-sort-size-up-alt:after {
+  content: "\f88f\f88f";
+}
+
+.fa-duotone.fa-train-track:after, .fad.fa-train-track:after {
+  content: "\e453\e453";
+}
+
+.fa-duotone.fa-puzzle-piece:after, .fad.fa-puzzle-piece:after {
+  content: "\f12e\f12e";
+}
+
+.fa-duotone.fa-money-check:after, .fad.fa-money-check:after {
+  content: "\f53c\f53c";
+}
+
+.fa-duotone.fa-star-half-alt:after, .fa-duotone.fa-star-half-stroke:after, .fad.fa-star-half-alt:after, .fad.fa-star-half-stroke:after {
+  content: "\f5c0\f5c0";
+}
+
+.fa-duotone.fa-file-exclamation:after, .fad.fa-file-exclamation:after {
+  content: "\f31a\f31a";
+}
+
+.fa-duotone.fa-code:after, .fad.fa-code:after {
+  content: "\f121\f121";
+}
+
+.fa-duotone.fa-glass-whiskey:after, .fa-duotone.fa-whiskey-glass:after, .fad.fa-glass-whiskey:after, .fad.fa-whiskey-glass:after {
+  content: "\f7a0\f7a0";
+}
+
+.fa-duotone.fa-moon-stars:after, .fad.fa-moon-stars:after {
+  content: "\f755\f755";
+}
+
+.fa-duotone.fa-building-circle-exclamation:after, .fad.fa-building-circle-exclamation:after {
+  content: "\e4d3\e4d3";
+}
+
+.fa-duotone.fa-clothes-hanger:after, .fad.fa-clothes-hanger:after {
+  content: "\e136\e136";
+}
+
+.fa-duotone.fa-mobile-iphone:after, .fa-duotone.fa-mobile-notch:after, .fad.fa-mobile-iphone:after, .fad.fa-mobile-notch:after {
+  content: "\e1ee\e1ee";
+}
+
+.fa-duotone.fa-magnifying-glass-chart:after, .fad.fa-magnifying-glass-chart:after {
+  content: "\e522\e522";
+}
+
+.fa-duotone.fa-arrow-up-right-from-square:after, .fa-duotone.fa-external-link:after, .fad.fa-arrow-up-right-from-square:after, .fad.fa-external-link:after {
+  content: "\f08e\f08e";
+}
+
+.fa-duotone.fa-cubes-stacked:after, .fad.fa-cubes-stacked:after {
+  content: "\e4e6\e4e6";
+}
+
+.fa-duotone.fa-images-user:after, .fad.fa-images-user:after {
+  content: "\e1b9\e1b9";
+}
+
+.fa-duotone.fa-krw:after, .fa-duotone.fa-won-sign:after, .fa-duotone.fa-won:after, .fad.fa-krw:after, .fad.fa-won-sign:after, .fad.fa-won:after {
+  content: "\f159\f159";
+}
+
+.fa-duotone.fa-image-polaroid-user:after, .fad.fa-image-polaroid-user:after {
+  content: "\e1b6\e1b6";
+}
+
+.fa-duotone.fa-virus-covid:after, .fad.fa-virus-covid:after {
+  content: "\e4a8\e4a8";
+}
+
+.fa-duotone.fa-square-ellipsis:after, .fad.fa-square-ellipsis:after {
+  content: "\e26e\e26e";
+}
+
+.fa-duotone.fa-pie:after, .fad.fa-pie:after {
+  content: "\f705\f705";
+}
+
+.fa-duotone.fa-chess-knight-alt:after, .fa-duotone.fa-chess-knight-piece:after, .fad.fa-chess-knight-alt:after, .fad.fa-chess-knight-piece:after {
+  content: "\f442\f442";
+}
+
+.fa-duotone.fa-austral-sign:after, .fad.fa-austral-sign:after {
+  content: "\e0a9\e0a9";
+}
+
+.fa-duotone.fa-cloud-plus:after, .fad.fa-cloud-plus:after {
+  content: "\e35e\e35e";
+}
+
+.fa-duotone.fa-f:after, .fad.fa-f:after {
+  content: "\46\46";
+}
+
+.fa-duotone.fa-leaf:after, .fad.fa-leaf:after {
+  content: "\f06c\f06c";
+}
+
+.fa-duotone.fa-bed-bunk:after, .fad.fa-bed-bunk:after {
+  content: "\f8f8\f8f8";
+}
+
+.fa-duotone.fa-road:after, .fad.fa-road:after {
+  content: "\f018\f018";
+}
+
+.fa-duotone.fa-cab:after, .fa-duotone.fa-taxi:after, .fad.fa-cab:after, .fad.fa-taxi:after {
+  content: "\f1ba\f1ba";
+}
+
+.fa-duotone.fa-person-circle-plus:after, .fad.fa-person-circle-plus:after {
+  content: "\e541\e541";
+}
+
+.fa-duotone.fa-chart-pie:after, .fa-duotone.fa-pie-chart:after, .fad.fa-chart-pie:after, .fad.fa-pie-chart:after {
+  content: "\f200\f200";
+}
+
+.fa-duotone.fa-bolt-lightning:after, .fad.fa-bolt-lightning:after {
+  content: "\e0b7\e0b7";
+}
+
+.fa-duotone.fa-clock-eight:after, .fad.fa-clock-eight:after {
+  content: "\e345\e345";
+}
+
+.fa-duotone.fa-sack-xmark:after, .fad.fa-sack-xmark:after {
+  content: "\e56a\e56a";
+}
+
+.fa-duotone.fa-file-xls:after, .fad.fa-file-xls:after {
+  content: "\e64d\e64d";
+}
+
+.fa-duotone.fa-file-excel:after, .fad.fa-file-excel:after {
+  content: "\f1c3\f1c3";
+}
+
+.fa-duotone.fa-file-contract:after, .fad.fa-file-contract:after {
+  content: "\f56c\f56c";
+}
+
+.fa-duotone.fa-fish-fins:after, .fad.fa-fish-fins:after {
+  content: "\e4f2\e4f2";
+}
+
+.fa-duotone.fa-circle-q:after, .fad.fa-circle-q:after {
+  content: "\e11e\e11e";
+}
+
+.fa-duotone.fa-building-flag:after, .fad.fa-building-flag:after {
+  content: "\e4d5\e4d5";
+}
+
+.fa-duotone.fa-face-grin-beam:after, .fa-duotone.fa-grin-beam:after, .fad.fa-face-grin-beam:after, .fad.fa-grin-beam:after {
+  content: "\f582\f582";
+}
+
+.fa-duotone.fa-object-ungroup:after, .fad.fa-object-ungroup:after {
+  content: "\f248\f248";
+}
+
+.fa-duotone.fa-face-disguise:after, .fad.fa-face-disguise:after {
+  content: "\e370\e370";
+}
+
+.fa-duotone.fa-circle-arrow-down-right:after, .fad.fa-circle-arrow-down-right:after {
+  content: "\e0fa\e0fa";
+}
+
+.fa-duotone.fa-alien-8bit:after, .fa-duotone.fa-alien-monster:after, .fad.fa-alien-8bit:after, .fad.fa-alien-monster:after {
+  content: "\f8f6\f8f6";
+}
+
+.fa-duotone.fa-hand-point-ribbon:after, .fad.fa-hand-point-ribbon:after {
+  content: "\e1a6\e1a6";
+}
+
+.fa-duotone.fa-poop:after, .fad.fa-poop:after {
+  content: "\f619\f619";
+}
+
+.fa-duotone.fa-object-exclude:after, .fad.fa-object-exclude:after {
+  content: "\e49c\e49c";
+}
+
+.fa-duotone.fa-telescope:after, .fad.fa-telescope:after {
+  content: "\e03e\e03e";
+}
+
+.fa-duotone.fa-location-pin:after, .fa-duotone.fa-map-marker:after, .fad.fa-location-pin:after, .fad.fa-map-marker:after {
+  content: "\f041\f041";
+}
+
+.fa-duotone.fa-square-list:after, .fad.fa-square-list:after {
+  content: "\e489\e489";
+}
+
+.fa-duotone.fa-kaaba:after, .fad.fa-kaaba:after {
+  content: "\f66b\f66b";
+}
+
+.fa-duotone.fa-toilet-paper:after, .fad.fa-toilet-paper:after {
+  content: "\f71e\f71e";
+}
+
+.fa-duotone.fa-hard-hat:after, .fa-duotone.fa-hat-hard:after, .fa-duotone.fa-helmet-safety:after, .fad.fa-hard-hat:after, .fad.fa-hat-hard:after, .fad.fa-helmet-safety:after {
+  content: "\f807\f807";
+}
+
+.fa-duotone.fa-comment-code:after, .fad.fa-comment-code:after {
+  content: "\e147\e147";
+}
+
+.fa-duotone.fa-sim-cards:after, .fad.fa-sim-cards:after {
+  content: "\e251\e251";
+}
+
+.fa-duotone.fa-starship:after, .fad.fa-starship:after {
+  content: "\e039\e039";
+}
+
+.fa-duotone.fa-eject:after, .fad.fa-eject:after {
+  content: "\f052\f052";
+}
+
+.fa-duotone.fa-arrow-alt-circle-right:after, .fa-duotone.fa-circle-right:after, .fad.fa-arrow-alt-circle-right:after, .fad.fa-circle-right:after {
+  content: "\f35a\f35a";
+}
+
+.fa-duotone.fa-plane-circle-check:after, .fad.fa-plane-circle-check:after {
+  content: "\e555\e555";
+}
+
+.fa-duotone.fa-seal:after, .fad.fa-seal:after {
+  content: "\e241\e241";
+}
+
+.fa-duotone.fa-user-cowboy:after, .fad.fa-user-cowboy:after {
+  content: "\f8ea\f8ea";
+}
+
+.fa-duotone.fa-hexagon-vertical-nft:after, .fad.fa-hexagon-vertical-nft:after {
+  content: "\e505\e505";
+}
+
+.fa-duotone.fa-face-rolling-eyes:after, .fa-duotone.fa-meh-rolling-eyes:after, .fad.fa-face-rolling-eyes:after, .fad.fa-meh-rolling-eyes:after {
+  content: "\f5a5\f5a5";
+}
+
+.fa-duotone.fa-bread-loaf:after, .fad.fa-bread-loaf:after {
+  content: "\f7eb\f7eb";
+}
+
+.fa-duotone.fa-rings-wedding:after, .fad.fa-rings-wedding:after {
+  content: "\f81b\f81b";
+}
+
+.fa-duotone.fa-object-group:after, .fad.fa-object-group:after {
+  content: "\f247\f247";
+}
+
+.fa-duotone.fa-french-fries:after, .fad.fa-french-fries:after {
+  content: "\f803\f803";
+}
+
+.fa-duotone.fa-chart-line:after, .fa-duotone.fa-line-chart:after, .fad.fa-chart-line:after, .fad.fa-line-chart:after {
+  content: "\f201\f201";
+}
+
+.fa-duotone.fa-calendar-arrow-down:after, .fa-duotone.fa-calendar-download:after, .fad.fa-calendar-arrow-down:after, .fad.fa-calendar-download:after {
+  content: "\e0d0\e0d0";
+}
+
+.fa-duotone.fa-send-back:after, .fad.fa-send-back:after {
+  content: "\f87e\f87e";
+}
+
+.fa-duotone.fa-mask-ventilator:after, .fad.fa-mask-ventilator:after {
+  content: "\e524\e524";
+}
+
+.fa-duotone.fa-tickets:after, .fad.fa-tickets:after {
+  content: "\e658\e658";
+}
+
+.fa-duotone.fa-signature-lock:after, .fad.fa-signature-lock:after {
+  content: "\e3ca\e3ca";
+}
+
+.fa-duotone.fa-arrow-right:after, .fad.fa-arrow-right:after {
+  content: "\f061\f061";
+}
+
+.fa-duotone.fa-map-signs:after, .fa-duotone.fa-signs-post:after, .fad.fa-map-signs:after, .fad.fa-signs-post:after {
+  content: "\f277\f277";
+}
+
+.fa-duotone.fa-octagon-plus:after, .fa-duotone.fa-plus-octagon:after, .fad.fa-octagon-plus:after, .fad.fa-plus-octagon:after {
+  content: "\f301\f301";
+}
+
+.fa-duotone.fa-cash-register:after, .fad.fa-cash-register:after {
+  content: "\f788\f788";
+}
+
+.fa-duotone.fa-person-circle-question:after, .fad.fa-person-circle-question:after {
+  content: "\e542\e542";
+}
+
+.fa-duotone.fa-melon-slice:after, .fad.fa-melon-slice:after {
+  content: "\e311\e311";
+}
+
+.fa-duotone.fa-space-station-moon:after, .fad.fa-space-station-moon:after {
+  content: "\e033\e033";
+}
+
+.fa-duotone.fa-comment-alt-smile:after, .fa-duotone.fa-message-smile:after, .fad.fa-comment-alt-smile:after, .fad.fa-message-smile:after {
+  content: "\f4aa\f4aa";
+}
+
+.fa-duotone.fa-cup-straw:after, .fad.fa-cup-straw:after {
+  content: "\e363\e363";
+}
+
+.fa-duotone.fa-arrow-alt-from-right:after, .fa-duotone.fa-left-from-line:after, .fad.fa-arrow-alt-from-right:after, .fad.fa-left-from-line:after {
+  content: "\f348\f348";
+}
+
+.fa-duotone.fa-h:after, .fad.fa-h:after {
+  content: "\48\48";
+}
+
+.fa-duotone.fa-basket-shopping-simple:after, .fa-duotone.fa-shopping-basket-alt:after, .fad.fa-basket-shopping-simple:after, .fad.fa-shopping-basket-alt:after {
+  content: "\e0af\e0af";
+}
+
+.fa-duotone.fa-hands-heart:after, .fa-duotone.fa-hands-holding-heart:after, .fad.fa-hands-heart:after, .fad.fa-hands-holding-heart:after {
+  content: "\f4c3\f4c3";
+}
+
+.fa-duotone.fa-clock-nine:after, .fad.fa-clock-nine:after {
+  content: "\e34c\e34c";
+}
+
+.fa-duotone.fa-hammer-brush:after, .fad.fa-hammer-brush:after {
+  content: "\e620\e620";
+}
+
+.fa-duotone.fa-tarp:after, .fad.fa-tarp:after {
+  content: "\e57b\e57b";
+}
+
+.fa-duotone.fa-face-sleepy:after, .fad.fa-face-sleepy:after {
+  content: "\e38e\e38e";
+}
+
+.fa-duotone.fa-hand-horns:after, .fad.fa-hand-horns:after {
+  content: "\e1a9\e1a9";
+}
+
+.fa-duotone.fa-screwdriver-wrench:after, .fa-duotone.fa-tools:after, .fad.fa-screwdriver-wrench:after, .fad.fa-tools:after {
+  content: "\f7d9\f7d9";
+}
+
+.fa-duotone.fa-arrows-to-eye:after, .fad.fa-arrows-to-eye:after {
+  content: "\e4bf\e4bf";
+}
+
+.fa-duotone.fa-circle-three-quarters:after, .fad.fa-circle-three-quarters:after {
+  content: "\e125\e125";
+}
+
+.fa-duotone.fa-trophy-alt:after, .fa-duotone.fa-trophy-star:after, .fad.fa-trophy-alt:after, .fad.fa-trophy-star:after {
+  content: "\f2eb\f2eb";
+}
+
+.fa-duotone.fa-plug-circle-bolt:after, .fad.fa-plug-circle-bolt:after {
+  content: "\e55b\e55b";
+}
+
+.fa-duotone.fa-face-thermometer:after, .fad.fa-face-thermometer:after {
+  content: "\e39a\e39a";
+}
+
+.fa-duotone.fa-grid-round-4:after, .fad.fa-grid-round-4:after {
+  content: "\e5dd\e5dd";
+}
+
+.fa-duotone.fa-sign-posts-wrench:after, .fad.fa-sign-posts-wrench:after {
+  content: "\e626\e626";
+}
+
+.fa-duotone.fa-shirt-running:after, .fad.fa-shirt-running:after {
+  content: "\e3c8\e3c8";
+}
+
+.fa-duotone.fa-book-circle-arrow-up:after, .fad.fa-book-circle-arrow-up:after {
+  content: "\e0bd\e0bd";
+}
+
+.fa-duotone.fa-face-nauseated:after, .fad.fa-face-nauseated:after {
+  content: "\e381\e381";
+}
+
+.fa-duotone.fa-heart:after, .fad.fa-heart:after {
+  content: "\f004\f004";
+}
+
+.fa-duotone.fa-file-chart-pie:after, .fad.fa-file-chart-pie:after {
+  content: "\f65a\f65a";
+}
+
+.fa-duotone.fa-mars-and-venus:after, .fad.fa-mars-and-venus:after {
+  content: "\f224\f224";
+}
+
+.fa-duotone.fa-home-user:after, .fa-duotone.fa-house-user:after, .fad.fa-home-user:after, .fad.fa-house-user:after {
+  content: "\e1b0\e1b0";
+}
+
+.fa-duotone.fa-circle-arrow-down-left:after, .fad.fa-circle-arrow-down-left:after {
+  content: "\e0f9\e0f9";
+}
+
+.fa-duotone.fa-dumpster-fire:after, .fad.fa-dumpster-fire:after {
+  content: "\f794\f794";
+}
+
+.fa-duotone.fa-hexagon-minus:after, .fa-duotone.fa-minus-hexagon:after, .fad.fa-hexagon-minus:after, .fad.fa-minus-hexagon:after {
+  content: "\f307\f307";
+}
+
+.fa-duotone.fa-arrow-alt-to-left:after, .fa-duotone.fa-left-to-line:after, .fad.fa-arrow-alt-to-left:after, .fad.fa-left-to-line:after {
+  content: "\f34b\f34b";
+}
+
+.fa-duotone.fa-house-crack:after, .fad.fa-house-crack:after {
+  content: "\e3b1\e3b1";
+}
+
+.fa-duotone.fa-paw-alt:after, .fa-duotone.fa-paw-simple:after, .fad.fa-paw-alt:after, .fad.fa-paw-simple:after {
+  content: "\f701\f701";
+}
+
+.fa-duotone.fa-arrow-left-long-to-line:after, .fad.fa-arrow-left-long-to-line:after {
+  content: "\e3d4\e3d4";
+}
+
+.fa-duotone.fa-brackets-round:after, .fa-duotone.fa-parentheses:after, .fad.fa-brackets-round:after, .fad.fa-parentheses:after {
+  content: "\e0c5\e0c5";
+}
+
+.fa-duotone.fa-cocktail:after, .fa-duotone.fa-martini-glass-citrus:after, .fad.fa-cocktail:after, .fad.fa-martini-glass-citrus:after {
+  content: "\f561\f561";
+}
+
+.fa-duotone.fa-user-shakespeare:after, .fad.fa-user-shakespeare:after {
+  content: "\e2c2\e2c2";
+}
+
+.fa-duotone.fa-arrow-right-to-arc:after, .fad.fa-arrow-right-to-arc:after {
+  content: "\e4b2\e4b2";
+}
+
+.fa-duotone.fa-face-surprise:after, .fa-duotone.fa-surprise:after, .fad.fa-face-surprise:after, .fad.fa-surprise:after {
+  content: "\f5c2\f5c2";
+}
+
+.fa-duotone.fa-bottle-water:after, .fad.fa-bottle-water:after {
+  content: "\e4c5\e4c5";
+}
+
+.fa-duotone.fa-circle-pause:after, .fa-duotone.fa-pause-circle:after, .fad.fa-circle-pause:after, .fad.fa-pause-circle:after {
+  content: "\f28b\f28b";
+}
+
+.fa-duotone.fa-gauge-circle-plus:after, .fad.fa-gauge-circle-plus:after {
+  content: "\e498\e498";
+}
+
+.fa-duotone.fa-folders:after, .fad.fa-folders:after {
+  content: "\f660\f660";
+}
+
+.fa-duotone.fa-angel:after, .fad.fa-angel:after {
+  content: "\f779\f779";
+}
+
+.fa-duotone.fa-value-absolute:after, .fad.fa-value-absolute:after {
+  content: "\f6a6\f6a6";
+}
+
+.fa-duotone.fa-rabbit:after, .fad.fa-rabbit:after {
+  content: "\f708\f708";
+}
+
+.fa-duotone.fa-toilet-paper-slash:after, .fad.fa-toilet-paper-slash:after {
+  content: "\e072\e072";
+}
+
+.fa-duotone.fa-circle-euro:after, .fad.fa-circle-euro:after {
+  content: "\e5ce\e5ce";
+}
+
+.fa-duotone.fa-apple-alt:after, .fa-duotone.fa-apple-whole:after, .fad.fa-apple-alt:after, .fad.fa-apple-whole:after {
+  content: "\f5d1\f5d1";
+}
+
+.fa-duotone.fa-kitchen-set:after, .fad.fa-kitchen-set:after {
+  content: "\e51a\e51a";
+}
+
+.fa-duotone.fa-diamond-half:after, .fad.fa-diamond-half:after {
+  content: "\e5b7\e5b7";
+}
+
+.fa-duotone.fa-lock-alt:after, .fa-duotone.fa-lock-keyhole:after, .fad.fa-lock-alt:after, .fad.fa-lock-keyhole:after {
+  content: "\f30d\f30d";
+}
+
+.fa-duotone.fa-r:after, .fad.fa-r:after {
+  content: "\52\52";
+}
+
+.fa-duotone.fa-temperature-1:after, .fa-duotone.fa-temperature-quarter:after, .fa-duotone.fa-thermometer-1:after, .fa-duotone.fa-thermometer-quarter:after, .fad.fa-temperature-1:after, .fad.fa-temperature-quarter:after, .fad.fa-thermometer-1:after, .fad.fa-thermometer-quarter:after {
+  content: "\f2ca\f2ca";
+}
+
+.fa-duotone.fa-info-square:after, .fa-duotone.fa-square-info:after, .fad.fa-info-square:after, .fad.fa-square-info:after {
+  content: "\f30f\f30f";
+}
+
+.fa-duotone.fa-wifi-slash:after, .fad.fa-wifi-slash:after {
+  content: "\f6ac\f6ac";
+}
+
+.fa-duotone.fa-toilet-paper-xmark:after, .fad.fa-toilet-paper-xmark:after {
+  content: "\e5b3\e5b3";
+}
+
+.fa-duotone.fa-hands-holding-dollar:after, .fa-duotone.fa-hands-usd:after, .fad.fa-hands-holding-dollar:after, .fad.fa-hands-usd:after {
+  content: "\f4c5\f4c5";
+}
+
+.fa-duotone.fa-cube:after, .fad.fa-cube:after {
+  content: "\f1b2\f1b2";
+}
+
+.fa-duotone.fa-arrow-down-triangle-square:after, .fa-duotone.fa-sort-shapes-down:after, .fad.fa-arrow-down-triangle-square:after, .fad.fa-sort-shapes-down:after {
+  content: "\f888\f888";
+}
+
+.fa-duotone.fa-bitcoin-sign:after, .fad.fa-bitcoin-sign:after {
+  content: "\e0b4\e0b4";
+}
+
+.fa-duotone.fa-shutters:after, .fad.fa-shutters:after {
+  content: "\e449\e449";
+}
+
+.fa-duotone.fa-shield-dog:after, .fad.fa-shield-dog:after {
+  content: "\e573\e573";
+}
+
+.fa-duotone.fa-solar-panel:after, .fad.fa-solar-panel:after {
+  content: "\f5ba\f5ba";
+}
+
+.fa-duotone.fa-lock-open:after, .fad.fa-lock-open:after {
+  content: "\f3c1\f3c1";
+}
+
+.fa-duotone.fa-table-tree:after, .fad.fa-table-tree:after {
+  content: "\e293\e293";
+}
+
+.fa-duotone.fa-house-chimney-heart:after, .fad.fa-house-chimney-heart:after {
+  content: "\e1b2\e1b2";
+}
+
+.fa-duotone.fa-tally-3:after, .fad.fa-tally-3:after {
+  content: "\e296\e296";
+}
+
+.fa-duotone.fa-elevator:after, .fad.fa-elevator:after {
+  content: "\e16d\e16d";
+}
+
+.fa-duotone.fa-money-bill-transfer:after, .fad.fa-money-bill-transfer:after {
+  content: "\e528\e528";
+}
+
+.fa-duotone.fa-money-bill-trend-up:after, .fad.fa-money-bill-trend-up:after {
+  content: "\e529\e529";
+}
+
+.fa-duotone.fa-house-flood-water-circle-arrow-right:after, .fad.fa-house-flood-water-circle-arrow-right:after {
+  content: "\e50f\e50f";
+}
+
+.fa-duotone.fa-poll-h:after, .fa-duotone.fa-square-poll-horizontal:after, .fad.fa-poll-h:after, .fad.fa-square-poll-horizontal:after {
+  content: "\f682\f682";
+}
+
+.fa-duotone.fa-circle:after, .fad.fa-circle:after {
+  content: "\f111\f111";
+}
+
+.fa-duotone.fa-left-to-bracket:after, .fad.fa-left-to-bracket:after {
+  content: "\e66d\e66d";
+}
+
+.fa-duotone.fa-cart-circle-exclamation:after, .fad.fa-cart-circle-exclamation:after {
+  content: "\e3f2\e3f2";
+}
+
+.fa-duotone.fa-sword:after, .fad.fa-sword:after {
+  content: "\f71c\f71c";
+}
+
+.fa-duotone.fa-backward-fast:after, .fa-duotone.fa-fast-backward:after, .fad.fa-backward-fast:after, .fad.fa-fast-backward:after {
+  content: "\f049\f049";
+}
+
+.fa-duotone.fa-recycle:after, .fad.fa-recycle:after {
+  content: "\f1b8\f1b8";
+}
+
+.fa-duotone.fa-user-astronaut:after, .fad.fa-user-astronaut:after {
+  content: "\f4fb\f4fb";
+}
+
+.fa-duotone.fa-interrobang:after, .fad.fa-interrobang:after {
+  content: "\e5ba\e5ba";
+}
+
+.fa-duotone.fa-plane-slash:after, .fad.fa-plane-slash:after {
+  content: "\e069\e069";
+}
+
+.fa-duotone.fa-circle-dashed:after, .fad.fa-circle-dashed:after {
+  content: "\e105\e105";
+}
+
+.fa-duotone.fa-trademark:after, .fad.fa-trademark:after {
+  content: "\f25c\f25c";
+}
+
+.fa-duotone.fa-basketball-ball:after, .fa-duotone.fa-basketball:after, .fad.fa-basketball-ball:after, .fad.fa-basketball:after {
+  content: "\f434\f434";
+}
+
+.fa-duotone.fa-fork-knife:after, .fa-duotone.fa-utensils-alt:after, .fad.fa-fork-knife:after, .fad.fa-utensils-alt:after {
+  content: "\f2e6\f2e6";
+}
+
+.fa-duotone.fa-satellite-dish:after, .fad.fa-satellite-dish:after {
+  content: "\f7c0\f7c0";
+}
+
+.fa-duotone.fa-badge-check:after, .fad.fa-badge-check:after {
+  content: "\f336\f336";
+}
+
+.fa-duotone.fa-arrow-alt-circle-up:after, .fa-duotone.fa-circle-up:after, .fad.fa-arrow-alt-circle-up:after, .fad.fa-circle-up:after {
+  content: "\f35b\f35b";
+}
+
+.fa-duotone.fa-slider:after, .fad.fa-slider:after {
+  content: "\e252\e252";
+}
+
+.fa-duotone.fa-mobile-alt:after, .fa-duotone.fa-mobile-screen-button:after, .fad.fa-mobile-alt:after, .fad.fa-mobile-screen-button:after {
+  content: "\f3cd\f3cd";
+}
+
+.fa-duotone.fa-clock-one-thirty:after, .fad.fa-clock-one-thirty:after {
+  content: "\e34f\e34f";
+}
+
+.fa-duotone.fa-inbox-arrow-up:after, .fa-duotone.fa-inbox-out:after, .fad.fa-inbox-arrow-up:after, .fad.fa-inbox-out:after {
+  content: "\f311\f311";
+}
+
+.fa-duotone.fa-cloud-slash:after, .fad.fa-cloud-slash:after {
+  content: "\e137\e137";
+}
+
+.fa-duotone.fa-volume-high:after, .fa-duotone.fa-volume-up:after, .fad.fa-volume-high:after, .fad.fa-volume-up:after {
+  content: "\f028\f028";
+}
+
+.fa-duotone.fa-users-rays:after, .fad.fa-users-rays:after {
+  content: "\e593\e593";
+}
+
+.fa-duotone.fa-wallet:after, .fad.fa-wallet:after {
+  content: "\f555\f555";
+}
+
+.fa-duotone.fa-octagon-check:after, .fad.fa-octagon-check:after {
+  content: "\e426\e426";
+}
+
+.fa-duotone.fa-flatbread-stuffed:after, .fad.fa-flatbread-stuffed:after {
+  content: "\e40c\e40c";
+}
+
+.fa-duotone.fa-clipboard-check:after, .fad.fa-clipboard-check:after {
+  content: "\f46c\f46c";
+}
+
+.fa-duotone.fa-cart-circle-plus:after, .fad.fa-cart-circle-plus:after {
+  content: "\e3f3\e3f3";
+}
+
+.fa-duotone.fa-shipping-timed:after, .fa-duotone.fa-truck-clock:after, .fad.fa-shipping-timed:after, .fad.fa-truck-clock:after {
+  content: "\f48c\f48c";
+}
+
+.fa-duotone.fa-pool-8-ball:after, .fad.fa-pool-8-ball:after {
+  content: "\e3c5\e3c5";
+}
+
+.fa-duotone.fa-file-audio:after, .fad.fa-file-audio:after {
+  content: "\f1c7\f1c7";
+}
+
+.fa-duotone.fa-turn-down-left:after, .fad.fa-turn-down-left:after {
+  content: "\e331\e331";
+}
+
+.fa-duotone.fa-lock-hashtag:after, .fad.fa-lock-hashtag:after {
+  content: "\e423\e423";
+}
+
+.fa-duotone.fa-chart-radar:after, .fad.fa-chart-radar:after {
+  content: "\e0e7\e0e7";
+}
+
+.fa-duotone.fa-staff:after, .fad.fa-staff:after {
+  content: "\f71b\f71b";
+}
+
+.fa-duotone.fa-burger:after, .fa-duotone.fa-hamburger:after, .fad.fa-burger:after, .fad.fa-hamburger:after {
+  content: "\f805\f805";
+}
+
+.fa-duotone.fa-utility-pole:after, .fad.fa-utility-pole:after {
+  content: "\e2c3\e2c3";
+}
+
+.fa-duotone.fa-transporter-6:after, .fad.fa-transporter-6:after {
+  content: "\e2a7\e2a7";
+}
+
+.fa-duotone.fa-arrow-turn-left:after, .fad.fa-arrow-turn-left:after {
+  content: "\e632\e632";
+}
+
+.fa-duotone.fa-wrench:after, .fad.fa-wrench:after {
+  content: "\f0ad\f0ad";
+}
+
+.fa-duotone.fa-bugs:after, .fad.fa-bugs:after {
+  content: "\e4d0\e4d0";
+}
+
+.fa-duotone.fa-vector-polygon:after, .fad.fa-vector-polygon:after {
+  content: "\e2c7\e2c7";
+}
+
+.fa-duotone.fa-diagram-nested:after, .fad.fa-diagram-nested:after {
+  content: "\e157\e157";
+}
+
+.fa-duotone.fa-rupee-sign:after, .fa-duotone.fa-rupee:after, .fad.fa-rupee-sign:after, .fad.fa-rupee:after {
+  content: "\f156\f156";
+}
+
+.fa-duotone.fa-file-image:after, .fad.fa-file-image:after {
+  content: "\f1c5\f1c5";
+}
+
+.fa-duotone.fa-circle-question:after, .fa-duotone.fa-question-circle:after, .fad.fa-circle-question:after, .fad.fa-question-circle:after {
+  content: "\f059\f059";
+}
+
+.fa-duotone.fa-tickets-perforated:after, .fad.fa-tickets-perforated:after {
+  content: "\e63f\e63f";
+}
+
+.fa-duotone.fa-image-user:after, .fad.fa-image-user:after {
+  content: "\e1b8\e1b8";
+}
+
+.fa-duotone.fa-buoy:after, .fad.fa-buoy:after {
+  content: "\e5b5\e5b5";
+}
+
+.fa-duotone.fa-plane-departure:after, .fad.fa-plane-departure:after {
+  content: "\f5b0\f5b0";
+}
+
+.fa-duotone.fa-handshake-slash:after, .fad.fa-handshake-slash:after {
+  content: "\e060\e060";
+}
+
+.fa-duotone.fa-book-bookmark:after, .fad.fa-book-bookmark:after {
+  content: "\e0bb\e0bb";
+}
+
+.fa-duotone.fa-border-center-h:after, .fad.fa-border-center-h:after {
+  content: "\f89c\f89c";
+}
+
+.fa-duotone.fa-can-food:after, .fad.fa-can-food:after {
+  content: "\e3e6\e3e6";
+}
+
+.fa-duotone.fa-typewriter:after, .fad.fa-typewriter:after {
+  content: "\f8e7\f8e7";
+}
+
+.fa-duotone.fa-arrow-right-from-arc:after, .fad.fa-arrow-right-from-arc:after {
+  content: "\e4b1\e4b1";
+}
+
+.fa-duotone.fa-circle-k:after, .fad.fa-circle-k:after {
+  content: "\e113\e113";
+}
+
+.fa-duotone.fa-face-hand-over-mouth:after, .fad.fa-face-hand-over-mouth:after {
+  content: "\e378\e378";
+}
+
+.fa-duotone.fa-popcorn:after, .fad.fa-popcorn:after {
+  content: "\f819\f819";
+}
+
+.fa-duotone.fa-house-flood:after, .fa-duotone.fa-house-water:after, .fad.fa-house-flood:after, .fad.fa-house-water:after {
+  content: "\f74f\f74f";
+}
+
+.fa-duotone.fa-object-subtract:after, .fad.fa-object-subtract:after {
+  content: "\e49e\e49e";
+}
+
+.fa-duotone.fa-code-branch:after, .fad.fa-code-branch:after {
+  content: "\f126\f126";
+}
+
+.fa-duotone.fa-warehouse-alt:after, .fa-duotone.fa-warehouse-full:after, .fad.fa-warehouse-alt:after, .fad.fa-warehouse-full:after {
+  content: "\f495\f495";
+}
+
+.fa-duotone.fa-hat-cowboy:after, .fad.fa-hat-cowboy:after {
+  content: "\f8c0\f8c0";
+}
+
+.fa-duotone.fa-bridge:after, .fad.fa-bridge:after {
+  content: "\e4c8\e4c8";
+}
+
+.fa-duotone.fa-phone-alt:after, .fa-duotone.fa-phone-flip:after, .fad.fa-phone-alt:after, .fad.fa-phone-flip:after {
+  content: "\f879\f879";
+}
+
+.fa-duotone.fa-arrow-down-from-dotted-line:after, .fad.fa-arrow-down-from-dotted-line:after {
+  content: "\e090\e090";
+}
+
+.fa-duotone.fa-file-doc:after, .fad.fa-file-doc:after {
+  content: "\e5ed\e5ed";
+}
+
+.fa-duotone.fa-square-quarters:after, .fad.fa-square-quarters:after {
+  content: "\e44e\e44e";
+}
+
+.fa-duotone.fa-truck-front:after, .fad.fa-truck-front:after {
+  content: "\e2b7\e2b7";
+}
+
+.fa-duotone.fa-cat:after, .fad.fa-cat:after {
+  content: "\f6be\f6be";
+}
+
+.fa-duotone.fa-trash-xmark:after, .fad.fa-trash-xmark:after {
+  content: "\e2b4\e2b4";
+}
+
+.fa-duotone.fa-caret-circle-left:after, .fa-duotone.fa-circle-caret-left:after, .fad.fa-caret-circle-left:after, .fad.fa-circle-caret-left:after {
+  content: "\f32e\f32e";
+}
+
+.fa-duotone.fa-files:after, .fad.fa-files:after {
+  content: "\e178\e178";
+}
+
+.fa-duotone.fa-anchor-circle-exclamation:after, .fad.fa-anchor-circle-exclamation:after {
+  content: "\e4ab\e4ab";
+}
+
+.fa-duotone.fa-face-clouds:after, .fad.fa-face-clouds:after {
+  content: "\e47d\e47d";
+}
+
+.fa-duotone.fa-user-crown:after, .fad.fa-user-crown:after {
+  content: "\f6a4\f6a4";
+}
+
+.fa-duotone.fa-basket-shopping-plus:after, .fad.fa-basket-shopping-plus:after {
+  content: "\e653\e653";
+}
+
+.fa-duotone.fa-truck-field:after, .fad.fa-truck-field:after {
+  content: "\e58d\e58d";
+}
+
+.fa-duotone.fa-route:after, .fad.fa-route:after {
+  content: "\f4d7\f4d7";
+}
+
+.fa-duotone.fa-cart-circle-check:after, .fad.fa-cart-circle-check:after {
+  content: "\e3f1\e3f1";
+}
+
+.fa-duotone.fa-clipboard-question:after, .fad.fa-clipboard-question:after {
+  content: "\e4e3\e4e3";
+}
+
+.fa-duotone.fa-panorama:after, .fad.fa-panorama:after {
+  content: "\e209\e209";
+}
+
+.fa-duotone.fa-comment-medical:after, .fad.fa-comment-medical:after {
+  content: "\f7f5\f7f5";
+}
+
+.fa-duotone.fa-teeth-open:after, .fad.fa-teeth-open:after {
+  content: "\f62f\f62f";
+}
+
+.fa-duotone.fa-user-tie-hair-long:after, .fad.fa-user-tie-hair-long:after {
+  content: "\e460\e460";
+}
+
+.fa-duotone.fa-file-circle-minus:after, .fad.fa-file-circle-minus:after {
+  content: "\e4ed\e4ed";
+}
+
+.fa-duotone.fa-head-side-medical:after, .fad.fa-head-side-medical:after {
+  content: "\f809\f809";
+}
+
+.fa-duotone.fa-arrow-turn-right:after, .fad.fa-arrow-turn-right:after {
+  content: "\e635\e635";
+}
+
+.fa-duotone.fa-tags:after, .fad.fa-tags:after {
+  content: "\f02c\f02c";
+}
+
+.fa-duotone.fa-wine-glass:after, .fad.fa-wine-glass:after {
+  content: "\f4e3\f4e3";
+}
+
+.fa-duotone.fa-fast-forward:after, .fa-duotone.fa-forward-fast:after, .fad.fa-fast-forward:after, .fad.fa-forward-fast:after {
+  content: "\f050\f050";
+}
+
+.fa-duotone.fa-face-meh-blank:after, .fa-duotone.fa-meh-blank:after, .fad.fa-face-meh-blank:after, .fad.fa-meh-blank:after {
+  content: "\f5a4\f5a4";
+}
+
+.fa-duotone.fa-user-robot:after, .fad.fa-user-robot:after {
+  content: "\e04b\e04b";
+}
+
+.fa-duotone.fa-parking:after, .fa-duotone.fa-square-parking:after, .fad.fa-parking:after, .fad.fa-square-parking:after {
+  content: "\f540\f540";
+}
+
+.fa-duotone.fa-card-diamond:after, .fad.fa-card-diamond:after {
+  content: "\e3ea\e3ea";
+}
+
+.fa-duotone.fa-face-zipper:after, .fad.fa-face-zipper:after {
+  content: "\e3a5\e3a5";
+}
+
+.fa-duotone.fa-face-raised-eyebrow:after, .fad.fa-face-raised-eyebrow:after {
+  content: "\e388\e388";
+}
+
+.fa-duotone.fa-house-signal:after, .fad.fa-house-signal:after {
+  content: "\e012\e012";
+}
+
+.fa-duotone.fa-chevron-square-up:after, .fa-duotone.fa-square-chevron-up:after, .fad.fa-chevron-square-up:after, .fad.fa-square-chevron-up:after {
+  content: "\f32c\f32c";
+}
+
+.fa-duotone.fa-bars-progress:after, .fa-duotone.fa-tasks-alt:after, .fad.fa-bars-progress:after, .fad.fa-tasks-alt:after {
+  content: "\f828\f828";
+}
+
+.fa-duotone.fa-faucet-drip:after, .fad.fa-faucet-drip:after {
+  content: "\e006\e006";
+}
+
+.fa-duotone.fa-arrows-to-line:after, .fad.fa-arrows-to-line:after {
+  content: "\e0a7\e0a7";
+}
+
+.fa-duotone.fa-dolphin:after, .fad.fa-dolphin:after {
+  content: "\e168\e168";
+}
+
+.fa-duotone.fa-arrow-up-right:after, .fad.fa-arrow-up-right:after {
+  content: "\e09f\e09f";
+}
+
+.fa-duotone.fa-circle-r:after, .fad.fa-circle-r:after {
+  content: "\e120\e120";
+}
+
+.fa-duotone.fa-cart-flatbed:after, .fa-duotone.fa-dolly-flatbed:after, .fad.fa-cart-flatbed:after, .fad.fa-dolly-flatbed:after {
+  content: "\f474\f474";
+}
+
+.fa-duotone.fa-ban-smoking:after, .fa-duotone.fa-smoking-ban:after, .fad.fa-ban-smoking:after, .fad.fa-smoking-ban:after {
+  content: "\f54d\f54d";
+}
+
+.fa-duotone.fa-circle-sort-up:after, .fa-duotone.fa-sort-circle-up:after, .fad.fa-circle-sort-up:after, .fad.fa-sort-circle-up:after {
+  content: "\e032\e032";
+}
+
+.fa-duotone.fa-terminal:after, .fad.fa-terminal:after {
+  content: "\f120\f120";
+}
+
+.fa-duotone.fa-mobile-button:after, .fad.fa-mobile-button:after {
+  content: "\f10b\f10b";
+}
+
+.fa-duotone.fa-house-medical-flag:after, .fad.fa-house-medical-flag:after {
+  content: "\e514\e514";
+}
+
+.fa-duotone.fa-basket-shopping:after, .fa-duotone.fa-shopping-basket:after, .fad.fa-basket-shopping:after, .fad.fa-shopping-basket:after {
+  content: "\f291\f291";
+}
+
+.fa-duotone.fa-tape:after, .fad.fa-tape:after {
+  content: "\f4db\f4db";
+}
+
+.fa-duotone.fa-chestnut:after, .fad.fa-chestnut:after {
+  content: "\e3f6\e3f6";
+}
+
+.fa-duotone.fa-bus-alt:after, .fa-duotone.fa-bus-simple:after, .fad.fa-bus-alt:after, .fad.fa-bus-simple:after {
+  content: "\f55e\f55e";
+}
+
+.fa-duotone.fa-eye:after, .fad.fa-eye:after {
+  content: "\f06e\f06e";
+}
+
+.fa-duotone.fa-face-sad-cry:after, .fa-duotone.fa-sad-cry:after, .fad.fa-face-sad-cry:after, .fad.fa-sad-cry:after {
+  content: "\f5b3\f5b3";
+}
+
+.fa-duotone.fa-heat:after, .fad.fa-heat:after {
+  content: "\e00c\e00c";
+}
+
+.fa-duotone.fa-ticket-airline:after, .fa-duotone.fa-ticket-perforated-plane:after, .fa-duotone.fa-ticket-plane:after, .fad.fa-ticket-airline:after, .fad.fa-ticket-perforated-plane:after, .fad.fa-ticket-plane:after {
+  content: "\e29a\e29a";
+}
+
+.fa-duotone.fa-boot-heeled:after, .fad.fa-boot-heeled:after {
+  content: "\e33f\e33f";
+}
+
+.fa-duotone.fa-arrows-minimize:after, .fa-duotone.fa-compress-arrows:after, .fad.fa-arrows-minimize:after, .fad.fa-compress-arrows:after {
+  content: "\e0a5\e0a5";
+}
+
+.fa-duotone.fa-audio-description:after, .fad.fa-audio-description:after {
+  content: "\f29e\f29e";
+}
+
+.fa-duotone.fa-person-military-to-person:after, .fad.fa-person-military-to-person:after {
+  content: "\e54c\e54c";
+}
+
+.fa-duotone.fa-file-shield:after, .fad.fa-file-shield:after {
+  content: "\e4f0\e4f0";
+}
+
+.fa-duotone.fa-hexagon:after, .fad.fa-hexagon:after {
+  content: "\f312\f312";
+}
+
+.fa-duotone.fa-manhole:after, .fad.fa-manhole:after {
+  content: "\e1d6\e1d6";
+}
+
+.fa-duotone.fa-user-slash:after, .fad.fa-user-slash:after {
+  content: "\f506\f506";
+}
+
+.fa-duotone.fa-pen:after, .fad.fa-pen:after {
+  content: "\f304\f304";
+}
+
+.fa-duotone.fa-tower-observation:after, .fad.fa-tower-observation:after {
+  content: "\e586\e586";
+}
+
+.fa-duotone.fa-floppy-disks:after, .fad.fa-floppy-disks:after {
+  content: "\e183\e183";
+}
+
+.fa-duotone.fa-toilet-paper-blank-under:after, .fa-duotone.fa-toilet-paper-reverse-alt:after, .fad.fa-toilet-paper-blank-under:after, .fad.fa-toilet-paper-reverse-alt:after {
+  content: "\e29f\e29f";
+}
+
+.fa-duotone.fa-file-code:after, .fad.fa-file-code:after {
+  content: "\f1c9\f1c9";
+}
+
+.fa-duotone.fa-signal-5:after, .fa-duotone.fa-signal-perfect:after, .fa-duotone.fa-signal:after, .fad.fa-signal-5:after, .fad.fa-signal-perfect:after, .fad.fa-signal:after {
+  content: "\f012\f012";
+}
+
+.fa-duotone.fa-pump:after, .fad.fa-pump:after {
+  content: "\e442\e442";
+}
+
+.fa-duotone.fa-bus:after, .fad.fa-bus:after {
+  content: "\f207\f207";
+}
+
+.fa-duotone.fa-heart-circle-xmark:after, .fad.fa-heart-circle-xmark:after {
+  content: "\e501\e501";
+}
+
+.fa-duotone.fa-arrow-up-left-from-circle:after, .fad.fa-arrow-up-left-from-circle:after {
+  content: "\e09e\e09e";
+}
+
+.fa-duotone.fa-home-lg:after, .fa-duotone.fa-house-chimney:after, .fad.fa-home-lg:after, .fad.fa-house-chimney:after {
+  content: "\e3af\e3af";
+}
+
+.fa-duotone.fa-window-maximize:after, .fad.fa-window-maximize:after {
+  content: "\f2d0\f2d0";
+}
+
+.fa-duotone.fa-dryer:after, .fad.fa-dryer:after {
+  content: "\f861\f861";
+}
+
+.fa-duotone.fa-face-frown:after, .fa-duotone.fa-frown:after, .fad.fa-face-frown:after, .fad.fa-frown:after {
+  content: "\f119\f119";
+}
+
+.fa-duotone.fa-chess-bishop-alt:after, .fa-duotone.fa-chess-bishop-piece:after, .fad.fa-chess-bishop-alt:after, .fad.fa-chess-bishop-piece:after {
+  content: "\f43b\f43b";
+}
+
+.fa-duotone.fa-shirt-tank-top:after, .fad.fa-shirt-tank-top:after {
+  content: "\e3c9\e3c9";
+}
+
+.fa-duotone.fa-diploma:after, .fa-duotone.fa-scroll-ribbon:after, .fad.fa-diploma:after, .fad.fa-scroll-ribbon:after {
+  content: "\f5ea\f5ea";
+}
+
+.fa-duotone.fa-screencast:after, .fad.fa-screencast:after {
+  content: "\e23e\e23e";
+}
+
+.fa-duotone.fa-walker:after, .fad.fa-walker:after {
+  content: "\f831\f831";
+}
+
+.fa-duotone.fa-prescription:after, .fad.fa-prescription:after {
+  content: "\f5b1\f5b1";
+}
+
+.fa-duotone.fa-shop:after, .fa-duotone.fa-store-alt:after, .fad.fa-shop:after, .fad.fa-store-alt:after {
+  content: "\f54f\f54f";
+}
+
+.fa-duotone.fa-floppy-disk:after, .fa-duotone.fa-save:after, .fad.fa-floppy-disk:after, .fad.fa-save:after {
+  content: "\f0c7\f0c7";
+}
+
+.fa-duotone.fa-vihara:after, .fad.fa-vihara:after {
+  content: "\f6a7\f6a7";
+}
+
+.fa-duotone.fa-face-kiss-closed-eyes:after, .fad.fa-face-kiss-closed-eyes:after {
+  content: "\e37d\e37d";
+}
+
+.fa-duotone.fa-balance-scale-left:after, .fa-duotone.fa-scale-unbalanced:after, .fad.fa-balance-scale-left:after, .fad.fa-scale-unbalanced:after {
+  content: "\f515\f515";
+}
+
+.fa-duotone.fa-file-user:after, .fad.fa-file-user:after {
+  content: "\f65c\f65c";
+}
+
+.fa-duotone.fa-user-police-tie:after, .fad.fa-user-police-tie:after {
+  content: "\e334\e334";
+}
+
+.fa-duotone.fa-face-tongue-money:after, .fad.fa-face-tongue-money:after {
+  content: "\e39d\e39d";
+}
+
+.fa-duotone.fa-tennis-ball:after, .fad.fa-tennis-ball:after {
+  content: "\f45e\f45e";
+}
+
+.fa-duotone.fa-square-l:after, .fad.fa-square-l:after {
+  content: "\e275\e275";
+}
+
+.fa-duotone.fa-sort-asc:after, .fa-duotone.fa-sort-up:after, .fad.fa-sort-asc:after, .fad.fa-sort-up:after {
+  content: "\f0de\f0de";
+}
+
+.fa-duotone.fa-calendar-arrow-up:after, .fa-duotone.fa-calendar-upload:after, .fad.fa-calendar-arrow-up:after, .fad.fa-calendar-upload:after {
+  content: "\e0d1\e0d1";
+}
+
+.fa-duotone.fa-comment-dots:after, .fa-duotone.fa-commenting:after, .fad.fa-comment-dots:after, .fad.fa-commenting:after {
+  content: "\f4ad\f4ad";
+}
+
+.fa-duotone.fa-plant-wilt:after, .fad.fa-plant-wilt:after {
+  content: "\e5aa\e5aa";
+}
+
+.fa-duotone.fa-scarf:after, .fad.fa-scarf:after {
+  content: "\f7c1\f7c1";
+}
+
+.fa-duotone.fa-album-circle-plus:after, .fad.fa-album-circle-plus:after {
+  content: "\e48c\e48c";
+}
+
+.fa-duotone.fa-user-nurse-hair-long:after, .fad.fa-user-nurse-hair-long:after {
+  content: "\e45e\e45e";
+}
+
+.fa-duotone.fa-diamond:after, .fad.fa-diamond:after {
+  content: "\f219\f219";
+}
+
+.fa-duotone.fa-arrow-alt-square-left:after, .fa-duotone.fa-square-left:after, .fad.fa-arrow-alt-square-left:after, .fad.fa-square-left:after {
+  content: "\f351\f351";
+}
+
+.fa-duotone.fa-face-grin-squint:after, .fa-duotone.fa-grin-squint:after, .fad.fa-face-grin-squint:after, .fad.fa-grin-squint:after {
+  content: "\f585\f585";
+}
+
+.fa-duotone.fa-circle-ellipsis-vertical:after, .fad.fa-circle-ellipsis-vertical:after {
+  content: "\e10b\e10b";
+}
+
+.fa-duotone.fa-hand-holding-dollar:after, .fa-duotone.fa-hand-holding-usd:after, .fad.fa-hand-holding-dollar:after, .fad.fa-hand-holding-usd:after {
+  content: "\f4c0\f4c0";
+}
+
+.fa-duotone.fa-grid-dividers:after, .fad.fa-grid-dividers:after {
+  content: "\e3ad\e3ad";
+}
+
+.fa-duotone.fa-bacterium:after, .fad.fa-bacterium:after {
+  content: "\e05a\e05a";
+}
+
+.fa-duotone.fa-hand-pointer:after, .fad.fa-hand-pointer:after {
+  content: "\f25a\f25a";
+}
+
+.fa-duotone.fa-drum-steelpan:after, .fad.fa-drum-steelpan:after {
+  content: "\f56a\f56a";
+}
+
+.fa-duotone.fa-hand-scissors:after, .fad.fa-hand-scissors:after {
+  content: "\f257\f257";
+}
+
+.fa-duotone.fa-hands-praying:after, .fa-duotone.fa-praying-hands:after, .fad.fa-hands-praying:after, .fad.fa-praying-hands:after {
+  content: "\f684\f684";
+}
+
+.fa-duotone.fa-face-pensive:after, .fad.fa-face-pensive:after {
+  content: "\e384\e384";
+}
+
+.fa-duotone.fa-user-music:after, .fad.fa-user-music:after {
+  content: "\f8eb\f8eb";
+}
+
+.fa-duotone.fa-arrow-right-rotate:after, .fa-duotone.fa-arrow-rotate-forward:after, .fa-duotone.fa-arrow-rotate-right:after, .fa-duotone.fa-redo:after, .fad.fa-arrow-right-rotate:after, .fad.fa-arrow-rotate-forward:after, .fad.fa-arrow-rotate-right:after, .fad.fa-redo:after {
+  content: "\f01e\f01e";
+}
+
+.fa-duotone.fa-comments-alt-dollar:after, .fa-duotone.fa-messages-dollar:after, .fad.fa-comments-alt-dollar:after, .fad.fa-messages-dollar:after {
+  content: "\f652\f652";
+}
+
+.fa-duotone.fa-sensor-on:after, .fad.fa-sensor-on:after {
+  content: "\e02b\e02b";
+}
+
+.fa-duotone.fa-balloon:after, .fad.fa-balloon:after {
+  content: "\e2e3\e2e3";
+}
+
+.fa-duotone.fa-biohazard:after, .fad.fa-biohazard:after {
+  content: "\f780\f780";
+}
+
+.fa-duotone.fa-chess-queen-alt:after, .fa-duotone.fa-chess-queen-piece:after, .fad.fa-chess-queen-alt:after, .fad.fa-chess-queen-piece:after {
+  content: "\f446\f446";
+}
+
+.fa-duotone.fa-location-crosshairs:after, .fa-duotone.fa-location:after, .fad.fa-location-crosshairs:after, .fad.fa-location:after {
+  content: "\f601\f601";
+}
+
+.fa-duotone.fa-mars-double:after, .fad.fa-mars-double:after {
+  content: "\f227\f227";
+}
+
+.fa-duotone.fa-left-from-bracket:after, .fad.fa-left-from-bracket:after {
+  content: "\e66c\e66c";
+}
+
+.fa-duotone.fa-house-leave:after, .fa-duotone.fa-house-person-depart:after, .fa-duotone.fa-house-person-leave:after, .fad.fa-house-leave:after, .fad.fa-house-person-depart:after, .fad.fa-house-person-leave:after {
+  content: "\e00f\e00f";
+}
+
+.fa-duotone.fa-ruler-triangle:after, .fad.fa-ruler-triangle:after {
+  content: "\f61c\f61c";
+}
+
+.fa-duotone.fa-card-club:after, .fad.fa-card-club:after {
+  content: "\e3e9\e3e9";
+}
+
+.fa-duotone.fa-child-dress:after, .fad.fa-child-dress:after {
+  content: "\e59c\e59c";
+}
+
+.fa-duotone.fa-users-between-lines:after, .fad.fa-users-between-lines:after {
+  content: "\e591\e591";
+}
+
+.fa-duotone.fa-lungs-virus:after, .fad.fa-lungs-virus:after {
+  content: "\e067\e067";
+}
+
+.fa-duotone.fa-spinner-third:after, .fad.fa-spinner-third:after {
+  content: "\f3f4\f3f4";
+}
+
+.fa-duotone.fa-face-grin-tears:after, .fa-duotone.fa-grin-tears:after, .fad.fa-face-grin-tears:after, .fad.fa-grin-tears:after {
+  content: "\f588\f588";
+}
+
+.fa-duotone.fa-phone:after, .fad.fa-phone:after {
+  content: "\f095\f095";
+}
+
+.fa-duotone.fa-computer-mouse-scrollwheel:after, .fa-duotone.fa-mouse-alt:after, .fad.fa-computer-mouse-scrollwheel:after, .fad.fa-mouse-alt:after {
+  content: "\f8cd\f8cd";
+}
+
+.fa-duotone.fa-calendar-times:after, .fa-duotone.fa-calendar-xmark:after, .fad.fa-calendar-times:after, .fad.fa-calendar-xmark:after {
+  content: "\f273\f273";
+}
+
+.fa-duotone.fa-child-reaching:after, .fad.fa-child-reaching:after {
+  content: "\e59d\e59d";
+}
+
+.fa-duotone.fa-table-layout:after, .fad.fa-table-layout:after {
+  content: "\e290\e290";
+}
+
+.fa-duotone.fa-narwhal:after, .fad.fa-narwhal:after {
+  content: "\f6fe\f6fe";
+}
+
+.fa-duotone.fa-ramp-loading:after, .fad.fa-ramp-loading:after {
+  content: "\f4d4\f4d4";
+}
+
+.fa-duotone.fa-calendar-circle-plus:after, .fad.fa-calendar-circle-plus:after {
+  content: "\e470\e470";
+}
+
+.fa-duotone.fa-toothbrush:after, .fad.fa-toothbrush:after {
+  content: "\f635\f635";
+}
+
+.fa-duotone.fa-border-inner:after, .fad.fa-border-inner:after {
+  content: "\f84e\f84e";
+}
+
+.fa-duotone.fa-paw-claws:after, .fad.fa-paw-claws:after {
+  content: "\f702\f702";
+}
+
+.fa-duotone.fa-kiwi-fruit:after, .fad.fa-kiwi-fruit:after {
+  content: "\e30c\e30c";
+}
+
+.fa-duotone.fa-traffic-light-slow:after, .fad.fa-traffic-light-slow:after {
+  content: "\f639\f639";
+}
+
+.fa-duotone.fa-rectangle-code:after, .fad.fa-rectangle-code:after {
+  content: "\e322\e322";
+}
+
+.fa-duotone.fa-head-side-virus:after, .fad.fa-head-side-virus:after {
+  content: "\e064\e064";
+}
+
+.fa-duotone.fa-keyboard-brightness:after, .fad.fa-keyboard-brightness:after {
+  content: "\e1c0\e1c0";
+}
+
+.fa-duotone.fa-books-medical:after, .fad.fa-books-medical:after {
+  content: "\f7e8\f7e8";
+}
+
+.fa-duotone.fa-lightbulb-slash:after, .fad.fa-lightbulb-slash:after {
+  content: "\f673\f673";
+}
+
+.fa-duotone.fa-home-blank:after, .fa-duotone.fa-house-blank:after, .fad.fa-home-blank:after, .fad.fa-house-blank:after {
+  content: "\e487\e487";
+}
+
+.fa-duotone.fa-square-5:after, .fad.fa-square-5:after {
+  content: "\e25a\e25a";
+}
+
+.fa-duotone.fa-heart-square:after, .fa-duotone.fa-square-heart:after, .fad.fa-heart-square:after, .fad.fa-square-heart:after {
+  content: "\f4c8\f4c8";
+}
+
+.fa-duotone.fa-puzzle:after, .fad.fa-puzzle:after {
+  content: "\e443\e443";
+}
+
+.fa-duotone.fa-user-cog:after, .fa-duotone.fa-user-gear:after, .fad.fa-user-cog:after, .fad.fa-user-gear:after {
+  content: "\f4fe\f4fe";
+}
+
+.fa-duotone.fa-pipe-circle-check:after, .fad.fa-pipe-circle-check:after {
+  content: "\e436\e436";
+}
+
+.fa-duotone.fa-arrow-up-1-9:after, .fa-duotone.fa-sort-numeric-up:after, .fad.fa-arrow-up-1-9:after, .fad.fa-sort-numeric-up:after {
+  content: "\f163\f163";
+}
+
+.fa-duotone.fa-octagon-exclamation:after, .fad.fa-octagon-exclamation:after {
+  content: "\e204\e204";
+}
+
+.fa-duotone.fa-dial-low:after, .fad.fa-dial-low:after {
+  content: "\e15d\e15d";
+}
+
+.fa-duotone.fa-door-closed:after, .fad.fa-door-closed:after {
+  content: "\f52a\f52a";
+}
+
+.fa-duotone.fa-laptop-mobile:after, .fa-duotone.fa-phone-laptop:after, .fad.fa-laptop-mobile:after, .fad.fa-phone-laptop:after {
+  content: "\f87a\f87a";
+}
+
+.fa-duotone.fa-conveyor-belt-alt:after, .fa-duotone.fa-conveyor-belt-boxes:after, .fad.fa-conveyor-belt-alt:after, .fad.fa-conveyor-belt-boxes:after {
+  content: "\f46f\f46f";
+}
+
+.fa-duotone.fa-shield-virus:after, .fad.fa-shield-virus:after {
+  content: "\e06c\e06c";
+}
+
+.fa-duotone.fa-starfighter-alt-advanced:after, .fa-duotone.fa-starfighter-twin-ion-engine-advanced:after, .fad.fa-starfighter-alt-advanced:after, .fad.fa-starfighter-twin-ion-engine-advanced:after {
+  content: "\e28e\e28e";
+}
+
+.fa-duotone.fa-dice-six:after, .fad.fa-dice-six:after {
+  content: "\f526\f526";
+}
+
+.fa-duotone.fa-starfighter-alt:after, .fa-duotone.fa-starfighter-twin-ion-engine:after, .fad.fa-starfighter-alt:after, .fad.fa-starfighter-twin-ion-engine:after {
+  content: "\e038\e038";
+}
+
+.fa-duotone.fa-rocket-launch:after, .fad.fa-rocket-launch:after {
+  content: "\e027\e027";
+}
+
+.fa-duotone.fa-mosquito-net:after, .fad.fa-mosquito-net:after {
+  content: "\e52c\e52c";
+}
+
+.fa-duotone.fa-vent-damper:after, .fad.fa-vent-damper:after {
+  content: "\e465\e465";
+}
+
+.fa-duotone.fa-bridge-water:after, .fad.fa-bridge-water:after {
+  content: "\e4ce\e4ce";
+}
+
+.fa-duotone.fa-ban-bug:after, .fa-duotone.fa-debug:after, .fad.fa-ban-bug:after, .fad.fa-debug:after {
+  content: "\f7f9\f7f9";
+}
+
+.fa-duotone.fa-person-booth:after, .fad.fa-person-booth:after {
+  content: "\f756\f756";
+}
+
+.fa-duotone.fa-text-width:after, .fad.fa-text-width:after {
+  content: "\f035\f035";
+}
+
+.fa-duotone.fa-garage-car:after, .fad.fa-garage-car:after {
+  content: "\e00a\e00a";
+}
+
+.fa-duotone.fa-square-kanban:after, .fad.fa-square-kanban:after {
+  content: "\e488\e488";
+}
+
+.fa-duotone.fa-hat-wizard:after, .fad.fa-hat-wizard:after {
+  content: "\f6e8\f6e8";
+}
+
+.fa-duotone.fa-chart-kanban:after, .fad.fa-chart-kanban:after {
+  content: "\e64f\e64f";
+}
+
+.fa-duotone.fa-pen-fancy:after, .fad.fa-pen-fancy:after {
+  content: "\f5ac\f5ac";
+}
+
+.fa-duotone.fa-coffee-pot:after, .fad.fa-coffee-pot:after {
+  content: "\e002\e002";
+}
+
+.fa-duotone.fa-mouse-field:after, .fad.fa-mouse-field:after {
+  content: "\e5a8\e5a8";
+}
+
+.fa-duotone.fa-digging:after, .fa-duotone.fa-person-digging:after, .fad.fa-digging:after, .fad.fa-person-digging:after {
+  content: "\f85e\f85e";
+}
+
+.fa-duotone.fa-shower-alt:after, .fa-duotone.fa-shower-down:after, .fad.fa-shower-alt:after, .fad.fa-shower-down:after {
+  content: "\e24d\e24d";
+}
+
+.fa-duotone.fa-box-circle-check:after, .fad.fa-box-circle-check:after {
+  content: "\e0c4\e0c4";
+}
+
+.fa-duotone.fa-brightness:after, .fad.fa-brightness:after {
+  content: "\e0c9\e0c9";
+}
+
+.fa-duotone.fa-car-side-bolt:after, .fad.fa-car-side-bolt:after {
+  content: "\e344\e344";
+}
+
+.fa-duotone.fa-file-xml:after, .fad.fa-file-xml:after {
+  content: "\e654\e654";
+}
+
+.fa-duotone.fa-ornament:after, .fad.fa-ornament:after {
+  content: "\f7b8\f7b8";
+}
+
+.fa-duotone.fa-phone-arrow-down-left:after, .fa-duotone.fa-phone-arrow-down:after, .fa-duotone.fa-phone-incoming:after, .fad.fa-phone-arrow-down-left:after, .fad.fa-phone-arrow-down:after, .fad.fa-phone-incoming:after {
+  content: "\e223\e223";
+}
+
+.fa-duotone.fa-cloud-word:after, .fad.fa-cloud-word:after {
+  content: "\e138\e138";
+}
+
+.fa-duotone.fa-hand-fingers-crossed:after, .fad.fa-hand-fingers-crossed:after {
+  content: "\e1a3\e1a3";
+}
+
+.fa-duotone.fa-trash:after, .fad.fa-trash:after {
+  content: "\f1f8\f1f8";
+}
+
+.fa-duotone.fa-gauge-simple-med:after, .fa-duotone.fa-gauge-simple:after, .fa-duotone.fa-tachometer-average:after, .fad.fa-gauge-simple-med:after, .fad.fa-gauge-simple:after, .fad.fa-tachometer-average:after {
+  content: "\f629\f629";
+}
+
+.fa-duotone.fa-arrow-down-small-big:after, .fa-duotone.fa-sort-size-down-alt:after, .fad.fa-arrow-down-small-big:after, .fad.fa-sort-size-down-alt:after {
+  content: "\f88d\f88d";
+}
+
+.fa-duotone.fa-book-medical:after, .fad.fa-book-medical:after {
+  content: "\f7e6\f7e6";
+}
+
+.fa-duotone.fa-face-melting:after, .fad.fa-face-melting:after {
+  content: "\e483\e483";
+}
+
+.fa-duotone.fa-poo:after, .fad.fa-poo:after {
+  content: "\f2fe\f2fe";
+}
+
+.fa-duotone.fa-pen-alt-slash:after, .fa-duotone.fa-pen-clip-slash:after, .fad.fa-pen-alt-slash:after, .fad.fa-pen-clip-slash:after {
+  content: "\e20f\e20f";
+}
+
+.fa-duotone.fa-quote-right-alt:after, .fa-duotone.fa-quote-right:after, .fad.fa-quote-right-alt:after, .fad.fa-quote-right:after {
+  content: "\f10e\f10e";
+}
+
+.fa-duotone.fa-scroll-old:after, .fad.fa-scroll-old:after {
+  content: "\f70f\f70f";
+}
+
+.fa-duotone.fa-guitars:after, .fad.fa-guitars:after {
+  content: "\f8bf\f8bf";
+}
+
+.fa-duotone.fa-phone-xmark:after, .fad.fa-phone-xmark:after {
+  content: "\e227\e227";
+}
+
+.fa-duotone.fa-hose:after, .fad.fa-hose:after {
+  content: "\e419\e419";
+}
+
+.fa-duotone.fa-clock-six:after, .fad.fa-clock-six:after {
+  content: "\e352\e352";
+}
+
+.fa-duotone.fa-shirt:after, .fa-duotone.fa-t-shirt:after, .fa-duotone.fa-tshirt:after, .fad.fa-shirt:after, .fad.fa-t-shirt:after, .fad.fa-tshirt:after {
+  content: "\f553\f553";
+}
+
+.fa-duotone.fa-billboard:after, .fad.fa-billboard:after {
+  content: "\e5cd\e5cd";
+}
+
+.fa-duotone.fa-square-r:after, .fad.fa-square-r:after {
+  content: "\e27c\e27c";
+}
+
+.fa-duotone.fa-cubes:after, .fad.fa-cubes:after {
+  content: "\f1b3\f1b3";
+}
+
+.fa-duotone.fa-envelope-open-dollar:after, .fad.fa-envelope-open-dollar:after {
+  content: "\f657\f657";
+}
+
+.fa-duotone.fa-divide:after, .fad.fa-divide:after {
+  content: "\f529\f529";
+}
+
+.fa-duotone.fa-sun-cloud:after, .fad.fa-sun-cloud:after {
+  content: "\f763\f763";
+}
+
+.fa-duotone.fa-lamp-floor:after, .fad.fa-lamp-floor:after {
+  content: "\e015\e015";
+}
+
+.fa-duotone.fa-square-7:after, .fad.fa-square-7:after {
+  content: "\e25c\e25c";
+}
+
+.fa-duotone.fa-tenge-sign:after, .fa-duotone.fa-tenge:after, .fad.fa-tenge-sign:after, .fad.fa-tenge:after {
+  content: "\f7d7\f7d7";
+}
+
+.fa-duotone.fa-headphones:after, .fad.fa-headphones:after {
+  content: "\f025\f025";
+}
+
+.fa-duotone.fa-hands-holding:after, .fad.fa-hands-holding:after {
+  content: "\f4c2\f4c2";
+}
+
+.fa-duotone.fa-campfire:after, .fad.fa-campfire:after {
+  content: "\f6ba\f6ba";
+}
+
+.fa-duotone.fa-circle-ampersand:after, .fad.fa-circle-ampersand:after {
+  content: "\e0f8\e0f8";
+}
+
+.fa-duotone.fa-snowflakes:after, .fad.fa-snowflakes:after {
+  content: "\f7cf\f7cf";
+}
+
+.fa-duotone.fa-hands-clapping:after, .fad.fa-hands-clapping:after {
+  content: "\e1a8\e1a8";
+}
+
+.fa-duotone.fa-republican:after, .fad.fa-republican:after {
+  content: "\f75e\f75e";
+}
+
+.fa-duotone.fa-leaf-maple:after, .fad.fa-leaf-maple:after {
+  content: "\f6f6\f6f6";
+}
+
+.fa-duotone.fa-arrow-left:after, .fad.fa-arrow-left:after {
+  content: "\f060\f060";
+}
+
+.fa-duotone.fa-person-circle-xmark:after, .fad.fa-person-circle-xmark:after {
+  content: "\e543\e543";
+}
+
+.fa-duotone.fa-ruler:after, .fad.fa-ruler:after {
+  content: "\f545\f545";
+}
+
+.fa-duotone.fa-arrow-left-from-bracket:after, .fad.fa-arrow-left-from-bracket:after {
+  content: "\e668\e668";
+}
+
+.fa-duotone.fa-cup-straw-swoosh:after, .fad.fa-cup-straw-swoosh:after {
+  content: "\e364\e364";
+}
+
+.fa-duotone.fa-temperature-hot:after, .fa-duotone.fa-temperature-sun:after, .fad.fa-temperature-hot:after, .fad.fa-temperature-sun:after {
+  content: "\f76a\f76a";
+}
+
+.fa-duotone.fa-align-left:after, .fad.fa-align-left:after {
+  content: "\f036\f036";
+}
+
+.fa-duotone.fa-dice-d6:after, .fad.fa-dice-d6:after {
+  content: "\f6d1\f6d1";
+}
+
+.fa-duotone.fa-restroom:after, .fad.fa-restroom:after {
+  content: "\f7bd\f7bd";
+}
+
+.fa-duotone.fa-high-definition:after, .fa-duotone.fa-rectangle-hd:after, .fad.fa-high-definition:after, .fad.fa-rectangle-hd:after {
+  content: "\e1ae\e1ae";
+}
+
+.fa-duotone.fa-j:after, .fad.fa-j:after {
+  content: "\4a\4a";
+}
+
+.fa-duotone.fa-galaxy:after, .fad.fa-galaxy:after {
+  content: "\e008\e008";
+}
+
+.fa-duotone.fa-users-viewfinder:after, .fad.fa-users-viewfinder:after {
+  content: "\e595\e595";
+}
+
+.fa-duotone.fa-file-video:after, .fad.fa-file-video:after {
+  content: "\f1c8\f1c8";
+}
+
+.fa-duotone.fa-cherries:after, .fad.fa-cherries:after {
+  content: "\e0ec\e0ec";
+}
+
+.fa-duotone.fa-external-link-alt:after, .fa-duotone.fa-up-right-from-square:after, .fad.fa-external-link-alt:after, .fad.fa-up-right-from-square:after {
+  content: "\f35d\f35d";
+}
+
+.fa-duotone.fa-circle-sort:after, .fa-duotone.fa-sort-circle:after, .fad.fa-circle-sort:after, .fad.fa-sort-circle:after {
+  content: "\e030\e030";
+}
+
+.fa-duotone.fa-table-cells:after, .fa-duotone.fa-th:after, .fad.fa-table-cells:after, .fad.fa-th:after {
+  content: "\f00a\f00a";
+}
+
+.fa-duotone.fa-bag-shopping-minus:after, .fad.fa-bag-shopping-minus:after {
+  content: "\e650\e650";
+}
+
+.fa-duotone.fa-file-pdf:after, .fad.fa-file-pdf:after {
+  content: "\f1c1\f1c1";
+}
+
+.fa-duotone.fa-siren:after, .fad.fa-siren:after {
+  content: "\e02d\e02d";
+}
+
+.fa-duotone.fa-arrow-up-to-dotted-line:after, .fad.fa-arrow-up-to-dotted-line:after {
+  content: "\e0a1\e0a1";
+}
+
+.fa-duotone.fa-image-landscape:after, .fa-duotone.fa-landscape:after, .fad.fa-image-landscape:after, .fad.fa-landscape:after {
+  content: "\e1b5\e1b5";
+}
+
+.fa-duotone.fa-tank-water:after, .fad.fa-tank-water:after {
+  content: "\e452\e452";
+}
+
+.fa-duotone.fa-curling-stone:after, .fa-duotone.fa-curling:after, .fad.fa-curling-stone:after, .fad.fa-curling:after {
+  content: "\f44a\f44a";
+}
+
+.fa-duotone.fa-gamepad-alt:after, .fa-duotone.fa-gamepad-modern:after, .fad.fa-gamepad-alt:after, .fad.fa-gamepad-modern:after {
+  content: "\e5a2\e5a2";
+}
+
+.fa-duotone.fa-messages-question:after, .fad.fa-messages-question:after {
+  content: "\e1e7\e1e7";
+}
+
+.fa-duotone.fa-bible:after, .fa-duotone.fa-book-bible:after, .fad.fa-bible:after, .fad.fa-book-bible:after {
+  content: "\f647\f647";
+}
+
+.fa-duotone.fa-o:after, .fad.fa-o:after {
+  content: "\4f\4f";
+}
+
+.fa-duotone.fa-medkit:after, .fa-duotone.fa-suitcase-medical:after, .fad.fa-medkit:after, .fad.fa-suitcase-medical:after {
+  content: "\f0fa\f0fa";
+}
+
+.fa-duotone.fa-briefcase-arrow-right:after, .fad.fa-briefcase-arrow-right:after {
+  content: "\e2f2\e2f2";
+}
+
+.fa-duotone.fa-expand-wide:after, .fad.fa-expand-wide:after {
+  content: "\f320\f320";
+}
+
+.fa-duotone.fa-clock-eleven-thirty:after, .fad.fa-clock-eleven-thirty:after {
+  content: "\e348\e348";
+}
+
+.fa-duotone.fa-rv:after, .fad.fa-rv:after {
+  content: "\f7be\f7be";
+}
+
+.fa-duotone.fa-user-secret:after, .fad.fa-user-secret:after {
+  content: "\f21b\f21b";
+}
+
+.fa-duotone.fa-otter:after, .fad.fa-otter:after {
+  content: "\f700\f700";
+}
+
+.fa-duotone.fa-dreidel:after, .fad.fa-dreidel:after {
+  content: "\f792\f792";
+}
+
+.fa-duotone.fa-female:after, .fa-duotone.fa-person-dress:after, .fad.fa-female:after, .fad.fa-person-dress:after {
+  content: "\f182\f182";
+}
+
+.fa-duotone.fa-comment-dollar:after, .fad.fa-comment-dollar:after {
+  content: "\f651\f651";
+}
+
+.fa-duotone.fa-briefcase-clock:after, .fa-duotone.fa-business-time:after, .fad.fa-briefcase-clock:after, .fad.fa-business-time:after {
+  content: "\f64a\f64a";
+}
+
+.fa-duotone.fa-flower-tulip:after, .fad.fa-flower-tulip:after {
+  content: "\f801\f801";
+}
+
+.fa-duotone.fa-people-pants-simple:after, .fad.fa-people-pants-simple:after {
+  content: "\e21a\e21a";
+}
+
+.fa-duotone.fa-cloud-drizzle:after, .fad.fa-cloud-drizzle:after {
+  content: "\f738\f738";
+}
+
+.fa-duotone.fa-table-cells-large:after, .fa-duotone.fa-th-large:after, .fad.fa-table-cells-large:after, .fad.fa-th-large:after {
+  content: "\f009\f009";
+}
+
+.fa-duotone.fa-book-tanakh:after, .fa-duotone.fa-tanakh:after, .fad.fa-book-tanakh:after, .fad.fa-tanakh:after {
+  content: "\f827\f827";
+}
+
+.fa-duotone.fa-solar-system:after, .fad.fa-solar-system:after {
+  content: "\e02f\e02f";
+}
+
+.fa-duotone.fa-seal-question:after, .fad.fa-seal-question:after {
+  content: "\e243\e243";
+}
+
+.fa-duotone.fa-phone-volume:after, .fa-duotone.fa-volume-control-phone:after, .fad.fa-phone-volume:after, .fad.fa-volume-control-phone:after {
+  content: "\f2a0\f2a0";
+}
+
+.fa-duotone.fa-disc-drive:after, .fad.fa-disc-drive:after {
+  content: "\f8b5\f8b5";
+}
+
+.fa-duotone.fa-hat-cowboy-side:after, .fad.fa-hat-cowboy-side:after {
+  content: "\f8c1\f8c1";
+}
+
+.fa-duotone.fa-rows:after, .fa-duotone.fa-table-rows:after, .fad.fa-rows:after, .fad.fa-table-rows:after {
+  content: "\e292\e292";
+}
+
+.fa-duotone.fa-location-exclamation:after, .fa-duotone.fa-map-marker-exclamation:after, .fad.fa-location-exclamation:after, .fad.fa-map-marker-exclamation:after {
+  content: "\f608\f608";
+}
+
+.fa-duotone.fa-face-fearful:after, .fad.fa-face-fearful:after {
+  content: "\e375\e375";
+}
+
+.fa-duotone.fa-clipboard-user:after, .fad.fa-clipboard-user:after {
+  content: "\f7f3\f7f3";
+}
+
+.fa-duotone.fa-bus-school:after, .fad.fa-bus-school:after {
+  content: "\f5dd\f5dd";
+}
+
+.fa-duotone.fa-film-slash:after, .fad.fa-film-slash:after {
+  content: "\e179\e179";
+}
+
+.fa-duotone.fa-square-arrow-down-right:after, .fad.fa-square-arrow-down-right:after {
+  content: "\e262\e262";
+}
+
+.fa-duotone.fa-book-sparkles:after, .fa-duotone.fa-book-spells:after, .fad.fa-book-sparkles:after, .fad.fa-book-spells:after {
+  content: "\f6b8\f6b8";
+}
+
+.fa-duotone.fa-washer:after, .fa-duotone.fa-washing-machine:after, .fad.fa-washer:after, .fad.fa-washing-machine:after {
+  content: "\f898\f898";
+}
+
+.fa-duotone.fa-child:after, .fad.fa-child:after {
+  content: "\f1ae\f1ae";
+}
+
+.fa-duotone.fa-lira-sign:after, .fad.fa-lira-sign:after {
+  content: "\f195\f195";
+}
+
+.fa-duotone.fa-user-visor:after, .fad.fa-user-visor:after {
+  content: "\e04c\e04c";
+}
+
+.fa-duotone.fa-file-plus-minus:after, .fad.fa-file-plus-minus:after {
+  content: "\e177\e177";
+}
+
+.fa-duotone.fa-chess-clock-alt:after, .fa-duotone.fa-chess-clock-flip:after, .fad.fa-chess-clock-alt:after, .fad.fa-chess-clock-flip:after {
+  content: "\f43e\f43e";
+}
+
+.fa-duotone.fa-satellite:after, .fad.fa-satellite:after {
+  content: "\f7bf\f7bf";
+}
+
+.fa-duotone.fa-truck-fire:after, .fad.fa-truck-fire:after {
+  content: "\e65a\e65a";
+}
+
+.fa-duotone.fa-plane-lock:after, .fad.fa-plane-lock:after {
+  content: "\e558\e558";
+}
+
+.fa-duotone.fa-steering-wheel:after, .fad.fa-steering-wheel:after {
+  content: "\f622\f622";
+}
+
+.fa-duotone.fa-tag:after, .fad.fa-tag:after {
+  content: "\f02b\f02b";
+}
+
+.fa-duotone.fa-stretcher:after, .fad.fa-stretcher:after {
+  content: "\f825\f825";
+}
+
+.fa-duotone.fa-book-law:after, .fa-duotone.fa-book-section:after, .fad.fa-book-law:after, .fad.fa-book-section:after {
+  content: "\e0c1\e0c1";
+}
+
+.fa-duotone.fa-inboxes:after, .fad.fa-inboxes:after {
+  content: "\e1bb\e1bb";
+}
+
+.fa-duotone.fa-coffee-bean:after, .fad.fa-coffee-bean:after {
+  content: "\e13e\e13e";
+}
+
+.fa-duotone.fa-circle-yen:after, .fad.fa-circle-yen:after {
+  content: "\e5d0\e5d0";
+}
+
+.fa-duotone.fa-brackets-curly:after, .fad.fa-brackets-curly:after {
+  content: "\f7ea\f7ea";
+}
+
+.fa-duotone.fa-ellipsis-stroke-vertical:after, .fa-duotone.fa-ellipsis-v-alt:after, .fad.fa-ellipsis-stroke-vertical:after, .fad.fa-ellipsis-v-alt:after {
+  content: "\f39c\f39c";
+}
+
+.fa-duotone.fa-comment:after, .fad.fa-comment:after {
+  content: "\f075\f075";
+}
+
+.fa-duotone.fa-square-1:after, .fad.fa-square-1:after {
+  content: "\e256\e256";
+}
+
+.fa-duotone.fa-birthday-cake:after, .fa-duotone.fa-cake-candles:after, .fa-duotone.fa-cake:after, .fad.fa-birthday-cake:after, .fad.fa-cake-candles:after, .fad.fa-cake:after {
+  content: "\f1fd\f1fd";
+}
+
+.fa-duotone.fa-head-side:after, .fad.fa-head-side:after {
+  content: "\f6e9\f6e9";
+}
+
+.fa-duotone.fa-truck-ladder:after, .fad.fa-truck-ladder:after {
+  content: "\e657\e657";
+}
+
+.fa-duotone.fa-envelope:after, .fad.fa-envelope:after {
+  content: "\f0e0\f0e0";
+}
+
+.fa-duotone.fa-dolly-empty:after, .fad.fa-dolly-empty:after {
+  content: "\f473\f473";
+}
+
+.fa-duotone.fa-face-tissue:after, .fad.fa-face-tissue:after {
+  content: "\e39c\e39c";
+}
+
+.fa-duotone.fa-angle-double-up:after, .fa-duotone.fa-angles-up:after, .fad.fa-angle-double-up:after, .fad.fa-angles-up:after {
+  content: "\f102\f102";
+}
+
+.fa-duotone.fa-bin-recycle:after, .fad.fa-bin-recycle:after {
+  content: "\e5f7\e5f7";
+}
+
+.fa-duotone.fa-paperclip:after, .fad.fa-paperclip:after {
+  content: "\f0c6\f0c6";
+}
+
+.fa-duotone.fa-chart-line-down:after, .fad.fa-chart-line-down:after {
+  content: "\f64d\f64d";
+}
+
+.fa-duotone.fa-arrow-right-to-city:after, .fad.fa-arrow-right-to-city:after {
+  content: "\e4b3\e4b3";
+}
+
+.fa-duotone.fa-lock-a:after, .fad.fa-lock-a:after {
+  content: "\e422\e422";
+}
+
+.fa-duotone.fa-ribbon:after, .fad.fa-ribbon:after {
+  content: "\f4d6\f4d6";
+}
+
+.fa-duotone.fa-lungs:after, .fad.fa-lungs:after {
+  content: "\f604\f604";
+}
+
+.fa-duotone.fa-person-pinball:after, .fad.fa-person-pinball:after {
+  content: "\e21d\e21d";
+}
+
+.fa-duotone.fa-arrow-up-9-1:after, .fa-duotone.fa-sort-numeric-up-alt:after, .fad.fa-arrow-up-9-1:after, .fad.fa-sort-numeric-up-alt:after {
+  content: "\f887\f887";
+}
+
+.fa-duotone.fa-apple-core:after, .fad.fa-apple-core:after {
+  content: "\e08f\e08f";
+}
+
+.fa-duotone.fa-circle-y:after, .fad.fa-circle-y:after {
+  content: "\e12f\e12f";
+}
+
+.fa-duotone.fa-h6:after, .fad.fa-h6:after {
+  content: "\e413\e413";
+}
+
+.fa-duotone.fa-litecoin-sign:after, .fad.fa-litecoin-sign:after {
+  content: "\e1d3\e1d3";
+}
+
+.fa-duotone.fa-bottle-baby:after, .fad.fa-bottle-baby:after {
+  content: "\e673\e673";
+}
+
+.fa-duotone.fa-circle-small:after, .fad.fa-circle-small:after {
+  content: "\e122\e122";
+}
+
+.fa-duotone.fa-border-none:after, .fad.fa-border-none:after {
+  content: "\f850\f850";
+}
+
+.fa-duotone.fa-arrow-turn-down-left:after, .fad.fa-arrow-turn-down-left:after {
+  content: "\e2e1\e2e1";
+}
+
+.fa-duotone.fa-circle-wifi-circle-wifi:after, .fa-duotone.fa-circle-wifi-group:after, .fad.fa-circle-wifi-circle-wifi:after, .fad.fa-circle-wifi-group:after {
+  content: "\e67e\e67e";
+}
+
+.fa-duotone.fa-circle-nodes:after, .fad.fa-circle-nodes:after {
+  content: "\e4e2\e4e2";
+}
+
+.fa-duotone.fa-parachute-box:after, .fad.fa-parachute-box:after {
+  content: "\f4cd\f4cd";
+}
+
+.fa-duotone.fa-reflect-horizontal:after, .fad.fa-reflect-horizontal:after {
+  content: "\e664\e664";
+}
+
+.fa-duotone.fa-comment-alt-medical:after, .fa-duotone.fa-message-medical:after, .fad.fa-comment-alt-medical:after, .fad.fa-message-medical:after {
+  content: "\f7f4\f7f4";
+}
+
+.fa-duotone.fa-rugby-ball:after, .fad.fa-rugby-ball:after {
+  content: "\e3c6\e3c6";
+}
+
+.fa-duotone.fa-comment-music:after, .fad.fa-comment-music:after {
+  content: "\f8b0\f8b0";
+}
+
+.fa-duotone.fa-indent:after, .fad.fa-indent:after {
+  content: "\f03c\f03c";
+}
+
+.fa-duotone.fa-tree-alt:after, .fa-duotone.fa-tree-deciduous:after, .fad.fa-tree-alt:after, .fad.fa-tree-deciduous:after {
+  content: "\f400\f400";
+}
+
+.fa-duotone.fa-puzzle-piece-alt:after, .fa-duotone.fa-puzzle-piece-simple:after, .fad.fa-puzzle-piece-alt:after, .fad.fa-puzzle-piece-simple:after {
+  content: "\e231\e231";
+}
+
+.fa-duotone.fa-truck-field-un:after, .fad.fa-truck-field-un:after {
+  content: "\e58e\e58e";
+}
+
+.fa-duotone.fa-nfc-trash:after, .fad.fa-nfc-trash:after {
+  content: "\e1fd\e1fd";
+}
+
+.fa-duotone.fa-hourglass-empty:after, .fa-duotone.fa-hourglass:after, .fad.fa-hourglass-empty:after, .fad.fa-hourglass:after {
+  content: "\f254\f254";
+}
+
+.fa-duotone.fa-mountain:after, .fad.fa-mountain:after {
+  content: "\f6fc\f6fc";
+}
+
+.fa-duotone.fa-file-times:after, .fa-duotone.fa-file-xmark:after, .fad.fa-file-times:after, .fad.fa-file-xmark:after {
+  content: "\f317\f317";
+}
+
+.fa-duotone.fa-home-heart:after, .fa-duotone.fa-house-heart:after, .fad.fa-home-heart:after, .fad.fa-house-heart:after {
+  content: "\f4c9\f4c9";
+}
+
+.fa-duotone.fa-house-chimney-blank:after, .fad.fa-house-chimney-blank:after {
+  content: "\e3b0\e3b0";
+}
+
+.fa-duotone.fa-meter-bolt:after, .fad.fa-meter-bolt:after {
+  content: "\e1e9\e1e9";
+}
+
+.fa-duotone.fa-user-doctor:after, .fa-duotone.fa-user-md:after, .fad.fa-user-doctor:after, .fad.fa-user-md:after {
+  content: "\f0f0\f0f0";
+}
+
+.fa-duotone.fa-slash-back:after, .fad.fa-slash-back:after {
+  content: "\5c\5c";
+}
+
+.fa-duotone.fa-circle-info:after, .fa-duotone.fa-info-circle:after, .fad.fa-circle-info:after, .fad.fa-info-circle:after {
+  content: "\f05a\f05a";
+}
+
+.fa-duotone.fa-fishing-rod:after, .fad.fa-fishing-rod:after {
+  content: "\e3a8\e3a8";
+}
+
+.fa-duotone.fa-hammer-crash:after, .fad.fa-hammer-crash:after {
+  content: "\e414\e414";
+}
+
+.fa-duotone.fa-message-heart:after, .fad.fa-message-heart:after {
+  content: "\e5c9\e5c9";
+}
+
+.fa-duotone.fa-cloud-meatball:after, .fad.fa-cloud-meatball:after {
+  content: "\f73b\f73b";
+}
+
+.fa-duotone.fa-camera-polaroid:after, .fad.fa-camera-polaroid:after {
+  content: "\f8aa\f8aa";
+}
+
+.fa-duotone.fa-camera-alt:after, .fa-duotone.fa-camera:after, .fad.fa-camera-alt:after, .fad.fa-camera:after {
+  content: "\f030\f030";
+}
+
+.fa-duotone.fa-square-virus:after, .fad.fa-square-virus:after {
+  content: "\e578\e578";
+}
+
+.fa-duotone.fa-cart-arrow-up:after, .fad.fa-cart-arrow-up:after {
+  content: "\e3ee\e3ee";
+}
+
+.fa-duotone.fa-meteor:after, .fad.fa-meteor:after {
+  content: "\f753\f753";
+}
+
+.fa-duotone.fa-car-on:after, .fad.fa-car-on:after {
+  content: "\e4dd\e4dd";
+}
+
+.fa-duotone.fa-sleigh:after, .fad.fa-sleigh:after {
+  content: "\f7cc\f7cc";
+}
+
+.fa-duotone.fa-arrow-down-1-9:after, .fa-duotone.fa-sort-numeric-asc:after, .fa-duotone.fa-sort-numeric-down:after, .fad.fa-arrow-down-1-9:after, .fad.fa-sort-numeric-asc:after, .fad.fa-sort-numeric-down:after {
+  content: "\f162\f162";
+}
+
+.fa-duotone.fa-buoy-mooring:after, .fad.fa-buoy-mooring:after {
+  content: "\e5b6\e5b6";
+}
+
+.fa-duotone.fa-square-4:after, .fad.fa-square-4:after {
+  content: "\e259\e259";
+}
+
+.fa-duotone.fa-hand-holding-droplet:after, .fa-duotone.fa-hand-holding-water:after, .fad.fa-hand-holding-droplet:after, .fad.fa-hand-holding-water:after {
+  content: "\f4c1\f4c1";
+}
+
+.fa-duotone.fa-file-eps:after, .fad.fa-file-eps:after {
+  content: "\e644\e644";
+}
+
+.fa-duotone.fa-tricycle-adult:after, .fad.fa-tricycle-adult:after {
+  content: "\e5c4\e5c4";
+}
+
+.fa-duotone.fa-waveform:after, .fad.fa-waveform:after {
+  content: "\f8f1\f8f1";
+}
+
+.fa-duotone.fa-water:after, .fad.fa-water:after {
+  content: "\f773\f773";
+}
+
+.fa-duotone.fa-star-sharp-half-alt:after, .fa-duotone.fa-star-sharp-half-stroke:after, .fad.fa-star-sharp-half-alt:after, .fad.fa-star-sharp-half-stroke:after {
+  content: "\e28d\e28d";
+}
+
+.fa-duotone.fa-nfc-signal:after, .fad.fa-nfc-signal:after {
+  content: "\e1fb\e1fb";
+}
+
+.fa-duotone.fa-plane-prop:after, .fad.fa-plane-prop:after {
+  content: "\e22b\e22b";
+}
+
+.fa-duotone.fa-calendar-check:after, .fad.fa-calendar-check:after {
+  content: "\f274\f274";
+}
+
+.fa-duotone.fa-clock-desk:after, .fad.fa-clock-desk:after {
+  content: "\e134\e134";
+}
+
+.fa-duotone.fa-calendar-clock:after, .fa-duotone.fa-calendar-time:after, .fad.fa-calendar-clock:after, .fad.fa-calendar-time:after {
+  content: "\e0d2\e0d2";
+}
+
+.fa-duotone.fa-braille:after, .fad.fa-braille:after {
+  content: "\f2a1\f2a1";
+}
+
+.fa-duotone.fa-prescription-bottle-alt:after, .fa-duotone.fa-prescription-bottle-medical:after, .fad.fa-prescription-bottle-alt:after, .fad.fa-prescription-bottle-medical:after {
+  content: "\f486\f486";
+}
+
+.fa-duotone.fa-plate-utensils:after, .fad.fa-plate-utensils:after {
+  content: "\e43b\e43b";
+}
+
+.fa-duotone.fa-family-pants:after, .fad.fa-family-pants:after {
+  content: "\e302\e302";
+}
+
+.fa-duotone.fa-hose-reel:after, .fad.fa-hose-reel:after {
+  content: "\e41a\e41a";
+}
+
+.fa-duotone.fa-house-window:after, .fad.fa-house-window:after {
+  content: "\e3b3\e3b3";
+}
+
+.fa-duotone.fa-landmark:after, .fad.fa-landmark:after {
+  content: "\f66f\f66f";
+}
+
+.fa-duotone.fa-truck:after, .fad.fa-truck:after {
+  content: "\f0d1\f0d1";
+}
+
+.fa-duotone.fa-music-magnifying-glass:after, .fad.fa-music-magnifying-glass:after {
+  content: "\e662\e662";
+}
+
+.fa-duotone.fa-crosshairs:after, .fad.fa-crosshairs:after {
+  content: "\f05b\f05b";
+}
+
+.fa-duotone.fa-cloud-rainbow:after, .fad.fa-cloud-rainbow:after {
+  content: "\f73e\f73e";
+}
+
+.fa-duotone.fa-person-cane:after, .fad.fa-person-cane:after {
+  content: "\e53c\e53c";
+}
+
+.fa-duotone.fa-alien:after, .fad.fa-alien:after {
+  content: "\f8f5\f8f5";
+}
+
+.fa-duotone.fa-tent:after, .fad.fa-tent:after {
+  content: "\e57d\e57d";
+}
+
+.fa-duotone.fa-laptop-binary:after, .fad.fa-laptop-binary:after {
+  content: "\e5e7\e5e7";
+}
+
+.fa-duotone.fa-vest-patches:after, .fad.fa-vest-patches:after {
+  content: "\e086\e086";
+}
+
+.fa-duotone.fa-people-dress-simple:after, .fad.fa-people-dress-simple:after {
+  content: "\e218\e218";
+}
+
+.fa-duotone.fa-check-double:after, .fad.fa-check-double:after {
+  content: "\f560\f560";
+}
+
+.fa-duotone.fa-arrow-down-a-z:after, .fa-duotone.fa-sort-alpha-asc:after, .fa-duotone.fa-sort-alpha-down:after, .fad.fa-arrow-down-a-z:after, .fad.fa-sort-alpha-asc:after, .fad.fa-sort-alpha-down:after {
+  content: "\f15d\f15d";
+}
+
+.fa-duotone.fa-bowling-ball-pin:after, .fad.fa-bowling-ball-pin:after {
+  content: "\e0c3\e0c3";
+}
+
+.fa-duotone.fa-bell-school-slash:after, .fad.fa-bell-school-slash:after {
+  content: "\f5d6\f5d6";
+}
+
+.fa-duotone.fa-plus-large:after, .fad.fa-plus-large:after {
+  content: "\e59e\e59e";
+}
+
+.fa-duotone.fa-money-bill-wheat:after, .fad.fa-money-bill-wheat:after {
+  content: "\e52a\e52a";
+}
+
+.fa-duotone.fa-camera-viewfinder:after, .fa-duotone.fa-screenshot:after, .fad.fa-camera-viewfinder:after, .fad.fa-screenshot:after {
+  content: "\e0da\e0da";
+}
+
+.fa-duotone.fa-comment-alt-music:after, .fa-duotone.fa-message-music:after, .fad.fa-comment-alt-music:after, .fad.fa-message-music:after {
+  content: "\f8af\f8af";
+}
+
+.fa-duotone.fa-car-building:after, .fad.fa-car-building:after {
+  content: "\f859\f859";
+}
+
+.fa-duotone.fa-border-bottom-right:after, .fa-duotone.fa-border-style-alt:after, .fad.fa-border-bottom-right:after, .fad.fa-border-style-alt:after {
+  content: "\f854\f854";
+}
+
+.fa-duotone.fa-octagon:after, .fad.fa-octagon:after {
+  content: "\f306\f306";
+}
+
+.fa-duotone.fa-comment-arrow-up-right:after, .fad.fa-comment-arrow-up-right:after {
+  content: "\e145\e145";
+}
+
+.fa-duotone.fa-octagon-divide:after, .fad.fa-octagon-divide:after {
+  content: "\e203\e203";
+}
+
+.fa-duotone.fa-cookie:after, .fad.fa-cookie:after {
+  content: "\f563\f563";
+}
+
+.fa-duotone.fa-arrow-left-rotate:after, .fa-duotone.fa-arrow-rotate-back:after, .fa-duotone.fa-arrow-rotate-backward:after, .fa-duotone.fa-arrow-rotate-left:after, .fa-duotone.fa-undo:after, .fad.fa-arrow-left-rotate:after, .fad.fa-arrow-rotate-back:after, .fad.fa-arrow-rotate-backward:after, .fad.fa-arrow-rotate-left:after, .fad.fa-undo:after {
+  content: "\f0e2\f0e2";
+}
+
+.fa-duotone.fa-tv-music:after, .fad.fa-tv-music:after {
+  content: "\f8e6\f8e6";
+}
+
+.fa-duotone.fa-hard-drive:after, .fa-duotone.fa-hdd:after, .fad.fa-hard-drive:after, .fad.fa-hdd:after {
+  content: "\f0a0\f0a0";
+}
+
+.fa-duotone.fa-reel:after, .fad.fa-reel:after {
+  content: "\e238\e238";
+}
+
+.fa-duotone.fa-face-grin-squint-tears:after, .fa-duotone.fa-grin-squint-tears:after, .fad.fa-face-grin-squint-tears:after, .fad.fa-grin-squint-tears:after {
+  content: "\f586\f586";
+}
+
+.fa-duotone.fa-dumbbell:after, .fad.fa-dumbbell:after {
+  content: "\f44b\f44b";
+}
+
+.fa-duotone.fa-list-alt:after, .fa-duotone.fa-rectangle-list:after, .fad.fa-list-alt:after, .fad.fa-rectangle-list:after {
+  content: "\f022\f022";
+}
+
+.fa-duotone.fa-tarp-droplet:after, .fad.fa-tarp-droplet:after {
+  content: "\e57c\e57c";
+}
+
+.fa-duotone.fa-alarm-exclamation:after, .fad.fa-alarm-exclamation:after {
+  content: "\f843\f843";
+}
+
+.fa-duotone.fa-house-medical-circle-check:after, .fad.fa-house-medical-circle-check:after {
+  content: "\e511\e511";
+}
+
+.fa-duotone.fa-traffic-cone:after, .fad.fa-traffic-cone:after {
+  content: "\f636\f636";
+}
+
+.fa-duotone.fa-grate:after, .fad.fa-grate:after {
+  content: "\e193\e193";
+}
+
+.fa-duotone.fa-arrow-down-right:after, .fad.fa-arrow-down-right:after {
+  content: "\e093\e093";
+}
+
+.fa-duotone.fa-person-skiing-nordic:after, .fa-duotone.fa-skiing-nordic:after, .fad.fa-person-skiing-nordic:after, .fad.fa-skiing-nordic:after {
+  content: "\f7ca\f7ca";
+}
+
+.fa-duotone.fa-calendar-plus:after, .fad.fa-calendar-plus:after {
+  content: "\f271\f271";
+}
+
+.fa-duotone.fa-person-from-portal:after, .fa-duotone.fa-portal-exit:after, .fad.fa-person-from-portal:after, .fad.fa-portal-exit:after {
+  content: "\e023\e023";
+}
+
+.fa-duotone.fa-plane-arrival:after, .fad.fa-plane-arrival:after {
+  content: "\f5af\f5af";
+}
+
+.fa-duotone.fa-cowbell-circle-plus:after, .fa-duotone.fa-cowbell-more:after, .fad.fa-cowbell-circle-plus:after, .fad.fa-cowbell-more:after {
+  content: "\f8b4\f8b4";
+}
+
+.fa-duotone.fa-arrow-alt-circle-left:after, .fa-duotone.fa-circle-left:after, .fad.fa-arrow-alt-circle-left:after, .fad.fa-circle-left:after {
+  content: "\f359\f359";
+}
+
+.fa-duotone.fa-distribute-spacing-vertical:after, .fad.fa-distribute-spacing-vertical:after {
+  content: "\e366\e366";
+}
+
+.fa-duotone.fa-signal-alt-2:after, .fa-duotone.fa-signal-bars-fair:after, .fad.fa-signal-alt-2:after, .fad.fa-signal-bars-fair:after {
+  content: "\f692\f692";
+}
+
+.fa-duotone.fa-sportsball:after, .fad.fa-sportsball:after {
+  content: "\e44b\e44b";
+}
+
+.fa-duotone.fa-game-console-handheld-crank:after, .fad.fa-game-console-handheld-crank:after {
+  content: "\e5b9\e5b9";
+}
+
+.fa-duotone.fa-subway:after, .fa-duotone.fa-train-subway:after, .fad.fa-subway:after, .fad.fa-train-subway:after {
+  content: "\f239\f239";
+}
+
+.fa-duotone.fa-chart-gantt:after, .fad.fa-chart-gantt:after {
+  content: "\e0e4\e0e4";
+}
+
+.fa-duotone.fa-face-smile-upside-down:after, .fad.fa-face-smile-upside-down:after {
+  content: "\e395\e395";
+}
+
+.fa-duotone.fa-ball-pile:after, .fad.fa-ball-pile:after {
+  content: "\f77e\f77e";
+}
+
+.fa-duotone.fa-badge-dollar:after, .fad.fa-badge-dollar:after {
+  content: "\f645\f645";
+}
+
+.fa-duotone.fa-money-bills-alt:after, .fa-duotone.fa-money-bills-simple:after, .fad.fa-money-bills-alt:after, .fad.fa-money-bills-simple:after {
+  content: "\e1f4\e1f4";
+}
+
+.fa-duotone.fa-list-timeline:after, .fad.fa-list-timeline:after {
+  content: "\e1d1\e1d1";
+}
+
+.fa-duotone.fa-indian-rupee-sign:after, .fa-duotone.fa-indian-rupee:after, .fa-duotone.fa-inr:after, .fad.fa-indian-rupee-sign:after, .fad.fa-indian-rupee:after, .fad.fa-inr:after {
+  content: "\e1bc\e1bc";
+}
+
+.fa-duotone.fa-crop-alt:after, .fa-duotone.fa-crop-simple:after, .fad.fa-crop-alt:after, .fad.fa-crop-simple:after {
+  content: "\f565\f565";
+}
+
+.fa-duotone.fa-money-bill-1:after, .fa-duotone.fa-money-bill-alt:after, .fad.fa-money-bill-1:after, .fad.fa-money-bill-alt:after {
+  content: "\f3d1\f3d1";
+}
+
+.fa-duotone.fa-left-long:after, .fa-duotone.fa-long-arrow-alt-left:after, .fad.fa-left-long:after, .fad.fa-long-arrow-alt-left:after {
+  content: "\f30a\f30a";
+}
+
+.fa-duotone.fa-keyboard-down:after, .fad.fa-keyboard-down:after {
+  content: "\e1c2\e1c2";
+}
+
+.fa-duotone.fa-circle-up-right:after, .fad.fa-circle-up-right:after {
+  content: "\e129\e129";
+}
+
+.fa-duotone.fa-cloud-bolt-moon:after, .fa-duotone.fa-thunderstorm-moon:after, .fad.fa-cloud-bolt-moon:after, .fad.fa-thunderstorm-moon:after {
+  content: "\f76d\f76d";
+}
+
+.fa-duotone.fa-turn-left-up:after, .fad.fa-turn-left-up:after {
+  content: "\e638\e638";
+}
+
+.fa-duotone.fa-dna:after, .fad.fa-dna:after {
+  content: "\f471\f471";
+}
+
+.fa-duotone.fa-virus-slash:after, .fad.fa-virus-slash:after {
+  content: "\e075\e075";
+}
+
+.fa-duotone.fa-bracket-round-right:after, .fad.fa-bracket-round-right:after {
+  content: "\29\29";
+}
+
+.fa-duotone.fa-circle-sterling:after, .fad.fa-circle-sterling:after {
+  content: "\e5cf\e5cf";
+}
+
+.fa-duotone.fa-circle-5:after, .fad.fa-circle-5:after {
+  content: "\e0f2\e0f2";
+}
+
+.fa-duotone.fa-minus:after, .fa-duotone.fa-subtract:after, .fad.fa-minus:after, .fad.fa-subtract:after {
+  content: "\f068\f068";
+}
+
+.fa-duotone.fa-fire-flame:after, .fa-duotone.fa-flame:after, .fad.fa-fire-flame:after, .fad.fa-flame:after {
+  content: "\f6df\f6df";
+}
+
+.fa-duotone.fa-arrow-alt-to-right:after, .fa-duotone.fa-right-to-line:after, .fad.fa-arrow-alt-to-right:after, .fad.fa-right-to-line:after {
+  content: "\f34c\f34c";
+}
+
+.fa-duotone.fa-gif:after, .fad.fa-gif:after {
+  content: "\e190\e190";
+}
+
+.fa-duotone.fa-chess:after, .fad.fa-chess:after {
+  content: "\f439\f439";
+}
+
+.fa-duotone.fa-trash-slash:after, .fad.fa-trash-slash:after {
+  content: "\e2b3\e2b3";
+}
+
+.fa-duotone.fa-arrow-left-long:after, .fa-duotone.fa-long-arrow-left:after, .fad.fa-arrow-left-long:after, .fad.fa-long-arrow-left:after {
+  content: "\f177\f177";
+}
+
+.fa-duotone.fa-plug-circle-check:after, .fad.fa-plug-circle-check:after {
+  content: "\e55c\e55c";
+}
+
+.fa-duotone.fa-font-case:after, .fad.fa-font-case:after {
+  content: "\f866\f866";
+}
+
+.fa-duotone.fa-street-view:after, .fad.fa-street-view:after {
+  content: "\f21d\f21d";
+}
+
+.fa-duotone.fa-arrow-down-left:after, .fad.fa-arrow-down-left:after {
+  content: "\e091\e091";
+}
+
+.fa-duotone.fa-franc-sign:after, .fad.fa-franc-sign:after {
+  content: "\e18f\e18f";
+}
+
+.fa-duotone.fa-flask-poison:after, .fa-duotone.fa-flask-round-poison:after, .fad.fa-flask-poison:after, .fad.fa-flask-round-poison:after {
+  content: "\f6e0\f6e0";
+}
+
+.fa-duotone.fa-volume-off:after, .fad.fa-volume-off:after {
+  content: "\f026\f026";
+}
+
+.fa-duotone.fa-book-circle-arrow-right:after, .fad.fa-book-circle-arrow-right:after {
+  content: "\e0bc\e0bc";
+}
+
+.fa-duotone.fa-chart-user:after, .fa-duotone.fa-user-chart:after, .fad.fa-chart-user:after, .fad.fa-user-chart:after {
+  content: "\f6a3\f6a3";
+}
+
+.fa-duotone.fa-american-sign-language-interpreting:after, .fa-duotone.fa-asl-interpreting:after, .fa-duotone.fa-hands-american-sign-language-interpreting:after, .fa-duotone.fa-hands-asl-interpreting:after, .fad.fa-american-sign-language-interpreting:after, .fad.fa-asl-interpreting:after, .fad.fa-hands-american-sign-language-interpreting:after, .fad.fa-hands-asl-interpreting:after {
+  content: "\f2a3\f2a3";
+}
+
+.fa-duotone.fa-presentation-screen:after, .fa-duotone.fa-presentation:after, .fad.fa-presentation-screen:after, .fad.fa-presentation:after {
+  content: "\f685\f685";
+}
+
+.fa-duotone.fa-circle-bolt:after, .fad.fa-circle-bolt:after {
+  content: "\e0fe\e0fe";
+}
+
+.fa-duotone.fa-face-smile-halo:after, .fad.fa-face-smile-halo:after {
+  content: "\e38f\e38f";
+}
+
+.fa-duotone.fa-cart-circle-arrow-down:after, .fad.fa-cart-circle-arrow-down:after {
+  content: "\e3ef\e3ef";
+}
+
+.fa-duotone.fa-house-person-arrive:after, .fa-duotone.fa-house-person-return:after, .fa-duotone.fa-house-return:after, .fad.fa-house-person-arrive:after, .fad.fa-house-person-return:after, .fad.fa-house-return:after {
+  content: "\e011\e011";
+}
+
+.fa-duotone.fa-comment-alt-times:after, .fa-duotone.fa-message-times:after, .fa-duotone.fa-message-xmark:after, .fad.fa-comment-alt-times:after, .fad.fa-message-times:after, .fad.fa-message-xmark:after {
+  content: "\f4ab\f4ab";
+}
+
+.fa-duotone.fa-file-award:after, .fa-duotone.fa-file-certificate:after, .fad.fa-file-award:after, .fad.fa-file-certificate:after {
+  content: "\f5f3\f5f3";
+}
+
+.fa-duotone.fa-user-doctor-hair-long:after, .fad.fa-user-doctor-hair-long:after {
+  content: "\e459\e459";
+}
+
+.fa-duotone.fa-camera-home:after, .fa-duotone.fa-camera-security:after, .fad.fa-camera-home:after, .fad.fa-camera-security:after {
+  content: "\f8fe\f8fe";
+}
+
+.fa-duotone.fa-cog:after, .fa-duotone.fa-gear:after, .fad.fa-cog:after, .fad.fa-gear:after {
+  content: "\f013\f013";
+}
+
+.fa-duotone.fa-droplet-slash:after, .fa-duotone.fa-tint-slash:after, .fad.fa-droplet-slash:after, .fad.fa-tint-slash:after {
+  content: "\f5c7\f5c7";
+}
+
+.fa-duotone.fa-book-heart:after, .fad.fa-book-heart:after {
+  content: "\f499\f499";
+}
+
+.fa-duotone.fa-mosque:after, .fad.fa-mosque:after {
+  content: "\f678\f678";
+}
+
+.fa-duotone.fa-duck:after, .fad.fa-duck:after {
+  content: "\f6d8\f6d8";
+}
+
+.fa-duotone.fa-mosquito:after, .fad.fa-mosquito:after {
+  content: "\e52b\e52b";
+}
+
+.fa-duotone.fa-star-of-david:after, .fad.fa-star-of-david:after {
+  content: "\f69a\f69a";
+}
+
+.fa-duotone.fa-flag-alt:after, .fa-duotone.fa-flag-swallowtail:after, .fad.fa-flag-alt:after, .fad.fa-flag-swallowtail:after {
+  content: "\f74c\f74c";
+}
+
+.fa-duotone.fa-person-military-rifle:after, .fad.fa-person-military-rifle:after {
+  content: "\e54b\e54b";
+}
+
+.fa-duotone.fa-car-garage:after, .fad.fa-car-garage:after {
+  content: "\f5e2\f5e2";
+}
+
+.fa-duotone.fa-cart-shopping:after, .fa-duotone.fa-shopping-cart:after, .fad.fa-cart-shopping:after, .fad.fa-shopping-cart:after {
+  content: "\f07a\f07a";
+}
+
+.fa-duotone.fa-book-font:after, .fad.fa-book-font:after {
+  content: "\e0bf\e0bf";
+}
+
+.fa-duotone.fa-shield-plus:after, .fad.fa-shield-plus:after {
+  content: "\e24a\e24a";
+}
+
+.fa-duotone.fa-vials:after, .fad.fa-vials:after {
+  content: "\f493\f493";
+}
+
+.fa-duotone.fa-eye-dropper-full:after, .fad.fa-eye-dropper-full:after {
+  content: "\e172\e172";
+}
+
+.fa-duotone.fa-distribute-spacing-horizontal:after, .fad.fa-distribute-spacing-horizontal:after {
+  content: "\e365\e365";
+}
+
+.fa-duotone.fa-tablet-rugged:after, .fad.fa-tablet-rugged:after {
+  content: "\f48f\f48f";
+}
+
+.fa-duotone.fa-temperature-frigid:after, .fa-duotone.fa-temperature-snow:after, .fad.fa-temperature-frigid:after, .fad.fa-temperature-snow:after {
+  content: "\f768\f768";
+}
+
+.fa-duotone.fa-moped:after, .fad.fa-moped:after {
+  content: "\e3b9\e3b9";
+}
+
+.fa-duotone.fa-face-smile-plus:after, .fa-duotone.fa-smile-plus:after, .fad.fa-face-smile-plus:after, .fad.fa-smile-plus:after {
+  content: "\f5b9\f5b9";
+}
+
+.fa-duotone.fa-radio-alt:after, .fa-duotone.fa-radio-tuner:after, .fad.fa-radio-alt:after, .fad.fa-radio-tuner:after {
+  content: "\f8d8\f8d8";
+}
+
+.fa-duotone.fa-face-swear:after, .fad.fa-face-swear:after {
+  content: "\e399\e399";
+}
+
+.fa-duotone.fa-water-arrow-down:after, .fa-duotone.fa-water-lower:after, .fad.fa-water-arrow-down:after, .fad.fa-water-lower:after {
+  content: "\f774\f774";
+}
+
+.fa-duotone.fa-scanner-touchscreen:after, .fad.fa-scanner-touchscreen:after {
+  content: "\f48a\f48a";
+}
+
+.fa-duotone.fa-circle-7:after, .fad.fa-circle-7:after {
+  content: "\e0f4\e0f4";
+}
+
+.fa-duotone.fa-plug-circle-plus:after, .fad.fa-plug-circle-plus:after {
+  content: "\e55f\e55f";
+}
+
+.fa-duotone.fa-person-ski-jumping:after, .fa-duotone.fa-ski-jump:after, .fad.fa-person-ski-jumping:after, .fad.fa-ski-jump:after {
+  content: "\f7c7\f7c7";
+}
+
+.fa-duotone.fa-place-of-worship:after, .fad.fa-place-of-worship:after {
+  content: "\f67f\f67f";
+}
+
+.fa-duotone.fa-water-arrow-up:after, .fa-duotone.fa-water-rise:after, .fad.fa-water-arrow-up:after, .fad.fa-water-rise:after {
+  content: "\f775\f775";
+}
+
+.fa-duotone.fa-waveform-lines:after, .fa-duotone.fa-waveform-path:after, .fad.fa-waveform-lines:after, .fad.fa-waveform-path:after {
+  content: "\f8f2\f8f2";
+}
+
+.fa-duotone.fa-split:after, .fad.fa-split:after {
+  content: "\e254\e254";
+}
+
+.fa-duotone.fa-film-canister:after, .fa-duotone.fa-film-cannister:after, .fad.fa-film-canister:after, .fad.fa-film-cannister:after {
+  content: "\f8b7\f8b7";
+}
+
+.fa-duotone.fa-folder-times:after, .fa-duotone.fa-folder-xmark:after, .fad.fa-folder-times:after, .fad.fa-folder-xmark:after {
+  content: "\f65f\f65f";
+}
+
+.fa-duotone.fa-toilet-paper-alt:after, .fa-duotone.fa-toilet-paper-blank:after, .fad.fa-toilet-paper-alt:after, .fad.fa-toilet-paper-blank:after {
+  content: "\f71f\f71f";
+}
+
+.fa-duotone.fa-tablet-android-alt:after, .fa-duotone.fa-tablet-screen:after, .fad.fa-tablet-android-alt:after, .fad.fa-tablet-screen:after {
+  content: "\f3fc\f3fc";
+}
+
+.fa-duotone.fa-hexagon-vertical-nft-slanted:after, .fad.fa-hexagon-vertical-nft-slanted:after {
+  content: "\e506\e506";
+}
+
+.fa-duotone.fa-folder-music:after, .fad.fa-folder-music:after {
+  content: "\e18d\e18d";
+}
+
+.fa-duotone.fa-desktop-medical:after, .fa-duotone.fa-display-medical:after, .fad.fa-desktop-medical:after, .fad.fa-display-medical:after {
+  content: "\e166\e166";
+}
+
+.fa-duotone.fa-share-all:after, .fad.fa-share-all:after {
+  content: "\f367\f367";
+}
+
+.fa-duotone.fa-peapod:after, .fad.fa-peapod:after {
+  content: "\e31c\e31c";
+}
+
+.fa-duotone.fa-chess-clock:after, .fad.fa-chess-clock:after {
+  content: "\f43d\f43d";
+}
+
+.fa-duotone.fa-axe:after, .fad.fa-axe:after {
+  content: "\f6b2\f6b2";
+}
+
+.fa-duotone.fa-square-d:after, .fad.fa-square-d:after {
+  content: "\e268\e268";
+}
+
+.fa-duotone.fa-grip-vertical:after, .fad.fa-grip-vertical:after {
+  content: "\f58e\f58e";
+}
+
+.fa-duotone.fa-mobile-signal-out:after, .fad.fa-mobile-signal-out:after {
+  content: "\e1f0\e1f0";
+}
+
+.fa-duotone.fa-arrow-turn-up:after, .fa-duotone.fa-level-up:after, .fad.fa-arrow-turn-up:after, .fad.fa-level-up:after {
+  content: "\f148\f148";
+}
+
+.fa-duotone.fa-u:after, .fad.fa-u:after {
+  content: "\55\55";
+}
+
+.fa-duotone.fa-arrow-up-from-dotted-line:after, .fad.fa-arrow-up-from-dotted-line:after {
+  content: "\e09b\e09b";
+}
+
+.fa-duotone.fa-square-root-alt:after, .fa-duotone.fa-square-root-variable:after, .fad.fa-square-root-alt:after, .fad.fa-square-root-variable:after {
+  content: "\f698\f698";
+}
+
+.fa-duotone.fa-light-switch-on:after, .fad.fa-light-switch-on:after {
+  content: "\e019\e019";
+}
+
+.fa-duotone.fa-arrow-down-arrow-up:after, .fa-duotone.fa-sort-alt:after, .fad.fa-arrow-down-arrow-up:after, .fad.fa-sort-alt:after {
+  content: "\f883\f883";
+}
+
+.fa-duotone.fa-raindrops:after, .fad.fa-raindrops:after {
+  content: "\f75c\f75c";
+}
+
+.fa-duotone.fa-dash:after, .fa-duotone.fa-minus-large:after, .fad.fa-dash:after, .fad.fa-minus-large:after {
+  content: "\e404\e404";
+}
+
+.fa-duotone.fa-clock-four:after, .fa-duotone.fa-clock:after, .fad.fa-clock-four:after, .fad.fa-clock:after {
+  content: "\f017\f017";
+}
+
+.fa-duotone.fa-input-numeric:after, .fad.fa-input-numeric:after {
+  content: "\e1bd\e1bd";
+}
+
+.fa-duotone.fa-truck-tow:after, .fad.fa-truck-tow:after {
+  content: "\e2b8\e2b8";
+}
+
+.fa-duotone.fa-backward-step:after, .fa-duotone.fa-step-backward:after, .fad.fa-backward-step:after, .fad.fa-step-backward:after {
+  content: "\f048\f048";
+}
+
+.fa-duotone.fa-pallet:after, .fad.fa-pallet:after {
+  content: "\f482\f482";
+}
+
+.fa-duotone.fa-car-bolt:after, .fad.fa-car-bolt:after {
+  content: "\e341\e341";
+}
+
+.fa-duotone.fa-arrows-maximize:after, .fa-duotone.fa-expand-arrows:after, .fad.fa-arrows-maximize:after, .fad.fa-expand-arrows:after {
+  content: "\f31d\f31d";
+}
+
+.fa-duotone.fa-faucet:after, .fad.fa-faucet:after {
+  content: "\e005\e005";
+}
+
+.fa-duotone.fa-cloud-sleet:after, .fad.fa-cloud-sleet:after {
+  content: "\f741\f741";
+}
+
+.fa-duotone.fa-lamp-street:after, .fad.fa-lamp-street:after {
+  content: "\e1c5\e1c5";
+}
+
+.fa-duotone.fa-list-radio:after, .fad.fa-list-radio:after {
+  content: "\e1d0\e1d0";
+}
+
+.fa-duotone.fa-pen-nib-slash:after, .fad.fa-pen-nib-slash:after {
+  content: "\e4a1\e4a1";
+}
+
+.fa-duotone.fa-baseball-bat-ball:after, .fad.fa-baseball-bat-ball:after {
+  content: "\f432\f432";
+}
+
+.fa-duotone.fa-square-up-left:after, .fad.fa-square-up-left:after {
+  content: "\e282\e282";
+}
+
+.fa-duotone.fa-overline:after, .fad.fa-overline:after {
+  content: "\f876\f876";
+}
+
+.fa-duotone.fa-s:after, .fad.fa-s:after {
+  content: "\53\53";
+}
+
+.fa-duotone.fa-timeline:after, .fad.fa-timeline:after {
+  content: "\e29c\e29c";
+}
+
+.fa-duotone.fa-keyboard:after, .fad.fa-keyboard:after {
+  content: "\f11c\f11c";
+}
+
+.fa-duotone.fa-arrows-from-dotted-line:after, .fad.fa-arrows-from-dotted-line:after {
+  content: "\e0a3\e0a3";
+}
+
+.fa-duotone.fa-usb-drive:after, .fad.fa-usb-drive:after {
+  content: "\f8e9\f8e9";
+}
+
+.fa-duotone.fa-ballot:after, .fad.fa-ballot:after {
+  content: "\f732\f732";
+}
+
+.fa-duotone.fa-caret-down:after, .fad.fa-caret-down:after {
+  content: "\f0d7\f0d7";
+}
+
+.fa-duotone.fa-location-dot-slash:after, .fa-duotone.fa-map-marker-alt-slash:after, .fad.fa-location-dot-slash:after, .fad.fa-map-marker-alt-slash:after {
+  content: "\f605\f605";
+}
+
+.fa-duotone.fa-cards:after, .fad.fa-cards:after {
+  content: "\e3ed\e3ed";
+}
+
+.fa-duotone.fa-clinic-medical:after, .fa-duotone.fa-house-chimney-medical:after, .fad.fa-clinic-medical:after, .fad.fa-house-chimney-medical:after {
+  content: "\f7f2\f7f2";
+}
+
+.fa-duotone.fa-boxing-glove:after, .fa-duotone.fa-glove-boxing:after, .fad.fa-boxing-glove:after, .fad.fa-glove-boxing:after {
+  content: "\f438\f438";
+}
+
+.fa-duotone.fa-temperature-3:after, .fa-duotone.fa-temperature-three-quarters:after, .fa-duotone.fa-thermometer-3:after, .fa-duotone.fa-thermometer-three-quarters:after, .fad.fa-temperature-3:after, .fad.fa-temperature-three-quarters:after, .fad.fa-thermometer-3:after, .fad.fa-thermometer-three-quarters:after {
+  content: "\f2c8\f2c8";
+}
+
+.fa-duotone.fa-bell-school:after, .fad.fa-bell-school:after {
+  content: "\f5d5\f5d5";
+}
+
+.fa-duotone.fa-mobile-android-alt:after, .fa-duotone.fa-mobile-screen:after, .fad.fa-mobile-android-alt:after, .fad.fa-mobile-screen:after {
+  content: "\f3cf\f3cf";
+}
+
+.fa-duotone.fa-plane-up:after, .fad.fa-plane-up:after {
+  content: "\e22d\e22d";
+}
+
+.fa-duotone.fa-folder-heart:after, .fad.fa-folder-heart:after {
+  content: "\e189\e189";
+}
+
+.fa-duotone.fa-circle-location-arrow:after, .fa-duotone.fa-location-circle:after, .fad.fa-circle-location-arrow:after, .fad.fa-location-circle:after {
+  content: "\f602\f602";
+}
+
+.fa-duotone.fa-face-head-bandage:after, .fad.fa-face-head-bandage:after {
+  content: "\e37a\e37a";
+}
+
+.fa-duotone.fa-maki-roll:after, .fa-duotone.fa-makizushi:after, .fa-duotone.fa-sushi-roll:after, .fad.fa-maki-roll:after, .fad.fa-makizushi:after, .fad.fa-sushi-roll:after {
+  content: "\e48b\e48b";
+}
+
+.fa-duotone.fa-car-bump:after, .fad.fa-car-bump:after {
+  content: "\f5e0\f5e0";
+}
+
+.fa-duotone.fa-piggy-bank:after, .fad.fa-piggy-bank:after {
+  content: "\f4d3\f4d3";
+}
+
+.fa-duotone.fa-racquet:after, .fad.fa-racquet:after {
+  content: "\f45a\f45a";
+}
+
+.fa-duotone.fa-car-mirrors:after, .fad.fa-car-mirrors:after {
+  content: "\e343\e343";
+}
+
+.fa-duotone.fa-industry-alt:after, .fa-duotone.fa-industry-windows:after, .fad.fa-industry-alt:after, .fad.fa-industry-windows:after {
+  content: "\f3b3\f3b3";
+}
+
+.fa-duotone.fa-bolt-auto:after, .fad.fa-bolt-auto:after {
+  content: "\e0b6\e0b6";
+}
+
+.fa-duotone.fa-battery-3:after, .fa-duotone.fa-battery-half:after, .fad.fa-battery-3:after, .fad.fa-battery-half:after {
+  content: "\f242\f242";
+}
+
+.fa-duotone.fa-flux-capacitor:after, .fad.fa-flux-capacitor:after {
+  content: "\f8ba\f8ba";
+}
+
+.fa-duotone.fa-mountain-city:after, .fad.fa-mountain-city:after {
+  content: "\e52e\e52e";
+}
+
+.fa-duotone.fa-coins:after, .fad.fa-coins:after {
+  content: "\f51e\f51e";
+}
+
+.fa-duotone.fa-honey-pot:after, .fad.fa-honey-pot:after {
+  content: "\e418\e418";
+}
+
+.fa-duotone.fa-olive:after, .fad.fa-olive:after {
+  content: "\e316\e316";
+}
+
+.fa-duotone.fa-khanda:after, .fad.fa-khanda:after {
+  content: "\f66d\f66d";
+}
+
+.fa-duotone.fa-filter-list:after, .fad.fa-filter-list:after {
+  content: "\e17c\e17c";
+}
+
+.fa-duotone.fa-outlet:after, .fad.fa-outlet:after {
+  content: "\e01c\e01c";
+}
+
+.fa-duotone.fa-sliders-h:after, .fa-duotone.fa-sliders:after, .fad.fa-sliders-h:after, .fad.fa-sliders:after {
+  content: "\f1de\f1de";
+}
+
+.fa-duotone.fa-cauldron:after, .fad.fa-cauldron:after {
+  content: "\f6bf\f6bf";
+}
+
+.fa-duotone.fa-people:after, .fad.fa-people:after {
+  content: "\e216\e216";
+}
+
+.fa-duotone.fa-folder-tree:after, .fad.fa-folder-tree:after {
+  content: "\f802\f802";
+}
+
+.fa-duotone.fa-network-wired:after, .fad.fa-network-wired:after {
+  content: "\f6ff\f6ff";
+}
+
+.fa-duotone.fa-croissant:after, .fad.fa-croissant:after {
+  content: "\f7f6\f7f6";
+}
+
+.fa-duotone.fa-map-pin:after, .fad.fa-map-pin:after {
+  content: "\f276\f276";
+}
+
+.fa-duotone.fa-hamsa:after, .fad.fa-hamsa:after {
+  content: "\f665\f665";
+}
+
+.fa-duotone.fa-cent-sign:after, .fad.fa-cent-sign:after {
+  content: "\e3f5\e3f5";
+}
+
+.fa-duotone.fa-swords-laser:after, .fad.fa-swords-laser:after {
+  content: "\e03d\e03d";
+}
+
+.fa-duotone.fa-flask:after, .fad.fa-flask:after {
+  content: "\f0c3\f0c3";
+}
+
+.fa-duotone.fa-person-pregnant:after, .fad.fa-person-pregnant:after {
+  content: "\e31e\e31e";
+}
+
+.fa-duotone.fa-square-u:after, .fad.fa-square-u:after {
+  content: "\e281\e281";
+}
+
+.fa-duotone.fa-wand-sparkles:after, .fad.fa-wand-sparkles:after {
+  content: "\f72b\f72b";
+}
+
+.fa-duotone.fa-router:after, .fad.fa-router:after {
+  content: "\f8da\f8da";
+}
+
+.fa-duotone.fa-ellipsis-v:after, .fa-duotone.fa-ellipsis-vertical:after, .fad.fa-ellipsis-v:after, .fad.fa-ellipsis-vertical:after {
+  content: "\f142\f142";
+}
+
+.fa-duotone.fa-sword-laser-alt:after, .fad.fa-sword-laser-alt:after {
+  content: "\e03c\e03c";
+}
+
+.fa-duotone.fa-ticket:after, .fad.fa-ticket:after {
+  content: "\f145\f145";
+}
+
+.fa-duotone.fa-power-off:after, .fad.fa-power-off:after {
+  content: "\f011\f011";
+}
+
+.fa-duotone.fa-coin:after, .fad.fa-coin:after {
+  content: "\f85c\f85c";
+}
+
+.fa-duotone.fa-laptop-slash:after, .fad.fa-laptop-slash:after {
+  content: "\e1c7\e1c7";
+}
+
+.fa-duotone.fa-long-arrow-alt-right:after, .fa-duotone.fa-right-long:after, .fad.fa-long-arrow-alt-right:after, .fad.fa-right-long:after {
+  content: "\f30b\f30b";
+}
+
+.fa-duotone.fa-circle-b:after, .fad.fa-circle-b:after {
+  content: "\e0fd\e0fd";
+}
+
+.fa-duotone.fa-person-dress-simple:after, .fad.fa-person-dress-simple:after {
+  content: "\e21c\e21c";
+}
+
+.fa-duotone.fa-pipe-collar:after, .fad.fa-pipe-collar:after {
+  content: "\e437\e437";
+}
+
+.fa-duotone.fa-lights-holiday:after, .fad.fa-lights-holiday:after {
+  content: "\f7b2\f7b2";
+}
+
+.fa-duotone.fa-citrus:after, .fad.fa-citrus:after {
+  content: "\e2f4\e2f4";
+}
+
+.fa-duotone.fa-flag-usa:after, .fad.fa-flag-usa:after {
+  content: "\f74d\f74d";
+}
+
+.fa-duotone.fa-laptop-file:after, .fad.fa-laptop-file:after {
+  content: "\e51d\e51d";
+}
+
+.fa-duotone.fa-teletype:after, .fa-duotone.fa-tty:after, .fad.fa-teletype:after, .fad.fa-tty:after {
+  content: "\f1e4\f1e4";
+}
+
+.fa-duotone.fa-chart-tree-map:after, .fad.fa-chart-tree-map:after {
+  content: "\e0ea\e0ea";
+}
+
+.fa-duotone.fa-diagram-next:after, .fad.fa-diagram-next:after {
+  content: "\e476\e476";
+}
+
+.fa-duotone.fa-person-rifle:after, .fad.fa-person-rifle:after {
+  content: "\e54e\e54e";
+}
+
+.fa-duotone.fa-clock-five-thirty:after, .fad.fa-clock-five-thirty:after {
+  content: "\e34a\e34a";
+}
+
+.fa-duotone.fa-pipe-valve:after, .fad.fa-pipe-valve:after {
+  content: "\e439\e439";
+}
+
+.fa-duotone.fa-arrow-up-from-arc:after, .fad.fa-arrow-up-from-arc:after {
+  content: "\e4b4\e4b4";
+}
+
+.fa-duotone.fa-face-spiral-eyes:after, .fad.fa-face-spiral-eyes:after {
+  content: "\e485\e485";
+}
+
+.fa-duotone.fa-compress-wide:after, .fad.fa-compress-wide:after {
+  content: "\f326\f326";
+}
+
+.fa-duotone.fa-circle-phone-hangup:after, .fa-duotone.fa-phone-circle-down:after, .fad.fa-circle-phone-hangup:after, .fad.fa-phone-circle-down:after {
+  content: "\e11d\e11d";
+}
+
+.fa-duotone.fa-gear-complex-code:after, .fad.fa-gear-complex-code:after {
+  content: "\e5eb\e5eb";
+}
+
+.fa-duotone.fa-house-medical-circle-exclamation:after, .fad.fa-house-medical-circle-exclamation:after {
+  content: "\e512\e512";
+}
+
+.fa-duotone.fa-badminton:after, .fad.fa-badminton:after {
+  content: "\e33a\e33a";
+}
+
+.fa-duotone.fa-closed-captioning:after, .fad.fa-closed-captioning:after {
+  content: "\f20a\f20a";
+}
+
+.fa-duotone.fa-hiking:after, .fa-duotone.fa-person-hiking:after, .fad.fa-hiking:after, .fad.fa-person-hiking:after {
+  content: "\f6ec\f6ec";
+}
+
+.fa-duotone.fa-arrow-alt-from-left:after, .fa-duotone.fa-right-from-line:after, .fad.fa-arrow-alt-from-left:after, .fad.fa-right-from-line:after {
+  content: "\f347\f347";
+}
+
+.fa-duotone.fa-venus-double:after, .fad.fa-venus-double:after {
+  content: "\f226\f226";
+}
+
+.fa-duotone.fa-images:after, .fad.fa-images:after {
+  content: "\f302\f302";
+}
+
+.fa-duotone.fa-calculator:after, .fad.fa-calculator:after {
+  content: "\f1ec\f1ec";
+}
+
+.fa-duotone.fa-shuttlecock:after, .fad.fa-shuttlecock:after {
+  content: "\f45b\f45b";
+}
+
+.fa-duotone.fa-user-hair:after, .fad.fa-user-hair:after {
+  content: "\e45a\e45a";
+}
+
+.fa-duotone.fa-eye-evil:after, .fad.fa-eye-evil:after {
+  content: "\f6db\f6db";
+}
+
+.fa-duotone.fa-people-pulling:after, .fad.fa-people-pulling:after {
+  content: "\e535\e535";
+}
+
+.fa-duotone.fa-n:after, .fad.fa-n:after {
+  content: "\4e\4e";
+}
+
+.fa-duotone.fa-swap:after, .fad.fa-swap:after {
+  content: "\e609\e609";
+}
+
+.fa-duotone.fa-garage:after, .fad.fa-garage:after {
+  content: "\e009\e009";
+}
+
+.fa-duotone.fa-cable-car:after, .fa-duotone.fa-tram:after, .fad.fa-cable-car:after, .fad.fa-tram:after {
+  content: "\f7da\f7da";
+}
+
+.fa-duotone.fa-shovel-snow:after, .fad.fa-shovel-snow:after {
+  content: "\f7c3\f7c3";
+}
+
+.fa-duotone.fa-cloud-rain:after, .fad.fa-cloud-rain:after {
+  content: "\f73d\f73d";
+}
+
+.fa-duotone.fa-face-lying:after, .fad.fa-face-lying:after {
+  content: "\e37e\e37e";
+}
+
+.fa-duotone.fa-sprinkler:after, .fad.fa-sprinkler:after {
+  content: "\e035\e035";
+}
+
+.fa-duotone.fa-building-circle-xmark:after, .fad.fa-building-circle-xmark:after {
+  content: "\e4d4\e4d4";
+}
+
+.fa-duotone.fa-person-sledding:after, .fa-duotone.fa-sledding:after, .fad.fa-person-sledding:after, .fad.fa-sledding:after {
+  content: "\f7cb\f7cb";
+}
+
+.fa-duotone.fa-game-console-handheld:after, .fad.fa-game-console-handheld:after {
+  content: "\f8bb\f8bb";
+}
+
+.fa-duotone.fa-ship:after, .fad.fa-ship:after {
+  content: "\f21a\f21a";
+}
+
+.fa-duotone.fa-clock-six-thirty:after, .fad.fa-clock-six-thirty:after {
+  content: "\e353\e353";
+}
+
+.fa-duotone.fa-battery-slash:after, .fad.fa-battery-slash:after {
+  content: "\f377\f377";
+}
+
+.fa-duotone.fa-tugrik-sign:after, .fad.fa-tugrik-sign:after {
+  content: "\e2ba\e2ba";
+}
+
+.fa-duotone.fa-arrows-down-to-line:after, .fad.fa-arrows-down-to-line:after {
+  content: "\e4b8\e4b8";
+}
+
+.fa-duotone.fa-download:after, .fad.fa-download:after {
+  content: "\f019\f019";
+}
+
+.fa-duotone.fa-angles-up-down:after, .fad.fa-angles-up-down:after {
+  content: "\e60d\e60d";
+}
+
+.fa-duotone.fa-inventory:after, .fa-duotone.fa-shelves:after, .fad.fa-inventory:after, .fad.fa-shelves:after {
+  content: "\f480\f480";
+}
+
+.fa-duotone.fa-cloud-snow:after, .fad.fa-cloud-snow:after {
+  content: "\f742\f742";
+}
+
+.fa-duotone.fa-face-grin:after, .fa-duotone.fa-grin:after, .fad.fa-face-grin:after, .fad.fa-grin:after {
+  content: "\f580\f580";
+}
+
+.fa-duotone.fa-backspace:after, .fa-duotone.fa-delete-left:after, .fad.fa-backspace:after, .fad.fa-delete-left:after {
+  content: "\f55a\f55a";
+}
+
+.fa-duotone.fa-oven:after, .fad.fa-oven:after {
+  content: "\e01d\e01d";
+}
+
+.fa-duotone.fa-cloud-binary:after, .fad.fa-cloud-binary:after {
+  content: "\e601\e601";
+}
+
+.fa-duotone.fa-eye-dropper-empty:after, .fa-duotone.fa-eye-dropper:after, .fa-duotone.fa-eyedropper:after, .fad.fa-eye-dropper-empty:after, .fad.fa-eye-dropper:after, .fad.fa-eyedropper:after {
+  content: "\f1fb\f1fb";
+}
+
+.fa-duotone.fa-comment-captions:after, .fad.fa-comment-captions:after {
+  content: "\e146\e146";
+}
+
+.fa-duotone.fa-comments-question:after, .fad.fa-comments-question:after {
+  content: "\e14e\e14e";
+}
+
+.fa-duotone.fa-scribble:after, .fad.fa-scribble:after {
+  content: "\e23f\e23f";
+}
+
+.fa-duotone.fa-rotate-exclamation:after, .fad.fa-rotate-exclamation:after {
+  content: "\e23c\e23c";
+}
+
+.fa-duotone.fa-file-circle-check:after, .fad.fa-file-circle-check:after {
+  content: "\e5a0\e5a0";
+}
+
+.fa-duotone.fa-glass:after, .fad.fa-glass:after {
+  content: "\f804\f804";
+}
+
+.fa-duotone.fa-loader:after, .fad.fa-loader:after {
+  content: "\e1d4\e1d4";
+}
+
+.fa-duotone.fa-forward:after, .fad.fa-forward:after {
+  content: "\f04e\f04e";
+}
+
+.fa-duotone.fa-user-pilot:after, .fad.fa-user-pilot:after {
+  content: "\e2c0\e2c0";
+}
+
+.fa-duotone.fa-mobile-android:after, .fa-duotone.fa-mobile-phone:after, .fa-duotone.fa-mobile:after, .fad.fa-mobile-android:after, .fad.fa-mobile-phone:after, .fad.fa-mobile:after {
+  content: "\f3ce\f3ce";
+}
+
+.fa-duotone.fa-code-pull-request-closed:after, .fad.fa-code-pull-request-closed:after {
+  content: "\e3f9\e3f9";
+}
+
+.fa-duotone.fa-face-meh:after, .fa-duotone.fa-meh:after, .fad.fa-face-meh:after, .fad.fa-meh:after {
+  content: "\f11a\f11a";
+}
+
+.fa-duotone.fa-align-center:after, .fad.fa-align-center:after {
+  content: "\f037\f037";
+}
+
+.fa-duotone.fa-book-dead:after, .fa-duotone.fa-book-skull:after, .fad.fa-book-dead:after, .fad.fa-book-skull:after {
+  content: "\f6b7\f6b7";
+}
+
+.fa-duotone.fa-drivers-license:after, .fa-duotone.fa-id-card:after, .fad.fa-drivers-license:after, .fad.fa-id-card:after {
+  content: "\f2c2\f2c2";
+}
+
+.fa-duotone.fa-face-dotted:after, .fad.fa-face-dotted:after {
+  content: "\e47f\e47f";
+}
+
+.fa-duotone.fa-face-worried:after, .fad.fa-face-worried:after {
+  content: "\e3a3\e3a3";
+}
+
+.fa-duotone.fa-dedent:after, .fa-duotone.fa-outdent:after, .fad.fa-dedent:after, .fad.fa-outdent:after {
+  content: "\f03b\f03b";
+}
+
+.fa-duotone.fa-court-sport:after, .fad.fa-court-sport:after {
+  content: "\e643\e643";
+}
+
+.fa-duotone.fa-heart-circle-exclamation:after, .fad.fa-heart-circle-exclamation:after {
+  content: "\e4fe\e4fe";
+}
+
+.fa-duotone.fa-home-alt:after, .fa-duotone.fa-home-lg-alt:after, .fa-duotone.fa-home:after, .fa-duotone.fa-house:after, .fad.fa-home-alt:after, .fad.fa-home-lg-alt:after, .fad.fa-home:after, .fad.fa-house:after {
+  content: "\f015\f015";
+}
+
+.fa-duotone.fa-vector-circle:after, .fad.fa-vector-circle:after {
+  content: "\e2c6\e2c6";
+}
+
+.fa-duotone.fa-car-circle-bolt:after, .fad.fa-car-circle-bolt:after {
+  content: "\e342\e342";
+}
+
+.fa-duotone.fa-calendar-week:after, .fad.fa-calendar-week:after {
+  content: "\f784\f784";
+}
+
+.fa-duotone.fa-flying-disc:after, .fad.fa-flying-disc:after {
+  content: "\e3a9\e3a9";
+}
+
+.fa-duotone.fa-laptop-medical:after, .fad.fa-laptop-medical:after {
+  content: "\f812\f812";
+}
+
+.fa-duotone.fa-square-down-right:after, .fad.fa-square-down-right:after {
+  content: "\e26c\e26c";
+}
+
+.fa-duotone.fa-b:after, .fad.fa-b:after {
+  content: "\42\42";
+}
+
+.fa-duotone.fa-seat-airline:after, .fad.fa-seat-airline:after {
+  content: "\e244\e244";
+}
+
+.fa-duotone.fa-eclipse-alt:after, .fa-duotone.fa-moon-over-sun:after, .fad.fa-eclipse-alt:after, .fad.fa-moon-over-sun:after {
+  content: "\f74a\f74a";
+}
+
+.fa-duotone.fa-pipe:after, .fad.fa-pipe:after {
+  content: "\7c\7c";
+}
+
+.fa-duotone.fa-file-medical:after, .fad.fa-file-medical:after {
+  content: "\f477\f477";
+}
+
+.fa-duotone.fa-potato:after, .fad.fa-potato:after {
+  content: "\e440\e440";
+}
+
+.fa-duotone.fa-dice-one:after, .fad.fa-dice-one:after {
+  content: "\f525\f525";
+}
+
+.fa-duotone.fa-circle-a:after, .fad.fa-circle-a:after {
+  content: "\e0f7\e0f7";
+}
+
+.fa-duotone.fa-helmet-battle:after, .fad.fa-helmet-battle:after {
+  content: "\f6eb\f6eb";
+}
+
+.fa-duotone.fa-butter:after, .fad.fa-butter:after {
+  content: "\e3e4\e3e4";
+}
+
+.fa-duotone.fa-blanket-fire:after, .fad.fa-blanket-fire:after {
+  content: "\e3da\e3da";
+}
+
+.fa-duotone.fa-kiwi-bird:after, .fad.fa-kiwi-bird:after {
+  content: "\f535\f535";
+}
+
+.fa-duotone.fa-castle:after, .fad.fa-castle:after {
+  content: "\e0de\e0de";
+}
+
+.fa-duotone.fa-golf-club:after, .fad.fa-golf-club:after {
+  content: "\f451\f451";
+}
+
+.fa-duotone.fa-arrow-right-arrow-left:after, .fa-duotone.fa-exchange:after, .fad.fa-arrow-right-arrow-left:after, .fad.fa-exchange:after {
+  content: "\f0ec\f0ec";
+}
+
+.fa-duotone.fa-redo-alt:after, .fa-duotone.fa-rotate-forward:after, .fa-duotone.fa-rotate-right:after, .fad.fa-redo-alt:after, .fad.fa-rotate-forward:after, .fad.fa-rotate-right:after {
+  content: "\f2f9\f2f9";
+}
+
+.fa-duotone.fa-cutlery:after, .fa-duotone.fa-utensils:after, .fad.fa-cutlery:after, .fad.fa-utensils:after {
+  content: "\f2e7\f2e7";
+}
+
+.fa-duotone.fa-arrow-up-wide-short:after, .fa-duotone.fa-sort-amount-up:after, .fad.fa-arrow-up-wide-short:after, .fad.fa-sort-amount-up:after {
+  content: "\f161\f161";
+}
+
+.fa-duotone.fa-chart-pie-simple-circle-dollar:after, .fad.fa-chart-pie-simple-circle-dollar:after {
+  content: "\e605\e605";
+}
+
+.fa-duotone.fa-balloons:after, .fad.fa-balloons:after {
+  content: "\e2e4\e2e4";
+}
+
+.fa-duotone.fa-mill-sign:after, .fad.fa-mill-sign:after {
+  content: "\e1ed\e1ed";
+}
+
+.fa-duotone.fa-bowl-rice:after, .fad.fa-bowl-rice:after {
+  content: "\e2eb\e2eb";
+}
+
+.fa-duotone.fa-timeline-arrow:after, .fad.fa-timeline-arrow:after {
+  content: "\e29d\e29d";
+}
+
+.fa-duotone.fa-skull:after, .fad.fa-skull:after {
+  content: "\f54c\f54c";
+}
+
+.fa-duotone.fa-game-board-alt:after, .fa-duotone.fa-game-board-simple:after, .fad.fa-game-board-alt:after, .fad.fa-game-board-simple:after {
+  content: "\f868\f868";
+}
+
+.fa-duotone.fa-circle-video:after, .fa-duotone.fa-video-circle:after, .fad.fa-circle-video:after, .fad.fa-video-circle:after {
+  content: "\e12b\e12b";
+}
+
+.fa-duotone.fa-chart-scatter-bubble:after, .fad.fa-chart-scatter-bubble:after {
+  content: "\e0e9\e0e9";
+}
+
+.fa-duotone.fa-house-turret:after, .fad.fa-house-turret:after {
+  content: "\e1b4\e1b4";
+}
+
+.fa-duotone.fa-banana:after, .fad.fa-banana:after {
+  content: "\e2e5\e2e5";
+}
+
+.fa-duotone.fa-hand-holding-skull:after, .fad.fa-hand-holding-skull:after {
+  content: "\e1a4\e1a4";
+}
+
+.fa-duotone.fa-people-dress:after, .fad.fa-people-dress:after {
+  content: "\e217\e217";
+}
+
+.fa-duotone.fa-couch-small:after, .fa-duotone.fa-loveseat:after, .fad.fa-couch-small:after, .fad.fa-loveseat:after {
+  content: "\f4cc\f4cc";
+}
+
+.fa-duotone.fa-broadcast-tower:after, .fa-duotone.fa-tower-broadcast:after, .fad.fa-broadcast-tower:after, .fad.fa-tower-broadcast:after {
+  content: "\f519\f519";
+}
+
+.fa-duotone.fa-truck-pickup:after, .fad.fa-truck-pickup:after {
+  content: "\f63c\f63c";
+}
+
+.fa-duotone.fa-block-quote:after, .fad.fa-block-quote:after {
+  content: "\e0b5\e0b5";
+}
+
+.fa-duotone.fa-long-arrow-alt-up:after, .fa-duotone.fa-up-long:after, .fad.fa-long-arrow-alt-up:after, .fad.fa-up-long:after {
+  content: "\f30c\f30c";
+}
+
+.fa-duotone.fa-stop:after, .fad.fa-stop:after {
+  content: "\f04d\f04d";
+}
+
+.fa-duotone.fa-code-merge:after, .fad.fa-code-merge:after {
+  content: "\f387\f387";
+}
+
+.fa-duotone.fa-money-check-dollar-pen:after, .fa-duotone.fa-money-check-edit-alt:after, .fad.fa-money-check-dollar-pen:after, .fad.fa-money-check-edit-alt:after {
+  content: "\f873\f873";
+}
+
+.fa-duotone.fa-arrow-alt-from-bottom:after, .fa-duotone.fa-up-from-line:after, .fad.fa-arrow-alt-from-bottom:after, .fad.fa-up-from-line:after {
+  content: "\f346\f346";
+}
+
+.fa-duotone.fa-upload:after, .fad.fa-upload:after {
+  content: "\f093\f093";
+}
+
+.fa-duotone.fa-hurricane:after, .fad.fa-hurricane:after {
+  content: "\f751\f751";
+}
+
+.fa-duotone.fa-grid-round-2-plus:after, .fad.fa-grid-round-2-plus:after {
+  content: "\e5dc\e5dc";
+}
+
+.fa-duotone.fa-people-pants:after, .fad.fa-people-pants:after {
+  content: "\e219\e219";
+}
+
+.fa-duotone.fa-mound:after, .fad.fa-mound:after {
+  content: "\e52d\e52d";
+}
+
+.fa-duotone.fa-windsock:after, .fad.fa-windsock:after {
+  content: "\f777\f777";
+}
+
+.fa-duotone.fa-circle-half:after, .fad.fa-circle-half:after {
+  content: "\e110\e110";
+}
+
+.fa-duotone.fa-brake-warning:after, .fad.fa-brake-warning:after {
+  content: "\e0c7\e0c7";
+}
+
+.fa-duotone.fa-toilet-portable:after, .fad.fa-toilet-portable:after {
+  content: "\e583\e583";
+}
+
+.fa-duotone.fa-compact-disc:after, .fad.fa-compact-disc:after {
+  content: "\f51f\f51f";
+}
+
+.fa-duotone.fa-file-arrow-down:after, .fa-duotone.fa-file-download:after, .fad.fa-file-arrow-down:after, .fad.fa-file-download:after {
+  content: "\f56d\f56d";
+}
+
+.fa-duotone.fa-sax-hot:after, .fa-duotone.fa-saxophone-fire:after, .fad.fa-sax-hot:after, .fad.fa-saxophone-fire:after {
+  content: "\f8db\f8db";
+}
+
+.fa-duotone.fa-camera-web-slash:after, .fa-duotone.fa-webcam-slash:after, .fad.fa-camera-web-slash:after, .fad.fa-webcam-slash:after {
+  content: "\f833\f833";
+}
+
+.fa-duotone.fa-folder-medical:after, .fad.fa-folder-medical:after {
+  content: "\e18c\e18c";
+}
+
+.fa-duotone.fa-folder-cog:after, .fa-duotone.fa-folder-gear:after, .fad.fa-folder-cog:after, .fad.fa-folder-gear:after {
+  content: "\e187\e187";
+}
+
+.fa-duotone.fa-hand-wave:after, .fad.fa-hand-wave:after {
+  content: "\e1a7\e1a7";
+}
+
+.fa-duotone.fa-arrow-up-arrow-down:after, .fa-duotone.fa-sort-up-down:after, .fad.fa-arrow-up-arrow-down:after, .fad.fa-sort-up-down:after {
+  content: "\e099\e099";
+}
+
+.fa-duotone.fa-caravan:after, .fad.fa-caravan:after {
+  content: "\f8ff\f8ff";
+}
+
+.fa-duotone.fa-shield-cat:after, .fad.fa-shield-cat:after {
+  content: "\e572\e572";
+}
+
+.fa-duotone.fa-comment-alt-slash:after, .fa-duotone.fa-message-slash:after, .fad.fa-comment-alt-slash:after, .fad.fa-message-slash:after {
+  content: "\f4a9\f4a9";
+}
+
+.fa-duotone.fa-bolt:after, .fa-duotone.fa-zap:after, .fad.fa-bolt:after, .fad.fa-zap:after {
+  content: "\f0e7\f0e7";
+}
+
+.fa-duotone.fa-trash-can-check:after, .fad.fa-trash-can-check:after {
+  content: "\e2a9\e2a9";
+}
+
+.fa-duotone.fa-glass-water:after, .fad.fa-glass-water:after {
+  content: "\e4f4\e4f4";
+}
+
+.fa-duotone.fa-oil-well:after, .fad.fa-oil-well:after {
+  content: "\e532\e532";
+}
+
+.fa-duotone.fa-person-simple:after, .fad.fa-person-simple:after {
+  content: "\e220\e220";
+}
+
+.fa-duotone.fa-arrow-turn-left-up:after, .fad.fa-arrow-turn-left-up:after {
+  content: "\e634\e634";
+}
+
+.fa-duotone.fa-vault:after, .fad.fa-vault:after {
+  content: "\e2c5\e2c5";
+}
+
+.fa-duotone.fa-mars:after, .fad.fa-mars:after {
+  content: "\f222\f222";
+}
+
+.fa-duotone.fa-toilet:after, .fad.fa-toilet:after {
+  content: "\f7d8\f7d8";
+}
+
+.fa-duotone.fa-plane-circle-xmark:after, .fad.fa-plane-circle-xmark:after {
+  content: "\e557\e557";
+}
+
+.fa-duotone.fa-cny:after, .fa-duotone.fa-jpy:after, .fa-duotone.fa-rmb:after, .fa-duotone.fa-yen-sign:after, .fa-duotone.fa-yen:after, .fad.fa-cny:after, .fad.fa-jpy:after, .fad.fa-rmb:after, .fad.fa-yen-sign:after, .fad.fa-yen:after {
+  content: "\f157\f157";
+}
+
+.fa-duotone.fa-gear-code:after, .fad.fa-gear-code:after {
+  content: "\e5e8\e5e8";
+}
+
+.fa-duotone.fa-notes:after, .fad.fa-notes:after {
+  content: "\e202\e202";
+}
+
+.fa-duotone.fa-rouble:after, .fa-duotone.fa-rub:after, .fa-duotone.fa-ruble-sign:after, .fa-duotone.fa-ruble:after, .fad.fa-rouble:after, .fad.fa-rub:after, .fad.fa-ruble-sign:after, .fad.fa-ruble:after {
+  content: "\f158\f158";
+}
+
+.fa-duotone.fa-trash-arrow-turn-left:after, .fa-duotone.fa-trash-undo:after, .fad.fa-trash-arrow-turn-left:after, .fad.fa-trash-undo:after {
+  content: "\f895\f895";
+}
+
+.fa-duotone.fa-champagne-glass:after, .fa-duotone.fa-glass-champagne:after, .fad.fa-champagne-glass:after, .fad.fa-glass-champagne:after {
+  content: "\f79e\f79e";
+}
+
+.fa-duotone.fa-objects-align-center-horizontal:after, .fad.fa-objects-align-center-horizontal:after {
+  content: "\e3bc\e3bc";
+}
+
+.fa-duotone.fa-sun:after, .fad.fa-sun:after {
+  content: "\f185\f185";
+}
+
+.fa-duotone.fa-trash-alt-slash:after, .fa-duotone.fa-trash-can-slash:after, .fad.fa-trash-alt-slash:after, .fad.fa-trash-can-slash:after {
+  content: "\e2ad\e2ad";
+}
+
+.fa-duotone.fa-screen-users:after, .fa-duotone.fa-users-class:after, .fad.fa-screen-users:after, .fad.fa-users-class:after {
+  content: "\f63d\f63d";
+}
+
+.fa-duotone.fa-guitar:after, .fad.fa-guitar:after {
+  content: "\f7a6\f7a6";
+}
+
+.fa-duotone.fa-arrow-square-left:after, .fa-duotone.fa-square-arrow-left:after, .fad.fa-arrow-square-left:after, .fad.fa-square-arrow-left:after {
+  content: "\f33a\f33a";
+}
+
+.fa-duotone.fa-square-8:after, .fad.fa-square-8:after {
+  content: "\e25d\e25d";
+}
+
+.fa-duotone.fa-face-smile-hearts:after, .fad.fa-face-smile-hearts:after {
+  content: "\e390\e390";
+}
+
+.fa-duotone.fa-brackets-square:after, .fa-duotone.fa-brackets:after, .fad.fa-brackets-square:after, .fad.fa-brackets:after {
+  content: "\f7e9\f7e9";
+}
+
+.fa-duotone.fa-laptop-arrow-down:after, .fad.fa-laptop-arrow-down:after {
+  content: "\e1c6\e1c6";
+}
+
+.fa-duotone.fa-hockey-stick-puck:after, .fad.fa-hockey-stick-puck:after {
+  content: "\e3ae\e3ae";
+}
+
+.fa-duotone.fa-house-tree:after, .fad.fa-house-tree:after {
+  content: "\e1b3\e1b3";
+}
+
+.fa-duotone.fa-signal-2:after, .fa-duotone.fa-signal-fair:after, .fad.fa-signal-2:after, .fad.fa-signal-fair:after {
+  content: "\f68d\f68d";
+}
+
+.fa-duotone.fa-face-laugh-wink:after, .fa-duotone.fa-laugh-wink:after, .fad.fa-face-laugh-wink:after, .fad.fa-laugh-wink:after {
+  content: "\f59c\f59c";
+}
+
+.fa-duotone.fa-circle-dollar:after, .fa-duotone.fa-dollar-circle:after, .fa-duotone.fa-usd-circle:after, .fad.fa-circle-dollar:after, .fad.fa-dollar-circle:after, .fad.fa-usd-circle:after {
+  content: "\f2e8\f2e8";
+}
+
+.fa-duotone.fa-horse-head:after, .fad.fa-horse-head:after {
+  content: "\f7ab\f7ab";
+}
+
+.fa-duotone.fa-arrows-repeat:after, .fa-duotone.fa-repeat-alt:after, .fad.fa-arrows-repeat:after, .fad.fa-repeat-alt:after {
+  content: "\f364\f364";
+}
+
+.fa-duotone.fa-bore-hole:after, .fad.fa-bore-hole:after {
+  content: "\e4c3\e4c3";
+}
+
+.fa-duotone.fa-industry:after, .fad.fa-industry:after {
+  content: "\f275\f275";
+}
+
+.fa-duotone.fa-image-polaroid:after, .fad.fa-image-polaroid:after {
+  content: "\f8c4\f8c4";
+}
+
+.fa-duotone.fa-wave-triangle:after, .fad.fa-wave-triangle:after {
+  content: "\f89a\f89a";
+}
+
+.fa-duotone.fa-turn-left-down:after, .fad.fa-turn-left-down:after {
+  content: "\e637\e637";
+}
+
+.fa-duotone.fa-person-running-fast:after, .fad.fa-person-running-fast:after {
+  content: "\e5ff\e5ff";
+}
+
+.fa-duotone.fa-arrow-alt-circle-down:after, .fa-duotone.fa-circle-down:after, .fad.fa-arrow-alt-circle-down:after, .fad.fa-circle-down:after {
+  content: "\f358\f358";
+}
+
+.fa-duotone.fa-grill:after, .fad.fa-grill:after {
+  content: "\e5a3\e5a3";
+}
+
+.fa-duotone.fa-arrows-turn-to-dots:after, .fad.fa-arrows-turn-to-dots:after {
+  content: "\e4c1\e4c1";
+}
+
+.fa-duotone.fa-analytics:after, .fa-duotone.fa-chart-mixed:after, .fad.fa-analytics:after, .fad.fa-chart-mixed:after {
+  content: "\f643\f643";
+}
+
+.fa-duotone.fa-florin-sign:after, .fad.fa-florin-sign:after {
+  content: "\e184\e184";
+}
+
+.fa-duotone.fa-arrow-down-short-wide:after, .fa-duotone.fa-sort-amount-desc:after, .fa-duotone.fa-sort-amount-down-alt:after, .fad.fa-arrow-down-short-wide:after, .fad.fa-sort-amount-desc:after, .fad.fa-sort-amount-down-alt:after {
+  content: "\f884\f884";
+}
+
+.fa-duotone.fa-less-than:after, .fad.fa-less-than:after {
+  content: "\3c\3c";
+}
+
+.fa-duotone.fa-desktop-code:after, .fa-duotone.fa-display-code:after, .fad.fa-desktop-code:after, .fad.fa-display-code:after {
+  content: "\e165\e165";
+}
+
+.fa-duotone.fa-face-drooling:after, .fad.fa-face-drooling:after {
+  content: "\e372\e372";
+}
+
+.fa-duotone.fa-oil-temp:after, .fa-duotone.fa-oil-temperature:after, .fad.fa-oil-temp:after, .fad.fa-oil-temperature:after {
+  content: "\f614\f614";
+}
+
+.fa-duotone.fa-question-square:after, .fa-duotone.fa-square-question:after, .fad.fa-question-square:after, .fad.fa-square-question:after {
+  content: "\f2fd\f2fd";
+}
+
+.fa-duotone.fa-air-conditioner:after, .fad.fa-air-conditioner:after {
+  content: "\f8f4\f8f4";
+}
+
+.fa-duotone.fa-angle-down:after, .fad.fa-angle-down:after {
+  content: "\f107\f107";
+}
+
+.fa-duotone.fa-mountains:after, .fad.fa-mountains:after {
+  content: "\f6fd\f6fd";
+}
+
+.fa-duotone.fa-omega:after, .fad.fa-omega:after {
+  content: "\f67a\f67a";
+}
+
+.fa-duotone.fa-car-tunnel:after, .fad.fa-car-tunnel:after {
+  content: "\e4de\e4de";
+}
+
+.fa-duotone.fa-person-dolly-empty:after, .fad.fa-person-dolly-empty:after {
+  content: "\f4d1\f4d1";
+}
+
+.fa-duotone.fa-pan-food:after, .fad.fa-pan-food:after {
+  content: "\e42b\e42b";
+}
+
+.fa-duotone.fa-head-side-cough:after, .fad.fa-head-side-cough:after {
+  content: "\e061\e061";
+}
+
+.fa-duotone.fa-grip-lines:after, .fad.fa-grip-lines:after {
+  content: "\f7a4\f7a4";
+}
+
+.fa-duotone.fa-thumbs-down:after, .fad.fa-thumbs-down:after {
+  content: "\f165\f165";
+}
+
+.fa-duotone.fa-user-lock:after, .fad.fa-user-lock:after {
+  content: "\f502\f502";
+}
+
+.fa-duotone.fa-arrow-right-long:after, .fa-duotone.fa-long-arrow-right:after, .fad.fa-arrow-right-long:after, .fad.fa-long-arrow-right:after {
+  content: "\f178\f178";
+}
+
+.fa-duotone.fa-tickets-airline:after, .fa-duotone.fa-tickets-perforated-plane:after, .fa-duotone.fa-tickets-plane:after, .fad.fa-tickets-airline:after, .fad.fa-tickets-perforated-plane:after, .fad.fa-tickets-plane:after {
+  content: "\e29b\e29b";
+}
+
+.fa-duotone.fa-tent-double-peak:after, .fad.fa-tent-double-peak:after {
+  content: "\e627\e627";
+}
+
+.fa-duotone.fa-anchor-circle-xmark:after, .fad.fa-anchor-circle-xmark:after {
+  content: "\e4ac\e4ac";
+}
+
+.fa-duotone.fa-ellipsis-h:after, .fa-duotone.fa-ellipsis:after, .fad.fa-ellipsis-h:after, .fad.fa-ellipsis:after {
+  content: "\f141\f141";
+}
+
+.fa-duotone.fa-nfc-slash:after, .fad.fa-nfc-slash:after {
+  content: "\e1fc\e1fc";
+}
+
+.fa-duotone.fa-chess-pawn:after, .fad.fa-chess-pawn:after {
+  content: "\f443\f443";
+}
+
+.fa-duotone.fa-first-aid:after, .fa-duotone.fa-kit-medical:after, .fad.fa-first-aid:after, .fad.fa-kit-medical:after {
+  content: "\f479\f479";
+}
+
+.fa-duotone.fa-grid-2-plus:after, .fad.fa-grid-2-plus:after {
+  content: "\e197\e197";
+}
+
+.fa-duotone.fa-bells:after, .fad.fa-bells:after {
+  content: "\f77f\f77f";
+}
+
+.fa-duotone.fa-person-through-window:after, .fad.fa-person-through-window:after {
+  content: "\e5a9\e5a9";
+}
+
+.fa-duotone.fa-toolbox:after, .fad.fa-toolbox:after {
+  content: "\f552\f552";
+}
+
+.fa-duotone.fa-envelope-badge:after, .fa-duotone.fa-envelope-dot:after, .fad.fa-envelope-badge:after, .fad.fa-envelope-dot:after {
+  content: "\e16f\e16f";
+}
+
+.fa-duotone.fa-magnifying-glass-waveform:after, .fad.fa-magnifying-glass-waveform:after {
+  content: "\e661\e661";
+}
+
+.fa-duotone.fa-hands-holding-circle:after, .fad.fa-hands-holding-circle:after {
+  content: "\e4fb\e4fb";
+}
+
+.fa-duotone.fa-bug:after, .fad.fa-bug:after {
+  content: "\f188\f188";
+}
+
+.fa-duotone.fa-bowl-chopsticks:after, .fad.fa-bowl-chopsticks:after {
+  content: "\e2e9\e2e9";
+}
+
+.fa-duotone.fa-credit-card-alt:after, .fa-duotone.fa-credit-card:after, .fad.fa-credit-card-alt:after, .fad.fa-credit-card:after {
+  content: "\f09d\f09d";
+}
+
+.fa-duotone.fa-circle-s:after, .fad.fa-circle-s:after {
+  content: "\e121\e121";
+}
+
+.fa-duotone.fa-box-ballot:after, .fad.fa-box-ballot:after {
+  content: "\f735\f735";
+}
+
+.fa-duotone.fa-automobile:after, .fa-duotone.fa-car:after, .fad.fa-automobile:after, .fad.fa-car:after {
+  content: "\f1b9\f1b9";
+}
+
+.fa-duotone.fa-hand-holding-hand:after, .fad.fa-hand-holding-hand:after {
+  content: "\e4f7\e4f7";
+}
+
+.fa-duotone.fa-user-tie-hair:after, .fad.fa-user-tie-hair:after {
+  content: "\e45f\e45f";
+}
+
+.fa-duotone.fa-podium-star:after, .fad.fa-podium-star:after {
+  content: "\f758\f758";
+}
+
+.fa-duotone.fa-business-front:after, .fa-duotone.fa-party-back:after, .fa-duotone.fa-trian-balbot:after, .fa-duotone.fa-user-hair-mullet:after, .fad.fa-business-front:after, .fad.fa-party-back:after, .fad.fa-trian-balbot:after, .fad.fa-user-hair-mullet:after {
+  content: "\e45c\e45c";
+}
+
+.fa-duotone.fa-microphone-stand:after, .fad.fa-microphone-stand:after {
+  content: "\f8cb\f8cb";
+}
+
+.fa-duotone.fa-book-open-reader:after, .fa-duotone.fa-book-reader:after, .fad.fa-book-open-reader:after, .fad.fa-book-reader:after {
+  content: "\f5da\f5da";
+}
+
+.fa-duotone.fa-family-dress:after, .fad.fa-family-dress:after {
+  content: "\e301\e301";
+}
+
+.fa-duotone.fa-circle-x:after, .fad.fa-circle-x:after {
+  content: "\e12e\e12e";
+}
+
+.fa-duotone.fa-cabin:after, .fad.fa-cabin:after {
+  content: "\e46d\e46d";
+}
+
+.fa-duotone.fa-mountain-sun:after, .fad.fa-mountain-sun:after {
+  content: "\e52f\e52f";
+}
+
+.fa-duotone.fa-chart-simple-horizontal:after, .fad.fa-chart-simple-horizontal:after {
+  content: "\e474\e474";
+}
+
+.fa-duotone.fa-arrows-left-right-to-line:after, .fad.fa-arrows-left-right-to-line:after {
+  content: "\e4ba\e4ba";
+}
+
+.fa-duotone.fa-hand-back-point-left:after, .fad.fa-hand-back-point-left:after {
+  content: "\e19f\e19f";
+}
+
+.fa-duotone.fa-comment-alt-dots:after, .fa-duotone.fa-message-dots:after, .fa-duotone.fa-messaging:after, .fad.fa-comment-alt-dots:after, .fad.fa-message-dots:after, .fad.fa-messaging:after {
+  content: "\f4a3\f4a3";
+}
+
+.fa-duotone.fa-file-heart:after, .fad.fa-file-heart:after {
+  content: "\e176\e176";
+}
+
+.fa-duotone.fa-beer-foam:after, .fa-duotone.fa-beer-mug:after, .fad.fa-beer-foam:after, .fad.fa-beer-mug:after {
+  content: "\e0b3\e0b3";
+}
+
+.fa-duotone.fa-dice-d20:after, .fad.fa-dice-d20:after {
+  content: "\f6cf\f6cf";
+}
+
+.fa-duotone.fa-drone:after, .fad.fa-drone:after {
+  content: "\f85f\f85f";
+}
+
+.fa-duotone.fa-truck-droplet:after, .fad.fa-truck-droplet:after {
+  content: "\e58c\e58c";
+}
+
+.fa-duotone.fa-file-circle-xmark:after, .fad.fa-file-circle-xmark:after {
+  content: "\e5a1\e5a1";
+}
+
+.fa-duotone.fa-temperature-arrow-up:after, .fa-duotone.fa-temperature-up:after, .fad.fa-temperature-arrow-up:after, .fad.fa-temperature-up:after {
+  content: "\e040\e040";
+}
+
+.fa-duotone.fa-medal:after, .fad.fa-medal:after {
+  content: "\f5a2\f5a2";
+}
+
+.fa-duotone.fa-person-fairy:after, .fad.fa-person-fairy:after {
+  content: "\e608\e608";
+}
+
+.fa-duotone.fa-bed:after, .fad.fa-bed:after {
+  content: "\f236\f236";
+}
+
+.fa-duotone.fa-book-copy:after, .fad.fa-book-copy:after {
+  content: "\e0be\e0be";
+}
+
+.fa-duotone.fa-h-square:after, .fa-duotone.fa-square-h:after, .fad.fa-h-square:after, .fad.fa-square-h:after {
+  content: "\f0fd\f0fd";
+}
+
+.fa-duotone.fa-square-c:after, .fad.fa-square-c:after {
+  content: "\e266\e266";
+}
+
+.fa-duotone.fa-clock-two:after, .fad.fa-clock-two:after {
+  content: "\e35a\e35a";
+}
+
+.fa-duotone.fa-square-ellipsis-vertical:after, .fad.fa-square-ellipsis-vertical:after {
+  content: "\e26f\e26f";
+}
+
+.fa-duotone.fa-calendar-users:after, .fad.fa-calendar-users:after {
+  content: "\e5e2\e5e2";
+}
+
+.fa-duotone.fa-podcast:after, .fad.fa-podcast:after {
+  content: "\f2ce\f2ce";
+}
+
+.fa-duotone.fa-bee:after, .fad.fa-bee:after {
+  content: "\e0b2\e0b2";
+}
+
+.fa-duotone.fa-temperature-4:after, .fa-duotone.fa-temperature-full:after, .fa-duotone.fa-thermometer-4:after, .fa-duotone.fa-thermometer-full:after, .fad.fa-temperature-4:after, .fad.fa-temperature-full:after, .fad.fa-thermometer-4:after, .fad.fa-thermometer-full:after {
+  content: "\f2c7\f2c7";
+}
+
+.fa-duotone.fa-bell:after, .fad.fa-bell:after {
+  content: "\f0f3\f0f3";
+}
+
+.fa-duotone.fa-candy-bar:after, .fa-duotone.fa-chocolate-bar:after, .fad.fa-candy-bar:after, .fad.fa-chocolate-bar:after {
+  content: "\e3e8\e3e8";
+}
+
+.fa-duotone.fa-xmark-large:after, .fad.fa-xmark-large:after {
+  content: "\e59b\e59b";
+}
+
+.fa-duotone.fa-pinata:after, .fad.fa-pinata:after {
+  content: "\e3c3\e3c3";
+}
+
+.fa-duotone.fa-file-ppt:after, .fad.fa-file-ppt:after {
+  content: "\e64a\e64a";
+}
+
+.fa-duotone.fa-arrows-from-line:after, .fad.fa-arrows-from-line:after {
+  content: "\e0a4\e0a4";
+}
+
+.fa-duotone.fa-superscript:after, .fad.fa-superscript:after {
+  content: "\f12b\f12b";
+}
+
+.fa-duotone.fa-bowl-spoon:after, .fad.fa-bowl-spoon:after {
+  content: "\e3e0\e3e0";
+}
+
+.fa-duotone.fa-hexagon-check:after, .fad.fa-hexagon-check:after {
+  content: "\e416\e416";
+}
+
+.fa-duotone.fa-plug-circle-xmark:after, .fad.fa-plug-circle-xmark:after {
+  content: "\e560\e560";
+}
+
+.fa-duotone.fa-star-of-life:after, .fad.fa-star-of-life:after {
+  content: "\f621\f621";
+}
+
+.fa-duotone.fa-phone-slash:after, .fad.fa-phone-slash:after {
+  content: "\f3dd\f3dd";
+}
+
+.fa-duotone.fa-traffic-light-stop:after, .fad.fa-traffic-light-stop:after {
+  content: "\f63a\f63a";
+}
+
+.fa-duotone.fa-paint-roller:after, .fad.fa-paint-roller:after {
+  content: "\f5aa\f5aa";
+}
+
+.fa-duotone.fa-accent-grave:after, .fad.fa-accent-grave:after {
+  content: "\60\60";
+}
+
+.fa-duotone.fa-hands-helping:after, .fa-duotone.fa-handshake-angle:after, .fad.fa-hands-helping:after, .fad.fa-handshake-angle:after {
+  content: "\f4c4\f4c4";
+}
+
+.fa-duotone.fa-circle-0:after, .fad.fa-circle-0:after {
+  content: "\e0ed\e0ed";
+}
+
+.fa-duotone.fa-dial-med-low:after, .fad.fa-dial-med-low:after {
+  content: "\e160\e160";
+}
+
+.fa-duotone.fa-location-dot:after, .fa-duotone.fa-map-marker-alt:after, .fad.fa-location-dot:after, .fad.fa-map-marker-alt:after {
+  content: "\f3c5\f3c5";
+}
+
+.fa-duotone.fa-crab:after, .fad.fa-crab:after {
+  content: "\e3ff\e3ff";
+}
+
+.fa-duotone.fa-box-full:after, .fa-duotone.fa-box-open-full:after, .fad.fa-box-full:after, .fad.fa-box-open-full:after {
+  content: "\f49c\f49c";
+}
+
+.fa-duotone.fa-file:after, .fad.fa-file:after {
+  content: "\f15b\f15b";
+}
+
+.fa-duotone.fa-greater-than:after, .fad.fa-greater-than:after {
+  content: "\3e\3e";
+}
+
+.fa-duotone.fa-quotes:after, .fad.fa-quotes:after {
+  content: "\e234\e234";
+}
+
+.fa-duotone.fa-pretzel:after, .fad.fa-pretzel:after {
+  content: "\e441\e441";
+}
+
+.fa-duotone.fa-t-rex:after, .fad.fa-t-rex:after {
+  content: "\e629\e629";
+}
+
+.fa-duotone.fa-person-swimming:after, .fa-duotone.fa-swimmer:after, .fad.fa-person-swimming:after, .fad.fa-swimmer:after {
+  content: "\f5c4\f5c4";
+}
+
+.fa-duotone.fa-arrow-down:after, .fad.fa-arrow-down:after {
+  content: "\f063\f063";
+}
+
+.fa-duotone.fa-user-robot-xmarks:after, .fad.fa-user-robot-xmarks:after {
+  content: "\e4a7\e4a7";
+}
+
+.fa-duotone.fa-comment-alt-quote:after, .fa-duotone.fa-message-quote:after, .fad.fa-comment-alt-quote:after, .fad.fa-message-quote:after {
+  content: "\e1e4\e1e4";
+}
+
+.fa-duotone.fa-candy-corn:after, .fad.fa-candy-corn:after {
+  content: "\f6bd\f6bd";
+}
+
+.fa-duotone.fa-folder-magnifying-glass:after, .fa-duotone.fa-folder-search:after, .fad.fa-folder-magnifying-glass:after, .fad.fa-folder-search:after {
+  content: "\e18b\e18b";
+}
+
+.fa-duotone.fa-notebook:after, .fad.fa-notebook:after {
+  content: "\e201\e201";
+}
+
+.fa-duotone.fa-circle-wifi:after, .fad.fa-circle-wifi:after {
+  content: "\e67d\e67d";
+}
+
+.fa-duotone.fa-droplet:after, .fa-duotone.fa-tint:after, .fad.fa-droplet:after, .fad.fa-tint:after {
+  content: "\f043\f043";
+}
+
+.fa-duotone.fa-bullseye-pointer:after, .fad.fa-bullseye-pointer:after {
+  content: "\f649\f649";
+}
+
+.fa-duotone.fa-eraser:after, .fad.fa-eraser:after {
+  content: "\f12d\f12d";
+}
+
+.fa-duotone.fa-hexagon-image:after, .fad.fa-hexagon-image:after {
+  content: "\e504\e504";
+}
+
+.fa-duotone.fa-earth-america:after, .fa-duotone.fa-earth-americas:after, .fa-duotone.fa-earth:after, .fa-duotone.fa-globe-americas:after, .fad.fa-earth-america:after, .fad.fa-earth-americas:after, .fad.fa-earth:after, .fad.fa-globe-americas:after {
+  content: "\f57d\f57d";
+}
+
+.fa-duotone.fa-file-svg:after, .fad.fa-file-svg:after {
+  content: "\e64b\e64b";
+}
+
+.fa-duotone.fa-crate-apple:after, .fad.fa-crate-apple:after {
+  content: "\f6b1\f6b1";
+}
+
+.fa-duotone.fa-apple-crate:after, .fad.fa-apple-crate:after {
+  content: "\f6b1\f6b1";
+}
+
+.fa-duotone.fa-person-burst:after, .fad.fa-person-burst:after {
+  content: "\e53b\e53b";
+}
+
+.fa-duotone.fa-game-board:after, .fad.fa-game-board:after {
+  content: "\f867\f867";
+}
+
+.fa-duotone.fa-hat-chef:after, .fad.fa-hat-chef:after {
+  content: "\f86b\f86b";
+}
+
+.fa-duotone.fa-hand-back-point-right:after, .fad.fa-hand-back-point-right:after {
+  content: "\e1a1\e1a1";
+}
+
+.fa-duotone.fa-dove:after, .fad.fa-dove:after {
+  content: "\f4ba\f4ba";
+}
+
+.fa-duotone.fa-snowflake-droplets:after, .fad.fa-snowflake-droplets:after {
+  content: "\e5c1\e5c1";
+}
+
+.fa-duotone.fa-battery-0:after, .fa-duotone.fa-battery-empty:after, .fad.fa-battery-0:after, .fad.fa-battery-empty:after {
+  content: "\f244\f244";
+}
+
+.fa-duotone.fa-grid-4:after, .fad.fa-grid-4:after {
+  content: "\e198\e198";
+}
+
+.fa-duotone.fa-socks:after, .fad.fa-socks:after {
+  content: "\f696\f696";
+}
+
+.fa-duotone.fa-face-sunglasses:after, .fad.fa-face-sunglasses:after {
+  content: "\e398\e398";
+}
+
+.fa-duotone.fa-inbox:after, .fad.fa-inbox:after {
+  content: "\f01c\f01c";
+}
+
+.fa-duotone.fa-square-0:after, .fad.fa-square-0:after {
+  content: "\e255\e255";
+}
+
+.fa-duotone.fa-section:after, .fad.fa-section:after {
+  content: "\e447\e447";
+}
+
+.fa-duotone.fa-box-up:after, .fa-duotone.fa-square-this-way-up:after, .fad.fa-box-up:after, .fad.fa-square-this-way-up:after {
+  content: "\f49f\f49f";
+}
+
+.fa-duotone.fa-gauge-high:after, .fa-duotone.fa-tachometer-alt-fast:after, .fa-duotone.fa-tachometer-alt:after, .fad.fa-gauge-high:after, .fad.fa-tachometer-alt-fast:after, .fad.fa-tachometer-alt:after {
+  content: "\f625\f625";
+}
+
+.fa-duotone.fa-square-ampersand:after, .fad.fa-square-ampersand:after {
+  content: "\e260\e260";
+}
+
+.fa-duotone.fa-envelope-open-text:after, .fad.fa-envelope-open-text:after {
+  content: "\f658\f658";
+}
+
+.fa-duotone.fa-lamp-desk:after, .fad.fa-lamp-desk:after {
+  content: "\e014\e014";
+}
+
+.fa-duotone.fa-hospital-alt:after, .fa-duotone.fa-hospital-wide:after, .fa-duotone.fa-hospital:after, .fad.fa-hospital-alt:after, .fad.fa-hospital-wide:after, .fad.fa-hospital:after {
+  content: "\f0f8\f0f8";
+}
+
+.fa-duotone.fa-poll-people:after, .fad.fa-poll-people:after {
+  content: "\f759\f759";
+}
+
+.fa-duotone.fa-glass-whiskey-rocks:after, .fa-duotone.fa-whiskey-glass-ice:after, .fad.fa-glass-whiskey-rocks:after, .fad.fa-whiskey-glass-ice:after {
+  content: "\f7a1\f7a1";
+}
+
+.fa-duotone.fa-wine-bottle:after, .fad.fa-wine-bottle:after {
+  content: "\f72f\f72f";
+}
+
+.fa-duotone.fa-chess-rook:after, .fad.fa-chess-rook:after {
+  content: "\f447\f447";
+}
+
+.fa-duotone.fa-user-bounty-hunter:after, .fad.fa-user-bounty-hunter:after {
+  content: "\e2bf\e2bf";
+}
+
+.fa-duotone.fa-bars-staggered:after, .fa-duotone.fa-reorder:after, .fa-duotone.fa-stream:after, .fad.fa-bars-staggered:after, .fad.fa-reorder:after, .fad.fa-stream:after {
+  content: "\f550\f550";
+}
+
+.fa-duotone.fa-diagram-sankey:after, .fad.fa-diagram-sankey:after {
+  content: "\e158\e158";
+}
+
+.fa-duotone.fa-cloud-hail-mixed:after, .fad.fa-cloud-hail-mixed:after {
+  content: "\f73a\f73a";
+}
+
+.fa-duotone.fa-circle-up-left:after, .fad.fa-circle-up-left:after {
+  content: "\e128\e128";
+}
+
+.fa-duotone.fa-dharmachakra:after, .fad.fa-dharmachakra:after {
+  content: "\f655\f655";
+}
+
+.fa-duotone.fa-objects-align-left:after, .fad.fa-objects-align-left:after {
+  content: "\e3be\e3be";
+}
+
+.fa-duotone.fa-oil-can-drip:after, .fad.fa-oil-can-drip:after {
+  content: "\e205\e205";
+}
+
+.fa-duotone.fa-face-smiling-hands:after, .fad.fa-face-smiling-hands:after {
+  content: "\e396\e396";
+}
+
+.fa-duotone.fa-broccoli:after, .fad.fa-broccoli:after {
+  content: "\e3e2\e3e2";
+}
+
+.fa-duotone.fa-route-interstate:after, .fad.fa-route-interstate:after {
+  content: "\f61b\f61b";
+}
+
+.fa-duotone.fa-ear-muffs:after, .fad.fa-ear-muffs:after {
+  content: "\f795\f795";
+}
+
+.fa-duotone.fa-hotdog:after, .fad.fa-hotdog:after {
+  content: "\f80f\f80f";
+}
+
+.fa-duotone.fa-transporter-empty:after, .fad.fa-transporter-empty:after {
+  content: "\e046\e046";
+}
+
+.fa-duotone.fa-blind:after, .fa-duotone.fa-person-walking-with-cane:after, .fad.fa-blind:after, .fad.fa-person-walking-with-cane:after {
+  content: "\f29d\f29d";
+}
+
+.fa-duotone.fa-angle-90:after, .fad.fa-angle-90:after {
+  content: "\e08d\e08d";
+}
+
+.fa-duotone.fa-rectangle-terminal:after, .fad.fa-rectangle-terminal:after {
+  content: "\e236\e236";
+}
+
+.fa-duotone.fa-kite:after, .fad.fa-kite:after {
+  content: "\f6f4\f6f4";
+}
+
+.fa-duotone.fa-drum:after, .fad.fa-drum:after {
+  content: "\f569\f569";
+}
+
+.fa-duotone.fa-scrubber:after, .fad.fa-scrubber:after {
+  content: "\f2f8\f2f8";
+}
+
+.fa-duotone.fa-ice-cream:after, .fad.fa-ice-cream:after {
+  content: "\f810\f810";
+}
+
+.fa-duotone.fa-heart-circle-bolt:after, .fad.fa-heart-circle-bolt:after {
+  content: "\e4fc\e4fc";
+}
+
+.fa-duotone.fa-fish-bones:after, .fad.fa-fish-bones:after {
+  content: "\e304\e304";
+}
+
+.fa-duotone.fa-deer-rudolph:after, .fad.fa-deer-rudolph:after {
+  content: "\f78f\f78f";
+}
+
+.fa-duotone.fa-fax:after, .fad.fa-fax:after {
+  content: "\f1ac\f1ac";
+}
+
+.fa-duotone.fa-paragraph:after, .fad.fa-paragraph:after {
+  content: "\f1dd\f1dd";
+}
+
+.fa-duotone.fa-head-side-heart:after, .fad.fa-head-side-heart:after {
+  content: "\e1aa\e1aa";
+}
+
+.fa-duotone.fa-square-e:after, .fad.fa-square-e:after {
+  content: "\e26d\e26d";
+}
+
+.fa-duotone.fa-meter-fire:after, .fad.fa-meter-fire:after {
+  content: "\e1eb\e1eb";
+}
+
+.fa-duotone.fa-cloud-hail:after, .fad.fa-cloud-hail:after {
+  content: "\f739\f739";
+}
+
+.fa-duotone.fa-check-to-slot:after, .fa-duotone.fa-vote-yea:after, .fad.fa-check-to-slot:after, .fad.fa-vote-yea:after {
+  content: "\f772\f772";
+}
+
+.fa-duotone.fa-money-from-bracket:after, .fad.fa-money-from-bracket:after {
+  content: "\e312\e312";
+}
+
+.fa-duotone.fa-star-half:after, .fad.fa-star-half:after {
+  content: "\f089\f089";
+}
+
+.fa-duotone.fa-car-bus:after, .fad.fa-car-bus:after {
+  content: "\f85a\f85a";
+}
+
+.fa-duotone.fa-speaker:after, .fad.fa-speaker:after {
+  content: "\f8df\f8df";
+}
+
+.fa-duotone.fa-timer:after, .fad.fa-timer:after {
+  content: "\e29e\e29e";
+}
+
+.fa-duotone.fa-boxes-alt:after, .fa-duotone.fa-boxes-stacked:after, .fa-duotone.fa-boxes:after, .fad.fa-boxes-alt:after, .fad.fa-boxes-stacked:after, .fad.fa-boxes:after {
+  content: "\f468\f468";
+}
+
+.fa-duotone.fa-landmark-magnifying-glass:after, .fad.fa-landmark-magnifying-glass:after {
+  content: "\e622\e622";
+}
+
+.fa-duotone.fa-grill-hot:after, .fad.fa-grill-hot:after {
+  content: "\e5a5\e5a5";
+}
+
+.fa-duotone.fa-ballot-check:after, .fad.fa-ballot-check:after {
+  content: "\f733\f733";
+}
+
+.fa-duotone.fa-chain:after, .fa-duotone.fa-link:after, .fad.fa-chain:after, .fad.fa-link:after {
+  content: "\f0c1\f0c1";
+}
+
+.fa-duotone.fa-assistive-listening-systems:after, .fa-duotone.fa-ear-listen:after, .fad.fa-assistive-listening-systems:after, .fad.fa-ear-listen:after {
+  content: "\f2a2\f2a2";
+}
+
+.fa-duotone.fa-file-minus:after, .fad.fa-file-minus:after {
+  content: "\f318\f318";
+}
+
+.fa-duotone.fa-tree-city:after, .fad.fa-tree-city:after {
+  content: "\e587\e587";
+}
+
+.fa-duotone.fa-play:after, .fad.fa-play:after {
+  content: "\f04b\f04b";
+}
+
+.fa-duotone.fa-font:after, .fad.fa-font:after {
+  content: "\f031\f031";
+}
+
+.fa-duotone.fa-coffee-togo:after, .fa-duotone.fa-cup-togo:after, .fad.fa-coffee-togo:after, .fad.fa-cup-togo:after {
+  content: "\f6c5\f6c5";
+}
+
+.fa-duotone.fa-square-down-left:after, .fad.fa-square-down-left:after {
+  content: "\e26b\e26b";
+}
+
+.fa-duotone.fa-burger-lettuce:after, .fad.fa-burger-lettuce:after {
+  content: "\e3e3\e3e3";
+}
+
+.fa-duotone.fa-table-cells-row-lock:after, .fad.fa-table-cells-row-lock:after {
+  content: "\e67a\e67a";
+}
+
+.fa-duotone.fa-rupiah-sign:after, .fad.fa-rupiah-sign:after {
+  content: "\e23d\e23d";
+}
+
+.fa-duotone.fa-magnifying-glass:after, .fa-duotone.fa-search:after, .fad.fa-magnifying-glass:after, .fad.fa-search:after {
+  content: "\f002\f002";
+}
+
+.fa-duotone.fa-ping-pong-paddle-ball:after, .fa-duotone.fa-table-tennis-paddle-ball:after, .fa-duotone.fa-table-tennis:after, .fad.fa-ping-pong-paddle-ball:after, .fad.fa-table-tennis-paddle-ball:after, .fad.fa-table-tennis:after {
+  content: "\f45d\f45d";
+}
+
+.fa-duotone.fa-diagnoses:after, .fa-duotone.fa-person-dots-from-line:after, .fad.fa-diagnoses:after, .fad.fa-person-dots-from-line:after {
+  content: "\f470\f470";
+}
+
+.fa-duotone.fa-chevron-double-down:after, .fa-duotone.fa-chevrons-down:after, .fad.fa-chevron-double-down:after, .fad.fa-chevrons-down:after {
+  content: "\f322\f322";
+}
+
+.fa-duotone.fa-trash-can-arrow-up:after, .fa-duotone.fa-trash-restore-alt:after, .fad.fa-trash-can-arrow-up:after, .fad.fa-trash-restore-alt:after {
+  content: "\f82a\f82a";
+}
+
+.fa-duotone.fa-signal-3:after, .fa-duotone.fa-signal-good:after, .fad.fa-signal-3:after, .fad.fa-signal-good:after {
+  content: "\f68e\f68e";
+}
+
+.fa-duotone.fa-location-question:after, .fa-duotone.fa-map-marker-question:after, .fad.fa-location-question:after, .fad.fa-map-marker-question:after {
+  content: "\f60b\f60b";
+}
+
+.fa-duotone.fa-floppy-disk-circle-xmark:after, .fa-duotone.fa-floppy-disk-times:after, .fa-duotone.fa-save-circle-xmark:after, .fa-duotone.fa-save-times:after, .fad.fa-floppy-disk-circle-xmark:after, .fad.fa-floppy-disk-times:after, .fad.fa-save-circle-xmark:after, .fad.fa-save-times:after {
+  content: "\e181\e181";
+}
+
+.fa-duotone.fa-naira-sign:after, .fad.fa-naira-sign:after {
+  content: "\e1f6\e1f6";
+}
+
+.fa-duotone.fa-peach:after, .fad.fa-peach:after {
+  content: "\e20b\e20b";
+}
+
+.fa-duotone.fa-taxi-bus:after, .fad.fa-taxi-bus:after {
+  content: "\e298\e298";
+}
+
+.fa-duotone.fa-bracket-curly-left:after, .fa-duotone.fa-bracket-curly:after, .fad.fa-bracket-curly-left:after, .fad.fa-bracket-curly:after {
+  content: "\7b\7b";
+}
+
+.fa-duotone.fa-lobster:after, .fad.fa-lobster:after {
+  content: "\e421\e421";
+}
+
+.fa-duotone.fa-cart-flatbed-empty:after, .fa-duotone.fa-dolly-flatbed-empty:after, .fad.fa-cart-flatbed-empty:after, .fad.fa-dolly-flatbed-empty:after {
+  content: "\f476\f476";
+}
+
+.fa-duotone.fa-colon:after, .fad.fa-colon:after {
+  content: "\3a\3a";
+}
+
+.fa-duotone.fa-cart-arrow-down:after, .fad.fa-cart-arrow-down:after {
+  content: "\f218\f218";
+}
+
+.fa-duotone.fa-wand:after, .fad.fa-wand:after {
+  content: "\f72a\f72a";
+}
+
+.fa-duotone.fa-walkie-talkie:after, .fad.fa-walkie-talkie:after {
+  content: "\f8ef\f8ef";
+}
+
+.fa-duotone.fa-file-edit:after, .fa-duotone.fa-file-pen:after, .fad.fa-file-edit:after, .fad.fa-file-pen:after {
+  content: "\f31c\f31c";
+}
+
+.fa-duotone.fa-receipt:after, .fad.fa-receipt:after {
+  content: "\f543\f543";
+}
+
+.fa-duotone.fa-table-picnic:after, .fad.fa-table-picnic:after {
+  content: "\e32d\e32d";
+}
+
+.fa-duotone.fa-pen-square:after, .fa-duotone.fa-pencil-square:after, .fa-duotone.fa-square-pen:after, .fad.fa-pen-square:after, .fad.fa-pencil-square:after, .fad.fa-square-pen:after {
+  content: "\f14b\f14b";
+}
+
+.fa-duotone.fa-circle-microphone-lines:after, .fa-duotone.fa-microphone-circle-alt:after, .fad.fa-circle-microphone-lines:after, .fad.fa-microphone-circle-alt:after {
+  content: "\e117\e117";
+}
+
+.fa-duotone.fa-desktop-slash:after, .fa-duotone.fa-display-slash:after, .fad.fa-desktop-slash:after, .fad.fa-display-slash:after {
+  content: "\e2fa\e2fa";
+}
+
+.fa-duotone.fa-suitcase-rolling:after, .fad.fa-suitcase-rolling:after {
+  content: "\f5c1\f5c1";
+}
+
+.fa-duotone.fa-person-circle-exclamation:after, .fad.fa-person-circle-exclamation:after {
+  content: "\e53f\e53f";
+}
+
+.fa-duotone.fa-transporter-2:after, .fad.fa-transporter-2:after {
+  content: "\e044\e044";
+}
+
+.fa-duotone.fa-hand-receiving:after, .fa-duotone.fa-hands-holding-diamond:after, .fad.fa-hand-receiving:after, .fad.fa-hands-holding-diamond:after {
+  content: "\f47c\f47c";
+}
+
+.fa-duotone.fa-money-bill-simple-wave:after, .fad.fa-money-bill-simple-wave:after {
+  content: "\e1f2\e1f2";
+}
+
+.fa-duotone.fa-chevron-down:after, .fad.fa-chevron-down:after {
+  content: "\f078\f078";
+}
+
+.fa-duotone.fa-battery-5:after, .fa-duotone.fa-battery-full:after, .fa-duotone.fa-battery:after, .fad.fa-battery-5:after, .fad.fa-battery-full:after, .fad.fa-battery:after {
+  content: "\f240\f240";
+}
+
+.fa-duotone.fa-bell-plus:after, .fad.fa-bell-plus:after {
+  content: "\f849\f849";
+}
+
+.fa-duotone.fa-book-arrow-right:after, .fad.fa-book-arrow-right:after {
+  content: "\e0b9\e0b9";
+}
+
+.fa-duotone.fa-hospitals:after, .fad.fa-hospitals:after {
+  content: "\f80e\f80e";
+}
+
+.fa-duotone.fa-club:after, .fad.fa-club:after {
+  content: "\f327\f327";
+}
+
+.fa-duotone.fa-skull-crossbones:after, .fad.fa-skull-crossbones:after {
+  content: "\f714\f714";
+}
+
+.fa-duotone.fa-dewpoint:after, .fa-duotone.fa-droplet-degree:after, .fad.fa-dewpoint:after, .fad.fa-droplet-degree:after {
+  content: "\f748\f748";
+}
+
+.fa-duotone.fa-code-compare:after, .fad.fa-code-compare:after {
+  content: "\e13a\e13a";
+}
+
+.fa-duotone.fa-list-dots:after, .fa-duotone.fa-list-ul:after, .fad.fa-list-dots:after, .fad.fa-list-ul:after {
+  content: "\f0ca\f0ca";
+}
+
+.fa-duotone.fa-hand-holding-magic:after, .fad.fa-hand-holding-magic:after {
+  content: "\f6e5\f6e5";
+}
+
+.fa-duotone.fa-watermelon-slice:after, .fad.fa-watermelon-slice:after {
+  content: "\e337\e337";
+}
+
+.fa-duotone.fa-circle-ellipsis:after, .fad.fa-circle-ellipsis:after {
+  content: "\e10a\e10a";
+}
+
+.fa-duotone.fa-school-lock:after, .fad.fa-school-lock:after {
+  content: "\e56f\e56f";
+}
+
+.fa-duotone.fa-tower-cell:after, .fad.fa-tower-cell:after {
+  content: "\e585\e585";
+}
+
+.fa-duotone.fa-sd-cards:after, .fad.fa-sd-cards:after {
+  content: "\e240\e240";
+}
+
+.fa-duotone.fa-jug-bottle:after, .fad.fa-jug-bottle:after {
+  content: "\e5fb\e5fb";
+}
+
+.fa-duotone.fa-down-long:after, .fa-duotone.fa-long-arrow-alt-down:after, .fad.fa-down-long:after, .fad.fa-long-arrow-alt-down:after {
+  content: "\f309\f309";
+}
+
+.fa-duotone.fa-envelopes:after, .fad.fa-envelopes:after {
+  content: "\e170\e170";
+}
+
+.fa-duotone.fa-phone-office:after, .fad.fa-phone-office:after {
+  content: "\f67d\f67d";
+}
+
+.fa-duotone.fa-ranking-star:after, .fad.fa-ranking-star:after {
+  content: "\e561\e561";
+}
+
+.fa-duotone.fa-chess-king:after, .fad.fa-chess-king:after {
+  content: "\f43f\f43f";
+}
+
+.fa-duotone.fa-nfc-pen:after, .fad.fa-nfc-pen:after {
+  content: "\e1fa\e1fa";
+}
+
+.fa-duotone.fa-person-harassing:after, .fad.fa-person-harassing:after {
+  content: "\e549\e549";
+}
+
+.fa-duotone.fa-magnifying-glass-play:after, .fad.fa-magnifying-glass-play:after {
+  content: "\e660\e660";
+}
+
+.fa-duotone.fa-hat-winter:after, .fad.fa-hat-winter:after {
+  content: "\f7a8\f7a8";
+}
+
+.fa-duotone.fa-brazilian-real-sign:after, .fad.fa-brazilian-real-sign:after {
+  content: "\e46c\e46c";
+}
+
+.fa-duotone.fa-landmark-alt:after, .fa-duotone.fa-landmark-dome:after, .fad.fa-landmark-alt:after, .fad.fa-landmark-dome:after {
+  content: "\f752\f752";
+}
+
+.fa-duotone.fa-bone-break:after, .fad.fa-bone-break:after {
+  content: "\f5d8\f5d8";
+}
+
+.fa-duotone.fa-arrow-up:after, .fad.fa-arrow-up:after {
+  content: "\f062\f062";
+}
+
+.fa-duotone.fa-down-from-dotted-line:after, .fad.fa-down-from-dotted-line:after {
+  content: "\e407\e407";
+}
+
+.fa-duotone.fa-television:after, .fa-duotone.fa-tv-alt:after, .fa-duotone.fa-tv:after, .fad.fa-television:after, .fad.fa-tv-alt:after, .fad.fa-tv:after {
+  content: "\f26c\f26c";
+}
+
+.fa-duotone.fa-border-left:after, .fad.fa-border-left:after {
+  content: "\f84f\f84f";
+}
+
+.fa-duotone.fa-circle-divide:after, .fad.fa-circle-divide:after {
+  content: "\e106\e106";
+}
+
+.fa-duotone.fa-shrimp:after, .fad.fa-shrimp:after {
+  content: "\e448\e448";
+}
+
+.fa-duotone.fa-list-check:after, .fa-duotone.fa-tasks:after, .fad.fa-list-check:after, .fad.fa-tasks:after {
+  content: "\f0ae\f0ae";
+}
+
+.fa-duotone.fa-diagram-subtask:after, .fad.fa-diagram-subtask:after {
+  content: "\e479\e479";
+}
+
+.fa-duotone.fa-jug-detergent:after, .fad.fa-jug-detergent:after {
+  content: "\e519\e519";
+}
+
+.fa-duotone.fa-circle-user:after, .fa-duotone.fa-user-circle:after, .fad.fa-circle-user:after, .fad.fa-user-circle:after {
+  content: "\f2bd\f2bd";
+}
+
+.fa-duotone.fa-square-y:after, .fad.fa-square-y:after {
+  content: "\e287\e287";
+}
+
+.fa-duotone.fa-user-doctor-hair:after, .fad.fa-user-doctor-hair:after {
+  content: "\e458\e458";
+}
+
+.fa-duotone.fa-planet-ringed:after, .fad.fa-planet-ringed:after {
+  content: "\e020\e020";
+}
+
+.fa-duotone.fa-mushroom:after, .fad.fa-mushroom:after {
+  content: "\e425\e425";
+}
+
+.fa-duotone.fa-user-shield:after, .fad.fa-user-shield:after {
+  content: "\f505\f505";
+}
+
+.fa-duotone.fa-megaphone:after, .fad.fa-megaphone:after {
+  content: "\f675\f675";
+}
+
+.fa-duotone.fa-wreath-laurel:after, .fad.fa-wreath-laurel:after {
+  content: "\e5d2\e5d2";
+}
+
+.fa-duotone.fa-circle-exclamation-check:after, .fad.fa-circle-exclamation-check:after {
+  content: "\e10d\e10d";
+}
+
+.fa-duotone.fa-wind:after, .fad.fa-wind:after {
+  content: "\f72e\f72e";
+}
+
+.fa-duotone.fa-box-dollar:after, .fa-duotone.fa-box-usd:after, .fad.fa-box-dollar:after, .fad.fa-box-usd:after {
+  content: "\f4a0\f4a0";
+}
+
+.fa-duotone.fa-car-burst:after, .fa-duotone.fa-car-crash:after, .fad.fa-car-burst:after, .fad.fa-car-crash:after {
+  content: "\f5e1\f5e1";
+}
+
+.fa-duotone.fa-y:after, .fad.fa-y:after {
+  content: "\59\59";
+}
+
+.fa-duotone.fa-user-headset:after, .fad.fa-user-headset:after {
+  content: "\f82d\f82d";
+}
+
+.fa-duotone.fa-arrows-retweet:after, .fa-duotone.fa-retweet-alt:after, .fad.fa-arrows-retweet:after, .fad.fa-retweet-alt:after {
+  content: "\f361\f361";
+}
+
+.fa-duotone.fa-person-snowboarding:after, .fa-duotone.fa-snowboarding:after, .fad.fa-person-snowboarding:after, .fad.fa-snowboarding:after {
+  content: "\f7ce\f7ce";
+}
+
+.fa-duotone.fa-chevron-square-right:after, .fa-duotone.fa-square-chevron-right:after, .fad.fa-chevron-square-right:after, .fad.fa-square-chevron-right:after {
+  content: "\f32b\f32b";
+}
+
+.fa-duotone.fa-lacrosse-stick-ball:after, .fad.fa-lacrosse-stick-ball:after {
+  content: "\e3b6\e3b6";
+}
+
+.fa-duotone.fa-shipping-fast:after, .fa-duotone.fa-truck-fast:after, .fad.fa-shipping-fast:after, .fad.fa-truck-fast:after {
+  content: "\f48b\f48b";
+}
+
+.fa-duotone.fa-user-magnifying-glass:after, .fad.fa-user-magnifying-glass:after {
+  content: "\e5c5\e5c5";
+}
+
+.fa-duotone.fa-star-sharp:after, .fad.fa-star-sharp:after {
+  content: "\e28b\e28b";
+}
+
+.fa-duotone.fa-comment-heart:after, .fad.fa-comment-heart:after {
+  content: "\e5c8\e5c8";
+}
+
+.fa-duotone.fa-circle-1:after, .fad.fa-circle-1:after {
+  content: "\e0ee\e0ee";
+}
+
+.fa-duotone.fa-circle-star:after, .fa-duotone.fa-star-circle:after, .fad.fa-circle-star:after, .fad.fa-star-circle:after {
+  content: "\e123\e123";
+}
+
+.fa-duotone.fa-fish:after, .fad.fa-fish:after {
+  content: "\f578\f578";
+}
+
+.fa-duotone.fa-cloud-fog:after, .fa-duotone.fa-fog:after, .fad.fa-cloud-fog:after, .fad.fa-fog:after {
+  content: "\f74e\f74e";
+}
+
+.fa-duotone.fa-waffle:after, .fad.fa-waffle:after {
+  content: "\e466\e466";
+}
+
+.fa-duotone.fa-music-alt:after, .fa-duotone.fa-music-note:after, .fad.fa-music-alt:after, .fad.fa-music-note:after {
+  content: "\f8cf\f8cf";
+}
+
+.fa-duotone.fa-hexagon-exclamation:after, .fad.fa-hexagon-exclamation:after {
+  content: "\e417\e417";
+}
+
+.fa-duotone.fa-cart-shopping-fast:after, .fad.fa-cart-shopping-fast:after {
+  content: "\e0dc\e0dc";
+}
+
+.fa-duotone.fa-object-union:after, .fad.fa-object-union:after {
+  content: "\e49f\e49f";
+}
+
+.fa-duotone.fa-user-graduate:after, .fad.fa-user-graduate:after {
+  content: "\f501\f501";
+}
+
+.fa-duotone.fa-starfighter:after, .fad.fa-starfighter:after {
+  content: "\e037\e037";
+}
+
+.fa-duotone.fa-adjust:after, .fa-duotone.fa-circle-half-stroke:after, .fad.fa-adjust:after, .fad.fa-circle-half-stroke:after {
+  content: "\f042\f042";
+}
+
+.fa-duotone.fa-arrow-right-long-to-line:after, .fad.fa-arrow-right-long-to-line:after {
+  content: "\e3d5\e3d5";
+}
+
+.fa-duotone.fa-arrow-square-down:after, .fa-duotone.fa-square-arrow-down:after, .fad.fa-arrow-square-down:after, .fad.fa-square-arrow-down:after {
+  content: "\f339\f339";
+}
+
+.fa-duotone.fa-diamond-half-stroke:after, .fad.fa-diamond-half-stroke:after {
+  content: "\e5b8\e5b8";
+}
+
+.fa-duotone.fa-clapperboard:after, .fad.fa-clapperboard:after {
+  content: "\e131\e131";
+}
+
+.fa-duotone.fa-chevron-square-left:after, .fa-duotone.fa-square-chevron-left:after, .fad.fa-chevron-square-left:after, .fad.fa-square-chevron-left:after {
+  content: "\f32a\f32a";
+}
+
+.fa-duotone.fa-phone-intercom:after, .fad.fa-phone-intercom:after {
+  content: "\e434\e434";
+}
+
+.fa-duotone.fa-chain-horizontal:after, .fa-duotone.fa-link-horizontal:after, .fad.fa-chain-horizontal:after, .fad.fa-link-horizontal:after {
+  content: "\e1cb\e1cb";
+}
+
+.fa-duotone.fa-mango:after, .fad.fa-mango:after {
+  content: "\e30f\e30f";
+}
+
+.fa-duotone.fa-music-alt-slash:after, .fa-duotone.fa-music-note-slash:after, .fad.fa-music-alt-slash:after, .fad.fa-music-note-slash:after {
+  content: "\f8d0\f8d0";
+}
+
+.fa-duotone.fa-circle-radiation:after, .fa-duotone.fa-radiation-alt:after, .fad.fa-circle-radiation:after, .fad.fa-radiation-alt:after {
+  content: "\f7ba\f7ba";
+}
+
+.fa-duotone.fa-face-tongue-sweat:after, .fad.fa-face-tongue-sweat:after {
+  content: "\e39e\e39e";
+}
+
+.fa-duotone.fa-globe-stand:after, .fad.fa-globe-stand:after {
+  content: "\f5f6\f5f6";
+}
+
+.fa-duotone.fa-baseball-ball:after, .fa-duotone.fa-baseball:after, .fad.fa-baseball-ball:after, .fad.fa-baseball:after {
+  content: "\f433\f433";
+}
+
+.fa-duotone.fa-circle-p:after, .fad.fa-circle-p:after {
+  content: "\e11a\e11a";
+}
+
+.fa-duotone.fa-award-simple:after, .fad.fa-award-simple:after {
+  content: "\e0ab\e0ab";
+}
+
+.fa-duotone.fa-jet-fighter-up:after, .fad.fa-jet-fighter-up:after {
+  content: "\e518\e518";
+}
+
+.fa-duotone.fa-diagram-project:after, .fa-duotone.fa-project-diagram:after, .fad.fa-diagram-project:after, .fad.fa-project-diagram:after {
+  content: "\f542\f542";
+}
+
+.fa-duotone.fa-pedestal:after, .fad.fa-pedestal:after {
+  content: "\e20d\e20d";
+}
+
+.fa-duotone.fa-chart-pyramid:after, .fad.fa-chart-pyramid:after {
+  content: "\e0e6\e0e6";
+}
+
+.fa-duotone.fa-sidebar:after, .fad.fa-sidebar:after {
+  content: "\e24e\e24e";
+}
+
+.fa-duotone.fa-frosty-head:after, .fa-duotone.fa-snowman-head:after, .fad.fa-frosty-head:after, .fad.fa-snowman-head:after {
+  content: "\f79b\f79b";
+}
+
+.fa-duotone.fa-copy:after, .fad.fa-copy:after {
+  content: "\f0c5\f0c5";
+}
+
+.fa-duotone.fa-burger-glass:after, .fad.fa-burger-glass:after {
+  content: "\e0ce\e0ce";
+}
+
+.fa-duotone.fa-volume-mute:after, .fa-duotone.fa-volume-times:after, .fa-duotone.fa-volume-xmark:after, .fad.fa-volume-mute:after, .fad.fa-volume-times:after, .fad.fa-volume-xmark:after {
+  content: "\f6a9\f6a9";
+}
+
+.fa-duotone.fa-hand-sparkles:after, .fad.fa-hand-sparkles:after {
+  content: "\e05d\e05d";
+}
+
+.fa-duotone.fa-bars-filter:after, .fad.fa-bars-filter:after {
+  content: "\e0ad\e0ad";
+}
+
+.fa-duotone.fa-paintbrush-pencil:after, .fad.fa-paintbrush-pencil:after {
+  content: "\e206\e206";
+}
+
+.fa-duotone.fa-party-bell:after, .fad.fa-party-bell:after {
+  content: "\e31a\e31a";
+}
+
+.fa-duotone.fa-user-vneck-hair:after, .fad.fa-user-vneck-hair:after {
+  content: "\e462\e462";
+}
+
+.fa-duotone.fa-jack-o-lantern:after, .fad.fa-jack-o-lantern:after {
+  content: "\f30e\f30e";
+}
+
+.fa-duotone.fa-grip-horizontal:after, .fa-duotone.fa-grip:after, .fad.fa-grip-horizontal:after, .fad.fa-grip:after {
+  content: "\f58d\f58d";
+}
+
+.fa-duotone.fa-share-from-square:after, .fa-duotone.fa-share-square:after, .fad.fa-share-from-square:after, .fad.fa-share-square:after {
+  content: "\f14d\f14d";
+}
+
+.fa-duotone.fa-keynote:after, .fad.fa-keynote:after {
+  content: "\f66c\f66c";
+}
+
+.fa-duotone.fa-child-combatant:after, .fa-duotone.fa-child-rifle:after, .fad.fa-child-combatant:after, .fad.fa-child-rifle:after {
+  content: "\e4e0\e4e0";
+}
+
+.fa-duotone.fa-gun:after, .fad.fa-gun:after {
+  content: "\e19b\e19b";
+}
+
+.fa-duotone.fa-phone-square:after, .fa-duotone.fa-square-phone:after, .fad.fa-phone-square:after, .fad.fa-square-phone:after {
+  content: "\f098\f098";
+}
+
+.fa-duotone.fa-hat-beach:after, .fad.fa-hat-beach:after {
+  content: "\e606\e606";
+}
+
+.fa-duotone.fa-add:after, .fa-duotone.fa-plus:after, .fad.fa-add:after, .fad.fa-plus:after {
+  content: "\2b\2b";
+}
+
+.fa-duotone.fa-expand:after, .fad.fa-expand:after {
+  content: "\f065\f065";
+}
+
+.fa-duotone.fa-computer:after, .fad.fa-computer:after {
+  content: "\e4e5\e4e5";
+}
+
+.fa-duotone.fa-fort:after, .fad.fa-fort:after {
+  content: "\e486\e486";
+}
+
+.fa-duotone.fa-cloud-check:after, .fad.fa-cloud-check:after {
+  content: "\e35c\e35c";
+}
+
+.fa-duotone.fa-close:after, .fa-duotone.fa-multiply:after, .fa-duotone.fa-remove:after, .fa-duotone.fa-times:after, .fa-duotone.fa-xmark:after, .fad.fa-close:after, .fad.fa-multiply:after, .fad.fa-remove:after, .fad.fa-times:after, .fad.fa-xmark:after {
+  content: "\f00d\f00d";
+}
+
+.fa-duotone.fa-face-smirking:after, .fad.fa-face-smirking:after {
+  content: "\e397\e397";
+}
+
+.fa-duotone.fa-arrows-up-down-left-right:after, .fa-duotone.fa-arrows:after, .fad.fa-arrows-up-down-left-right:after, .fad.fa-arrows:after {
+  content: "\f047\f047";
+}
+
+.fa-duotone.fa-chalkboard-teacher:after, .fa-duotone.fa-chalkboard-user:after, .fad.fa-chalkboard-teacher:after, .fad.fa-chalkboard-user:after {
+  content: "\f51c\f51c";
+}
+
+.fa-duotone.fa-rhombus:after, .fad.fa-rhombus:after {
+  content: "\e23b\e23b";
+}
+
+.fa-duotone.fa-claw-marks:after, .fad.fa-claw-marks:after {
+  content: "\f6c2\f6c2";
+}
+
+.fa-duotone.fa-peso-sign:after, .fad.fa-peso-sign:after {
+  content: "\e222\e222";
+}
+
+.fa-duotone.fa-face-smile-tongue:after, .fad.fa-face-smile-tongue:after {
+  content: "\e394\e394";
+}
+
+.fa-duotone.fa-cart-circle-xmark:after, .fad.fa-cart-circle-xmark:after {
+  content: "\e3f4\e3f4";
+}
+
+.fa-duotone.fa-building-shield:after, .fad.fa-building-shield:after {
+  content: "\e4d8\e4d8";
+}
+
+.fa-duotone.fa-circle-phone-flip:after, .fa-duotone.fa-phone-circle-alt:after, .fad.fa-circle-phone-flip:after, .fad.fa-phone-circle-alt:after {
+  content: "\e11c\e11c";
+}
+
+.fa-duotone.fa-baby:after, .fad.fa-baby:after {
+  content: "\f77c\f77c";
+}
+
+.fa-duotone.fa-users-line:after, .fad.fa-users-line:after {
+  content: "\e592\e592";
+}
+
+.fa-duotone.fa-quote-left-alt:after, .fa-duotone.fa-quote-left:after, .fad.fa-quote-left-alt:after, .fad.fa-quote-left:after {
+  content: "\f10d\f10d";
+}
+
+.fa-duotone.fa-tractor:after, .fad.fa-tractor:after {
+  content: "\f722\f722";
+}
+
+.fa-duotone.fa-down-from-bracket:after, .fad.fa-down-from-bracket:after {
+  content: "\e66b\e66b";
+}
+
+.fa-duotone.fa-key-skeleton:after, .fad.fa-key-skeleton:after {
+  content: "\f6f3\f6f3";
+}
+
+.fa-duotone.fa-trash-arrow-up:after, .fa-duotone.fa-trash-restore:after, .fad.fa-trash-arrow-up:after, .fad.fa-trash-restore:after {
+  content: "\f829\f829";
+}
+
+.fa-duotone.fa-arrow-down-up-lock:after, .fad.fa-arrow-down-up-lock:after {
+  content: "\e4b0\e4b0";
+}
+
+.fa-duotone.fa-arrow-down-to-bracket:after, .fad.fa-arrow-down-to-bracket:after {
+  content: "\e094\e094";
+}
+
+.fa-duotone.fa-lines-leaning:after, .fad.fa-lines-leaning:after {
+  content: "\e51e\e51e";
+}
+
+.fa-duotone.fa-square-q:after, .fad.fa-square-q:after {
+  content: "\e27b\e27b";
+}
+
+.fa-duotone.fa-ruler-combined:after, .fad.fa-ruler-combined:after {
+  content: "\f546\f546";
+}
+
+.fa-duotone.fa-icons-alt:after, .fa-duotone.fa-symbols:after, .fad.fa-icons-alt:after, .fad.fa-symbols:after {
+  content: "\f86e\f86e";
+}
+
+.fa-duotone.fa-copyright:after, .fad.fa-copyright:after {
+  content: "\f1f9\f1f9";
+}
+
+.fa-duotone.fa-flask-gear:after, .fad.fa-flask-gear:after {
+  content: "\e5f1\e5f1";
+}
+
+.fa-duotone.fa-highlighter-line:after, .fad.fa-highlighter-line:after {
+  content: "\e1af\e1af";
+}
+
+.fa-duotone.fa-bracket-left:after, .fa-duotone.fa-bracket-square:after, .fa-duotone.fa-bracket:after, .fad.fa-bracket-left:after, .fad.fa-bracket-square:after, .fad.fa-bracket:after {
+  content: "\5b\5b";
+}
+
+.fa-duotone.fa-island-tree-palm:after, .fa-duotone.fa-island-tropical:after, .fad.fa-island-tree-palm:after, .fad.fa-island-tropical:after {
+  content: "\f811\f811";
+}
+
+.fa-duotone.fa-arrow-from-left:after, .fa-duotone.fa-arrow-right-from-line:after, .fad.fa-arrow-from-left:after, .fad.fa-arrow-right-from-line:after {
+  content: "\f343\f343";
+}
+
+.fa-duotone.fa-h2:after, .fad.fa-h2:after {
+  content: "\f314\f314";
+}
+
+.fa-duotone.fa-equals:after, .fad.fa-equals:after {
+  content: "\3d\3d";
+}
+
+.fa-duotone.fa-cake-slice:after, .fa-duotone.fa-shortcake:after, .fad.fa-cake-slice:after, .fad.fa-shortcake:after {
+  content: "\e3e5\e3e5";
+}
+
+.fa-duotone.fa-building-magnifying-glass:after, .fad.fa-building-magnifying-glass:after {
+  content: "\e61c\e61c";
+}
+
+.fa-duotone.fa-peanut:after, .fad.fa-peanut:after {
+  content: "\e430\e430";
+}
+
+.fa-duotone.fa-wrench-simple:after, .fad.fa-wrench-simple:after {
+  content: "\e2d1\e2d1";
+}
+
+.fa-duotone.fa-blender:after, .fad.fa-blender:after {
+  content: "\f517\f517";
+}
+
+.fa-duotone.fa-teeth:after, .fad.fa-teeth:after {
+  content: "\f62e\f62e";
+}
+
+.fa-duotone.fa-tally-2:after, .fad.fa-tally-2:after {
+  content: "\e295\e295";
+}
+
+.fa-duotone.fa-ils:after, .fa-duotone.fa-shekel-sign:after, .fa-duotone.fa-shekel:after, .fa-duotone.fa-sheqel-sign:after, .fa-duotone.fa-sheqel:after, .fad.fa-ils:after, .fad.fa-shekel-sign:after, .fad.fa-shekel:after, .fad.fa-sheqel-sign:after, .fad.fa-sheqel:after {
+  content: "\f20b\f20b";
+}
+
+.fa-duotone.fa-cars:after, .fad.fa-cars:after {
+  content: "\f85b\f85b";
+}
+
+.fa-duotone.fa-axe-battle:after, .fad.fa-axe-battle:after {
+  content: "\f6b3\f6b3";
+}
+
+.fa-duotone.fa-user-hair-long:after, .fad.fa-user-hair-long:after {
+  content: "\e45b\e45b";
+}
+
+.fa-duotone.fa-map:after, .fad.fa-map:after {
+  content: "\f279\f279";
+}
+
+.fa-duotone.fa-arrow-left-from-arc:after, .fad.fa-arrow-left-from-arc:after {
+  content: "\e615\e615";
+}
+
+.fa-duotone.fa-file-circle-info:after, .fad.fa-file-circle-info:after {
+  content: "\e493\e493";
+}
+
+.fa-duotone.fa-face-disappointed:after, .fad.fa-face-disappointed:after {
+  content: "\e36f\e36f";
+}
+
+.fa-duotone.fa-lasso-sparkles:after, .fad.fa-lasso-sparkles:after {
+  content: "\e1c9\e1c9";
+}
+
+.fa-duotone.fa-clock-eleven:after, .fad.fa-clock-eleven:after {
+  content: "\e347\e347";
+}
+
+.fa-duotone.fa-rocket:after, .fad.fa-rocket:after {
+  content: "\f135\f135";
+}
+
+.fa-duotone.fa-siren-on:after, .fad.fa-siren-on:after {
+  content: "\e02e\e02e";
+}
+
+.fa-duotone.fa-clock-ten:after, .fad.fa-clock-ten:after {
+  content: "\e354\e354";
+}
+
+.fa-duotone.fa-candle-holder:after, .fad.fa-candle-holder:after {
+  content: "\f6bc\f6bc";
+}
+
+.fa-duotone.fa-video-arrow-down-left:after, .fad.fa-video-arrow-down-left:after {
+  content: "\e2c8\e2c8";
+}
+
+.fa-duotone.fa-photo-film:after, .fa-duotone.fa-photo-video:after, .fad.fa-photo-film:after, .fad.fa-photo-video:after {
+  content: "\f87c\f87c";
+}
+
+.fa-duotone.fa-floppy-disk-circle-arrow-right:after, .fa-duotone.fa-save-circle-arrow-right:after, .fad.fa-floppy-disk-circle-arrow-right:after, .fad.fa-save-circle-arrow-right:after {
+  content: "\e180\e180";
+}
+
+.fa-duotone.fa-folder-minus:after, .fad.fa-folder-minus:after {
+  content: "\f65d\f65d";
+}
+
+.fa-duotone.fa-planet-moon:after, .fad.fa-planet-moon:after {
+  content: "\e01f\e01f";
+}
+
+.fa-duotone.fa-face-eyes-xmarks:after, .fad.fa-face-eyes-xmarks:after {
+  content: "\e374\e374";
+}
+
+.fa-duotone.fa-chart-scatter:after, .fad.fa-chart-scatter:after {
+  content: "\f7ee\f7ee";
+}
+
+.fa-duotone.fa-circle-gf:after, .fad.fa-circle-gf:after {
+  content: "\e67f\e67f";
+}
+
+.fa-duotone.fa-display-arrow-down:after, .fad.fa-display-arrow-down:after {
+  content: "\e164\e164";
+}
+
+.fa-duotone.fa-store:after, .fad.fa-store:after {
+  content: "\f54e\f54e";
+}
+
+.fa-duotone.fa-arrow-trend-up:after, .fad.fa-arrow-trend-up:after {
+  content: "\e098\e098";
+}
+
+.fa-duotone.fa-plug-circle-minus:after, .fad.fa-plug-circle-minus:after {
+  content: "\e55e\e55e";
+}
+
+.fa-duotone.fa-olive-branch:after, .fad.fa-olive-branch:after {
+  content: "\e317\e317";
+}
+
+.fa-duotone.fa-angle:after, .fad.fa-angle:after {
+  content: "\e08c\e08c";
+}
+
+.fa-duotone.fa-vacuum-robot:after, .fad.fa-vacuum-robot:after {
+  content: "\e04e\e04e";
+}
+
+.fa-duotone.fa-sign-hanging:after, .fa-duotone.fa-sign:after, .fad.fa-sign-hanging:after, .fad.fa-sign:after {
+  content: "\f4d9\f4d9";
+}
+
+.fa-duotone.fa-square-divide:after, .fad.fa-square-divide:after {
+  content: "\e26a\e26a";
+}
+
+.fa-duotone.fa-folder-check:after, .fad.fa-folder-check:after {
+  content: "\e64e\e64e";
+}
+
+.fa-duotone.fa-signal-stream-slash:after, .fad.fa-signal-stream-slash:after {
+  content: "\e250\e250";
+}
+
+.fa-duotone.fa-bezier-curve:after, .fad.fa-bezier-curve:after {
+  content: "\f55b\f55b";
+}
+
+.fa-duotone.fa-eye-dropper-half:after, .fad.fa-eye-dropper-half:after {
+  content: "\e173\e173";
+}
+
+.fa-duotone.fa-store-lock:after, .fad.fa-store-lock:after {
+  content: "\e4a6\e4a6";
+}
+
+.fa-duotone.fa-bell-slash:after, .fad.fa-bell-slash:after {
+  content: "\f1f6\f1f6";
+}
+
+.fa-duotone.fa-cloud-bolt-sun:after, .fa-duotone.fa-thunderstorm-sun:after, .fad.fa-cloud-bolt-sun:after, .fad.fa-thunderstorm-sun:after {
+  content: "\f76e\f76e";
+}
+
+.fa-duotone.fa-camera-slash:after, .fad.fa-camera-slash:after {
+  content: "\e0d9\e0d9";
+}
+
+.fa-duotone.fa-comment-quote:after, .fad.fa-comment-quote:after {
+  content: "\e14c\e14c";
+}
+
+.fa-duotone.fa-tablet-android:after, .fa-duotone.fa-tablet:after, .fad.fa-tablet-android:after, .fad.fa-tablet:after {
+  content: "\f3fb\f3fb";
+}
+
+.fa-duotone.fa-school-flag:after, .fad.fa-school-flag:after {
+  content: "\e56e\e56e";
+}
+
+.fa-duotone.fa-message-code:after, .fad.fa-message-code:after {
+  content: "\e1df\e1df";
+}
+
+.fa-duotone.fa-glass-half-empty:after, .fa-duotone.fa-glass-half-full:after, .fa-duotone.fa-glass-half:after, .fad.fa-glass-half-empty:after, .fad.fa-glass-half-full:after, .fad.fa-glass-half:after {
+  content: "\e192\e192";
+}
+
+.fa-duotone.fa-fill:after, .fad.fa-fill:after {
+  content: "\f575\f575";
+}
+
+.fa-duotone.fa-comment-alt-minus:after, .fa-duotone.fa-message-minus:after, .fad.fa-comment-alt-minus:after, .fad.fa-message-minus:after {
+  content: "\f4a7\f4a7";
+}
+
+.fa-duotone.fa-angle-up:after, .fad.fa-angle-up:after {
+  content: "\f106\f106";
+}
+
+.fa-duotone.fa-dinosaur:after, .fad.fa-dinosaur:after {
+  content: "\e5fe\e5fe";
+}
+
+.fa-duotone.fa-drumstick-bite:after, .fad.fa-drumstick-bite:after {
+  content: "\f6d7\f6d7";
+}
+
+.fa-duotone.fa-chain-horizontal-slash:after, .fa-duotone.fa-link-horizontal-slash:after, .fad.fa-chain-horizontal-slash:after, .fad.fa-link-horizontal-slash:after {
+  content: "\e1cc\e1cc";
+}
+
+.fa-duotone.fa-holly-berry:after, .fad.fa-holly-berry:after {
+  content: "\f7aa\f7aa";
+}
+
+.fa-duotone.fa-nose:after, .fad.fa-nose:after {
+  content: "\e5bd\e5bd";
+}
+
+.fa-duotone.fa-arrow-left-to-arc:after, .fad.fa-arrow-left-to-arc:after {
+  content: "\e616\e616";
+}
+
+.fa-duotone.fa-chevron-left:after, .fad.fa-chevron-left:after {
+  content: "\f053\f053";
+}
+
+.fa-duotone.fa-bacteria:after, .fad.fa-bacteria:after {
+  content: "\e059\e059";
+}
+
+.fa-duotone.fa-clouds:after, .fad.fa-clouds:after {
+  content: "\f744\f744";
+}
+
+.fa-duotone.fa-money-bill-simple:after, .fad.fa-money-bill-simple:after {
+  content: "\e1f1\e1f1";
+}
+
+.fa-duotone.fa-hand-lizard:after, .fad.fa-hand-lizard:after {
+  content: "\f258\f258";
+}
+
+.fa-duotone.fa-table-pivot:after, .fad.fa-table-pivot:after {
+  content: "\e291\e291";
+}
+
+.fa-duotone.fa-filter-slash:after, .fad.fa-filter-slash:after {
+  content: "\e17d\e17d";
+}
+
+.fa-duotone.fa-trash-can-arrow-turn-left:after, .fa-duotone.fa-trash-can-undo:after, .fa-duotone.fa-trash-undo-alt:after, .fad.fa-trash-can-arrow-turn-left:after, .fad.fa-trash-can-undo:after, .fad.fa-trash-undo-alt:after {
+  content: "\f896\f896";
+}
+
+.fa-duotone.fa-notdef:after, .fad.fa-notdef:after {
+  content: "\e1fe\e1fe";
+}
+
+.fa-duotone.fa-disease:after, .fad.fa-disease:after {
+  content: "\f7fa\f7fa";
+}
+
+.fa-duotone.fa-person-to-door:after, .fad.fa-person-to-door:after {
+  content: "\e433\e433";
+}
+
+.fa-duotone.fa-turntable:after, .fad.fa-turntable:after {
+  content: "\f8e4\f8e4";
+}
+
+.fa-duotone.fa-briefcase-medical:after, .fad.fa-briefcase-medical:after {
+  content: "\f469\f469";
+}
+
+.fa-duotone.fa-genderless:after, .fad.fa-genderless:after {
+  content: "\f22d\f22d";
+}
+
+.fa-duotone.fa-chevron-right:after, .fad.fa-chevron-right:after {
+  content: "\f054\f054";
+}
+
+.fa-duotone.fa-signal-1:after, .fa-duotone.fa-signal-weak:after, .fad.fa-signal-1:after, .fad.fa-signal-weak:after {
+  content: "\f68c\f68c";
+}
+
+.fa-duotone.fa-clock-five:after, .fad.fa-clock-five:after {
+  content: "\e349\e349";
+}
+
+.fa-duotone.fa-retweet:after, .fad.fa-retweet:after {
+  content: "\f079\f079";
+}
+
+.fa-duotone.fa-car-alt:after, .fa-duotone.fa-car-rear:after, .fad.fa-car-alt:after, .fad.fa-car-rear:after {
+  content: "\f5de\f5de";
+}
+
+.fa-duotone.fa-pump-soap:after, .fad.fa-pump-soap:after {
+  content: "\e06b\e06b";
+}
+
+.fa-duotone.fa-computer-classic:after, .fad.fa-computer-classic:after {
+  content: "\f8b1\f8b1";
+}
+
+.fa-duotone.fa-frame:after, .fad.fa-frame:after {
+  content: "\e495\e495";
+}
+
+.fa-duotone.fa-video-slash:after, .fad.fa-video-slash:after {
+  content: "\f4e2\f4e2";
+}
+
+.fa-duotone.fa-battery-2:after, .fa-duotone.fa-battery-quarter:after, .fad.fa-battery-2:after, .fad.fa-battery-quarter:after {
+  content: "\f243\f243";
+}
+
+.fa-duotone.fa-ellipsis-h-alt:after, .fa-duotone.fa-ellipsis-stroke:after, .fad.fa-ellipsis-h-alt:after, .fad.fa-ellipsis-stroke:after {
+  content: "\f39b\f39b";
+}
+
+.fa-duotone.fa-radio:after, .fad.fa-radio:after {
+  content: "\f8d7\f8d7";
+}
+
+.fa-duotone.fa-baby-carriage:after, .fa-duotone.fa-carriage-baby:after, .fad.fa-baby-carriage:after, .fad.fa-carriage-baby:after {
+  content: "\f77d\f77d";
+}
+
+.fa-duotone.fa-face-expressionless:after, .fad.fa-face-expressionless:after {
+  content: "\e373\e373";
+}
+
+.fa-duotone.fa-down-to-dotted-line:after, .fad.fa-down-to-dotted-line:after {
+  content: "\e408\e408";
+}
+
+.fa-duotone.fa-cloud-music:after, .fad.fa-cloud-music:after {
+  content: "\f8ae\f8ae";
+}
+
+.fa-duotone.fa-traffic-light:after, .fad.fa-traffic-light:after {
+  content: "\f637\f637";
+}
+
+.fa-duotone.fa-cloud-minus:after, .fad.fa-cloud-minus:after {
+  content: "\e35d\e35d";
+}
+
+.fa-duotone.fa-thermometer:after, .fad.fa-thermometer:after {
+  content: "\f491\f491";
+}
+
+.fa-duotone.fa-shield-minus:after, .fad.fa-shield-minus:after {
+  content: "\e249\e249";
+}
+
+.fa-duotone.fa-vr-cardboard:after, .fad.fa-vr-cardboard:after {
+  content: "\f729\f729";
+}
+
+.fa-duotone.fa-car-tilt:after, .fad.fa-car-tilt:after {
+  content: "\f5e5\f5e5";
+}
+
+.fa-duotone.fa-gauge-circle-minus:after, .fad.fa-gauge-circle-minus:after {
+  content: "\e497\e497";
+}
+
+.fa-duotone.fa-brightness-low:after, .fad.fa-brightness-low:after {
+  content: "\e0ca\e0ca";
+}
+
+.fa-duotone.fa-hand-middle-finger:after, .fad.fa-hand-middle-finger:after {
+  content: "\f806\f806";
+}
+
+.fa-duotone.fa-percent:after, .fa-duotone.fa-percentage:after, .fad.fa-percent:after, .fad.fa-percentage:after {
+  content: "\25\25";
+}
+
+.fa-duotone.fa-truck-moving:after, .fad.fa-truck-moving:after {
+  content: "\f4df\f4df";
+}
+
+.fa-duotone.fa-glass-water-droplet:after, .fad.fa-glass-water-droplet:after {
+  content: "\e4f5\e4f5";
+}
+
+.fa-duotone.fa-conveyor-belt:after, .fad.fa-conveyor-belt:after {
+  content: "\f46e\f46e";
+}
+
+.fa-duotone.fa-location-check:after, .fa-duotone.fa-map-marker-check:after, .fad.fa-location-check:after, .fad.fa-map-marker-check:after {
+  content: "\f606\f606";
+}
+
+.fa-duotone.fa-coin-vertical:after, .fad.fa-coin-vertical:after {
+  content: "\e3fd\e3fd";
+}
+
+.fa-duotone.fa-display:after, .fad.fa-display:after {
+  content: "\e163\e163";
+}
+
+.fa-duotone.fa-person-sign:after, .fad.fa-person-sign:after {
+  content: "\f757\f757";
+}
+
+.fa-duotone.fa-face-smile:after, .fa-duotone.fa-smile:after, .fad.fa-face-smile:after, .fad.fa-smile:after {
+  content: "\f118\f118";
+}
+
+.fa-duotone.fa-phone-hangup:after, .fad.fa-phone-hangup:after {
+  content: "\e225\e225";
+}
+
+.fa-duotone.fa-signature-slash:after, .fad.fa-signature-slash:after {
+  content: "\e3cb\e3cb";
+}
+
+.fa-duotone.fa-thumb-tack:after, .fa-duotone.fa-thumbtack:after, .fad.fa-thumb-tack:after, .fad.fa-thumbtack:after {
+  content: "\f08d\f08d";
+}
+
+.fa-duotone.fa-wheat-slash:after, .fad.fa-wheat-slash:after {
+  content: "\e339\e339";
+}
+
+.fa-duotone.fa-trophy:after, .fad.fa-trophy:after {
+  content: "\f091\f091";
+}
+
+.fa-duotone.fa-clouds-sun:after, .fad.fa-clouds-sun:after {
+  content: "\f746\f746";
+}
+
+.fa-duotone.fa-person-praying:after, .fa-duotone.fa-pray:after, .fad.fa-person-praying:after, .fad.fa-pray:after {
+  content: "\f683\f683";
+}
+
+.fa-duotone.fa-hammer:after, .fad.fa-hammer:after {
+  content: "\f6e3\f6e3";
+}
+
+.fa-duotone.fa-face-vomit:after, .fad.fa-face-vomit:after {
+  content: "\e3a0\e3a0";
+}
+
+.fa-duotone.fa-speakers:after, .fad.fa-speakers:after {
+  content: "\f8e0\f8e0";
+}
+
+.fa-duotone.fa-teletype-answer:after, .fa-duotone.fa-tty-answer:after, .fad.fa-teletype-answer:after, .fad.fa-tty-answer:after {
+  content: "\e2b9\e2b9";
+}
+
+.fa-duotone.fa-mug-tea-saucer:after, .fad.fa-mug-tea-saucer:after {
+  content: "\e1f5\e1f5";
+}
+
+.fa-duotone.fa-diagram-lean-canvas:after, .fad.fa-diagram-lean-canvas:after {
+  content: "\e156\e156";
+}
+
+.fa-duotone.fa-alt:after, .fad.fa-alt:after {
+  content: "\e08a\e08a";
+}
+
+.fa-duotone.fa-dial-med-high:after, .fa-duotone.fa-dial:after, .fad.fa-dial-med-high:after, .fad.fa-dial:after {
+  content: "\e15b\e15b";
+}
+
+.fa-duotone.fa-hand-peace:after, .fad.fa-hand-peace:after {
+  content: "\f25b\f25b";
+}
+
+.fa-duotone.fa-circle-trash:after, .fa-duotone.fa-trash-circle:after, .fad.fa-circle-trash:after, .fad.fa-trash-circle:after {
+  content: "\e126\e126";
+}
+
+.fa-duotone.fa-rotate:after, .fa-duotone.fa-sync-alt:after, .fad.fa-rotate:after, .fad.fa-sync-alt:after {
+  content: "\f2f1\f2f1";
+}
+
+.fa-duotone.fa-circle-quarters:after, .fad.fa-circle-quarters:after {
+  content: "\e3f8\e3f8";
+}
+
+.fa-duotone.fa-spinner:after, .fad.fa-spinner:after {
+  content: "\f110\f110";
+}
+
+.fa-duotone.fa-tower-control:after, .fad.fa-tower-control:after {
+  content: "\e2a2\e2a2";
+}
+
+.fa-duotone.fa-arrow-up-triangle-square:after, .fa-duotone.fa-sort-shapes-up:after, .fad.fa-arrow-up-triangle-square:after, .fad.fa-sort-shapes-up:after {
+  content: "\f88a\f88a";
+}
+
+.fa-duotone.fa-whale:after, .fad.fa-whale:after {
+  content: "\f72c\f72c";
+}
+
+.fa-duotone.fa-robot:after, .fad.fa-robot:after {
+  content: "\f544\f544";
+}
+
+.fa-duotone.fa-peace:after, .fad.fa-peace:after {
+  content: "\f67c\f67c";
+}
+
+.fa-duotone.fa-party-horn:after, .fad.fa-party-horn:after {
+  content: "\e31b\e31b";
+}
+
+.fa-duotone.fa-cogs:after, .fa-duotone.fa-gears:after, .fad.fa-cogs:after, .fad.fa-gears:after {
+  content: "\f085\f085";
+}
+
+.fa-duotone.fa-sun-alt:after, .fa-duotone.fa-sun-bright:after, .fad.fa-sun-alt:after, .fad.fa-sun-bright:after {
+  content: "\e28f\e28f";
+}
+
+.fa-duotone.fa-warehouse:after, .fad.fa-warehouse:after {
+  content: "\f494\f494";
+}
+
+.fa-duotone.fa-conveyor-belt-arm:after, .fad.fa-conveyor-belt-arm:after {
+  content: "\e5f8\e5f8";
+}
+
+.fa-duotone.fa-lock-keyhole-open:after, .fa-duotone.fa-lock-open-alt:after, .fad.fa-lock-keyhole-open:after, .fad.fa-lock-open-alt:after {
+  content: "\f3c2\f3c2";
+}
+
+.fa-duotone.fa-box-fragile:after, .fa-duotone.fa-square-fragile:after, .fa-duotone.fa-square-wine-glass-crack:after, .fad.fa-box-fragile:after, .fad.fa-square-fragile:after, .fad.fa-square-wine-glass-crack:after {
+  content: "\f49b\f49b";
+}
+
+.fa-duotone.fa-arrow-up-right-dots:after, .fad.fa-arrow-up-right-dots:after {
+  content: "\e4b7\e4b7";
+}
+
+.fa-duotone.fa-square-n:after, .fad.fa-square-n:after {
+  content: "\e277\e277";
+}
+
+.fa-duotone.fa-splotch:after, .fad.fa-splotch:after {
+  content: "\f5bc\f5bc";
+}
+
+.fa-duotone.fa-face-grin-hearts:after, .fa-duotone.fa-grin-hearts:after, .fad.fa-face-grin-hearts:after, .fad.fa-grin-hearts:after {
+  content: "\f584\f584";
+}
+
+.fa-duotone.fa-meter:after, .fad.fa-meter:after {
+  content: "\e1e8\e1e8";
+}
+
+.fa-duotone.fa-mandolin:after, .fad.fa-mandolin:after {
+  content: "\f6f9\f6f9";
+}
+
+.fa-duotone.fa-dice-four:after, .fad.fa-dice-four:after {
+  content: "\f524\f524";
+}
+
+.fa-duotone.fa-sim-card:after, .fad.fa-sim-card:after {
+  content: "\f7c4\f7c4";
+}
+
+.fa-duotone.fa-transgender-alt:after, .fa-duotone.fa-transgender:after, .fad.fa-transgender-alt:after, .fad.fa-transgender:after {
+  content: "\f225\f225";
+}
+
+.fa-duotone.fa-mercury:after, .fad.fa-mercury:after {
+  content: "\f223\f223";
+}
+
+.fa-duotone.fa-up-from-bracket:after, .fad.fa-up-from-bracket:after {
+  content: "\e590\e590";
+}
+
+.fa-duotone.fa-knife-kitchen:after, .fad.fa-knife-kitchen:after {
+  content: "\f6f5\f6f5";
+}
+
+.fa-duotone.fa-border-right:after, .fad.fa-border-right:after {
+  content: "\f852\f852";
+}
+
+.fa-duotone.fa-arrow-turn-down:after, .fa-duotone.fa-level-down:after, .fad.fa-arrow-turn-down:after, .fad.fa-level-down:after {
+  content: "\f149\f149";
+}
+
+.fa-duotone.fa-spade:after, .fad.fa-spade:after {
+  content: "\f2f4\f2f4";
+}
+
+.fa-duotone.fa-card-spade:after, .fad.fa-card-spade:after {
+  content: "\e3ec\e3ec";
+}
+
+.fa-duotone.fa-line-columns:after, .fad.fa-line-columns:after {
+  content: "\f870\f870";
+}
+
+.fa-duotone.fa-ant:after, .fad.fa-ant:after {
+  content: "\e680\e680";
+}
+
+.fa-duotone.fa-arrow-right-to-line:after, .fa-duotone.fa-arrow-to-right:after, .fad.fa-arrow-right-to-line:after, .fad.fa-arrow-to-right:after {
+  content: "\f340\f340";
+}
+
+.fa-duotone.fa-person-falling-burst:after, .fad.fa-person-falling-burst:after {
+  content: "\e547\e547";
+}
+
+.fa-duotone.fa-flag-pennant:after, .fa-duotone.fa-pennant:after, .fad.fa-flag-pennant:after, .fad.fa-pennant:after {
+  content: "\f456\f456";
+}
+
+.fa-duotone.fa-conveyor-belt-empty:after, .fad.fa-conveyor-belt-empty:after {
+  content: "\e150\e150";
+}
+
+.fa-duotone.fa-user-group-simple:after, .fad.fa-user-group-simple:after {
+  content: "\e603\e603";
+}
+
+.fa-duotone.fa-award:after, .fad.fa-award:after {
+  content: "\f559\f559";
+}
+
+.fa-duotone.fa-ticket-alt:after, .fa-duotone.fa-ticket-simple:after, .fad.fa-ticket-alt:after, .fad.fa-ticket-simple:after {
+  content: "\f3ff\f3ff";
+}
+
+.fa-duotone.fa-building:after, .fad.fa-building:after {
+  content: "\f1ad\f1ad";
+}
+
+.fa-duotone.fa-angle-double-left:after, .fa-duotone.fa-angles-left:after, .fad.fa-angle-double-left:after, .fad.fa-angles-left:after {
+  content: "\f100\f100";
+}
+
+.fa-duotone.fa-camcorder:after, .fa-duotone.fa-video-handheld:after, .fad.fa-camcorder:after, .fad.fa-video-handheld:after {
+  content: "\f8a8\f8a8";
+}
+
+.fa-duotone.fa-pancakes:after, .fad.fa-pancakes:after {
+  content: "\e42d\e42d";
+}
+
+.fa-duotone.fa-album-circle-user:after, .fad.fa-album-circle-user:after {
+  content: "\e48d\e48d";
+}
+
+.fa-duotone.fa-subtitles-slash:after, .fad.fa-subtitles-slash:after {
+  content: "\e610\e610";
+}
+
+.fa-duotone.fa-qrcode:after, .fad.fa-qrcode:after {
+  content: "\f029\f029";
+}
+
+.fa-duotone.fa-dice-d10:after, .fad.fa-dice-d10:after {
+  content: "\f6cd\f6cd";
+}
+
+.fa-duotone.fa-fireplace:after, .fad.fa-fireplace:after {
+  content: "\f79a\f79a";
+}
+
+.fa-duotone.fa-browser:after, .fad.fa-browser:after {
+  content: "\f37e\f37e";
+}
+
+.fa-duotone.fa-pen-paintbrush:after, .fa-duotone.fa-pencil-paintbrush:after, .fad.fa-pen-paintbrush:after, .fad.fa-pencil-paintbrush:after {
+  content: "\f618\f618";
+}
+
+.fa-duotone.fa-fish-cooked:after, .fad.fa-fish-cooked:after {
+  content: "\f7fe\f7fe";
+}
+
+.fa-duotone.fa-chair-office:after, .fad.fa-chair-office:after {
+  content: "\f6c1\f6c1";
+}
+
+.fa-duotone.fa-magnifying-glass-music:after, .fad.fa-magnifying-glass-music:after {
+  content: "\e65f\e65f";
+}
+
+.fa-duotone.fa-nesting-dolls:after, .fad.fa-nesting-dolls:after {
+  content: "\e3ba\e3ba";
+}
+
+.fa-duotone.fa-clock-rotate-left:after, .fa-duotone.fa-history:after, .fad.fa-clock-rotate-left:after, .fad.fa-history:after {
+  content: "\f1da\f1da";
+}
+
+.fa-duotone.fa-trumpet:after, .fad.fa-trumpet:after {
+  content: "\f8e3\f8e3";
+}
+
+.fa-duotone.fa-face-grin-beam-sweat:after, .fa-duotone.fa-grin-beam-sweat:after, .fad.fa-face-grin-beam-sweat:after, .fad.fa-grin-beam-sweat:after {
+  content: "\f583\f583";
+}
+
+.fa-duotone.fa-fire-smoke:after, .fad.fa-fire-smoke:after {
+  content: "\f74b\f74b";
+}
+
+.fa-duotone.fa-phone-missed:after, .fad.fa-phone-missed:after {
+  content: "\e226\e226";
+}
+
+.fa-duotone.fa-arrow-right-from-file:after, .fa-duotone.fa-file-export:after, .fad.fa-arrow-right-from-file:after, .fad.fa-file-export:after {
+  content: "\f56e\f56e";
+}
+
+.fa-duotone.fa-shield-blank:after, .fa-duotone.fa-shield:after, .fad.fa-shield-blank:after, .fad.fa-shield:after {
+  content: "\f132\f132";
+}
+
+.fa-duotone.fa-arrow-up-short-wide:after, .fa-duotone.fa-sort-amount-up-alt:after, .fad.fa-arrow-up-short-wide:after, .fad.fa-sort-amount-up-alt:after {
+  content: "\f885\f885";
+}
+
+.fa-duotone.fa-arrows-repeat-1:after, .fa-duotone.fa-repeat-1-alt:after, .fad.fa-arrows-repeat-1:after, .fad.fa-repeat-1-alt:after {
+  content: "\f366\f366";
+}
+
+.fa-duotone.fa-gun-slash:after, .fad.fa-gun-slash:after {
+  content: "\e19c\e19c";
+}
+
+.fa-duotone.fa-avocado:after, .fad.fa-avocado:after {
+  content: "\e0aa\e0aa";
+}
+
+.fa-duotone.fa-binary:after, .fad.fa-binary:after {
+  content: "\e33b\e33b";
+}
+
+.fa-duotone.fa-glasses-alt:after, .fa-duotone.fa-glasses-round:after, .fad.fa-glasses-alt:after, .fad.fa-glasses-round:after {
+  content: "\f5f5\f5f5";
+}
+
+.fa-duotone.fa-phone-plus:after, .fad.fa-phone-plus:after {
+  content: "\f4d2\f4d2";
+}
+
+.fa-duotone.fa-ditto:after, .fad.fa-ditto:after {
+  content: "\22\22";
+}
+
+.fa-duotone.fa-person-seat:after, .fad.fa-person-seat:after {
+  content: "\e21e\e21e";
+}
+
+.fa-duotone.fa-house-medical:after, .fad.fa-house-medical:after {
+  content: "\e3b2\e3b2";
+}
+
+.fa-duotone.fa-golf-ball-tee:after, .fa-duotone.fa-golf-ball:after, .fad.fa-golf-ball-tee:after, .fad.fa-golf-ball:after {
+  content: "\f450\f450";
+}
+
+.fa-duotone.fa-chevron-circle-left:after, .fa-duotone.fa-circle-chevron-left:after, .fad.fa-chevron-circle-left:after, .fad.fa-circle-chevron-left:after {
+  content: "\f137\f137";
+}
+
+.fa-duotone.fa-house-chimney-window:after, .fad.fa-house-chimney-window:after {
+  content: "\e00d\e00d";
+}
+
+.fa-duotone.fa-scythe:after, .fad.fa-scythe:after {
+  content: "\f710\f710";
+}
+
+.fa-duotone.fa-pen-nib:after, .fad.fa-pen-nib:after {
+  content: "\f5ad\f5ad";
+}
+
+.fa-duotone.fa-ban-parking:after, .fa-duotone.fa-parking-circle-slash:after, .fad.fa-ban-parking:after, .fad.fa-parking-circle-slash:after {
+  content: "\f616\f616";
+}
+
+.fa-duotone.fa-tent-arrow-turn-left:after, .fad.fa-tent-arrow-turn-left:after {
+  content: "\e580\e580";
+}
+
+.fa-duotone.fa-face-diagonal-mouth:after, .fad.fa-face-diagonal-mouth:after {
+  content: "\e47e\e47e";
+}
+
+.fa-duotone.fa-diagram-cells:after, .fad.fa-diagram-cells:after {
+  content: "\e475\e475";
+}
+
+.fa-duotone.fa-cricket-bat-ball:after, .fa-duotone.fa-cricket:after, .fad.fa-cricket-bat-ball:after, .fad.fa-cricket:after {
+  content: "\f449\f449";
+}
+
+.fa-duotone.fa-tents:after, .fad.fa-tents:after {
+  content: "\e582\e582";
+}
+
+.fa-duotone.fa-magic:after, .fa-duotone.fa-wand-magic:after, .fad.fa-magic:after, .fad.fa-wand-magic:after {
+  content: "\f0d0\f0d0";
+}
+
+.fa-duotone.fa-dog:after, .fad.fa-dog:after {
+  content: "\f6d3\f6d3";
+}
+
+.fa-duotone.fa-pen-line:after, .fad.fa-pen-line:after {
+  content: "\e212\e212";
+}
+
+.fa-duotone.fa-atom-alt:after, .fa-duotone.fa-atom-simple:after, .fad.fa-atom-alt:after, .fad.fa-atom-simple:after {
+  content: "\f5d3\f5d3";
+}
+
+.fa-duotone.fa-ampersand:after, .fad.fa-ampersand:after {
+  content: "\26\26";
+}
+
+.fa-duotone.fa-carrot:after, .fad.fa-carrot:after {
+  content: "\f787\f787";
+}
+
+.fa-duotone.fa-arrow-from-bottom:after, .fa-duotone.fa-arrow-up-from-line:after, .fad.fa-arrow-from-bottom:after, .fad.fa-arrow-up-from-line:after {
+  content: "\f342\f342";
+}
+
+.fa-duotone.fa-moon:after, .fad.fa-moon:after {
+  content: "\f186\f186";
+}
+
+.fa-duotone.fa-pen-slash:after, .fad.fa-pen-slash:after {
+  content: "\e213\e213";
+}
+
+.fa-duotone.fa-wine-glass-alt:after, .fa-duotone.fa-wine-glass-empty:after, .fad.fa-wine-glass-alt:after, .fad.fa-wine-glass-empty:after {
+  content: "\f5ce\f5ce";
+}
+
+.fa-duotone.fa-square-star:after, .fad.fa-square-star:after {
+  content: "\e27f\e27f";
+}
+
+.fa-duotone.fa-cheese:after, .fad.fa-cheese:after {
+  content: "\f7ef\f7ef";
+}
+
+.fa-duotone.fa-send-backward:after, .fad.fa-send-backward:after {
+  content: "\f87f\f87f";
+}
+
+.fa-duotone.fa-yin-yang:after, .fad.fa-yin-yang:after {
+  content: "\f6ad\f6ad";
+}
+
+.fa-duotone.fa-music:after, .fad.fa-music:after {
+  content: "\f001\f001";
+}
+
+.fa-duotone.fa-compass-slash:after, .fad.fa-compass-slash:after {
+  content: "\f5e9\f5e9";
+}
+
+.fa-duotone.fa-clock-one:after, .fad.fa-clock-one:after {
+  content: "\e34e\e34e";
+}
+
+.fa-duotone.fa-file-music:after, .fad.fa-file-music:after {
+  content: "\f8b6\f8b6";
+}
+
+.fa-duotone.fa-code-commit:after, .fad.fa-code-commit:after {
+  content: "\f386\f386";
+}
+
+.fa-duotone.fa-temperature-low:after, .fad.fa-temperature-low:after {
+  content: "\f76b\f76b";
+}
+
+.fa-duotone.fa-biking:after, .fa-duotone.fa-person-biking:after, .fad.fa-biking:after, .fad.fa-person-biking:after {
+  content: "\f84a\f84a";
+}
+
+.fa-duotone.fa-display-chart-up-circle-currency:after, .fad.fa-display-chart-up-circle-currency:after {
+  content: "\e5e5\e5e5";
+}
+
+.fa-duotone.fa-skeleton:after, .fad.fa-skeleton:after {
+  content: "\f620\f620";
+}
+
+.fa-duotone.fa-circle-g:after, .fad.fa-circle-g:after {
+  content: "\e10f\e10f";
+}
+
+.fa-duotone.fa-circle-arrow-up-left:after, .fad.fa-circle-arrow-up-left:after {
+  content: "\e0fb\e0fb";
+}
+
+.fa-duotone.fa-coin-blank:after, .fad.fa-coin-blank:after {
+  content: "\e3fb\e3fb";
+}
+
+.fa-duotone.fa-broom:after, .fad.fa-broom:after {
+  content: "\f51a\f51a";
+}
+
+.fa-duotone.fa-vacuum:after, .fad.fa-vacuum:after {
+  content: "\e04d\e04d";
+}
+
+.fa-duotone.fa-shield-heart:after, .fad.fa-shield-heart:after {
+  content: "\e574\e574";
+}
+
+.fa-duotone.fa-card-heart:after, .fad.fa-card-heart:after {
+  content: "\e3eb\e3eb";
+}
+
+.fa-duotone.fa-lightbulb-cfl-on:after, .fad.fa-lightbulb-cfl-on:after {
+  content: "\e5a7\e5a7";
+}
+
+.fa-duotone.fa-melon:after, .fad.fa-melon:after {
+  content: "\e310\e310";
+}
+
+.fa-duotone.fa-gopuram:after, .fad.fa-gopuram:after {
+  content: "\f664\f664";
+}
+
+.fa-duotone.fa-earth-oceania:after, .fa-duotone.fa-globe-oceania:after, .fad.fa-earth-oceania:after, .fad.fa-globe-oceania:after {
+  content: "\e47b\e47b";
+}
+
+.fa-duotone.fa-container-storage:after, .fad.fa-container-storage:after {
+  content: "\f4b7\f4b7";
+}
+
+.fa-duotone.fa-face-pouting:after, .fad.fa-face-pouting:after {
+  content: "\e387\e387";
+}
+
+.fa-duotone.fa-square-xmark:after, .fa-duotone.fa-times-square:after, .fa-duotone.fa-xmark-square:after, .fad.fa-square-xmark:after, .fad.fa-times-square:after, .fad.fa-xmark-square:after {
+  content: "\f2d3\f2d3";
+}
+
+.fa-duotone.fa-exploding-head:after, .fa-duotone.fa-face-explode:after, .fad.fa-exploding-head:after, .fad.fa-face-explode:after {
+  content: "\e2fe\e2fe";
+}
+
+.fa-duotone.fa-hashtag:after, .fad.fa-hashtag:after {
+  content: "\23\23";
+}
+
+.fa-duotone.fa-expand-alt:after, .fa-duotone.fa-up-right-and-down-left-from-center:after, .fad.fa-expand-alt:after, .fad.fa-up-right-and-down-left-from-center:after {
+  content: "\f424\f424";
+}
+
+.fa-duotone.fa-oil-can:after, .fad.fa-oil-can:after {
+  content: "\f613\f613";
+}
+
+.fa-duotone.fa-t:after, .fad.fa-t:after {
+  content: "\54\54";
+}
+
+.fa-duotone.fa-transformer-bolt:after, .fad.fa-transformer-bolt:after {
+  content: "\e2a4\e2a4";
+}
+
+.fa-duotone.fa-hippo:after, .fad.fa-hippo:after {
+  content: "\f6ed\f6ed";
+}
+
+.fa-duotone.fa-chart-column:after, .fad.fa-chart-column:after {
+  content: "\e0e3\e0e3";
+}
+
+.fa-duotone.fa-cassette-vhs:after, .fa-duotone.fa-vhs:after, .fad.fa-cassette-vhs:after, .fad.fa-vhs:after {
+  content: "\f8ec\f8ec";
+}
+
+.fa-duotone.fa-infinity:after, .fad.fa-infinity:after {
+  content: "\f534\f534";
+}
+
+.fa-duotone.fa-vial-circle-check:after, .fad.fa-vial-circle-check:after {
+  content: "\e596\e596";
+}
+
+.fa-duotone.fa-chimney:after, .fad.fa-chimney:after {
+  content: "\f78b\f78b";
+}
+
+.fa-duotone.fa-object-intersect:after, .fad.fa-object-intersect:after {
+  content: "\e49d\e49d";
+}
+
+.fa-duotone.fa-person-arrow-down-to-line:after, .fad.fa-person-arrow-down-to-line:after {
+  content: "\e538\e538";
+}
+
+.fa-duotone.fa-voicemail:after, .fad.fa-voicemail:after {
+  content: "\f897\f897";
+}
+
+.fa-duotone.fa-block-brick:after, .fa-duotone.fa-wall-brick:after, .fad.fa-block-brick:after, .fad.fa-wall-brick:after {
+  content: "\e3db\e3db";
+}
+
+.fa-duotone.fa-fan:after, .fad.fa-fan:after {
+  content: "\f863\f863";
+}
+
+.fa-duotone.fa-bags-shopping:after, .fad.fa-bags-shopping:after {
+  content: "\f847\f847";
+}
+
+.fa-duotone.fa-paragraph-left:after, .fa-duotone.fa-paragraph-rtl:after, .fad.fa-paragraph-left:after, .fad.fa-paragraph-rtl:after {
+  content: "\f878\f878";
+}
+
+.fa-duotone.fa-person-walking-luggage:after, .fad.fa-person-walking-luggage:after {
+  content: "\e554\e554";
+}
+
+.fa-duotone.fa-caravan-alt:after, .fa-duotone.fa-caravan-simple:after, .fad.fa-caravan-alt:after, .fad.fa-caravan-simple:after {
+  content: "\e000\e000";
+}
+
+.fa-duotone.fa-turtle:after, .fad.fa-turtle:after {
+  content: "\f726\f726";
+}
+
+.fa-duotone.fa-pencil-mechanical:after, .fad.fa-pencil-mechanical:after {
+  content: "\e5ca\e5ca";
+}
+
+.fa-duotone.fa-arrows-alt-v:after, .fa-duotone.fa-up-down:after, .fad.fa-arrows-alt-v:after, .fad.fa-up-down:after {
+  content: "\f338\f338";
+}
+
+.fa-duotone.fa-cloud-moon-rain:after, .fad.fa-cloud-moon-rain:after {
+  content: "\f73c\f73c";
+}
+
+.fa-duotone.fa-booth-curtain:after, .fad.fa-booth-curtain:after {
+  content: "\f734\f734";
+}
+
+.fa-duotone.fa-calendar:after, .fad.fa-calendar:after {
+  content: "\f133\f133";
+}
+
+.fa-duotone.fa-box-heart:after, .fad.fa-box-heart:after {
+  content: "\f49d\f49d";
+}
+
+.fa-duotone.fa-trailer:after, .fad.fa-trailer:after {
+  content: "\e041\e041";
+}
+
+.fa-duotone.fa-user-doctor-message:after, .fa-duotone.fa-user-md-chat:after, .fad.fa-user-doctor-message:after, .fad.fa-user-md-chat:after {
+  content: "\f82e\f82e";
+}
+
+.fa-duotone.fa-bahai:after, .fa-duotone.fa-haykal:after, .fad.fa-bahai:after, .fad.fa-haykal:after {
+  content: "\f666\f666";
+}
+
+.fa-duotone.fa-lighthouse:after, .fad.fa-lighthouse:after {
+  content: "\e612\e612";
+}
+
+.fa-duotone.fa-amp-guitar:after, .fad.fa-amp-guitar:after {
+  content: "\f8a1\f8a1";
+}
+
+.fa-duotone.fa-sd-card:after, .fad.fa-sd-card:after {
+  content: "\f7c2\f7c2";
+}
+
+.fa-duotone.fa-volume-slash:after, .fad.fa-volume-slash:after {
+  content: "\f2e2\f2e2";
+}
+
+.fa-duotone.fa-border-bottom:after, .fad.fa-border-bottom:after {
+  content: "\f84d\f84d";
+}
+
+.fa-duotone.fa-wifi-1:after, .fa-duotone.fa-wifi-weak:after, .fad.fa-wifi-1:after, .fad.fa-wifi-weak:after {
+  content: "\f6aa\f6aa";
+}
+
+.fa-duotone.fa-dragon:after, .fad.fa-dragon:after {
+  content: "\f6d5\f6d5";
+}
+
+.fa-duotone.fa-shoe-prints:after, .fad.fa-shoe-prints:after {
+  content: "\f54b\f54b";
+}
+
+.fa-duotone.fa-circle-plus:after, .fa-duotone.fa-plus-circle:after, .fad.fa-circle-plus:after, .fad.fa-plus-circle:after {
+  content: "\f055\f055";
+}
+
+.fa-duotone.fa-face-grin-tongue-wink:after, .fa-duotone.fa-grin-tongue-wink:after, .fad.fa-face-grin-tongue-wink:after, .fad.fa-grin-tongue-wink:after {
+  content: "\f58b\f58b";
+}
+
+.fa-duotone.fa-hand-holding:after, .fad.fa-hand-holding:after {
+  content: "\f4bd\f4bd";
+}
+
+.fa-duotone.fa-plug-circle-exclamation:after, .fad.fa-plug-circle-exclamation:after {
+  content: "\e55d\e55d";
+}
+
+.fa-duotone.fa-chain-broken:after, .fa-duotone.fa-chain-slash:after, .fa-duotone.fa-link-slash:after, .fa-duotone.fa-unlink:after, .fad.fa-chain-broken:after, .fad.fa-chain-slash:after, .fad.fa-link-slash:after, .fad.fa-unlink:after {
+  content: "\f127\f127";
+}
+
+.fa-duotone.fa-clone:after, .fad.fa-clone:after {
+  content: "\f24d\f24d";
+}
+
+.fa-duotone.fa-person-walking-arrow-loop-left:after, .fad.fa-person-walking-arrow-loop-left:after {
+  content: "\e551\e551";
+}
+
+.fa-duotone.fa-arrow-up-z-a:after, .fa-duotone.fa-sort-alpha-up-alt:after, .fad.fa-arrow-up-z-a:after, .fad.fa-sort-alpha-up-alt:after {
+  content: "\f882\f882";
+}
+
+.fa-duotone.fa-fire-alt:after, .fa-duotone.fa-fire-flame-curved:after, .fad.fa-fire-alt:after, .fad.fa-fire-flame-curved:after {
+  content: "\f7e4\f7e4";
+}
+
+.fa-duotone.fa-tornado:after, .fad.fa-tornado:after {
+  content: "\f76f\f76f";
+}
+
+.fa-duotone.fa-file-circle-plus:after, .fad.fa-file-circle-plus:after {
+  content: "\e494\e494";
+}
+
+.fa-duotone.fa-delete-right:after, .fad.fa-delete-right:after {
+  content: "\e154\e154";
+}
+
+.fa-duotone.fa-book-quran:after, .fa-duotone.fa-quran:after, .fad.fa-book-quran:after, .fad.fa-quran:after {
+  content: "\f687\f687";
+}
+
+.fa-duotone.fa-circle-quarter:after, .fad.fa-circle-quarter:after {
+  content: "\e11f\e11f";
+}
+
+.fa-duotone.fa-anchor:after, .fad.fa-anchor:after {
+  content: "\f13d\f13d";
+}
+
+.fa-duotone.fa-border-all:after, .fad.fa-border-all:after {
+  content: "\f84c\f84c";
+}
+
+.fa-duotone.fa-function:after, .fad.fa-function:after {
+  content: "\f661\f661";
+}
+
+.fa-duotone.fa-angry:after, .fa-duotone.fa-face-angry:after, .fad.fa-angry:after, .fad.fa-face-angry:after {
+  content: "\f556\f556";
+}
+
+.fa-duotone.fa-people-simple:after, .fad.fa-people-simple:after {
+  content: "\e21b\e21b";
+}
+
+.fa-duotone.fa-cookie-bite:after, .fad.fa-cookie-bite:after {
+  content: "\f564\f564";
+}
+
+.fa-duotone.fa-arrow-trend-down:after, .fad.fa-arrow-trend-down:after {
+  content: "\e097\e097";
+}
+
+.fa-duotone.fa-feed:after, .fa-duotone.fa-rss:after, .fad.fa-feed:after, .fad.fa-rss:after {
+  content: "\f09e\f09e";
+}
+
+.fa-duotone.fa-face-monocle:after, .fad.fa-face-monocle:after {
+  content: "\e380\e380";
+}
+
+.fa-duotone.fa-draw-polygon:after, .fad.fa-draw-polygon:after {
+  content: "\f5ee\f5ee";
+}
+
+.fa-duotone.fa-balance-scale:after, .fa-duotone.fa-scale-balanced:after, .fad.fa-balance-scale:after, .fad.fa-scale-balanced:after {
+  content: "\f24e\f24e";
+}
+
+.fa-duotone.fa-calendar-lines:after, .fa-duotone.fa-calendar-note:after, .fad.fa-calendar-lines:after, .fad.fa-calendar-note:after {
+  content: "\e0d5\e0d5";
+}
+
+.fa-duotone.fa-arrow-down-big-small:after, .fa-duotone.fa-sort-size-down:after, .fad.fa-arrow-down-big-small:after, .fad.fa-sort-size-down:after {
+  content: "\f88c\f88c";
+}
+
+.fa-duotone.fa-gauge-simple-high:after, .fa-duotone.fa-tachometer-fast:after, .fa-duotone.fa-tachometer:after, .fad.fa-gauge-simple-high:after, .fad.fa-tachometer-fast:after, .fad.fa-tachometer:after {
+  content: "\f62a\f62a";
+}
+
+.fa-duotone.fa-do-not-enter:after, .fad.fa-do-not-enter:after {
+  content: "\f5ec\f5ec";
+}
+
+.fa-duotone.fa-shower:after, .fad.fa-shower:after {
+  content: "\f2cc\f2cc";
+}
+
+.fa-duotone.fa-dice-d8:after, .fad.fa-dice-d8:after {
+  content: "\f6d2\f6d2";
+}
+
+.fa-duotone.fa-desktop-alt:after, .fa-duotone.fa-desktop:after, .fad.fa-desktop-alt:after, .fad.fa-desktop:after {
+  content: "\f390\f390";
+}
+
+.fa-duotone.fa-m:after, .fad.fa-m:after {
+  content: "\4d\4d";
+}
+
+.fa-duotone.fa-spinner-scale:after, .fad.fa-spinner-scale:after {
+  content: "\e62a\e62a";
+}
+
+.fa-duotone.fa-grip-dots-vertical:after, .fad.fa-grip-dots-vertical:after {
+  content: "\e411\e411";
+}
+
+.fa-duotone.fa-face-viewfinder:after, .fad.fa-face-viewfinder:after {
+  content: "\e2ff\e2ff";
+}
+
+.fa-duotone.fa-creemee:after, .fa-duotone.fa-soft-serve:after, .fad.fa-creemee:after, .fad.fa-soft-serve:after {
+  content: "\e400\e400";
+}
+
+.fa-duotone.fa-h5:after, .fad.fa-h5:after {
+  content: "\e412\e412";
+}
+
+.fa-duotone.fa-hand-back-point-down:after, .fad.fa-hand-back-point-down:after {
+  content: "\e19e\e19e";
+}
+
+.fa-duotone.fa-table-list:after, .fa-duotone.fa-th-list:after, .fad.fa-table-list:after, .fad.fa-th-list:after {
+  content: "\f00b\f00b";
+}
+
+.fa-duotone.fa-basket-shopping-minus:after, .fad.fa-basket-shopping-minus:after {
+  content: "\e652\e652";
+}
+
+.fa-duotone.fa-comment-sms:after, .fa-duotone.fa-sms:after, .fad.fa-comment-sms:after, .fad.fa-sms:after {
+  content: "\f7cd\f7cd";
+}
+
+.fa-duotone.fa-rectangle-landscape:after, .fa-duotone.fa-rectangle:after, .fad.fa-rectangle-landscape:after, .fad.fa-rectangle:after {
+  content: "\f2fa\f2fa";
+}
+
+.fa-duotone.fa-clipboard-list-check:after, .fad.fa-clipboard-list-check:after {
+  content: "\f737\f737";
+}
+
+.fa-duotone.fa-turkey:after, .fad.fa-turkey:after {
+  content: "\f725\f725";
+}
+
+.fa-duotone.fa-book:after, .fad.fa-book:after {
+  content: "\f02d\f02d";
+}
+
+.fa-duotone.fa-user-plus:after, .fad.fa-user-plus:after {
+  content: "\f234\f234";
+}
+
+.fa-duotone.fa-ice-skate:after, .fad.fa-ice-skate:after {
+  content: "\f7ac\f7ac";
+}
+
+.fa-duotone.fa-check:after, .fad.fa-check:after {
+  content: "\f00c\f00c";
+}
+
+.fa-duotone.fa-battery-4:after, .fa-duotone.fa-battery-three-quarters:after, .fad.fa-battery-4:after, .fad.fa-battery-three-quarters:after {
+  content: "\f241\f241";
+}
+
+.fa-duotone.fa-tomato:after, .fad.fa-tomato:after {
+  content: "\e330\e330";
+}
+
+.fa-duotone.fa-sword-laser:after, .fad.fa-sword-laser:after {
+  content: "\e03b\e03b";
+}
+
+.fa-duotone.fa-house-circle-check:after, .fad.fa-house-circle-check:after {
+  content: "\e509\e509";
+}
+
+.fa-duotone.fa-buildings:after, .fad.fa-buildings:after {
+  content: "\e0cc\e0cc";
+}
+
+.fa-duotone.fa-angle-left:after, .fad.fa-angle-left:after {
+  content: "\f104\f104";
+}
+
+.fa-duotone.fa-cart-flatbed-boxes:after, .fa-duotone.fa-dolly-flatbed-alt:after, .fad.fa-cart-flatbed-boxes:after, .fad.fa-dolly-flatbed-alt:after {
+  content: "\f475\f475";
+}
+
+.fa-duotone.fa-diagram-successor:after, .fad.fa-diagram-successor:after {
+  content: "\e47a\e47a";
+}
+
+.fa-duotone.fa-truck-arrow-right:after, .fad.fa-truck-arrow-right:after {
+  content: "\e58b\e58b";
+}
+
+.fa-duotone.fa-square-w:after, .fad.fa-square-w:after {
+  content: "\e285\e285";
+}
+
+.fa-duotone.fa-arrows-split-up-and-left:after, .fad.fa-arrows-split-up-and-left:after {
+  content: "\e4bc\e4bc";
+}
+
+.fa-duotone.fa-lamp:after, .fad.fa-lamp:after {
+  content: "\f4ca\f4ca";
+}
+
+.fa-duotone.fa-airplay:after, .fad.fa-airplay:after {
+  content: "\e089\e089";
+}
+
+.fa-duotone.fa-fist-raised:after, .fa-duotone.fa-hand-fist:after, .fad.fa-fist-raised:after, .fad.fa-hand-fist:after {
+  content: "\f6de\f6de";
+}
+
+.fa-duotone.fa-shield-quartered:after, .fad.fa-shield-quartered:after {
+  content: "\e575\e575";
+}
+
+.fa-duotone.fa-slash-forward:after, .fad.fa-slash-forward:after {
+  content: "\2f\2f";
+}
+
+.fa-duotone.fa-location-pen:after, .fa-duotone.fa-map-marker-edit:after, .fad.fa-location-pen:after, .fad.fa-map-marker-edit:after {
+  content: "\f607\f607";
+}
+
+.fa-duotone.fa-cloud-moon:after, .fad.fa-cloud-moon:after {
+  content: "\f6c3\f6c3";
+}
+
+.fa-duotone.fa-pot-food:after, .fad.fa-pot-food:after {
+  content: "\e43f\e43f";
+}
+
+.fa-duotone.fa-briefcase:after, .fad.fa-briefcase:after {
+  content: "\f0b1\f0b1";
+}
+
+.fa-duotone.fa-person-falling:after, .fad.fa-person-falling:after {
+  content: "\e546\e546";
+}
+
+.fa-duotone.fa-image-portrait:after, .fa-duotone.fa-portrait:after, .fad.fa-image-portrait:after, .fad.fa-portrait:after {
+  content: "\f3e0\f3e0";
+}
+
+.fa-duotone.fa-user-tag:after, .fad.fa-user-tag:after {
+  content: "\f507\f507";
+}
+
+.fa-duotone.fa-rug:after, .fad.fa-rug:after {
+  content: "\e569\e569";
+}
+
+.fa-duotone.fa-print-slash:after, .fad.fa-print-slash:after {
+  content: "\f686\f686";
+}
+
+.fa-duotone.fa-earth-europe:after, .fa-duotone.fa-globe-europe:after, .fad.fa-earth-europe:after, .fad.fa-globe-europe:after {
+  content: "\f7a2\f7a2";
+}
+
+.fa-duotone.fa-cart-flatbed-suitcase:after, .fa-duotone.fa-luggage-cart:after, .fad.fa-cart-flatbed-suitcase:after, .fad.fa-luggage-cart:after {
+  content: "\f59d\f59d";
+}
+
+.fa-duotone.fa-hand-back-point-ribbon:after, .fad.fa-hand-back-point-ribbon:after {
+  content: "\e1a0\e1a0";
+}
+
+.fa-duotone.fa-rectangle-times:after, .fa-duotone.fa-rectangle-xmark:after, .fa-duotone.fa-times-rectangle:after, .fa-duotone.fa-window-close:after, .fad.fa-rectangle-times:after, .fad.fa-rectangle-xmark:after, .fad.fa-times-rectangle:after, .fad.fa-window-close:after {
+  content: "\f410\f410";
+}
+
+.fa-duotone.fa-tire-rugged:after, .fad.fa-tire-rugged:after {
+  content: "\f634\f634";
+}
+
+.fa-duotone.fa-lightbulb-dollar:after, .fad.fa-lightbulb-dollar:after {
+  content: "\f670\f670";
+}
+
+.fa-duotone.fa-cowbell:after, .fad.fa-cowbell:after {
+  content: "\f8b3\f8b3";
+}
+
+.fa-duotone.fa-baht-sign:after, .fad.fa-baht-sign:after {
+  content: "\e0ac\e0ac";
+}
+
+.fa-duotone.fa-corner:after, .fad.fa-corner:after {
+  content: "\e3fe\e3fe";
+}
+
+.fa-duotone.fa-chevron-double-right:after, .fa-duotone.fa-chevrons-right:after, .fad.fa-chevron-double-right:after, .fad.fa-chevrons-right:after {
+  content: "\f324\f324";
+}
+
+.fa-duotone.fa-book-open:after, .fad.fa-book-open:after {
+  content: "\f518\f518";
+}
+
+.fa-duotone.fa-book-journal-whills:after, .fa-duotone.fa-journal-whills:after, .fad.fa-book-journal-whills:after, .fad.fa-journal-whills:after {
+  content: "\f66a\f66a";
+}
+
+.fa-duotone.fa-inhaler:after, .fad.fa-inhaler:after {
+  content: "\f5f9\f5f9";
+}
+
+.fa-duotone.fa-handcuffs:after, .fad.fa-handcuffs:after {
+  content: "\e4f8\e4f8";
+}
+
+.fa-duotone.fa-snake:after, .fad.fa-snake:after {
+  content: "\f716\f716";
+}
+
+.fa-duotone.fa-exclamation-triangle:after, .fa-duotone.fa-triangle-exclamation:after, .fa-duotone.fa-warning:after, .fad.fa-exclamation-triangle:after, .fad.fa-triangle-exclamation:after, .fad.fa-warning:after {
+  content: "\f071\f071";
+}
+
+.fa-duotone.fa-note-medical:after, .fad.fa-note-medical:after {
+  content: "\e200\e200";
+}
+
+.fa-duotone.fa-database:after, .fad.fa-database:after {
+  content: "\f1c0\f1c0";
+}
+
+.fa-duotone.fa-down-left:after, .fad.fa-down-left:after {
+  content: "\e16a\e16a";
+}
+
+.fa-duotone.fa-mail-forward:after, .fa-duotone.fa-share:after, .fad.fa-mail-forward:after, .fad.fa-share:after {
+  content: "\f064\f064";
+}
+
+.fa-duotone.fa-face-thinking:after, .fad.fa-face-thinking:after {
+  content: "\e39b\e39b";
+}
+
+.fa-duotone.fa-turn-down-right:after, .fad.fa-turn-down-right:after {
+  content: "\e455\e455";
+}
+
+.fa-duotone.fa-bottle-droplet:after, .fad.fa-bottle-droplet:after {
+  content: "\e4c4\e4c4";
+}
+
+.fa-duotone.fa-mask-face:after, .fad.fa-mask-face:after {
+  content: "\e1d7\e1d7";
+}
+
+.fa-duotone.fa-hill-rockslide:after, .fad.fa-hill-rockslide:after {
+  content: "\e508\e508";
+}
+
+.fa-duotone.fa-scanner-keyboard:after, .fad.fa-scanner-keyboard:after {
+  content: "\f489\f489";
+}
+
+.fa-duotone.fa-circle-o:after, .fad.fa-circle-o:after {
+  content: "\e119\e119";
+}
+
+.fa-duotone.fa-grid-horizontal:after, .fad.fa-grid-horizontal:after {
+  content: "\e307\e307";
+}
+
+.fa-duotone.fa-comment-alt-dollar:after, .fa-duotone.fa-message-dollar:after, .fad.fa-comment-alt-dollar:after, .fad.fa-message-dollar:after {
+  content: "\f650\f650";
+}
+
+.fa-duotone.fa-exchange-alt:after, .fa-duotone.fa-right-left:after, .fad.fa-exchange-alt:after, .fad.fa-right-left:after {
+  content: "\f362\f362";
+}
+
+.fa-duotone.fa-columns-3:after, .fad.fa-columns-3:after {
+  content: "\e361\e361";
+}
+
+.fa-duotone.fa-paper-plane:after, .fad.fa-paper-plane:after {
+  content: "\f1d8\f1d8";
+}
+
+.fa-duotone.fa-road-circle-exclamation:after, .fad.fa-road-circle-exclamation:after {
+  content: "\e565\e565";
+}
+
+.fa-duotone.fa-dungeon:after, .fad.fa-dungeon:after {
+  content: "\f6d9\f6d9";
+}
+
+.fa-duotone.fa-hand-holding-box:after, .fad.fa-hand-holding-box:after {
+  content: "\f47b\f47b";
+}
+
+.fa-duotone.fa-input-text:after, .fad.fa-input-text:after {
+  content: "\e1bf\e1bf";
+}
+
+.fa-duotone.fa-window-alt:after, .fa-duotone.fa-window-flip:after, .fad.fa-window-alt:after, .fad.fa-window-flip:after {
+  content: "\f40f\f40f";
+}
+
+.fa-duotone.fa-align-right:after, .fad.fa-align-right:after {
+  content: "\f038\f038";
+}
+
+.fa-duotone.fa-scanner-gun:after, .fa-duotone.fa-scanner:after, .fad.fa-scanner-gun:after, .fad.fa-scanner:after {
+  content: "\f488\f488";
+}
+
+.fa-duotone.fa-tire:after, .fad.fa-tire:after {
+  content: "\f631\f631";
+}
+
+.fa-duotone.fa-engine:after, .fad.fa-engine:after {
+  content: "\e16e\e16e";
+}
+
+.fa-duotone.fa-money-bill-1-wave:after, .fa-duotone.fa-money-bill-wave-alt:after, .fad.fa-money-bill-1-wave:after, .fad.fa-money-bill-wave-alt:after {
+  content: "\f53b\f53b";
+}
+
+.fa-duotone.fa-life-ring:after, .fad.fa-life-ring:after {
+  content: "\f1cd\f1cd";
+}
+
+.fa-duotone.fa-hands:after, .fa-duotone.fa-sign-language:after, .fa-duotone.fa-signing:after, .fad.fa-hands:after, .fad.fa-sign-language:after, .fad.fa-signing:after {
+  content: "\f2a7\f2a7";
+}
+
+.fa-duotone.fa-caret-circle-right:after, .fa-duotone.fa-circle-caret-right:after, .fad.fa-caret-circle-right:after, .fad.fa-circle-caret-right:after {
+  content: "\f330\f330";
+}
+
+.fa-duotone.fa-turn-left:after, .fad.fa-turn-left:after {
+  content: "\e636\e636";
+}
+
+.fa-duotone.fa-wheat:after, .fad.fa-wheat:after {
+  content: "\f72d\f72d";
+}
+
+.fa-duotone.fa-file-spreadsheet:after, .fad.fa-file-spreadsheet:after {
+  content: "\f65b\f65b";
+}
+
+.fa-duotone.fa-audio-description-slash:after, .fad.fa-audio-description-slash:after {
+  content: "\e0a8\e0a8";
+}
+
+.fa-duotone.fa-bell-ring:after, .fad.fa-bell-ring:after {
+  content: "\e62c\e62c";
+}
+
+.fa-duotone.fa-calendar-day:after, .fad.fa-calendar-day:after {
+  content: "\f783\f783";
+}
+
+.fa-duotone.fa-ladder-water:after, .fa-duotone.fa-swimming-pool:after, .fa-duotone.fa-water-ladder:after, .fad.fa-ladder-water:after, .fad.fa-swimming-pool:after, .fad.fa-water-ladder:after {
+  content: "\f5c5\f5c5";
+}
+
+.fa-duotone.fa-arrows-up-down:after, .fa-duotone.fa-arrows-v:after, .fad.fa-arrows-up-down:after, .fad.fa-arrows-v:after {
+  content: "\f07d\f07d";
+}
+
+.fa-duotone.fa-chess-pawn-alt:after, .fa-duotone.fa-chess-pawn-piece:after, .fad.fa-chess-pawn-alt:after, .fad.fa-chess-pawn-piece:after {
+  content: "\f444\f444";
+}
+
+.fa-duotone.fa-face-grimace:after, .fa-duotone.fa-grimace:after, .fad.fa-face-grimace:after, .fad.fa-grimace:after {
+  content: "\f57f\f57f";
+}
+
+.fa-duotone.fa-wheelchair-alt:after, .fa-duotone.fa-wheelchair-move:after, .fad.fa-wheelchair-alt:after, .fad.fa-wheelchair-move:after {
+  content: "\e2ce\e2ce";
+}
+
+.fa-duotone.fa-level-down-alt:after, .fa-duotone.fa-turn-down:after, .fad.fa-level-down-alt:after, .fad.fa-turn-down:after {
+  content: "\f3be\f3be";
+}
+
+.fa-duotone.fa-square-s:after, .fad.fa-square-s:after {
+  content: "\e27d\e27d";
+}
+
+.fa-duotone.fa-barcode-alt:after, .fa-duotone.fa-rectangle-barcode:after, .fad.fa-barcode-alt:after, .fad.fa-rectangle-barcode:after {
+  content: "\f463\f463";
+}
+
+.fa-duotone.fa-person-walking-arrow-right:after, .fad.fa-person-walking-arrow-right:after {
+  content: "\e552\e552";
+}
+
+.fa-duotone.fa-envelope-square:after, .fa-duotone.fa-square-envelope:after, .fad.fa-envelope-square:after, .fad.fa-square-envelope:after {
+  content: "\f199\f199";
+}
+
+.fa-duotone.fa-dice:after, .fad.fa-dice:after {
+  content: "\f522\f522";
+}
+
+.fa-duotone.fa-unicorn:after, .fad.fa-unicorn:after {
+  content: "\f727\f727";
+}
+
+.fa-duotone.fa-bowling-ball:after, .fad.fa-bowling-ball:after {
+  content: "\f436\f436";
+}
+
+.fa-duotone.fa-pompebled:after, .fad.fa-pompebled:after {
+  content: "\e43d\e43d";
+}
+
+.fa-duotone.fa-brain:after, .fad.fa-brain:after {
+  content: "\f5dc\f5dc";
+}
+
+.fa-duotone.fa-watch-smart:after, .fad.fa-watch-smart:after {
+  content: "\e2cc\e2cc";
+}
+
+.fa-duotone.fa-book-user:after, .fad.fa-book-user:after {
+  content: "\f7e7\f7e7";
+}
+
+.fa-duotone.fa-sensor-cloud:after, .fa-duotone.fa-sensor-smoke:after, .fad.fa-sensor-cloud:after, .fad.fa-sensor-smoke:after {
+  content: "\e02c\e02c";
+}
+
+.fa-duotone.fa-clapperboard-play:after, .fad.fa-clapperboard-play:after {
+  content: "\e132\e132";
+}
+
+.fa-duotone.fa-band-aid:after, .fa-duotone.fa-bandage:after, .fad.fa-band-aid:after, .fad.fa-bandage:after {
+  content: "\f462\f462";
+}
+
+.fa-duotone.fa-calendar-minus:after, .fad.fa-calendar-minus:after {
+  content: "\f272\f272";
+}
+
+.fa-duotone.fa-circle-xmark:after, .fa-duotone.fa-times-circle:after, .fa-duotone.fa-xmark-circle:after, .fad.fa-circle-xmark:after, .fad.fa-times-circle:after, .fad.fa-xmark-circle:after {
+  content: "\f057\f057";
+}
+
+.fa-duotone.fa-circle-4:after, .fad.fa-circle-4:after {
+  content: "\e0f1\e0f1";
+}
+
+.fa-duotone.fa-gifts:after, .fad.fa-gifts:after {
+  content: "\f79c\f79c";
+}
+
+.fa-duotone.fa-album-collection:after, .fad.fa-album-collection:after {
+  content: "\f8a0\f8a0";
+}
+
+.fa-duotone.fa-hotel:after, .fad.fa-hotel:after {
+  content: "\f594\f594";
+}
+
+.fa-duotone.fa-earth-asia:after, .fa-duotone.fa-globe-asia:after, .fad.fa-earth-asia:after, .fad.fa-globe-asia:after {
+  content: "\f57e\f57e";
+}
+
+.fa-duotone.fa-id-card-alt:after, .fa-duotone.fa-id-card-clip:after, .fad.fa-id-card-alt:after, .fad.fa-id-card-clip:after {
+  content: "\f47f\f47f";
+}
+
+.fa-duotone.fa-magnifying-glass-plus:after, .fa-duotone.fa-search-plus:after, .fad.fa-magnifying-glass-plus:after, .fad.fa-search-plus:after {
+  content: "\f00e\f00e";
+}
+
+.fa-duotone.fa-thumbs-up:after, .fad.fa-thumbs-up:after {
+  content: "\f164\f164";
+}
+
+.fa-duotone.fa-cloud-showers:after, .fad.fa-cloud-showers:after {
+  content: "\f73f\f73f";
+}
+
+.fa-duotone.fa-user-clock:after, .fad.fa-user-clock:after {
+  content: "\f4fd\f4fd";
+}
+
+.fa-duotone.fa-onion:after, .fad.fa-onion:after {
+  content: "\e427\e427";
+}
+
+.fa-duotone.fa-clock-twelve-thirty:after, .fad.fa-clock-twelve-thirty:after {
+  content: "\e359\e359";
+}
+
+.fa-duotone.fa-arrow-down-to-dotted-line:after, .fad.fa-arrow-down-to-dotted-line:after {
+  content: "\e095\e095";
+}
+
+.fa-duotone.fa-allergies:after, .fa-duotone.fa-hand-dots:after, .fad.fa-allergies:after, .fad.fa-hand-dots:after {
+  content: "\f461\f461";
+}
+
+.fa-duotone.fa-file-invoice:after, .fad.fa-file-invoice:after {
+  content: "\f570\f570";
+}
+
+.fa-duotone.fa-window-minimize:after, .fad.fa-window-minimize:after {
+  content: "\f2d1\f2d1";
+}
+
+.fa-duotone.fa-rectangle-wide:after, .fad.fa-rectangle-wide:after {
+  content: "\f2fc\f2fc";
+}
+
+.fa-duotone.fa-comment-arrow-up:after, .fad.fa-comment-arrow-up:after {
+  content: "\e144\e144";
+}
+
+.fa-duotone.fa-garlic:after, .fad.fa-garlic:after {
+  content: "\e40e\e40e";
+}
+
+.fa-duotone.fa-coffee:after, .fa-duotone.fa-mug-saucer:after, .fad.fa-coffee:after, .fad.fa-mug-saucer:after {
+  content: "\f0f4\f0f4";
+}
+
+.fa-duotone.fa-brush:after, .fad.fa-brush:after {
+  content: "\f55d\f55d";
+}
+
+.fa-duotone.fa-tree-decorated:after, .fad.fa-tree-decorated:after {
+  content: "\f7dc\f7dc";
+}
+
+.fa-duotone.fa-mask:after, .fad.fa-mask:after {
+  content: "\f6fa\f6fa";
+}
+
+.fa-duotone.fa-calendar-heart:after, .fad.fa-calendar-heart:after {
+  content: "\e0d3\e0d3";
+}
+
+.fa-duotone.fa-magnifying-glass-minus:after, .fa-duotone.fa-search-minus:after, .fad.fa-magnifying-glass-minus:after, .fad.fa-search-minus:after {
+  content: "\f010\f010";
+}
+
+.fa-duotone.fa-flower:after, .fad.fa-flower:after {
+  content: "\f7ff\f7ff";
+}
+
+.fa-duotone.fa-arrow-down-from-arc:after, .fad.fa-arrow-down-from-arc:after {
+  content: "\e614\e614";
+}
+
+.fa-duotone.fa-right-left-large:after, .fad.fa-right-left-large:after {
+  content: "\e5e1\e5e1";
+}
+
+.fa-duotone.fa-ruler-vertical:after, .fad.fa-ruler-vertical:after {
+  content: "\f548\f548";
+}
+
+.fa-duotone.fa-circles-overlap:after, .fad.fa-circles-overlap:after {
+  content: "\e600\e600";
+}
+
+.fa-duotone.fa-user-alt:after, .fa-duotone.fa-user-large:after, .fad.fa-user-alt:after, .fad.fa-user-large:after {
+  content: "\f406\f406";
+}
+
+.fa-duotone.fa-starship-freighter:after, .fad.fa-starship-freighter:after {
+  content: "\e03a\e03a";
+}
+
+.fa-duotone.fa-train-tram:after, .fad.fa-train-tram:after {
+  content: "\e5b4\e5b4";
+}
+
+.fa-duotone.fa-bridge-suspension:after, .fad.fa-bridge-suspension:after {
+  content: "\e4cd\e4cd";
+}
+
+.fa-duotone.fa-trash-check:after, .fad.fa-trash-check:after {
+  content: "\e2af\e2af";
+}
+
+.fa-duotone.fa-user-nurse:after, .fad.fa-user-nurse:after {
+  content: "\f82f\f82f";
+}
+
+.fa-duotone.fa-boombox:after, .fad.fa-boombox:after {
+  content: "\f8a5\f8a5";
+}
+
+.fa-duotone.fa-syringe:after, .fad.fa-syringe:after {
+  content: "\f48e\f48e";
+}
+
+.fa-duotone.fa-cloud-sun:after, .fad.fa-cloud-sun:after {
+  content: "\f6c4\f6c4";
+}
+
+.fa-duotone.fa-shield-exclamation:after, .fad.fa-shield-exclamation:after {
+  content: "\e247\e247";
+}
+
+.fa-duotone.fa-stopwatch-20:after, .fad.fa-stopwatch-20:after {
+  content: "\e06f\e06f";
+}
+
+.fa-duotone.fa-square-full:after, .fad.fa-square-full:after {
+  content: "\f45c\f45c";
+}
+
+.fa-duotone.fa-grip-dots:after, .fad.fa-grip-dots:after {
+  content: "\e410\e410";
+}
+
+.fa-duotone.fa-comment-exclamation:after, .fad.fa-comment-exclamation:after {
+  content: "\f4af\f4af";
+}
+
+.fa-duotone.fa-pen-swirl:after, .fad.fa-pen-swirl:after {
+  content: "\e214\e214";
+}
+
+.fa-duotone.fa-falafel:after, .fad.fa-falafel:after {
+  content: "\e40a\e40a";
+}
+
+.fa-duotone.fa-circle-2:after, .fad.fa-circle-2:after {
+  content: "\e0ef\e0ef";
+}
+
+.fa-duotone.fa-magnet:after, .fad.fa-magnet:after {
+  content: "\f076\f076";
+}
+
+.fa-duotone.fa-jar:after, .fad.fa-jar:after {
+  content: "\e516\e516";
+}
+
+.fa-duotone.fa-gramophone:after, .fad.fa-gramophone:after {
+  content: "\f8bd\f8bd";
+}
+
+.fa-duotone.fa-dice-d12:after, .fad.fa-dice-d12:after {
+  content: "\f6ce\f6ce";
+}
+
+.fa-duotone.fa-note-sticky:after, .fa-duotone.fa-sticky-note:after, .fad.fa-note-sticky:after, .fad.fa-sticky-note:after {
+  content: "\f249\f249";
+}
+
+.fa-duotone.fa-arrow-alt-down:after, .fa-duotone.fa-down:after, .fad.fa-arrow-alt-down:after, .fad.fa-down:after {
+  content: "\f354\f354";
+}
+
+.fa-duotone.fa-100:after, .fa-duotone.fa-hundred-points:after, .fad.fa-100:after, .fad.fa-hundred-points:after {
+  content: "\e41c\e41c";
+}
+
+.fa-duotone.fa-paperclip-vertical:after, .fad.fa-paperclip-vertical:after {
+  content: "\e3c2\e3c2";
+}
+
+.fa-duotone.fa-wind-circle-exclamation:after, .fa-duotone.fa-wind-warning:after, .fad.fa-wind-circle-exclamation:after, .fad.fa-wind-warning:after {
+  content: "\f776\f776";
+}
+
+.fa-duotone.fa-location-pin-slash:after, .fa-duotone.fa-map-marker-slash:after, .fad.fa-location-pin-slash:after, .fad.fa-map-marker-slash:after {
+  content: "\f60c\f60c";
+}
+
+.fa-duotone.fa-face-sad-sweat:after, .fad.fa-face-sad-sweat:after {
+  content: "\e38a\e38a";
+}
+
+.fa-duotone.fa-bug-slash:after, .fad.fa-bug-slash:after {
+  content: "\e490\e490";
+}
+
+.fa-duotone.fa-cupcake:after, .fad.fa-cupcake:after {
+  content: "\e402\e402";
+}
+
+.fa-duotone.fa-light-switch-off:after, .fad.fa-light-switch-off:after {
+  content: "\e018\e018";
+}
+
+.fa-duotone.fa-toggle-large-off:after, .fad.fa-toggle-large-off:after {
+  content: "\e5b0\e5b0";
+}
+
+.fa-duotone.fa-pen-fancy-slash:after, .fad.fa-pen-fancy-slash:after {
+  content: "\e210\e210";
+}
+
+.fa-duotone.fa-truck-container:after, .fad.fa-truck-container:after {
+  content: "\f4dc\f4dc";
+}
+
+.fa-duotone.fa-boot:after, .fad.fa-boot:after {
+  content: "\f782\f782";
+}
+
+.fa-duotone.fa-arrow-up-from-water-pump:after, .fad.fa-arrow-up-from-water-pump:after {
+  content: "\e4b6\e4b6";
+}
+
+.fa-duotone.fa-file-check:after, .fad.fa-file-check:after {
+  content: "\f316\f316";
+}
+
+.fa-duotone.fa-bone:after, .fad.fa-bone:after {
+  content: "\f5d7\f5d7";
+}
+
+.fa-duotone.fa-cards-blank:after, .fad.fa-cards-blank:after {
+  content: "\e4df\e4df";
+}
+
+.fa-duotone.fa-circle-3:after, .fad.fa-circle-3:after {
+  content: "\e0f0\e0f0";
+}
+
+.fa-duotone.fa-bench-tree:after, .fad.fa-bench-tree:after {
+  content: "\e2e7\e2e7";
+}
+
+.fa-duotone.fa-keyboard-brightness-low:after, .fad.fa-keyboard-brightness-low:after {
+  content: "\e1c1\e1c1";
+}
+
+.fa-duotone.fa-ski-boot-ski:after, .fad.fa-ski-boot-ski:after {
+  content: "\e3cd\e3cd";
+}
+
+.fa-duotone.fa-brain-circuit:after, .fad.fa-brain-circuit:after {
+  content: "\e0c6\e0c6";
+}
+
+.fa-duotone.fa-user-injured:after, .fad.fa-user-injured:after {
+  content: "\f728\f728";
+}
+
+.fa-duotone.fa-block-brick-fire:after, .fa-duotone.fa-firewall:after, .fad.fa-block-brick-fire:after, .fad.fa-firewall:after {
+  content: "\e3dc\e3dc";
+}
+
+.fa-duotone.fa-face-sad-tear:after, .fa-duotone.fa-sad-tear:after, .fad.fa-face-sad-tear:after, .fad.fa-sad-tear:after {
+  content: "\f5b4\f5b4";
+}
+
+.fa-duotone.fa-plane:after, .fad.fa-plane:after {
+  content: "\f072\f072";
+}
+
+.fa-duotone.fa-tent-arrows-down:after, .fad.fa-tent-arrows-down:after {
+  content: "\e581\e581";
+}
+
+.fa-duotone.fa-exclamation:after, .fad.fa-exclamation:after {
+  content: "\21\21";
+}
+
+.fa-duotone.fa-arrows-spin:after, .fad.fa-arrows-spin:after {
+  content: "\e4bb\e4bb";
+}
+
+.fa-duotone.fa-face-smile-relaxed:after, .fad.fa-face-smile-relaxed:after {
+  content: "\e392\e392";
+}
+
+.fa-duotone.fa-comment-times:after, .fa-duotone.fa-comment-xmark:after, .fad.fa-comment-times:after, .fad.fa-comment-xmark:after {
+  content: "\f4b5\f4b5";
+}
+
+.fa-duotone.fa-print:after, .fad.fa-print:after {
+  content: "\f02f\f02f";
+}
+
+.fa-duotone.fa-try:after, .fa-duotone.fa-turkish-lira-sign:after, .fa-duotone.fa-turkish-lira:after, .fad.fa-try:after, .fad.fa-turkish-lira-sign:after, .fad.fa-turkish-lira:after {
+  content: "\e2bb\e2bb";
+}
+
+.fa-duotone.fa-face-nose-steam:after, .fad.fa-face-nose-steam:after {
+  content: "\e382\e382";
+}
+
+.fa-duotone.fa-circle-waveform-lines:after, .fa-duotone.fa-waveform-circle:after, .fad.fa-circle-waveform-lines:after, .fad.fa-waveform-circle:after {
+  content: "\e12d\e12d";
+}
+
+.fa-duotone.fa-dollar-sign:after, .fa-duotone.fa-dollar:after, .fa-duotone.fa-usd:after, .fad.fa-dollar-sign:after, .fad.fa-dollar:after, .fad.fa-usd:after {
+  content: "\24\24";
+}
+
+.fa-duotone.fa-ferris-wheel:after, .fad.fa-ferris-wheel:after {
+  content: "\e174\e174";
+}
+
+.fa-duotone.fa-computer-speaker:after, .fad.fa-computer-speaker:after {
+  content: "\f8b2\f8b2";
+}
+
+.fa-duotone.fa-skull-cow:after, .fad.fa-skull-cow:after {
+  content: "\f8de\f8de";
+}
+
+.fa-duotone.fa-x:after, .fad.fa-x:after {
+  content: "\58\58";
+}
+
+.fa-duotone.fa-magnifying-glass-dollar:after, .fa-duotone.fa-search-dollar:after, .fad.fa-magnifying-glass-dollar:after, .fad.fa-search-dollar:after {
+  content: "\f688\f688";
+}
+
+.fa-duotone.fa-users-cog:after, .fa-duotone.fa-users-gear:after, .fad.fa-users-cog:after, .fad.fa-users-gear:after {
+  content: "\f509\f509";
+}
+
+.fa-duotone.fa-person-military-pointing:after, .fad.fa-person-military-pointing:after {
+  content: "\e54a\e54a";
+}
+
+.fa-duotone.fa-bank:after, .fa-duotone.fa-building-columns:after, .fa-duotone.fa-institution:after, .fa-duotone.fa-museum:after, .fa-duotone.fa-university:after, .fad.fa-bank:after, .fad.fa-building-columns:after, .fad.fa-institution:after, .fad.fa-museum:after, .fad.fa-university:after {
+  content: "\f19c\f19c";
+}
+
+.fa-duotone.fa-circle-t:after, .fad.fa-circle-t:after {
+  content: "\e124\e124";
+}
+
+.fa-duotone.fa-sack:after, .fad.fa-sack:after {
+  content: "\f81c\f81c";
+}
+
+.fa-duotone.fa-grid-2:after, .fad.fa-grid-2:after {
+  content: "\e196\e196";
+}
+
+.fa-duotone.fa-camera-cctv:after, .fa-duotone.fa-cctv:after, .fad.fa-camera-cctv:after, .fad.fa-cctv:after {
+  content: "\f8ac\f8ac";
+}
+
+.fa-duotone.fa-umbrella:after, .fad.fa-umbrella:after {
+  content: "\f0e9\f0e9";
+}
+
+.fa-duotone.fa-trowel:after, .fad.fa-trowel:after {
+  content: "\e589\e589";
+}
+
+.fa-duotone.fa-horizontal-rule:after, .fad.fa-horizontal-rule:after {
+  content: "\f86c\f86c";
+}
+
+.fa-duotone.fa-bed-alt:after, .fa-duotone.fa-bed-front:after, .fad.fa-bed-alt:after, .fad.fa-bed-front:after {
+  content: "\f8f7\f8f7";
+}
+
+.fa-duotone.fa-d:after, .fad.fa-d:after {
+  content: "\44\44";
+}
+
+.fa-duotone.fa-stapler:after, .fad.fa-stapler:after {
+  content: "\e5af\e5af";
+}
+
+.fa-duotone.fa-masks-theater:after, .fa-duotone.fa-theater-masks:after, .fad.fa-masks-theater:after, .fad.fa-theater-masks:after {
+  content: "\f630\f630";
+}
+
+.fa-duotone.fa-file-gif:after, .fad.fa-file-gif:after {
+  content: "\e645\e645";
+}
+
+.fa-duotone.fa-kip-sign:after, .fad.fa-kip-sign:after {
+  content: "\e1c4\e1c4";
+}
+
+.fa-duotone.fa-face-woozy:after, .fad.fa-face-woozy:after {
+  content: "\e3a2\e3a2";
+}
+
+.fa-duotone.fa-cloud-question:after, .fad.fa-cloud-question:after {
+  content: "\e492\e492";
+}
+
+.fa-duotone.fa-pineapple:after, .fad.fa-pineapple:after {
+  content: "\e31f\e31f";
+}
+
+.fa-duotone.fa-hand-point-left:after, .fad.fa-hand-point-left:after {
+  content: "\f0a5\f0a5";
+}
+
+.fa-duotone.fa-gallery-thumbnails:after, .fad.fa-gallery-thumbnails:after {
+  content: "\e3aa\e3aa";
+}
+
+.fa-duotone.fa-circle-j:after, .fad.fa-circle-j:after {
+  content: "\e112\e112";
+}
+
+.fa-duotone.fa-eyes:after, .fad.fa-eyes:after {
+  content: "\e367\e367";
+}
+
+.fa-duotone.fa-handshake-alt:after, .fa-duotone.fa-handshake-simple:after, .fad.fa-handshake-alt:after, .fad.fa-handshake-simple:after {
+  content: "\f4c6\f4c6";
+}
+
+.fa-duotone.fa-file-caret-up:after, .fa-duotone.fa-page-caret-up:after, .fad.fa-file-caret-up:after, .fad.fa-page-caret-up:after {
+  content: "\e42a\e42a";
+}
+
+.fa-duotone.fa-fighter-jet:after, .fa-duotone.fa-jet-fighter:after, .fad.fa-fighter-jet:after, .fad.fa-jet-fighter:after {
+  content: "\f0fb\f0fb";
+}
+
+.fa-duotone.fa-comet:after, .fad.fa-comet:after {
+  content: "\e003\e003";
+}
+
+.fa-duotone.fa-share-alt-square:after, .fa-duotone.fa-square-share-nodes:after, .fad.fa-share-alt-square:after, .fad.fa-square-share-nodes:after {
+  content: "\f1e1\f1e1";
+}
+
+.fa-duotone.fa-reflect-vertical:after, .fad.fa-reflect-vertical:after {
+  content: "\e665\e665";
+}
+
+.fa-duotone.fa-shield-keyhole:after, .fad.fa-shield-keyhole:after {
+  content: "\e248\e248";
+}
+
+.fa-duotone.fa-file-mp4:after, .fad.fa-file-mp4:after {
+  content: "\e649\e649";
+}
+
+.fa-duotone.fa-barcode:after, .fad.fa-barcode:after {
+  content: "\f02a\f02a";
+}
+
+.fa-duotone.fa-bulldozer:after, .fad.fa-bulldozer:after {
+  content: "\e655\e655";
+}
+
+.fa-duotone.fa-plus-minus:after, .fad.fa-plus-minus:after {
+  content: "\e43c\e43c";
+}
+
+.fa-duotone.fa-sliders-v-square:after, .fa-duotone.fa-square-sliders-vertical:after, .fad.fa-sliders-v-square:after, .fad.fa-square-sliders-vertical:after {
+  content: "\f3f2\f3f2";
+}
+
+.fa-duotone.fa-video-camera:after, .fa-duotone.fa-video:after, .fad.fa-video-camera:after, .fad.fa-video:after {
+  content: "\f03d\f03d";
+}
+
+.fa-duotone.fa-comment-middle-alt:after, .fa-duotone.fa-message-middle:after, .fad.fa-comment-middle-alt:after, .fad.fa-message-middle:after {
+  content: "\e1e1\e1e1";
+}
+
+.fa-duotone.fa-graduation-cap:after, .fa-duotone.fa-mortar-board:after, .fad.fa-graduation-cap:after, .fad.fa-mortar-board:after {
+  content: "\f19d\f19d";
+}
+
+.fa-duotone.fa-hand-holding-medical:after, .fad.fa-hand-holding-medical:after {
+  content: "\e05c\e05c";
+}
+
+.fa-duotone.fa-person-circle-check:after, .fad.fa-person-circle-check:after {
+  content: "\e53e\e53e";
+}
+
+.fa-duotone.fa-square-z:after, .fad.fa-square-z:after {
+  content: "\e288\e288";
+}
+
+.fa-duotone.fa-comment-alt-text:after, .fa-duotone.fa-message-text:after, .fad.fa-comment-alt-text:after, .fad.fa-message-text:after {
+  content: "\e1e6\e1e6";
+}
+
+.fa-duotone.fa-level-up-alt:after, .fa-duotone.fa-turn-up:after, .fad.fa-level-up-alt:after, .fad.fa-turn-up:after {
+  content: "\f3bf\f3bf";
+}
+
+:host, :root {
+  --fa-font-light: normal 300 1em/1 "Font Awesome 6 Pro";
+}
+
+.fa-light, .fal {
+  font-weight: 300;
+}
+
+:host, :root {
+  --fa-font-regular: normal 400 1em/1 "Font Awesome 6 Pro";
+}
+
+.fa-regular, .far {
+  font-weight: 400;
+}
+
+:host, :root {
+  --fa-font-solid: normal 900 1em/1 "Font Awesome 6 Pro";
+}
+
+.fa-solid, .fas {
+  font-weight: 900;
+}
+
+:host, :root {
+  --fa-style-family-classic: "Font Awesome 6 Pro";
+  --fa-font-thin: normal 100 1em/1 "Font Awesome 6 Pro";
+}
+
+.fa-thin, .fat {
+  font-weight: 100;
+}
+
diff --git a/WebContentt/public/assets/css/fontawesome.min.css b/WebContentt/public/assets/css/fontawesome.min.css
new file mode 100644
index 0000000..47846b1
--- /dev/null
+++ b/WebContentt/public/assets/css/fontawesome.min.css
@@ -0,0 +1,13674 @@
+/* !
+ * Font Awesome Pro 6.5.2 by @fontawesome - https://fontawesome.com
+ * License - https://fontawesome.com/license (Commercial License)
+ * Copyright 2024 Fonticons, Inc. */
+
+.fa {
+  font-family: var(--fa-style-family,"Font Awesome 6 Pro");
+  font-weight: var(--fa-style,900);
+}
+
+.fa, .fa-brands, .fa-classic, .fa-duotone, .fa-light, .fa-regular, .fa-sharp, .fa-sharp-solid, .fa-solid, .fa-thin, .fab, .fad, .fal, .far, .fas, .fasl, .fasr, .fass, .fast, .fat {
+  -moz-osx-font-smoothing: grayscale;
+  -webkit-font-smoothing: antialiased;
+  display: var(--fa-display,inline-block);
+  font-style: normal;
+  font-variant: normal;
+  line-height: 1;
+  text-rendering: auto;
+}
+
+.fa-classic, .fa-light, .fa-regular, .fa-solid, .fa-thin, .fal, .far, .fas, .fat {
+  font-family: "Font Awesome 6 Pro";
+}
+
+.fa-brands, .fab {
+  font-family: "Font Awesome 6 Brands";
+}
+
+.fa-classic.fa-duotone, .fa-duotone, .fad {
+  font-family: "Font Awesome 6 Duotone";
+}
+
+.fa-sharp, .fasl, .fasr, .fass, .fast {
+  font-family: "Font Awesome 6 Sharp";
+}
+
+.fa-sharp, .fass {
+  font-weight: 900;
+}
+
+.fa-1x {
+  font-size: 1em;
+}
+
+.fa-2x {
+  font-size: 2em;
+}
+
+.fa-3x {
+  font-size: 3em;
+}
+
+.fa-4x {
+  font-size: 4em;
+}
+
+.fa-5x {
+  font-size: 5em;
+}
+
+.fa-6x {
+  font-size: 6em;
+}
+
+.fa-7x {
+  font-size: 7em;
+}
+
+.fa-8x {
+  font-size: 8em;
+}
+
+.fa-9x {
+  font-size: 9em;
+}
+
+.fa-10x {
+  font-size: 10em;
+}
+
+.fa-2xs {
+  font-size: .625em;
+  line-height: .1em;
+  vertical-align: .225em;
+}
+
+.fa-xs {
+  font-size: .75em;
+  line-height: .08333em;
+  vertical-align: .125em;
+}
+
+.fa-sm {
+  font-size: .875em;
+  line-height: .07143em;
+  vertical-align: .05357em;
+}
+
+.fa-lg {
+  font-size: 1.25em;
+  line-height: .05em;
+  vertical-align: -.075em;
+}
+
+.fa-xl {
+  font-size: 1.5em;
+  line-height: .04167em;
+  vertical-align: -.125em;
+}
+
+.fa-2xl {
+  font-size: 2em;
+  line-height: .03125em;
+  vertical-align: -.1875em;
+}
+
+.fa-fw {
+  text-align: center;
+  width: 1.25em;
+}
+
+.fa-ul {
+  list-style-type: none;
+  margin-left: var(--fa-li-margin,2.5em);
+  padding-left: 0;
+}
+
+.fa-ul > li {
+  position: relative;
+}
+
+.fa-li {
+  left: calc(var(--fa-li-width, 2em)*-1);
+  position: absolute;
+  text-align: center;
+  width: var(--fa-li-width,2em);
+  line-height: inherit;
+}
+
+.fa-border {
+  border-radius: var(--fa-border-radius,.1em);
+  border: var(--fa-border-width,.08em) var(--fa-border-style,solid) var(--fa-border-color,#eee);
+  padding: var(--fa-border-padding,.2em .25em .15em);
+}
+
+.fa-pull-left {
+  float: left;
+  margin-right: var(--fa-pull-margin,.3em);
+}
+
+.fa-pull-right {
+  float: right;
+  margin-left: var(--fa-pull-margin,.3em);
+}
+
+.fa-beat {
+  -webkit-animation-name: fa-beat;
+  animation-name: fa-beat;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,ease-in-out);
+  animation-timing-function: var(--fa-animation-timing,ease-in-out);
+}
+
+.fa-bounce {
+  -webkit-animation-name: fa-bounce;
+  animation-name: fa-bounce;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.28,.84,.42,1));
+}
+
+.fa-fade {
+  -webkit-animation-name: fa-fade;
+  animation-name: fa-fade;
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+}
+
+.fa-beat-fade, .fa-fade {
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+}
+
+.fa-beat-fade {
+  -webkit-animation-name: fa-beat-fade;
+  animation-name: fa-beat-fade;
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+  animation-timing-function: var(--fa-animation-timing,cubic-bezier(.4,0,.6,1));
+}
+
+.fa-flip {
+  -webkit-animation-name: fa-flip;
+  animation-name: fa-flip;
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,ease-in-out);
+  animation-timing-function: var(--fa-animation-timing,ease-in-out);
+}
+
+.fa-shake {
+  -webkit-animation-name: fa-shake;
+  animation-name: fa-shake;
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,linear);
+  animation-timing-function: var(--fa-animation-timing,linear);
+}
+
+.fa-shake, .fa-spin {
+  -webkit-animation-delay: var(--fa-animation-delay,0s);
+  animation-delay: var(--fa-animation-delay,0s);
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+}
+
+.fa-spin {
+  -webkit-animation-name: fa-spin;
+  animation-name: fa-spin;
+  -webkit-animation-duration: var(--fa-animation-duration,2s);
+  animation-duration: var(--fa-animation-duration,2s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,linear);
+  animation-timing-function: var(--fa-animation-timing,linear);
+}
+
+.fa-spin-reverse {
+  --fa-animation-direction: reverse;
+}
+
+.fa-pulse, .fa-spin-pulse {
+  -webkit-animation-name: fa-spin;
+  animation-name: fa-spin;
+  -webkit-animation-direction: var(--fa-animation-direction,normal);
+  animation-direction: var(--fa-animation-direction,normal);
+  -webkit-animation-duration: var(--fa-animation-duration,1s);
+  animation-duration: var(--fa-animation-duration,1s);
+  -webkit-animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  animation-iteration-count: var(--fa-animation-iteration-count,infinite);
+  -webkit-animation-timing-function: var(--fa-animation-timing,steps(8));
+  animation-timing-function: var(--fa-animation-timing,steps(8));
+}
+
+@media (prefers-reduced-motion:reduce) {
+  .fa-beat, .fa-beat-fade, .fa-bounce, .fa-fade, .fa-flip, .fa-pulse, .fa-shake, .fa-spin, .fa-spin-pulse {
+    -webkit-animation-delay: -1ms;
+    animation-delay: -1ms;
+    -webkit-animation-duration: 1ms;
+    animation-duration: 1ms;
+    -webkit-animation-iteration-count: 1;
+    animation-iteration-count: 1;
+    -webkit-transition-delay: 0s;
+    transition-delay: 0s;
+    -webkit-transition-duration: 0s;
+    transition-duration: 0s;
+  }
+}
+
+@keyframes fa-beat {
+  0%, 90% {
+    -webkit-transform: scale(1);
+    transform: scale(1);
+  }
+  45% {
+    -webkit-transform: scale(var(--fa-beat-scale,1.25));
+    transform: scale(var(--fa-beat-scale,1.25));
+  }
+}
+
+@keyframes fa-bounce {
+  0% {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+  10% {
+    -webkit-transform: scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);
+    transform: scale(var(--fa-bounce-start-scale-x,1.1),var(--fa-bounce-start-scale-y,.9)) translateY(0);
+  }
+  30% {
+    -webkit-transform: scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));
+    transform: scale(var(--fa-bounce-jump-scale-x,.9),var(--fa-bounce-jump-scale-y,1.1)) translateY(var(--fa-bounce-height,-.5em));
+  }
+  50% {
+    -webkit-transform: scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);
+    transform: scale(var(--fa-bounce-land-scale-x,1.05),var(--fa-bounce-land-scale-y,.95)) translateY(0);
+  }
+  57% {
+    -webkit-transform: scale(1) translateY(var(--fa-bounce-rebound,-.125em));
+    transform: scale(1) translateY(var(--fa-bounce-rebound,-.125em));
+  }
+  64% {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+  to {
+    -webkit-transform: scale(1) translateY(0);
+    transform: scale(1) translateY(0);
+  }
+}
+
+@keyframes fa-fade {
+  50% {
+    opacity: var(--fa-fade-opacity,.4);
+  }
+}
+
+@keyframes fa-beat-fade {
+  0%, to {
+    opacity: var(--fa-beat-fade-opacity,.4);
+    -webkit-transform: scale(1);
+    transform: scale(1);
+  }
+  50% {
+    opacity: 1;
+    -webkit-transform: scale(var(--fa-beat-fade-scale,1.125));
+    transform: scale(var(--fa-beat-fade-scale,1.125));
+  }
+}
+
+@keyframes fa-flip {
+  50% {
+    -webkit-transform: rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));
+    transform: rotate3d(var(--fa-flip-x,0),var(--fa-flip-y,1),var(--fa-flip-z,0),var(--fa-flip-angle,-180deg));
+  }
+}
+
+@keyframes fa-shake {
+  0% {
+    -webkit-transform: rotate(-15deg);
+    transform: rotate(-15deg);
+  }
+  4% {
+    -webkit-transform: rotate(15deg);
+    transform: rotate(15deg);
+  }
+  8%, 24% {
+    -webkit-transform: rotate(-18deg);
+    transform: rotate(-18deg);
+  }
+  12%, 28% {
+    -webkit-transform: rotate(18deg);
+    transform: rotate(18deg);
+  }
+  16% {
+    -webkit-transform: rotate(-22deg);
+    transform: rotate(-22deg);
+  }
+  20% {
+    -webkit-transform: rotate(22deg);
+    transform: rotate(22deg);
+  }
+  32% {
+    -webkit-transform: rotate(-12deg);
+    transform: rotate(-12deg);
+  }
+  36% {
+    -webkit-transform: rotate(12deg);
+    transform: rotate(12deg);
+  }
+  40%, to {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+}
+
+@keyframes fa-spin {
+  0% {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+  to {
+    -webkit-transform: rotate(1turn);
+    transform: rotate(1turn);
+  }
+}
+
+.fa-rotate-90 {
+  -webkit-transform: rotate(90deg);
+  transform: rotate(90deg);
+}
+
+.fa-rotate-180 {
+  -webkit-transform: rotate(180deg);
+  transform: rotate(180deg);
+}
+
+.fa-rotate-270 {
+  -webkit-transform: rotate(270deg);
+  transform: rotate(270deg);
+}
+
+.fa-flip-horizontal {
+  -webkit-transform: scaleX(-1);
+  transform: scaleX(-1);
+}
+
+.fa-flip-vertical {
+  -webkit-transform: scaleY(-1);
+  transform: scaleY(-1);
+}
+
+.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {
+  -webkit-transform: scale(-1);
+  transform: scale(-1);
+}
+
+.fa-rotate-by {
+  -webkit-transform: rotate(var(--fa-rotate-angle,0));
+  transform: rotate(var(--fa-rotate-angle,0));
+}
+
+.fa-stack {
+  display: inline-block;
+  height: 2em;
+  line-height: 2em;
+  position: relative;
+  vertical-align: middle;
+  width: 2.5em;
+}
+
+.fa-stack-1x, .fa-stack-2x {
+  left: 0;
+  position: absolute;
+  text-align: center;
+  width: 100%;
+  z-index: var(--fa-stack-z-index,auto);
+}
+
+.fa-stack-1x {
+  line-height: inherit;
+}
+
+.fa-stack-2x {
+  font-size: 2em;
+}
+
+.fa-inverse {
+  color: var(--fa-inverse,#fff);
+}
+
+.fa-0:before {
+  content: "\30";
+}
+
+.fa-1:before {
+  content: "\31";
+}
+
+.fa-2:before {
+  content: "\32";
+}
+
+.fa-3:before {
+  content: "\33";
+}
+
+.fa-4:before {
+  content: "\34";
+}
+
+.fa-5:before {
+  content: "\35";
+}
+
+.fa-6:before {
+  content: "\36";
+}
+
+.fa-7:before {
+  content: "\37";
+}
+
+.fa-8:before {
+  content: "\38";
+}
+
+.fa-9:before {
+  content: "\39";
+}
+
+.fa-fill-drip:before {
+  content: "\f576";
+}
+
+.fa-arrows-to-circle:before {
+  content: "\e4bd";
+}
+
+.fa-chevron-circle-right:before, .fa-circle-chevron-right:before {
+  content: "\f138";
+}
+
+.fa-wagon-covered:before {
+  content: "\f8ee";
+}
+
+.fa-line-height:before {
+  content: "\f871";
+}
+
+.fa-bagel:before {
+  content: "\e3d7";
+}
+
+.fa-transporter-7:before {
+  content: "\e2a8";
+}
+
+.fa-at:before {
+  content: "\40";
+}
+
+.fa-rectangles-mixed:before {
+  content: "\e323";
+}
+
+.fa-phone-arrow-up-right:before, .fa-phone-arrow-up:before, .fa-phone-outgoing:before {
+  content: "\e224";
+}
+
+.fa-trash-alt:before, .fa-trash-can:before {
+  content: "\f2ed";
+}
+
+.fa-circle-l:before {
+  content: "\e114";
+}
+
+.fa-head-side-goggles:before, .fa-head-vr:before {
+  content: "\f6ea";
+}
+
+.fa-text-height:before {
+  content: "\f034";
+}
+
+.fa-user-times:before, .fa-user-xmark:before {
+  content: "\f235";
+}
+
+.fa-face-hand-yawn:before {
+  content: "\e379";
+}
+
+.fa-gauge-simple-min:before, .fa-tachometer-slowest:before {
+  content: "\f62d";
+}
+
+.fa-stethoscope:before {
+  content: "\f0f1";
+}
+
+.fa-coffin:before {
+  content: "\f6c6";
+}
+
+.fa-comment-alt:before, .fa-message:before {
+  content: "\f27a";
+}
+
+.fa-bowl-salad:before, .fa-salad:before {
+  content: "\f81e";
+}
+
+.fa-info:before {
+  content: "\f129";
+}
+
+.fa-robot-astromech:before {
+  content: "\e2d2";
+}
+
+.fa-ring-diamond:before {
+  content: "\e5ab";
+}
+
+.fa-fondue-pot:before {
+  content: "\e40d";
+}
+
+.fa-theta:before {
+  content: "\f69e";
+}
+
+.fa-face-hand-peeking:before {
+  content: "\e481";
+}
+
+.fa-square-user:before {
+  content: "\e283";
+}
+
+.fa-compress-alt:before, .fa-down-left-and-up-right-to-center:before {
+  content: "\f422";
+}
+
+.fa-explosion:before {
+  content: "\e4e9";
+}
+
+.fa-file-alt:before, .fa-file-lines:before, .fa-file-text:before {
+  content: "\f15c";
+}
+
+.fa-wave-square:before {
+  content: "\f83e";
+}
+
+.fa-ring:before {
+  content: "\f70b";
+}
+
+.fa-building-un:before {
+  content: "\e4d9";
+}
+
+.fa-dice-three:before {
+  content: "\f527";
+}
+
+.fa-tire-pressure-warning:before {
+  content: "\f633";
+}
+
+.fa-wifi-2:before, .fa-wifi-fair:before {
+  content: "\f6ab";
+}
+
+.fa-calendar-alt:before, .fa-calendar-days:before {
+  content: "\f073";
+}
+
+.fa-mp3-player:before {
+  content: "\f8ce";
+}
+
+.fa-anchor-circle-check:before {
+  content: "\e4aa";
+}
+
+.fa-tally-4:before {
+  content: "\e297";
+}
+
+.fa-rectangle-history:before {
+  content: "\e4a2";
+}
+
+.fa-building-circle-arrow-right:before {
+  content: "\e4d1";
+}
+
+.fa-volleyball-ball:before, .fa-volleyball:before {
+  content: "\f45f";
+}
+
+.fa-sun-haze:before {
+  content: "\f765";
+}
+
+.fa-text-size:before {
+  content: "\f894";
+}
+
+.fa-ufo:before {
+  content: "\e047";
+}
+
+.fa-fork:before, .fa-utensil-fork:before {
+  content: "\f2e3";
+}
+
+.fa-arrows-up-to-line:before {
+  content: "\e4c2";
+}
+
+.fa-mobile-signal:before {
+  content: "\e1ef";
+}
+
+.fa-barcode-scan:before {
+  content: "\f465";
+}
+
+.fa-sort-desc:before, .fa-sort-down:before {
+  content: "\f0dd";
+}
+
+.fa-folder-arrow-down:before, .fa-folder-download:before {
+  content: "\e053";
+}
+
+.fa-circle-minus:before, .fa-minus-circle:before {
+  content: "\f056";
+}
+
+.fa-face-icicles:before {
+  content: "\e37c";
+}
+
+.fa-shovel:before {
+  content: "\f713";
+}
+
+.fa-door-open:before {
+  content: "\f52b";
+}
+
+.fa-films:before {
+  content: "\e17a";
+}
+
+.fa-right-from-bracket:before, .fa-sign-out-alt:before {
+  content: "\f2f5";
+}
+
+.fa-face-glasses:before {
+  content: "\e377";
+}
+
+.fa-nfc:before {
+  content: "\e1f7";
+}
+
+.fa-atom:before {
+  content: "\f5d2";
+}
+
+.fa-soap:before {
+  content: "\e06e";
+}
+
+.fa-heart-music-camera-bolt:before, .fa-icons:before {
+  content: "\f86d";
+}
+
+.fa-microphone-alt-slash:before, .fa-microphone-lines-slash:before {
+  content: "\f539";
+}
+
+.fa-closed-captioning-slash:before {
+  content: "\e135";
+}
+
+.fa-calculator-alt:before, .fa-calculator-simple:before {
+  content: "\f64c";
+}
+
+.fa-bridge-circle-check:before {
+  content: "\e4c9";
+}
+
+.fa-sliders-up:before, .fa-sliders-v:before {
+  content: "\f3f1";
+}
+
+.fa-location-minus:before, .fa-map-marker-minus:before {
+  content: "\f609";
+}
+
+.fa-pump-medical:before {
+  content: "\e06a";
+}
+
+.fa-fingerprint:before {
+  content: "\f577";
+}
+
+.fa-ski-boot:before {
+  content: "\e3cc";
+}
+
+.fa-rectangle-sd:before, .fa-standard-definition:before {
+  content: "\e28a";
+}
+
+.fa-h1:before {
+  content: "\f313";
+}
+
+.fa-hand-point-right:before {
+  content: "\f0a4";
+}
+
+.fa-magnifying-glass-location:before, .fa-search-location:before {
+  content: "\f689";
+}
+
+.fa-message-bot:before {
+  content: "\e3b8";
+}
+
+.fa-forward-step:before, .fa-step-forward:before {
+  content: "\f051";
+}
+
+.fa-face-smile-beam:before, .fa-smile-beam:before {
+  content: "\f5b8";
+}
+
+.fa-light-ceiling:before {
+  content: "\e016";
+}
+
+.fa-comment-alt-exclamation:before, .fa-message-exclamation:before {
+  content: "\f4a5";
+}
+
+.fa-bowl-scoop:before, .fa-bowl-shaved-ice:before {
+  content: "\e3de";
+}
+
+.fa-square-x:before {
+  content: "\e286";
+}
+
+.fa-building-memo:before {
+  content: "\e61e";
+}
+
+.fa-utility-pole-double:before {
+  content: "\e2c4";
+}
+
+.fa-flag-checkered:before {
+  content: "\f11e";
+}
+
+.fa-chevron-double-up:before, .fa-chevrons-up:before {
+  content: "\f325";
+}
+
+.fa-football-ball:before, .fa-football:before {
+  content: "\f44e";
+}
+
+.fa-user-vneck:before {
+  content: "\e461";
+}
+
+.fa-school-circle-exclamation:before {
+  content: "\e56c";
+}
+
+.fa-crop:before {
+  content: "\f125";
+}
+
+.fa-angle-double-down:before, .fa-angles-down:before {
+  content: "\f103";
+}
+
+.fa-users-rectangle:before {
+  content: "\e594";
+}
+
+.fa-people-roof:before {
+  content: "\e537";
+}
+
+.fa-arrow-square-right:before, .fa-square-arrow-right:before {
+  content: "\f33b";
+}
+
+.fa-location-plus:before, .fa-map-marker-plus:before {
+  content: "\f60a";
+}
+
+.fa-lightbulb-exclamation-on:before {
+  content: "\e1ca";
+}
+
+.fa-people-line:before {
+  content: "\e534";
+}
+
+.fa-beer-mug-empty:before, .fa-beer:before {
+  content: "\f0fc";
+}
+
+.fa-crate-empty:before {
+  content: "\e151";
+}
+
+.fa-diagram-predecessor:before {
+  content: "\e477";
+}
+
+.fa-transporter:before {
+  content: "\e042";
+}
+
+.fa-calendar-circle-user:before {
+  content: "\e471";
+}
+
+.fa-arrow-up-long:before, .fa-long-arrow-up:before {
+  content: "\f176";
+}
+
+.fa-person-carry-box:before, .fa-person-carry:before {
+  content: "\f4cf";
+}
+
+.fa-burn:before, .fa-fire-flame-simple:before {
+  content: "\f46a";
+}
+
+.fa-male:before, .fa-person:before {
+  content: "\f183";
+}
+
+.fa-laptop:before {
+  content: "\f109";
+}
+
+.fa-file-csv:before {
+  content: "\f6dd";
+}
+
+.fa-menorah:before {
+  content: "\f676";
+}
+
+.fa-union:before {
+  content: "\f6a2";
+}
+
+.fa-chevron-double-left:before, .fa-chevrons-left:before {
+  content: "\f323";
+}
+
+.fa-circle-heart:before, .fa-heart-circle:before {
+  content: "\f4c7";
+}
+
+.fa-truck-plane:before {
+  content: "\e58f";
+}
+
+.fa-record-vinyl:before {
+  content: "\f8d9";
+}
+
+.fa-bring-forward:before {
+  content: "\f856";
+}
+
+.fa-square-p:before {
+  content: "\e279";
+}
+
+.fa-face-grin-stars:before, .fa-grin-stars:before {
+  content: "\f587";
+}
+
+.fa-sigma:before {
+  content: "\f68b";
+}
+
+.fa-camera-movie:before {
+  content: "\f8a9";
+}
+
+.fa-bong:before {
+  content: "\f55c";
+}
+
+.fa-clarinet:before {
+  content: "\f8ad";
+}
+
+.fa-truck-flatbed:before {
+  content: "\e2b6";
+}
+
+.fa-pastafarianism:before, .fa-spaghetti-monster-flying:before {
+  content: "\f67b";
+}
+
+.fa-arrow-down-up-across-line:before {
+  content: "\e4af";
+}
+
+.fa-arrows-rotate-reverse:before {
+  content: "\e630";
+}
+
+.fa-leaf-heart:before {
+  content: "\f4cb";
+}
+
+.fa-house-building:before {
+  content: "\e1b1";
+}
+
+.fa-cheese-swiss:before {
+  content: "\f7f0";
+}
+
+.fa-spoon:before, .fa-utensil-spoon:before {
+  content: "\f2e5";
+}
+
+.fa-jar-wheat:before {
+  content: "\e517";
+}
+
+.fa-envelopes-bulk:before, .fa-mail-bulk:before {
+  content: "\f674";
+}
+
+.fa-file-circle-exclamation:before {
+  content: "\e4eb";
+}
+
+.fa-bow-arrow:before {
+  content: "\f6b9";
+}
+
+.fa-cart-xmark:before {
+  content: "\e0dd";
+}
+
+.fa-hexagon-xmark:before, .fa-times-hexagon:before, .fa-xmark-hexagon:before {
+  content: "\f2ee";
+}
+
+.fa-circle-h:before, .fa-hospital-symbol:before {
+  content: "\f47e";
+}
+
+.fa-merge:before {
+  content: "\e526";
+}
+
+.fa-pager:before {
+  content: "\f815";
+}
+
+.fa-cart-minus:before {
+  content: "\e0db";
+}
+
+.fa-address-book:before, .fa-contact-book:before {
+  content: "\f2b9";
+}
+
+.fa-pan-frying:before {
+  content: "\e42c";
+}
+
+.fa-grid-3:before, .fa-grid:before {
+  content: "\e195";
+}
+
+.fa-football-helmet:before {
+  content: "\f44f";
+}
+
+.fa-hand-love:before {
+  content: "\e1a5";
+}
+
+.fa-trees:before {
+  content: "\f724";
+}
+
+.fa-strikethrough:before {
+  content: "\f0cc";
+}
+
+.fa-page:before {
+  content: "\e428";
+}
+
+.fa-k:before {
+  content: "\4b";
+}
+
+.fa-diagram-previous:before {
+  content: "\e478";
+}
+
+.fa-gauge-min:before, .fa-tachometer-alt-slowest:before {
+  content: "\f628";
+}
+
+.fa-folder-grid:before {
+  content: "\e188";
+}
+
+.fa-eggplant:before {
+  content: "\e16c";
+}
+
+.fa-excavator:before {
+  content: "\e656";
+}
+
+.fa-ram:before {
+  content: "\f70a";
+}
+
+.fa-landmark-flag:before {
+  content: "\e51c";
+}
+
+.fa-lips:before {
+  content: "\f600";
+}
+
+.fa-pencil-alt:before, .fa-pencil:before {
+  content: "\f303";
+}
+
+.fa-backward:before {
+  content: "\f04a";
+}
+
+.fa-caret-right:before {
+  content: "\f0da";
+}
+
+.fa-comments:before {
+  content: "\f086";
+}
+
+.fa-file-clipboard:before, .fa-paste:before {
+  content: "\f0ea";
+}
+
+.fa-desktop-arrow-down:before {
+  content: "\e155";
+}
+
+.fa-code-pull-request:before {
+  content: "\e13c";
+}
+
+.fa-pumpkin:before {
+  content: "\f707";
+}
+
+.fa-clipboard-list:before {
+  content: "\f46d";
+}
+
+.fa-pen-field:before {
+  content: "\e211";
+}
+
+.fa-blueberries:before {
+  content: "\e2e8";
+}
+
+.fa-truck-loading:before, .fa-truck-ramp-box:before {
+  content: "\f4de";
+}
+
+.fa-note:before {
+  content: "\e1ff";
+}
+
+.fa-arrow-down-to-square:before {
+  content: "\e096";
+}
+
+.fa-user-check:before {
+  content: "\f4fc";
+}
+
+.fa-cloud-xmark:before {
+  content: "\e35f";
+}
+
+.fa-vial-virus:before {
+  content: "\e597";
+}
+
+.fa-book-alt:before, .fa-book-blank:before {
+  content: "\f5d9";
+}
+
+.fa-golf-flag-hole:before {
+  content: "\e3ac";
+}
+
+.fa-comment-alt-arrow-down:before, .fa-message-arrow-down:before {
+  content: "\e1db";
+}
+
+.fa-face-unamused:before {
+  content: "\e39f";
+}
+
+.fa-sheet-plastic:before {
+  content: "\e571";
+}
+
+.fa-circle-9:before {
+  content: "\e0f6";
+}
+
+.fa-blog:before {
+  content: "\f781";
+}
+
+.fa-user-ninja:before {
+  content: "\f504";
+}
+
+.fa-pencil-slash:before {
+  content: "\e215";
+}
+
+.fa-bowling-pins:before {
+  content: "\f437";
+}
+
+.fa-person-arrow-up-from-line:before {
+  content: "\e539";
+}
+
+.fa-down-right:before {
+  content: "\e16b";
+}
+
+.fa-scroll-torah:before, .fa-torah:before {
+  content: "\f6a0";
+}
+
+.fa-webhook:before {
+  content: "\e5d5";
+}
+
+.fa-blinds-open:before {
+  content: "\f8fc";
+}
+
+.fa-fence:before {
+  content: "\e303";
+}
+
+.fa-arrow-alt-up:before, .fa-up:before {
+  content: "\f357";
+}
+
+.fa-broom-ball:before, .fa-quidditch-broom-ball:before, .fa-quidditch:before {
+  content: "\f458";
+}
+
+.fa-drumstick:before {
+  content: "\f6d6";
+}
+
+.fa-square-v:before {
+  content: "\e284";
+}
+
+.fa-face-awesome:before, .fa-gave-dandy:before {
+  content: "\e409";
+}
+
+.fa-dial-off:before {
+  content: "\e162";
+}
+
+.fa-toggle-off:before {
+  content: "\f204";
+}
+
+.fa-face-smile-horns:before {
+  content: "\e391";
+}
+
+.fa-archive:before, .fa-box-archive:before {
+  content: "\f187";
+}
+
+.fa-grapes:before {
+  content: "\e306";
+}
+
+.fa-person-drowning:before {
+  content: "\e545";
+}
+
+.fa-dial-max:before {
+  content: "\e15e";
+}
+
+.fa-circle-m:before {
+  content: "\e115";
+}
+
+.fa-calendar-image:before {
+  content: "\e0d4";
+}
+
+.fa-caret-circle-down:before, .fa-circle-caret-down:before {
+  content: "\f32d";
+}
+
+.fa-arrow-down-9-1:before, .fa-sort-numeric-desc:before, .fa-sort-numeric-down-alt:before {
+  content: "\f886";
+}
+
+.fa-face-grin-tongue-squint:before, .fa-grin-tongue-squint:before {
+  content: "\f58a";
+}
+
+.fa-shish-kebab:before {
+  content: "\f821";
+}
+
+.fa-spray-can:before {
+  content: "\f5bd";
+}
+
+.fa-alarm-snooze:before {
+  content: "\f845";
+}
+
+.fa-scarecrow:before {
+  content: "\f70d";
+}
+
+.fa-truck-monster:before {
+  content: "\f63b";
+}
+
+.fa-gift-card:before {
+  content: "\f663";
+}
+
+.fa-w:before {
+  content: "\57";
+}
+
+.fa-code-pull-request-draft:before {
+  content: "\e3fa";
+}
+
+.fa-square-b:before {
+  content: "\e264";
+}
+
+.fa-elephant:before {
+  content: "\f6da";
+}
+
+.fa-earth-africa:before, .fa-globe-africa:before {
+  content: "\f57c";
+}
+
+.fa-rainbow:before {
+  content: "\f75b";
+}
+
+.fa-circle-notch:before {
+  content: "\f1ce";
+}
+
+.fa-tablet-alt:before, .fa-tablet-screen-button:before {
+  content: "\f3fa";
+}
+
+.fa-paw:before {
+  content: "\f1b0";
+}
+
+.fa-message-question:before {
+  content: "\e1e3";
+}
+
+.fa-cloud:before {
+  content: "\f0c2";
+}
+
+.fa-trowel-bricks:before {
+  content: "\e58a";
+}
+
+.fa-square-3:before {
+  content: "\e258";
+}
+
+.fa-face-flushed:before, .fa-flushed:before {
+  content: "\f579";
+}
+
+.fa-hospital-user:before {
+  content: "\f80d";
+}
+
+.fa-microwave:before {
+  content: "\e01b";
+}
+
+.fa-chf-sign:before {
+  content: "\e602";
+}
+
+.fa-tent-arrow-left-right:before {
+  content: "\e57f";
+}
+
+.fa-cart-circle-arrow-up:before {
+  content: "\e3f0";
+}
+
+.fa-trash-clock:before {
+  content: "\e2b0";
+}
+
+.fa-reflect-both:before {
+  content: "\e66f";
+}
+
+.fa-gavel:before, .fa-legal:before {
+  content: "\f0e3";
+}
+
+.fa-sprinkler-ceiling:before {
+  content: "\e44c";
+}
+
+.fa-browsers:before {
+  content: "\e0cb";
+}
+
+.fa-trillium:before {
+  content: "\e588";
+}
+
+.fa-music-slash:before {
+  content: "\f8d1";
+}
+
+.fa-truck-ramp:before {
+  content: "\f4e0";
+}
+
+.fa-binoculars:before {
+  content: "\f1e5";
+}
+
+.fa-microphone-slash:before {
+  content: "\f131";
+}
+
+.fa-box-tissue:before {
+  content: "\e05b";
+}
+
+.fa-circle-c:before {
+  content: "\e101";
+}
+
+.fa-star-christmas:before {
+  content: "\f7d4";
+}
+
+.fa-chart-bullet:before {
+  content: "\e0e1";
+}
+
+.fa-motorcycle:before {
+  content: "\f21c";
+}
+
+.fa-tree-christmas:before {
+  content: "\f7db";
+}
+
+.fa-tire-flat:before {
+  content: "\f632";
+}
+
+.fa-sunglasses:before {
+  content: "\f892";
+}
+
+.fa-badge:before {
+  content: "\f335";
+}
+
+.fa-comment-alt-edit:before, .fa-message-edit:before, .fa-message-pen:before {
+  content: "\f4a4";
+}
+
+.fa-bell-concierge:before, .fa-concierge-bell:before {
+  content: "\f562";
+}
+
+.fa-pen-ruler:before, .fa-pencil-ruler:before {
+  content: "\f5ae";
+}
+
+.fa-file-mp3:before {
+  content: "\e648";
+}
+
+.fa-arrow-progress:before {
+  content: "\e5df";
+}
+
+.fa-chess-rook-alt:before, .fa-chess-rook-piece:before {
+  content: "\f448";
+}
+
+.fa-square-root:before {
+  content: "\f697";
+}
+
+.fa-album-collection-circle-plus:before {
+  content: "\e48e";
+}
+
+.fa-people-arrows-left-right:before, .fa-people-arrows:before {
+  content: "\e068";
+}
+
+.fa-sign-post:before {
+  content: "\e624";
+}
+
+.fa-face-angry-horns:before {
+  content: "\e368";
+}
+
+.fa-mars-and-venus-burst:before {
+  content: "\e523";
+}
+
+.fa-tombstone:before {
+  content: "\f720";
+}
+
+.fa-caret-square-right:before, .fa-square-caret-right:before {
+  content: "\f152";
+}
+
+.fa-cut:before, .fa-scissors:before {
+  content: "\f0c4";
+}
+
+.fa-list-music:before {
+  content: "\f8c9";
+}
+
+.fa-sun-plant-wilt:before {
+  content: "\e57a";
+}
+
+.fa-toilets-portable:before {
+  content: "\e584";
+}
+
+.fa-hockey-puck:before {
+  content: "\f453";
+}
+
+.fa-mustache:before {
+  content: "\e5bc";
+}
+
+.fa-hyphen:before {
+  content: "\2d";
+}
+
+.fa-table:before {
+  content: "\f0ce";
+}
+
+.fa-user-chef:before {
+  content: "\e3d2";
+}
+
+.fa-comment-alt-image:before, .fa-message-image:before {
+  content: "\e1e0";
+}
+
+.fa-users-medical:before {
+  content: "\f830";
+}
+
+.fa-sensor-alert:before, .fa-sensor-triangle-exclamation:before {
+  content: "\e029";
+}
+
+.fa-magnifying-glass-arrow-right:before {
+  content: "\e521";
+}
+
+.fa-digital-tachograph:before, .fa-tachograph-digital:before {
+  content: "\f566";
+}
+
+.fa-face-mask:before {
+  content: "\e37f";
+}
+
+.fa-pickleball:before {
+  content: "\e435";
+}
+
+.fa-star-sharp-half:before {
+  content: "\e28c";
+}
+
+.fa-users-slash:before {
+  content: "\e073";
+}
+
+.fa-clover:before {
+  content: "\e139";
+}
+
+.fa-meat:before {
+  content: "\f814";
+}
+
+.fa-mail-reply:before, .fa-reply:before {
+  content: "\f3e5";
+}
+
+.fa-star-and-crescent:before {
+  content: "\f699";
+}
+
+.fa-empty-set:before {
+  content: "\f656";
+}
+
+.fa-house-fire:before {
+  content: "\e50c";
+}
+
+.fa-minus-square:before, .fa-square-minus:before {
+  content: "\f146";
+}
+
+.fa-helicopter:before {
+  content: "\f533";
+}
+
+.fa-bird:before {
+  content: "\e469";
+}
+
+.fa-compass:before {
+  content: "\f14e";
+}
+
+.fa-caret-square-down:before, .fa-square-caret-down:before {
+  content: "\f150";
+}
+
+.fa-heart-half-alt:before, .fa-heart-half-stroke:before {
+  content: "\e1ac";
+}
+
+.fa-file-circle-question:before {
+  content: "\e4ef";
+}
+
+.fa-truck-utensils:before {
+  content: "\e628";
+}
+
+.fa-laptop-code:before {
+  content: "\f5fc";
+}
+
+.fa-joystick:before {
+  content: "\f8c5";
+}
+
+.fa-grill-fire:before {
+  content: "\e5a4";
+}
+
+.fa-rectangle-vertical-history:before {
+  content: "\e237";
+}
+
+.fa-swatchbook:before {
+  content: "\f5c3";
+}
+
+.fa-prescription-bottle:before {
+  content: "\f485";
+}
+
+.fa-bars:before, .fa-navicon:before {
+  content: "\f0c9";
+}
+
+.fa-keyboard-left:before {
+  content: "\e1c3";
+}
+
+.fa-people-group:before {
+  content: "\e533";
+}
+
+.fa-hourglass-3:before, .fa-hourglass-end:before {
+  content: "\f253";
+}
+
+.fa-heart-broken:before, .fa-heart-crack:before {
+  content: "\f7a9";
+}
+
+.fa-face-beam-hand-over-mouth:before {
+  content: "\e47c";
+}
+
+.fa-droplet-percent:before, .fa-humidity:before {
+  content: "\f750";
+}
+
+.fa-external-link-square-alt:before, .fa-square-up-right:before {
+  content: "\f360";
+}
+
+.fa-face-kiss-beam:before, .fa-kiss-beam:before {
+  content: "\f597";
+}
+
+.fa-corn:before {
+  content: "\f6c7";
+}
+
+.fa-roller-coaster:before {
+  content: "\e324";
+}
+
+.fa-photo-film-music:before {
+  content: "\e228";
+}
+
+.fa-radar:before {
+  content: "\e024";
+}
+
+.fa-sickle:before {
+  content: "\f822";
+}
+
+.fa-film:before {
+  content: "\f008";
+}
+
+.fa-coconut:before {
+  content: "\e2f6";
+}
+
+.fa-ruler-horizontal:before {
+  content: "\f547";
+}
+
+.fa-shield-cross:before {
+  content: "\f712";
+}
+
+.fa-cassette-tape:before {
+  content: "\f8ab";
+}
+
+.fa-square-terminal:before {
+  content: "\e32a";
+}
+
+.fa-people-robbery:before {
+  content: "\e536";
+}
+
+.fa-lightbulb:before {
+  content: "\f0eb";
+}
+
+.fa-caret-left:before {
+  content: "\f0d9";
+}
+
+.fa-comment-middle:before {
+  content: "\e149";
+}
+
+.fa-trash-can-list:before {
+  content: "\e2ab";
+}
+
+.fa-block:before {
+  content: "\e46a";
+}
+
+.fa-circle-exclamation:before, .fa-exclamation-circle:before {
+  content: "\f06a";
+}
+
+.fa-school-circle-xmark:before {
+  content: "\e56d";
+}
+
+.fa-arrow-right-from-bracket:before, .fa-sign-out:before {
+  content: "\f08b";
+}
+
+.fa-face-frown-slight:before {
+  content: "\e376";
+}
+
+.fa-chevron-circle-down:before, .fa-circle-chevron-down:before {
+  content: "\f13a";
+}
+
+.fa-sidebar-flip:before {
+  content: "\e24f";
+}
+
+.fa-unlock-alt:before, .fa-unlock-keyhole:before {
+  content: "\f13e";
+}
+
+.fa-temperature-list:before {
+  content: "\e299";
+}
+
+.fa-cloud-showers-heavy:before {
+  content: "\f740";
+}
+
+.fa-headphones-alt:before, .fa-headphones-simple:before {
+  content: "\f58f";
+}
+
+.fa-sitemap:before {
+  content: "\f0e8";
+}
+
+.fa-pipe-section:before {
+  content: "\e438";
+}
+
+.fa-space-station-moon-alt:before, .fa-space-station-moon-construction:before {
+  content: "\e034";
+}
+
+.fa-circle-dollar-to-slot:before, .fa-donate:before {
+  content: "\f4b9";
+}
+
+.fa-memory:before {
+  content: "\f538";
+}
+
+.fa-face-sleeping:before {
+  content: "\e38d";
+}
+
+.fa-road-spikes:before {
+  content: "\e568";
+}
+
+.fa-fire-burner:before {
+  content: "\e4f1";
+}
+
+.fa-squirrel:before {
+  content: "\f71a";
+}
+
+.fa-arrow-to-top:before, .fa-arrow-up-to-line:before {
+  content: "\f341";
+}
+
+.fa-flag:before {
+  content: "\f024";
+}
+
+.fa-face-cowboy-hat:before {
+  content: "\e36e";
+}
+
+.fa-hanukiah:before {
+  content: "\f6e6";
+}
+
+.fa-chart-scatter-3d:before {
+  content: "\e0e8";
+}
+
+.fa-display-chart-up:before {
+  content: "\e5e3";
+}
+
+.fa-square-code:before {
+  content: "\e267";
+}
+
+.fa-feather:before {
+  content: "\f52d";
+}
+
+.fa-volume-down:before, .fa-volume-low:before {
+  content: "\f027";
+}
+
+.fa-times-to-slot:before, .fa-vote-nay:before, .fa-xmark-to-slot:before {
+  content: "\f771";
+}
+
+.fa-box-alt:before, .fa-box-taped:before {
+  content: "\f49a";
+}
+
+.fa-comment-slash:before {
+  content: "\f4b3";
+}
+
+.fa-swords:before {
+  content: "\f71d";
+}
+
+.fa-cloud-sun-rain:before {
+  content: "\f743";
+}
+
+.fa-album:before {
+  content: "\f89f";
+}
+
+.fa-circle-n:before {
+  content: "\e118";
+}
+
+.fa-compress:before {
+  content: "\f066";
+}
+
+.fa-wheat-alt:before, .fa-wheat-awn:before {
+  content: "\e2cd";
+}
+
+.fa-ankh:before {
+  content: "\f644";
+}
+
+.fa-hands-holding-child:before {
+  content: "\e4fa";
+}
+
+.fa-asterisk:before {
+  content: "\2a";
+}
+
+.fa-key-skeleton-left-right:before {
+  content: "\e3b4";
+}
+
+.fa-comment-lines:before {
+  content: "\f4b0";
+}
+
+.fa-luchador-mask:before, .fa-luchador:before, .fa-mask-luchador:before {
+  content: "\f455";
+}
+
+.fa-check-square:before, .fa-square-check:before {
+  content: "\f14a";
+}
+
+.fa-shredder:before {
+  content: "\f68a";
+}
+
+.fa-book-open-alt:before, .fa-book-open-cover:before {
+  content: "\e0c0";
+}
+
+.fa-sandwich:before {
+  content: "\f81f";
+}
+
+.fa-peseta-sign:before {
+  content: "\e221";
+}
+
+.fa-parking-slash:before, .fa-square-parking-slash:before {
+  content: "\f617";
+}
+
+.fa-train-tunnel:before {
+  content: "\e454";
+}
+
+.fa-header:before, .fa-heading:before {
+  content: "\f1dc";
+}
+
+.fa-ghost:before {
+  content: "\f6e2";
+}
+
+.fa-face-anguished:before {
+  content: "\e369";
+}
+
+.fa-hockey-sticks:before {
+  content: "\f454";
+}
+
+.fa-abacus:before {
+  content: "\f640";
+}
+
+.fa-film-alt:before, .fa-film-simple:before {
+  content: "\f3a0";
+}
+
+.fa-list-squares:before, .fa-list:before {
+  content: "\f03a";
+}
+
+.fa-tree-palm:before {
+  content: "\f82b";
+}
+
+.fa-phone-square-alt:before, .fa-square-phone-flip:before {
+  content: "\f87b";
+}
+
+.fa-cart-plus:before {
+  content: "\f217";
+}
+
+.fa-gamepad:before {
+  content: "\f11b";
+}
+
+.fa-border-center-v:before {
+  content: "\f89d";
+}
+
+.fa-circle-dot:before, .fa-dot-circle:before {
+  content: "\f192";
+}
+
+.fa-clipboard-medical:before {
+  content: "\e133";
+}
+
+.fa-dizzy:before, .fa-face-dizzy:before {
+  content: "\f567";
+}
+
+.fa-egg:before {
+  content: "\f7fb";
+}
+
+.fa-arrow-alt-to-top:before, .fa-up-to-line:before {
+  content: "\f34d";
+}
+
+.fa-house-medical-circle-xmark:before {
+  content: "\e513";
+}
+
+.fa-watch-fitness:before {
+  content: "\f63e";
+}
+
+.fa-clock-nine-thirty:before {
+  content: "\e34d";
+}
+
+.fa-campground:before {
+  content: "\f6bb";
+}
+
+.fa-folder-plus:before {
+  content: "\f65e";
+}
+
+.fa-jug:before {
+  content: "\f8c6";
+}
+
+.fa-futbol-ball:before, .fa-futbol:before, .fa-soccer-ball:before {
+  content: "\f1e3";
+}
+
+.fa-snow-blowing:before {
+  content: "\f761";
+}
+
+.fa-paint-brush:before, .fa-paintbrush:before {
+  content: "\f1fc";
+}
+
+.fa-lock:before {
+  content: "\f023";
+}
+
+.fa-arrow-down-from-line:before, .fa-arrow-from-top:before {
+  content: "\f345";
+}
+
+.fa-gas-pump:before {
+  content: "\f52f";
+}
+
+.fa-signal-alt-slash:before, .fa-signal-bars-slash:before {
+  content: "\f694";
+}
+
+.fa-monkey:before {
+  content: "\f6fb";
+}
+
+.fa-pro:before, .fa-rectangle-pro:before {
+  content: "\e235";
+}
+
+.fa-house-night:before {
+  content: "\e010";
+}
+
+.fa-hot-tub-person:before, .fa-hot-tub:before {
+  content: "\f593";
+}
+
+.fa-globe-pointer:before {
+  content: "\e60e";
+}
+
+.fa-blanket:before {
+  content: "\f498";
+}
+
+.fa-map-location:before, .fa-map-marked:before {
+  content: "\f59f";
+}
+
+.fa-house-flood-water:before {
+  content: "\e50e";
+}
+
+.fa-comments-question-check:before {
+  content: "\e14f";
+}
+
+.fa-tree:before {
+  content: "\f1bb";
+}
+
+.fa-arrows-cross:before {
+  content: "\e0a2";
+}
+
+.fa-backpack:before {
+  content: "\f5d4";
+}
+
+.fa-square-small:before {
+  content: "\e27e";
+}
+
+.fa-folder-arrow-up:before, .fa-folder-upload:before {
+  content: "\e054";
+}
+
+.fa-bridge-lock:before {
+  content: "\e4cc";
+}
+
+.fa-crosshairs-simple:before {
+  content: "\e59f";
+}
+
+.fa-sack-dollar:before {
+  content: "\f81d";
+}
+
+.fa-edit:before, .fa-pen-to-square:before {
+  content: "\f044";
+}
+
+.fa-sliders-h-square:before, .fa-square-sliders:before {
+  content: "\f3f0";
+}
+
+.fa-car-side:before {
+  content: "\f5e4";
+}
+
+.fa-comment-middle-top-alt:before, .fa-message-middle-top:before {
+  content: "\e1e2";
+}
+
+.fa-lightbulb-on:before {
+  content: "\f672";
+}
+
+.fa-knife:before, .fa-utensil-knife:before {
+  content: "\f2e4";
+}
+
+.fa-share-alt:before, .fa-share-nodes:before {
+  content: "\f1e0";
+}
+
+.fa-display-chart-up-circle-dollar:before {
+  content: "\e5e6";
+}
+
+.fa-wave-sine:before {
+  content: "\f899";
+}
+
+.fa-heart-circle-minus:before {
+  content: "\e4ff";
+}
+
+.fa-circle-w:before {
+  content: "\e12c";
+}
+
+.fa-calendar-circle:before, .fa-circle-calendar:before {
+  content: "\e102";
+}
+
+.fa-hourglass-2:before, .fa-hourglass-half:before {
+  content: "\f252";
+}
+
+.fa-microscope:before {
+  content: "\f610";
+}
+
+.fa-sunset:before {
+  content: "\f767";
+}
+
+.fa-sink:before {
+  content: "\e06d";
+}
+
+.fa-calendar-exclamation:before {
+  content: "\f334";
+}
+
+.fa-truck-container-empty:before {
+  content: "\e2b5";
+}
+
+.fa-hand-heart:before {
+  content: "\f4bc";
+}
+
+.fa-bag-shopping:before, .fa-shopping-bag:before {
+  content: "\f290";
+}
+
+.fa-arrow-down-z-a:before, .fa-sort-alpha-desc:before, .fa-sort-alpha-down-alt:before {
+  content: "\f881";
+}
+
+.fa-mitten:before {
+  content: "\f7b5";
+}
+
+.fa-reply-clock:before, .fa-reply-time:before {
+  content: "\e239";
+}
+
+.fa-person-rays:before {
+  content: "\e54d";
+}
+
+.fa-arrow-alt-right:before, .fa-right:before {
+  content: "\f356";
+}
+
+.fa-circle-f:before {
+  content: "\e10e";
+}
+
+.fa-users:before {
+  content: "\f0c0";
+}
+
+.fa-face-pleading:before {
+  content: "\e386";
+}
+
+.fa-eye-slash:before {
+  content: "\f070";
+}
+
+.fa-flask-vial:before {
+  content: "\e4f3";
+}
+
+.fa-police-box:before {
+  content: "\e021";
+}
+
+.fa-cucumber:before {
+  content: "\e401";
+}
+
+.fa-head-side-brain:before {
+  content: "\f808";
+}
+
+.fa-hand-paper:before, .fa-hand:before {
+  content: "\f256";
+}
+
+.fa-biking-mountain:before, .fa-person-biking-mountain:before {
+  content: "\f84b";
+}
+
+.fa-utensils-slash:before {
+  content: "\e464";
+}
+
+.fa-print-magnifying-glass:before, .fa-print-search:before {
+  content: "\f81a";
+}
+
+.fa-turn-right:before {
+  content: "\e639";
+}
+
+.fa-folder-bookmark:before {
+  content: "\e186";
+}
+
+.fa-arrow-turn-left-down:before {
+  content: "\e633";
+}
+
+.fa-om:before {
+  content: "\f679";
+}
+
+.fa-pi:before {
+  content: "\f67e";
+}
+
+.fa-flask-potion:before, .fa-flask-round-potion:before {
+  content: "\f6e1";
+}
+
+.fa-face-shush:before {
+  content: "\e38c";
+}
+
+.fa-worm:before {
+  content: "\e599";
+}
+
+.fa-house-circle-xmark:before {
+  content: "\e50b";
+}
+
+.fa-plug:before {
+  content: "\f1e6";
+}
+
+.fa-calendar-circle-exclamation:before {
+  content: "\e46e";
+}
+
+.fa-square-i:before {
+  content: "\e272";
+}
+
+.fa-chevron-up:before {
+  content: "\f077";
+}
+
+.fa-face-saluting:before {
+  content: "\e484";
+}
+
+.fa-gauge-simple-low:before, .fa-tachometer-slow:before {
+  content: "\f62c";
+}
+
+.fa-face-persevering:before {
+  content: "\e385";
+}
+
+.fa-camera-circle:before, .fa-circle-camera:before {
+  content: "\e103";
+}
+
+.fa-hand-spock:before {
+  content: "\f259";
+}
+
+.fa-spider-web:before {
+  content: "\f719";
+}
+
+.fa-circle-microphone:before, .fa-microphone-circle:before {
+  content: "\e116";
+}
+
+.fa-book-arrow-up:before {
+  content: "\e0ba";
+}
+
+.fa-popsicle:before {
+  content: "\e43e";
+}
+
+.fa-command:before {
+  content: "\e142";
+}
+
+.fa-blinds:before {
+  content: "\f8fb";
+}
+
+.fa-stopwatch:before {
+  content: "\f2f2";
+}
+
+.fa-saxophone:before {
+  content: "\f8dc";
+}
+
+.fa-square-2:before {
+  content: "\e257";
+}
+
+.fa-field-hockey-stick-ball:before, .fa-field-hockey:before {
+  content: "\f44c";
+}
+
+.fa-arrow-up-square-triangle:before, .fa-sort-shapes-up-alt:before {
+  content: "\f88b";
+}
+
+.fa-face-scream:before {
+  content: "\e38b";
+}
+
+.fa-square-m:before {
+  content: "\e276";
+}
+
+.fa-camera-web:before, .fa-webcam:before {
+  content: "\f832";
+}
+
+.fa-comment-arrow-down:before {
+  content: "\e143";
+}
+
+.fa-lightbulb-cfl:before {
+  content: "\e5a6";
+}
+
+.fa-window-frame-open:before {
+  content: "\e050";
+}
+
+.fa-face-kiss:before, .fa-kiss:before {
+  content: "\f596";
+}
+
+.fa-bridge-circle-xmark:before {
+  content: "\e4cb";
+}
+
+.fa-period:before {
+  content: "\2e";
+}
+
+.fa-face-grin-tongue:before, .fa-grin-tongue:before {
+  content: "\f589";
+}
+
+.fa-up-to-dotted-line:before {
+  content: "\e457";
+}
+
+.fa-thought-bubble:before {
+  content: "\e32e";
+}
+
+.fa-skeleton-ribs:before {
+  content: "\e5cb";
+}
+
+.fa-raygun:before {
+  content: "\e025";
+}
+
+.fa-flute:before {
+  content: "\f8b9";
+}
+
+.fa-acorn:before {
+  content: "\f6ae";
+}
+
+.fa-video-arrow-up-right:before {
+  content: "\e2c9";
+}
+
+.fa-grate-droplet:before {
+  content: "\e194";
+}
+
+.fa-seal-exclamation:before {
+  content: "\e242";
+}
+
+.fa-chess-bishop:before {
+  content: "\f43a";
+}
+
+.fa-message-sms:before {
+  content: "\e1e5";
+}
+
+.fa-coffee-beans:before {
+  content: "\e13f";
+}
+
+.fa-hat-witch:before {
+  content: "\f6e7";
+}
+
+.fa-face-grin-wink:before, .fa-grin-wink:before {
+  content: "\f58c";
+}
+
+.fa-clock-three-thirty:before {
+  content: "\e357";
+}
+
+.fa-deaf:before, .fa-deafness:before, .fa-ear-deaf:before, .fa-hard-of-hearing:before {
+  content: "\f2a4";
+}
+
+.fa-alarm-clock:before {
+  content: "\f34e";
+}
+
+.fa-eclipse:before {
+  content: "\f749";
+}
+
+.fa-face-relieved:before {
+  content: "\e389";
+}
+
+.fa-road-circle-check:before {
+  content: "\e564";
+}
+
+.fa-dice-five:before {
+  content: "\f523";
+}
+
+.fa-minus-octagon:before, .fa-octagon-minus:before {
+  content: "\f308";
+}
+
+.fa-rss-square:before, .fa-square-rss:before {
+  content: "\f143";
+}
+
+.fa-face-zany:before {
+  content: "\e3a4";
+}
+
+.fa-tricycle:before {
+  content: "\e5c3";
+}
+
+.fa-land-mine-on:before {
+  content: "\e51b";
+}
+
+.fa-square-arrow-up-left:before {
+  content: "\e263";
+}
+
+.fa-i-cursor:before {
+  content: "\f246";
+}
+
+.fa-chart-mixed-up-circle-dollar:before {
+  content: "\e5d9";
+}
+
+.fa-salt-shaker:before {
+  content: "\e446";
+}
+
+.fa-stamp:before {
+  content: "\f5bf";
+}
+
+.fa-file-plus:before {
+  content: "\f319";
+}
+
+.fa-draw-square:before {
+  content: "\f5ef";
+}
+
+.fa-toilet-paper-reverse-slash:before, .fa-toilet-paper-under-slash:before {
+  content: "\e2a1";
+}
+
+.fa-stairs:before {
+  content: "\e289";
+}
+
+.fa-drone-alt:before, .fa-drone-front:before {
+  content: "\f860";
+}
+
+.fa-glass-empty:before {
+  content: "\e191";
+}
+
+.fa-dial-high:before {
+  content: "\e15c";
+}
+
+.fa-user-construction:before, .fa-user-hard-hat:before, .fa-user-helmet-safety:before {
+  content: "\f82c";
+}
+
+.fa-i:before {
+  content: "\49";
+}
+
+.fa-hryvnia-sign:before, .fa-hryvnia:before {
+  content: "\f6f2";
+}
+
+.fa-arrow-down-left-and-arrow-up-right-to-center:before {
+  content: "\e092";
+}
+
+.fa-pills:before {
+  content: "\f484";
+}
+
+.fa-face-grin-wide:before, .fa-grin-alt:before {
+  content: "\f581";
+}
+
+.fa-tooth:before {
+  content: "\f5c9";
+}
+
+.fa-basketball-hoop:before {
+  content: "\f435";
+}
+
+.fa-objects-align-bottom:before {
+  content: "\e3bb";
+}
+
+.fa-v:before {
+  content: "\56";
+}
+
+.fa-sparkles:before {
+  content: "\f890";
+}
+
+.fa-squid:before {
+  content: "\e450";
+}
+
+.fa-leafy-green:before {
+  content: "\e41d";
+}
+
+.fa-circle-arrow-up-right:before {
+  content: "\e0fc";
+}
+
+.fa-calendars:before {
+  content: "\e0d7";
+}
+
+.fa-bangladeshi-taka-sign:before {
+  content: "\e2e6";
+}
+
+.fa-bicycle:before {
+  content: "\f206";
+}
+
+.fa-hammer-war:before {
+  content: "\f6e4";
+}
+
+.fa-circle-d:before {
+  content: "\e104";
+}
+
+.fa-spider-black-widow:before {
+  content: "\f718";
+}
+
+.fa-rod-asclepius:before, .fa-rod-snake:before, .fa-staff-aesculapius:before, .fa-staff-snake:before {
+  content: "\e579";
+}
+
+.fa-pear:before {
+  content: "\e20c";
+}
+
+.fa-head-side-cough-slash:before {
+  content: "\e062";
+}
+
+.fa-file-mov:before {
+  content: "\e647";
+}
+
+.fa-triangle:before {
+  content: "\f2ec";
+}
+
+.fa-apartment:before {
+  content: "\e468";
+}
+
+.fa-ambulance:before, .fa-truck-medical:before {
+  content: "\f0f9";
+}
+
+.fa-pepper:before {
+  content: "\e432";
+}
+
+.fa-piano:before {
+  content: "\f8d4";
+}
+
+.fa-gun-squirt:before {
+  content: "\e19d";
+}
+
+.fa-wheat-awn-circle-exclamation:before {
+  content: "\e598";
+}
+
+.fa-snowman:before {
+  content: "\f7d0";
+}
+
+.fa-user-alien:before {
+  content: "\e04a";
+}
+
+.fa-shield-check:before {
+  content: "\f2f7";
+}
+
+.fa-mortar-pestle:before {
+  content: "\f5a7";
+}
+
+.fa-road-barrier:before {
+  content: "\e562";
+}
+
+.fa-chart-candlestick:before {
+  content: "\e0e2";
+}
+
+.fa-briefcase-blank:before {
+  content: "\e0c8";
+}
+
+.fa-school:before {
+  content: "\f549";
+}
+
+.fa-igloo:before {
+  content: "\f7ae";
+}
+
+.fa-bracket-round:before, .fa-parenthesis:before {
+  content: "\28";
+}
+
+.fa-joint:before {
+  content: "\f595";
+}
+
+.fa-horse-saddle:before {
+  content: "\f8c3";
+}
+
+.fa-mug-marshmallows:before {
+  content: "\f7b7";
+}
+
+.fa-filters:before {
+  content: "\e17e";
+}
+
+.fa-bell-on:before {
+  content: "\f8fa";
+}
+
+.fa-angle-right:before {
+  content: "\f105";
+}
+
+.fa-dial-med:before {
+  content: "\e15f";
+}
+
+.fa-horse:before {
+  content: "\f6f0";
+}
+
+.fa-q:before {
+  content: "\51";
+}
+
+.fa-monitor-heart-rate:before, .fa-monitor-waveform:before {
+  content: "\f611";
+}
+
+.fa-link-simple:before {
+  content: "\e1cd";
+}
+
+.fa-whistle:before {
+  content: "\f460";
+}
+
+.fa-g:before {
+  content: "\47";
+}
+
+.fa-fragile:before, .fa-wine-glass-crack:before {
+  content: "\f4bb";
+}
+
+.fa-slot-machine:before {
+  content: "\e3ce";
+}
+
+.fa-notes-medical:before {
+  content: "\f481";
+}
+
+.fa-car-wash:before {
+  content: "\f5e6";
+}
+
+.fa-escalator:before {
+  content: "\e171";
+}
+
+.fa-comment-image:before {
+  content: "\e148";
+}
+
+.fa-temperature-2:before, .fa-temperature-half:before, .fa-thermometer-2:before, .fa-thermometer-half:before {
+  content: "\f2c9";
+}
+
+.fa-dong-sign:before {
+  content: "\e169";
+}
+
+.fa-donut:before, .fa-doughnut:before {
+  content: "\e406";
+}
+
+.fa-capsules:before {
+  content: "\f46b";
+}
+
+.fa-poo-bolt:before, .fa-poo-storm:before {
+  content: "\f75a";
+}
+
+.fa-tally-1:before {
+  content: "\e294";
+}
+
+.fa-file-vector:before {
+  content: "\e64c";
+}
+
+.fa-face-frown-open:before, .fa-frown-open:before {
+  content: "\f57a";
+}
+
+.fa-square-dashed:before {
+  content: "\e269";
+}
+
+.fa-bag-shopping-plus:before {
+  content: "\e651";
+}
+
+.fa-square-j:before {
+  content: "\e273";
+}
+
+.fa-hand-point-up:before {
+  content: "\f0a6";
+}
+
+.fa-money-bill:before {
+  content: "\f0d6";
+}
+
+.fa-arrow-up-big-small:before, .fa-sort-size-up:before {
+  content: "\f88e";
+}
+
+.fa-barcode-read:before {
+  content: "\f464";
+}
+
+.fa-baguette:before {
+  content: "\e3d8";
+}
+
+.fa-bowl-soft-serve:before {
+  content: "\e46b";
+}
+
+.fa-face-holding-back-tears:before {
+  content: "\e482";
+}
+
+.fa-arrow-alt-square-up:before, .fa-square-up:before {
+  content: "\f353";
+}
+
+.fa-subway-tunnel:before, .fa-train-subway-tunnel:before {
+  content: "\e2a3";
+}
+
+.fa-exclamation-square:before, .fa-square-exclamation:before {
+  content: "\f321";
+}
+
+.fa-semicolon:before {
+  content: "\3b";
+}
+
+.fa-bookmark:before {
+  content: "\f02e";
+}
+
+.fa-fan-table:before {
+  content: "\e004";
+}
+
+.fa-align-justify:before {
+  content: "\f039";
+}
+
+.fa-battery-1:before, .fa-battery-low:before {
+  content: "\e0b1";
+}
+
+.fa-credit-card-front:before {
+  content: "\f38a";
+}
+
+.fa-brain-arrow-curved-right:before, .fa-mind-share:before {
+  content: "\f677";
+}
+
+.fa-umbrella-beach:before {
+  content: "\f5ca";
+}
+
+.fa-helmet-un:before {
+  content: "\e503";
+}
+
+.fa-location-smile:before, .fa-map-marker-smile:before {
+  content: "\f60d";
+}
+
+.fa-arrow-left-to-line:before, .fa-arrow-to-left:before {
+  content: "\f33e";
+}
+
+.fa-bullseye:before {
+  content: "\f140";
+}
+
+.fa-nigiri:before, .fa-sushi:before {
+  content: "\e48a";
+}
+
+.fa-comment-alt-captions:before, .fa-message-captions:before {
+  content: "\e1de";
+}
+
+.fa-trash-list:before {
+  content: "\e2b1";
+}
+
+.fa-bacon:before {
+  content: "\f7e5";
+}
+
+.fa-option:before {
+  content: "\e318";
+}
+
+.fa-raccoon:before {
+  content: "\e613";
+}
+
+.fa-hand-point-down:before {
+  content: "\f0a7";
+}
+
+.fa-arrow-up-from-bracket:before {
+  content: "\e09a";
+}
+
+.fa-head-side-gear:before {
+  content: "\e611";
+}
+
+.fa-trash-plus:before {
+  content: "\e2b2";
+}
+
+.fa-file-cad:before {
+  content: "\e672";
+}
+
+.fa-objects-align-top:before {
+  content: "\e3c0";
+}
+
+.fa-folder-blank:before, .fa-folder:before {
+  content: "\f07b";
+}
+
+.fa-face-anxious-sweat:before {
+  content: "\e36a";
+}
+
+.fa-credit-card-blank:before {
+  content: "\f389";
+}
+
+.fa-file-medical-alt:before, .fa-file-waveform:before {
+  content: "\f478";
+}
+
+.fa-microchip-ai:before {
+  content: "\e1ec";
+}
+
+.fa-mug:before {
+  content: "\f874";
+}
+
+.fa-plane-up-slash:before {
+  content: "\e22e";
+}
+
+.fa-radiation:before {
+  content: "\f7b9";
+}
+
+.fa-pen-circle:before {
+  content: "\e20e";
+}
+
+.fa-bag-seedling:before {
+  content: "\e5f2";
+}
+
+.fa-chart-simple:before {
+  content: "\e473";
+}
+
+.fa-crutches:before {
+  content: "\f7f8";
+}
+
+.fa-circle-parking:before, .fa-parking-circle:before {
+  content: "\f615";
+}
+
+.fa-mars-stroke:before {
+  content: "\f229";
+}
+
+.fa-leaf-oak:before {
+  content: "\f6f7";
+}
+
+.fa-square-bolt:before {
+  content: "\e265";
+}
+
+.fa-vial:before {
+  content: "\f492";
+}
+
+.fa-dashboard:before, .fa-gauge-med:before, .fa-gauge:before, .fa-tachometer-alt-average:before {
+  content: "\f624";
+}
+
+.fa-magic-wand-sparkles:before, .fa-wand-magic-sparkles:before {
+  content: "\e2ca";
+}
+
+.fa-lambda:before {
+  content: "\f66e";
+}
+
+.fa-e:before {
+  content: "\45";
+}
+
+.fa-pizza:before {
+  content: "\f817";
+}
+
+.fa-bowl-chopsticks-noodles:before {
+  content: "\e2ea";
+}
+
+.fa-h3:before {
+  content: "\f315";
+}
+
+.fa-pen-alt:before, .fa-pen-clip:before {
+  content: "\f305";
+}
+
+.fa-bridge-circle-exclamation:before {
+  content: "\e4ca";
+}
+
+.fa-badge-percent:before {
+  content: "\f646";
+}
+
+.fa-rotate-reverse:before {
+  content: "\e631";
+}
+
+.fa-user:before {
+  content: "\f007";
+}
+
+.fa-sensor:before {
+  content: "\e028";
+}
+
+.fa-comma:before {
+  content: "\2c";
+}
+
+.fa-school-circle-check:before {
+  content: "\e56b";
+}
+
+.fa-toilet-paper-reverse:before, .fa-toilet-paper-under:before {
+  content: "\e2a0";
+}
+
+.fa-light-emergency:before {
+  content: "\e41f";
+}
+
+.fa-arrow-down-to-arc:before {
+  content: "\e4ae";
+}
+
+.fa-dumpster:before {
+  content: "\f793";
+}
+
+.fa-shuttle-van:before, .fa-van-shuttle:before {
+  content: "\f5b6";
+}
+
+.fa-building-user:before {
+  content: "\e4da";
+}
+
+.fa-light-switch:before {
+  content: "\e017";
+}
+
+.fa-caret-square-left:before, .fa-square-caret-left:before {
+  content: "\f191";
+}
+
+.fa-highlighter:before {
+  content: "\f591";
+}
+
+.fa-heart-rate:before, .fa-wave-pulse:before {
+  content: "\f5f8";
+}
+
+.fa-key:before {
+  content: "\f084";
+}
+
+.fa-arrow-left-to-bracket:before {
+  content: "\e669";
+}
+
+.fa-hat-santa:before {
+  content: "\f7a7";
+}
+
+.fa-tamale:before {
+  content: "\e451";
+}
+
+.fa-box-check:before {
+  content: "\f467";
+}
+
+.fa-bullhorn:before {
+  content: "\f0a1";
+}
+
+.fa-steak:before {
+  content: "\f824";
+}
+
+.fa-location-crosshairs-slash:before, .fa-location-slash:before {
+  content: "\f603";
+}
+
+.fa-person-dolly:before {
+  content: "\f4d0";
+}
+
+.fa-globe:before {
+  content: "\f0ac";
+}
+
+.fa-synagogue:before {
+  content: "\f69b";
+}
+
+.fa-file-chart-column:before, .fa-file-chart-line:before {
+  content: "\f659";
+}
+
+.fa-person-half-dress:before {
+  content: "\e548";
+}
+
+.fa-folder-image:before {
+  content: "\e18a";
+}
+
+.fa-calendar-edit:before, .fa-calendar-pen:before {
+  content: "\f333";
+}
+
+.fa-road-bridge:before {
+  content: "\e563";
+}
+
+.fa-face-smile-tear:before {
+  content: "\e393";
+}
+
+.fa-comment-alt-plus:before, .fa-message-plus:before {
+  content: "\f4a8";
+}
+
+.fa-location-arrow:before {
+  content: "\f124";
+}
+
+.fa-c:before {
+  content: "\43";
+}
+
+.fa-tablet-button:before {
+  content: "\f10a";
+}
+
+.fa-person-dress-fairy:before {
+  content: "\e607";
+}
+
+.fa-rectangle-history-circle-user:before {
+  content: "\e4a4";
+}
+
+.fa-building-lock:before {
+  content: "\e4d6";
+}
+
+.fa-chart-line-up:before {
+  content: "\e0e5";
+}
+
+.fa-mailbox:before {
+  content: "\f813";
+}
+
+.fa-sign-posts:before {
+  content: "\e625";
+}
+
+.fa-truck-bolt:before {
+  content: "\e3d0";
+}
+
+.fa-pizza-slice:before {
+  content: "\f818";
+}
+
+.fa-money-bill-wave:before {
+  content: "\f53a";
+}
+
+.fa-area-chart:before, .fa-chart-area:before {
+  content: "\f1fe";
+}
+
+.fa-house-flag:before {
+  content: "\e50d";
+}
+
+.fa-circle-three-quarters-stroke:before {
+  content: "\e5d4";
+}
+
+.fa-person-circle-minus:before {
+  content: "\e540";
+}
+
+.fa-scalpel:before {
+  content: "\f61d";
+}
+
+.fa-ban:before, .fa-cancel:before {
+  content: "\f05e";
+}
+
+.fa-bell-exclamation:before {
+  content: "\f848";
+}
+
+.fa-bookmark-circle:before, .fa-circle-bookmark:before {
+  content: "\e100";
+}
+
+.fa-egg-fried:before {
+  content: "\f7fc";
+}
+
+.fa-face-weary:before {
+  content: "\e3a1";
+}
+
+.fa-uniform-martial-arts:before {
+  content: "\e3d1";
+}
+
+.fa-camera-rotate:before {
+  content: "\e0d8";
+}
+
+.fa-sun-dust:before {
+  content: "\f764";
+}
+
+.fa-comment-text:before {
+  content: "\e14d";
+}
+
+.fa-air-freshener:before, .fa-spray-can-sparkles:before {
+  content: "\f5d0";
+}
+
+.fa-signal-alt-4:before, .fa-signal-alt:before, .fa-signal-bars-strong:before, .fa-signal-bars:before {
+  content: "\f690";
+}
+
+.fa-diamond-exclamation:before {
+  content: "\e405";
+}
+
+.fa-star:before {
+  content: "\f005";
+}
+
+.fa-dial-min:before {
+  content: "\e161";
+}
+
+.fa-repeat:before {
+  content: "\f363";
+}
+
+.fa-cross:before {
+  content: "\f654";
+}
+
+.fa-file-caret-down:before, .fa-page-caret-down:before {
+  content: "\e429";
+}
+
+.fa-box:before {
+  content: "\f466";
+}
+
+.fa-venus-mars:before {
+  content: "\f228";
+}
+
+.fa-clock-seven-thirty:before {
+  content: "\e351";
+}
+
+.fa-arrow-pointer:before, .fa-mouse-pointer:before {
+  content: "\f245";
+}
+
+.fa-clock-four-thirty:before {
+  content: "\e34b";
+}
+
+.fa-signal-alt-3:before, .fa-signal-bars-good:before {
+  content: "\f693";
+}
+
+.fa-cactus:before {
+  content: "\f8a7";
+}
+
+.fa-lightbulb-gear:before {
+  content: "\e5fd";
+}
+
+.fa-expand-arrows-alt:before, .fa-maximize:before {
+  content: "\f31e";
+}
+
+.fa-charging-station:before {
+  content: "\f5e7";
+}
+
+.fa-shapes:before, .fa-triangle-circle-square:before {
+  content: "\f61f";
+}
+
+.fa-plane-tail:before {
+  content: "\e22c";
+}
+
+.fa-gauge-simple-max:before, .fa-tachometer-fastest:before {
+  content: "\f62b";
+}
+
+.fa-circle-u:before {
+  content: "\e127";
+}
+
+.fa-shield-slash:before {
+  content: "\e24b";
+}
+
+.fa-phone-square-down:before, .fa-square-phone-hangup:before {
+  content: "\e27a";
+}
+
+.fa-arrow-up-left:before {
+  content: "\e09d";
+}
+
+.fa-transporter-1:before {
+  content: "\e043";
+}
+
+.fa-peanuts:before {
+  content: "\e431";
+}
+
+.fa-random:before, .fa-shuffle:before {
+  content: "\f074";
+}
+
+.fa-person-running:before, .fa-running:before {
+  content: "\f70c";
+}
+
+.fa-mobile-retro:before {
+  content: "\e527";
+}
+
+.fa-grip-lines-vertical:before {
+  content: "\f7a5";
+}
+
+.fa-bin-bottles-recycle:before {
+  content: "\e5f6";
+}
+
+.fa-arrow-up-from-square:before {
+  content: "\e09c";
+}
+
+.fa-file-dashed-line:before, .fa-page-break:before {
+  content: "\f877";
+}
+
+.fa-bracket-curly-right:before {
+  content: "\7d";
+}
+
+.fa-spider:before {
+  content: "\f717";
+}
+
+.fa-clock-three:before {
+  content: "\e356";
+}
+
+.fa-hands-bound:before {
+  content: "\e4f9";
+}
+
+.fa-scalpel-line-dashed:before, .fa-scalpel-path:before {
+  content: "\f61e";
+}
+
+.fa-file-invoice-dollar:before {
+  content: "\f571";
+}
+
+.fa-pipe-smoking:before {
+  content: "\e3c4";
+}
+
+.fa-face-astonished:before {
+  content: "\e36b";
+}
+
+.fa-window:before {
+  content: "\f40e";
+}
+
+.fa-plane-circle-exclamation:before {
+  content: "\e556";
+}
+
+.fa-ear:before {
+  content: "\f5f0";
+}
+
+.fa-file-lock:before {
+  content: "\e3a6";
+}
+
+.fa-diagram-venn:before {
+  content: "\e15a";
+}
+
+.fa-arrow-down-from-bracket:before {
+  content: "\e667";
+}
+
+.fa-x-ray:before {
+  content: "\f497";
+}
+
+.fa-goal-net:before {
+  content: "\e3ab";
+}
+
+.fa-coffin-cross:before {
+  content: "\e051";
+}
+
+.fa-spell-check:before {
+  content: "\f891";
+}
+
+.fa-location-xmark:before, .fa-map-marker-times:before, .fa-map-marker-xmark:before {
+  content: "\f60e";
+}
+
+.fa-circle-quarter-stroke:before {
+  content: "\e5d3";
+}
+
+.fa-lasso:before {
+  content: "\f8c8";
+}
+
+.fa-slash:before {
+  content: "\f715";
+}
+
+.fa-person-to-portal:before, .fa-portal-enter:before {
+  content: "\e022";
+}
+
+.fa-calendar-star:before {
+  content: "\f736";
+}
+
+.fa-computer-mouse:before, .fa-mouse:before {
+  content: "\f8cc";
+}
+
+.fa-arrow-right-to-bracket:before, .fa-sign-in:before {
+  content: "\f090";
+}
+
+.fa-pegasus:before {
+  content: "\f703";
+}
+
+.fa-files-medical:before {
+  content: "\f7fd";
+}
+
+.fa-cannon:before {
+  content: "\e642";
+}
+
+.fa-nfc-lock:before {
+  content: "\e1f8";
+}
+
+.fa-person-ski-lift:before, .fa-ski-lift:before {
+  content: "\f7c8";
+}
+
+.fa-square-6:before {
+  content: "\e25b";
+}
+
+.fa-shop-slash:before, .fa-store-alt-slash:before {
+  content: "\e070";
+}
+
+.fa-wind-turbine:before {
+  content: "\f89b";
+}
+
+.fa-sliders-simple:before {
+  content: "\e253";
+}
+
+.fa-grid-round:before {
+  content: "\e5da";
+}
+
+.fa-badge-sheriff:before {
+  content: "\f8a2";
+}
+
+.fa-server:before {
+  content: "\f233";
+}
+
+.fa-virus-covid-slash:before {
+  content: "\e4a9";
+}
+
+.fa-intersection:before {
+  content: "\f668";
+}
+
+.fa-shop-lock:before {
+  content: "\e4a5";
+}
+
+.fa-family:before {
+  content: "\e300";
+}
+
+.fa-hourglass-1:before, .fa-hourglass-start:before {
+  content: "\f251";
+}
+
+.fa-user-hair-buns:before {
+  content: "\e3d3";
+}
+
+.fa-blender-phone:before {
+  content: "\f6b6";
+}
+
+.fa-hourglass-clock:before {
+  content: "\e41b";
+}
+
+.fa-person-seat-reclined:before {
+  content: "\e21f";
+}
+
+.fa-paper-plane-alt:before, .fa-paper-plane-top:before, .fa-send:before {
+  content: "\e20a";
+}
+
+.fa-comment-alt-arrow-up:before, .fa-message-arrow-up:before {
+  content: "\e1dc";
+}
+
+.fa-lightbulb-exclamation:before {
+  content: "\f671";
+}
+
+.fa-layer-group-minus:before, .fa-layer-minus:before {
+  content: "\f5fe";
+}
+
+.fa-chart-pie-simple-circle-currency:before {
+  content: "\e604";
+}
+
+.fa-circle-e:before {
+  content: "\e109";
+}
+
+.fa-building-wheat:before {
+  content: "\e4db";
+}
+
+.fa-gauge-max:before, .fa-tachometer-alt-fastest:before {
+  content: "\f626";
+}
+
+.fa-person-breastfeeding:before {
+  content: "\e53a";
+}
+
+.fa-apostrophe:before {
+  content: "\27";
+}
+
+.fa-file-png:before {
+  content: "\e666";
+}
+
+.fa-fire-hydrant:before {
+  content: "\e17f";
+}
+
+.fa-right-to-bracket:before, .fa-sign-in-alt:before {
+  content: "\f2f6";
+}
+
+.fa-video-plus:before {
+  content: "\f4e1";
+}
+
+.fa-arrow-alt-square-right:before, .fa-square-right:before {
+  content: "\f352";
+}
+
+.fa-comment-smile:before {
+  content: "\f4b4";
+}
+
+.fa-venus:before {
+  content: "\f221";
+}
+
+.fa-passport:before {
+  content: "\f5ab";
+}
+
+.fa-inbox-arrow-down:before, .fa-inbox-in:before {
+  content: "\f310";
+}
+
+.fa-heart-pulse:before, .fa-heartbeat:before {
+  content: "\f21e";
+}
+
+.fa-circle-8:before {
+  content: "\e0f5";
+}
+
+.fa-clouds-moon:before {
+  content: "\f745";
+}
+
+.fa-clock-ten-thirty:before {
+  content: "\e355";
+}
+
+.fa-people-carry-box:before, .fa-people-carry:before {
+  content: "\f4ce";
+}
+
+.fa-folder-user:before {
+  content: "\e18e";
+}
+
+.fa-trash-can-xmark:before {
+  content: "\e2ae";
+}
+
+.fa-temperature-high:before {
+  content: "\f769";
+}
+
+.fa-microchip:before {
+  content: "\f2db";
+}
+
+.fa-left-long-to-line:before {
+  content: "\e41e";
+}
+
+.fa-crown:before {
+  content: "\f521";
+}
+
+.fa-weight-hanging:before {
+  content: "\f5cd";
+}
+
+.fa-xmarks-lines:before {
+  content: "\e59a";
+}
+
+.fa-file-prescription:before {
+  content: "\f572";
+}
+
+.fa-table-cells-lock:before {
+  content: "\e679";
+}
+
+.fa-calendar-range:before {
+  content: "\e0d6";
+}
+
+.fa-flower-daffodil:before {
+  content: "\f800";
+}
+
+.fa-hand-back-point-up:before {
+  content: "\e1a2";
+}
+
+.fa-weight-scale:before, .fa-weight:before {
+  content: "\f496";
+}
+
+.fa-arrow-up-to-arc:before {
+  content: "\e617";
+}
+
+.fa-star-exclamation:before {
+  content: "\f2f3";
+}
+
+.fa-books:before {
+  content: "\f5db";
+}
+
+.fa-user-friends:before, .fa-user-group:before {
+  content: "\f500";
+}
+
+.fa-arrow-up-a-z:before, .fa-sort-alpha-up:before {
+  content: "\f15e";
+}
+
+.fa-layer-group-plus:before, .fa-layer-plus:before {
+  content: "\f5ff";
+}
+
+.fa-play-pause:before {
+  content: "\e22f";
+}
+
+.fa-block-question:before {
+  content: "\e3dd";
+}
+
+.fa-snooze:before, .fa-zzz:before {
+  content: "\f880";
+}
+
+.fa-scanner-image:before {
+  content: "\f8f3";
+}
+
+.fa-tv-retro:before {
+  content: "\f401";
+}
+
+.fa-square-t:before {
+  content: "\e280";
+}
+
+.fa-barn-silo:before, .fa-farm:before {
+  content: "\f864";
+}
+
+.fa-chess-knight:before {
+  content: "\f441";
+}
+
+.fa-bars-sort:before {
+  content: "\e0ae";
+}
+
+.fa-palette-boxes:before, .fa-pallet-alt:before, .fa-pallet-boxes:before {
+  content: "\f483";
+}
+
+.fa-face-laugh-squint:before, .fa-laugh-squint:before {
+  content: "\f59b";
+}
+
+.fa-code-simple:before {
+  content: "\e13d";
+}
+
+.fa-bolt-slash:before {
+  content: "\e0b8";
+}
+
+.fa-panel-fire:before {
+  content: "\e42f";
+}
+
+.fa-binary-circle-check:before {
+  content: "\e33c";
+}
+
+.fa-comment-minus:before {
+  content: "\f4b1";
+}
+
+.fa-burrito:before {
+  content: "\f7ed";
+}
+
+.fa-violin:before {
+  content: "\f8ed";
+}
+
+.fa-objects-column:before {
+  content: "\e3c1";
+}
+
+.fa-chevron-square-down:before, .fa-square-chevron-down:before {
+  content: "\f329";
+}
+
+.fa-comment-plus:before {
+  content: "\f4b2";
+}
+
+.fa-triangle-instrument:before, .fa-triangle-music:before {
+  content: "\f8e2";
+}
+
+.fa-wheelchair:before {
+  content: "\f193";
+}
+
+.fa-user-pilot-tie:before {
+  content: "\e2c1";
+}
+
+.fa-piano-keyboard:before {
+  content: "\f8d5";
+}
+
+.fa-bed-empty:before {
+  content: "\f8f9";
+}
+
+.fa-arrow-circle-up:before, .fa-circle-arrow-up:before {
+  content: "\f0aa";
+}
+
+.fa-toggle-on:before {
+  content: "\f205";
+}
+
+.fa-rectangle-portrait:before, .fa-rectangle-vertical:before {
+  content: "\f2fb";
+}
+
+.fa-person-walking:before, .fa-walking:before {
+  content: "\f554";
+}
+
+.fa-l:before {
+  content: "\4c";
+}
+
+.fa-signal-stream:before {
+  content: "\f8dd";
+}
+
+.fa-down-to-bracket:before {
+  content: "\e4e7";
+}
+
+.fa-circle-z:before {
+  content: "\e130";
+}
+
+.fa-stars:before {
+  content: "\f762";
+}
+
+.fa-fire:before {
+  content: "\f06d";
+}
+
+.fa-bed-pulse:before, .fa-procedures:before {
+  content: "\f487";
+}
+
+.fa-house-day:before {
+  content: "\e00e";
+}
+
+.fa-shuttle-space:before, .fa-space-shuttle:before {
+  content: "\f197";
+}
+
+.fa-shirt-long-sleeve:before {
+  content: "\e3c7";
+}
+
+.fa-chart-pie-alt:before, .fa-chart-pie-simple:before {
+  content: "\f64e";
+}
+
+.fa-face-laugh:before, .fa-laugh:before {
+  content: "\f599";
+}
+
+.fa-folder-open:before {
+  content: "\f07c";
+}
+
+.fa-album-collection-circle-user:before {
+  content: "\e48f";
+}
+
+.fa-candy:before {
+  content: "\e3e7";
+}
+
+.fa-bowl-hot:before, .fa-soup:before {
+  content: "\f823";
+}
+
+.fa-flatbread:before {
+  content: "\e40b";
+}
+
+.fa-heart-circle-plus:before {
+  content: "\e500";
+}
+
+.fa-code-fork:before {
+  content: "\e13b";
+}
+
+.fa-city:before {
+  content: "\f64f";
+}
+
+.fa-signal-alt-1:before, .fa-signal-bars-weak:before {
+  content: "\f691";
+}
+
+.fa-microphone-alt:before, .fa-microphone-lines:before {
+  content: "\f3c9";
+}
+
+.fa-clock-twelve:before {
+  content: "\e358";
+}
+
+.fa-pepper-hot:before {
+  content: "\f816";
+}
+
+.fa-citrus-slice:before {
+  content: "\e2f5";
+}
+
+.fa-sheep:before {
+  content: "\f711";
+}
+
+.fa-unlock:before {
+  content: "\f09c";
+}
+
+.fa-colon-sign:before {
+  content: "\e140";
+}
+
+.fa-headset:before {
+  content: "\f590";
+}
+
+.fa-badger-honey:before {
+  content: "\f6b4";
+}
+
+.fa-h4:before {
+  content: "\f86a";
+}
+
+.fa-store-slash:before {
+  content: "\e071";
+}
+
+.fa-road-circle-xmark:before {
+  content: "\e566";
+}
+
+.fa-signal-slash:before {
+  content: "\f695";
+}
+
+.fa-user-minus:before {
+  content: "\f503";
+}
+
+.fa-mars-stroke-up:before, .fa-mars-stroke-v:before {
+  content: "\f22a";
+}
+
+.fa-champagne-glasses:before, .fa-glass-cheers:before {
+  content: "\f79f";
+}
+
+.fa-taco:before {
+  content: "\f826";
+}
+
+.fa-hexagon-plus:before, .fa-plus-hexagon:before {
+  content: "\f300";
+}
+
+.fa-clipboard:before {
+  content: "\f328";
+}
+
+.fa-house-circle-exclamation:before {
+  content: "\e50a";
+}
+
+.fa-file-arrow-up:before, .fa-file-upload:before {
+  content: "\f574";
+}
+
+.fa-wifi-3:before, .fa-wifi-strong:before, .fa-wifi:before {
+  content: "\f1eb";
+}
+
+.fa-comments-alt:before, .fa-messages:before {
+  content: "\f4b6";
+}
+
+.fa-bath:before, .fa-bathtub:before {
+  content: "\f2cd";
+}
+
+.fa-umbrella-alt:before, .fa-umbrella-simple:before {
+  content: "\e2bc";
+}
+
+.fa-rectangle-history-circle-plus:before {
+  content: "\e4a3";
+}
+
+.fa-underline:before {
+  content: "\f0cd";
+}
+
+.fa-prescription-bottle-pill:before {
+  content: "\e5c0";
+}
+
+.fa-user-edit:before, .fa-user-pen:before {
+  content: "\f4ff";
+}
+
+.fa-binary-slash:before {
+  content: "\e33e";
+}
+
+.fa-square-o:before {
+  content: "\e278";
+}
+
+.fa-caduceus:before {
+  content: "\e681";
+}
+
+.fa-signature:before {
+  content: "\f5b7";
+}
+
+.fa-stroopwafel:before {
+  content: "\f551";
+}
+
+.fa-bold:before {
+  content: "\f032";
+}
+
+.fa-anchor-lock:before {
+  content: "\e4ad";
+}
+
+.fa-building-ngo:before {
+  content: "\e4d7";
+}
+
+.fa-transporter-3:before {
+  content: "\e045";
+}
+
+.fa-engine-exclamation:before, .fa-engine-warning:before {
+  content: "\f5f2";
+}
+
+.fa-circle-down-right:before {
+  content: "\e108";
+}
+
+.fa-square-k:before {
+  content: "\e274";
+}
+
+.fa-manat-sign:before {
+  content: "\e1d5";
+}
+
+.fa-money-check-edit:before, .fa-money-check-pen:before {
+  content: "\f872";
+}
+
+.fa-not-equal:before {
+  content: "\f53e";
+}
+
+.fa-border-style:before, .fa-border-top-left:before {
+  content: "\f853";
+}
+
+.fa-map-location-dot:before, .fa-map-marked-alt:before {
+  content: "\f5a0";
+}
+
+.fa-tilde:before {
+  content: "\7e";
+}
+
+.fa-jedi:before {
+  content: "\f669";
+}
+
+.fa-poll:before, .fa-square-poll-vertical:before {
+  content: "\f681";
+}
+
+.fa-arrow-down-square-triangle:before, .fa-sort-shapes-down-alt:before {
+  content: "\f889";
+}
+
+.fa-mug-hot:before {
+  content: "\f7b6";
+}
+
+.fa-dog-leashed:before {
+  content: "\f6d4";
+}
+
+.fa-battery-car:before, .fa-car-battery:before {
+  content: "\f5df";
+}
+
+.fa-face-downcast-sweat:before {
+  content: "\e371";
+}
+
+.fa-mailbox-flag-up:before {
+  content: "\e5bb";
+}
+
+.fa-memo-circle-info:before {
+  content: "\e49a";
+}
+
+.fa-gift:before {
+  content: "\f06b";
+}
+
+.fa-dice-two:before {
+  content: "\f528";
+}
+
+.fa-volume-medium:before, .fa-volume:before {
+  content: "\f6a8";
+}
+
+.fa-transporter-5:before {
+  content: "\e2a6";
+}
+
+.fa-gauge-circle-bolt:before {
+  content: "\e496";
+}
+
+.fa-coin-front:before {
+  content: "\e3fc";
+}
+
+.fa-file-slash:before {
+  content: "\e3a7";
+}
+
+.fa-message-arrow-up-right:before {
+  content: "\e1dd";
+}
+
+.fa-treasure-chest:before {
+  content: "\f723";
+}
+
+.fa-chess-queen:before {
+  content: "\f445";
+}
+
+.fa-paint-brush-alt:before, .fa-paint-brush-fine:before, .fa-paintbrush-alt:before, .fa-paintbrush-fine:before {
+  content: "\f5a9";
+}
+
+.fa-glasses:before {
+  content: "\f530";
+}
+
+.fa-hood-cloak:before {
+  content: "\f6ef";
+}
+
+.fa-square-quote:before {
+  content: "\e329";
+}
+
+.fa-up-left:before {
+  content: "\e2bd";
+}
+
+.fa-bring-front:before {
+  content: "\f857";
+}
+
+.fa-chess-board:before {
+  content: "\f43c";
+}
+
+.fa-burger-cheese:before, .fa-cheeseburger:before {
+  content: "\f7f1";
+}
+
+.fa-building-circle-check:before {
+  content: "\e4d2";
+}
+
+.fa-repeat-1:before {
+  content: "\f365";
+}
+
+.fa-arrow-down-to-line:before, .fa-arrow-to-bottom:before {
+  content: "\f33d";
+}
+
+.fa-grid-5:before {
+  content: "\e199";
+}
+
+.fa-swap-arrows:before {
+  content: "\e60a";
+}
+
+.fa-right-long-to-line:before {
+  content: "\e444";
+}
+
+.fa-person-chalkboard:before {
+  content: "\e53d";
+}
+
+.fa-mars-stroke-h:before, .fa-mars-stroke-right:before {
+  content: "\f22b";
+}
+
+.fa-hand-back-fist:before, .fa-hand-rock:before {
+  content: "\f255";
+}
+
+.fa-grid-round-5:before {
+  content: "\e5de";
+}
+
+.fa-tally-5:before, .fa-tally:before {
+  content: "\f69c";
+}
+
+.fa-caret-square-up:before, .fa-square-caret-up:before {
+  content: "\f151";
+}
+
+.fa-cloud-showers-water:before {
+  content: "\e4e4";
+}
+
+.fa-bar-chart:before, .fa-chart-bar:before {
+  content: "\f080";
+}
+
+.fa-hands-bubbles:before, .fa-hands-wash:before {
+  content: "\e05e";
+}
+
+.fa-less-than-equal:before {
+  content: "\f537";
+}
+
+.fa-train:before {
+  content: "\f238";
+}
+
+.fa-up-from-dotted-line:before {
+  content: "\e456";
+}
+
+.fa-eye-low-vision:before, .fa-low-vision:before {
+  content: "\f2a8";
+}
+
+.fa-traffic-light-go:before {
+  content: "\f638";
+}
+
+.fa-face-exhaling:before {
+  content: "\e480";
+}
+
+.fa-sensor-fire:before {
+  content: "\e02a";
+}
+
+.fa-user-unlock:before {
+  content: "\e058";
+}
+
+.fa-hexagon-divide:before {
+  content: "\e1ad";
+}
+
+.fa-00:before {
+  content: "\e467";
+}
+
+.fa-crow:before {
+  content: "\f520";
+}
+
+.fa-betamax:before, .fa-cassette-betamax:before {
+  content: "\f8a4";
+}
+
+.fa-sailboat:before {
+  content: "\e445";
+}
+
+.fa-window-restore:before {
+  content: "\f2d2";
+}
+
+.fa-nfc-magnifying-glass:before {
+  content: "\e1f9";
+}
+
+.fa-file-binary:before {
+  content: "\e175";
+}
+
+.fa-circle-v:before {
+  content: "\e12a";
+}
+
+.fa-plus-square:before, .fa-square-plus:before {
+  content: "\f0fe";
+}
+
+.fa-bowl-scoops:before {
+  content: "\e3df";
+}
+
+.fa-mistletoe:before {
+  content: "\f7b4";
+}
+
+.fa-custard:before {
+  content: "\e403";
+}
+
+.fa-lacrosse-stick:before {
+  content: "\e3b5";
+}
+
+.fa-hockey-mask:before {
+  content: "\f6ee";
+}
+
+.fa-sunrise:before {
+  content: "\f766";
+}
+
+.fa-subtitles:before {
+  content: "\e60f";
+}
+
+.fa-panel-ews:before {
+  content: "\e42e";
+}
+
+.fa-torii-gate:before {
+  content: "\f6a1";
+}
+
+.fa-cloud-exclamation:before {
+  content: "\e491";
+}
+
+.fa-comment-alt-lines:before, .fa-message-lines:before {
+  content: "\f4a6";
+}
+
+.fa-frog:before {
+  content: "\f52e";
+}
+
+.fa-bucket:before {
+  content: "\e4cf";
+}
+
+.fa-floppy-disk-pen:before {
+  content: "\e182";
+}
+
+.fa-image:before {
+  content: "\f03e";
+}
+
+.fa-window-frame:before {
+  content: "\e04f";
+}
+
+.fa-microphone:before {
+  content: "\f130";
+}
+
+.fa-cow:before {
+  content: "\f6c8";
+}
+
+.fa-file-zip:before {
+  content: "\e5ee";
+}
+
+.fa-square-ring:before {
+  content: "\e44f";
+}
+
+.fa-arrow-alt-from-top:before, .fa-down-from-line:before {
+  content: "\f349";
+}
+
+.fa-caret-up:before {
+  content: "\f0d8";
+}
+
+.fa-shield-times:before, .fa-shield-xmark:before {
+  content: "\e24c";
+}
+
+.fa-screwdriver:before {
+  content: "\f54a";
+}
+
+.fa-circle-sort-down:before, .fa-sort-circle-down:before {
+  content: "\e031";
+}
+
+.fa-folder-closed:before {
+  content: "\e185";
+}
+
+.fa-house-tsunami:before {
+  content: "\e515";
+}
+
+.fa-square-nfi:before {
+  content: "\e576";
+}
+
+.fa-forklift:before {
+  content: "\f47a";
+}
+
+.fa-arrow-up-from-ground-water:before {
+  content: "\e4b5";
+}
+
+.fa-bracket-square-right:before {
+  content: "\5d";
+}
+
+.fa-glass-martini-alt:before, .fa-martini-glass:before {
+  content: "\f57b";
+}
+
+.fa-rotate-back:before, .fa-rotate-backward:before, .fa-rotate-left:before, .fa-undo-alt:before {
+  content: "\f2ea";
+}
+
+.fa-columns:before, .fa-table-columns:before {
+  content: "\f0db";
+}
+
+.fa-square-a:before {
+  content: "\e25f";
+}
+
+.fa-tick:before {
+  content: "\e32f";
+}
+
+.fa-lemon:before {
+  content: "\f094";
+}
+
+.fa-head-side-mask:before {
+  content: "\e063";
+}
+
+.fa-handshake:before {
+  content: "\f2b5";
+}
+
+.fa-gem:before {
+  content: "\f3a5";
+}
+
+.fa-dolly-box:before, .fa-dolly:before {
+  content: "\f472";
+}
+
+.fa-smoking:before {
+  content: "\f48d";
+}
+
+.fa-compress-arrows-alt:before, .fa-minimize:before {
+  content: "\f78c";
+}
+
+.fa-refrigerator:before {
+  content: "\e026";
+}
+
+.fa-monument:before {
+  content: "\f5a6";
+}
+
+.fa-octagon-xmark:before, .fa-times-octagon:before, .fa-xmark-octagon:before {
+  content: "\f2f0";
+}
+
+.fa-align-slash:before {
+  content: "\f846";
+}
+
+.fa-snowplow:before {
+  content: "\f7d2";
+}
+
+.fa-angle-double-right:before, .fa-angles-right:before {
+  content: "\f101";
+}
+
+.fa-truck-couch:before, .fa-truck-ramp-couch:before {
+  content: "\f4dd";
+}
+
+.fa-cannabis:before {
+  content: "\f55f";
+}
+
+.fa-circle-play:before, .fa-play-circle:before {
+  content: "\f144";
+}
+
+.fa-arrow-up-right-and-arrow-down-left-from-center:before {
+  content: "\e0a0";
+}
+
+.fa-location-arrow-up:before {
+  content: "\e63a";
+}
+
+.fa-tablets:before {
+  content: "\f490";
+}
+
+.fa-360-degrees:before {
+  content: "\e2dc";
+}
+
+.fa-ethernet:before {
+  content: "\f796";
+}
+
+.fa-eur:before, .fa-euro-sign:before, .fa-euro:before {
+  content: "\f153";
+}
+
+.fa-chair:before {
+  content: "\f6c0";
+}
+
+.fa-check-circle:before, .fa-circle-check:before {
+  content: "\f058";
+}
+
+.fa-square-dashed-circle-plus:before {
+  content: "\e5c2";
+}
+
+.fa-hand-holding-circle-dollar:before {
+  content: "\e621";
+}
+
+.fa-money-simple-from-bracket:before {
+  content: "\e313";
+}
+
+.fa-bat:before {
+  content: "\f6b5";
+}
+
+.fa-circle-stop:before, .fa-stop-circle:before {
+  content: "\f28d";
+}
+
+.fa-head-side-headphones:before {
+  content: "\f8c2";
+}
+
+.fa-phone-rotary:before {
+  content: "\f8d3";
+}
+
+.fa-arrow-up-to-bracket:before {
+  content: "\e66a";
+}
+
+.fa-compass-drafting:before, .fa-drafting-compass:before {
+  content: "\f568";
+}
+
+.fa-plate-wheat:before {
+  content: "\e55a";
+}
+
+.fa-calendar-circle-minus:before {
+  content: "\e46f";
+}
+
+.fa-chopsticks:before {
+  content: "\e3f7";
+}
+
+.fa-car-mechanic:before, .fa-car-wrench:before {
+  content: "\f5e3";
+}
+
+.fa-icicles:before {
+  content: "\f7ad";
+}
+
+.fa-person-shelter:before {
+  content: "\e54f";
+}
+
+.fa-neuter:before {
+  content: "\f22c";
+}
+
+.fa-id-badge:before {
+  content: "\f2c1";
+}
+
+.fa-kazoo:before {
+  content: "\f8c7";
+}
+
+.fa-marker:before {
+  content: "\f5a1";
+}
+
+.fa-bin-bottles:before {
+  content: "\e5f5";
+}
+
+.fa-face-laugh-beam:before, .fa-laugh-beam:before {
+  content: "\f59a";
+}
+
+.fa-square-arrow-down-left:before {
+  content: "\e261";
+}
+
+.fa-battery-bolt:before {
+  content: "\f376";
+}
+
+.fa-tree-large:before {
+  content: "\f7dd";
+}
+
+.fa-helicopter-symbol:before {
+  content: "\e502";
+}
+
+.fa-aperture:before {
+  content: "\e2df";
+}
+
+.fa-universal-access:before {
+  content: "\f29a";
+}
+
+.fa-gear-complex:before {
+  content: "\e5e9";
+}
+
+.fa-file-magnifying-glass:before, .fa-file-search:before {
+  content: "\f865";
+}
+
+.fa-up-right:before {
+  content: "\e2be";
+}
+
+.fa-chevron-circle-up:before, .fa-circle-chevron-up:before {
+  content: "\f139";
+}
+
+.fa-user-police:before {
+  content: "\e333";
+}
+
+.fa-lari-sign:before {
+  content: "\e1c8";
+}
+
+.fa-volcano:before {
+  content: "\f770";
+}
+
+.fa-teddy-bear:before {
+  content: "\e3cf";
+}
+
+.fa-stocking:before {
+  content: "\f7d5";
+}
+
+.fa-person-walking-dashed-line-arrow-right:before {
+  content: "\e553";
+}
+
+.fa-image-slash:before {
+  content: "\e1b7";
+}
+
+.fa-mask-snorkel:before {
+  content: "\e3b7";
+}
+
+.fa-smoke:before {
+  content: "\f760";
+}
+
+.fa-gbp:before, .fa-pound-sign:before, .fa-sterling-sign:before {
+  content: "\f154";
+}
+
+.fa-battery-exclamation:before {
+  content: "\e0b0";
+}
+
+.fa-viruses:before {
+  content: "\e076";
+}
+
+.fa-square-person-confined:before {
+  content: "\e577";
+}
+
+.fa-user-tie:before {
+  content: "\f508";
+}
+
+.fa-up-to-bracket:before {
+  content: "\e66e";
+}
+
+.fa-arrow-down-long:before, .fa-long-arrow-down:before {
+  content: "\f175";
+}
+
+.fa-tent-arrow-down-to-line:before {
+  content: "\e57e";
+}
+
+.fa-certificate:before {
+  content: "\f0a3";
+}
+
+.fa-crystal-ball:before {
+  content: "\e362";
+}
+
+.fa-mail-reply-all:before, .fa-reply-all:before {
+  content: "\f122";
+}
+
+.fa-suitcase:before {
+  content: "\f0f2";
+}
+
+.fa-person-skating:before, .fa-skating:before {
+  content: "\f7c5";
+}
+
+.fa-star-shooting:before {
+  content: "\e036";
+}
+
+.fa-binary-lock:before {
+  content: "\e33d";
+}
+
+.fa-filter-circle-dollar:before, .fa-funnel-dollar:before {
+  content: "\f662";
+}
+
+.fa-camera-retro:before {
+  content: "\f083";
+}
+
+.fa-arrow-circle-down:before, .fa-circle-arrow-down:before {
+  content: "\f0ab";
+}
+
+.fa-comment-edit:before, .fa-comment-pen:before {
+  content: "\f4ae";
+}
+
+.fa-arrow-right-to-file:before, .fa-file-import:before {
+  content: "\f56f";
+}
+
+.fa-banjo:before {
+  content: "\f8a3";
+}
+
+.fa-external-link-square:before, .fa-square-arrow-up-right:before {
+  content: "\f14c";
+}
+
+.fa-light-emergency-on:before {
+  content: "\e420";
+}
+
+.fa-kerning:before {
+  content: "\f86f";
+}
+
+.fa-box-open:before {
+  content: "\f49e";
+}
+
+.fa-square-f:before {
+  content: "\e270";
+}
+
+.fa-scroll:before {
+  content: "\f70e";
+}
+
+.fa-spa:before {
+  content: "\f5bb";
+}
+
+.fa-arrow-from-right:before, .fa-arrow-left-from-line:before {
+  content: "\f344";
+}
+
+.fa-strawberry:before {
+  content: "\e32b";
+}
+
+.fa-location-pin-lock:before {
+  content: "\e51f";
+}
+
+.fa-pause:before {
+  content: "\f04c";
+}
+
+.fa-clock-eight-thirty:before {
+  content: "\e346";
+}
+
+.fa-plane-alt:before, .fa-plane-engines:before {
+  content: "\f3de";
+}
+
+.fa-hill-avalanche:before {
+  content: "\e507";
+}
+
+.fa-temperature-0:before, .fa-temperature-empty:before, .fa-thermometer-0:before, .fa-thermometer-empty:before {
+  content: "\f2cb";
+}
+
+.fa-bomb:before {
+  content: "\f1e2";
+}
+
+.fa-gauge-low:before, .fa-tachometer-alt-slow:before {
+  content: "\f627";
+}
+
+.fa-registered:before {
+  content: "\f25d";
+}
+
+.fa-trash-can-plus:before {
+  content: "\e2ac";
+}
+
+.fa-address-card:before, .fa-contact-card:before, .fa-vcard:before {
+  content: "\f2bb";
+}
+
+.fa-balance-scale-right:before, .fa-scale-unbalanced-flip:before {
+  content: "\f516";
+}
+
+.fa-globe-snow:before {
+  content: "\f7a3";
+}
+
+.fa-subscript:before {
+  content: "\f12c";
+}
+
+.fa-diamond-turn-right:before, .fa-directions:before {
+  content: "\f5eb";
+}
+
+.fa-integral:before {
+  content: "\f667";
+}
+
+.fa-burst:before {
+  content: "\e4dc";
+}
+
+.fa-house-laptop:before, .fa-laptop-house:before {
+  content: "\e066";
+}
+
+.fa-face-tired:before, .fa-tired:before {
+  content: "\f5c8";
+}
+
+.fa-money-bills:before {
+  content: "\e1f3";
+}
+
+.fa-blinds-raised:before {
+  content: "\f8fd";
+}
+
+.fa-smog:before {
+  content: "\f75f";
+}
+
+.fa-ufo-beam:before {
+  content: "\e048";
+}
+
+.fa-caret-circle-up:before, .fa-circle-caret-up:before {
+  content: "\f331";
+}
+
+.fa-user-vneck-hair-long:before {
+  content: "\e463";
+}
+
+.fa-square-a-lock:before {
+  content: "\e44d";
+}
+
+.fa-crutch:before {
+  content: "\f7f7";
+}
+
+.fa-gas-pump-slash:before {
+  content: "\f5f4";
+}
+
+.fa-cloud-arrow-up:before, .fa-cloud-upload-alt:before, .fa-cloud-upload:before {
+  content: "\f0ee";
+}
+
+.fa-palette:before {
+  content: "\f53f";
+}
+
+.fa-transporter-4:before {
+  content: "\e2a5";
+}
+
+.fa-chart-mixed-up-circle-currency:before {
+  content: "\e5d8";
+}
+
+.fa-objects-align-right:before {
+  content: "\e3bf";
+}
+
+.fa-arrows-turn-right:before {
+  content: "\e4c0";
+}
+
+.fa-vest:before {
+  content: "\e085";
+}
+
+.fa-pig:before {
+  content: "\f706";
+}
+
+.fa-inbox-full:before {
+  content: "\e1ba";
+}
+
+.fa-circle-envelope:before, .fa-envelope-circle:before {
+  content: "\e10c";
+}
+
+.fa-construction:before, .fa-triangle-person-digging:before {
+  content: "\f85d";
+}
+
+.fa-ferry:before {
+  content: "\e4ea";
+}
+
+.fa-bullseye-arrow:before {
+  content: "\f648";
+}
+
+.fa-arrows-down-to-people:before {
+  content: "\e4b9";
+}
+
+.fa-seedling:before, .fa-sprout:before {
+  content: "\f4d8";
+}
+
+.fa-clock-seven:before {
+  content: "\e350";
+}
+
+.fa-arrows-alt-h:before, .fa-left-right:before {
+  content: "\f337";
+}
+
+.fa-boxes-packing:before {
+  content: "\e4c7";
+}
+
+.fa-arrow-circle-left:before, .fa-circle-arrow-left:before {
+  content: "\f0a8";
+}
+
+.fa-flashlight:before {
+  content: "\f8b8";
+}
+
+.fa-file-jpg:before {
+  content: "\e646";
+}
+
+.fa-group-arrows-rotate:before {
+  content: "\e4f6";
+}
+
+.fa-bowl-food:before {
+  content: "\e4c6";
+}
+
+.fa-square-9:before {
+  content: "\e25e";
+}
+
+.fa-candy-cane:before {
+  content: "\f786";
+}
+
+.fa-arrow-down-wide-short:before, .fa-sort-amount-asc:before, .fa-sort-amount-down:before {
+  content: "\f160";
+}
+
+.fa-dollar-square:before, .fa-square-dollar:before, .fa-usd-square:before {
+  content: "\f2e9";
+}
+
+.fa-phone-arrow-right:before {
+  content: "\e5be";
+}
+
+.fa-hand-holding-seedling:before {
+  content: "\f4bf";
+}
+
+.fa-comment-alt-check:before, .fa-message-check:before {
+  content: "\f4a2";
+}
+
+.fa-cloud-bolt:before, .fa-thunderstorm:before {
+  content: "\f76c";
+}
+
+.fa-chart-line-up-down:before {
+  content: "\e5d7";
+}
+
+.fa-remove-format:before, .fa-text-slash:before {
+  content: "\f87d";
+}
+
+.fa-watch:before {
+  content: "\f2e1";
+}
+
+.fa-circle-down-left:before {
+  content: "\e107";
+}
+
+.fa-text:before {
+  content: "\f893";
+}
+
+.fa-projector:before {
+  content: "\f8d6";
+}
+
+.fa-face-smile-wink:before, .fa-smile-wink:before {
+  content: "\f4da";
+}
+
+.fa-tombstone-alt:before, .fa-tombstone-blank:before {
+  content: "\f721";
+}
+
+.fa-chess-king-alt:before, .fa-chess-king-piece:before {
+  content: "\f440";
+}
+
+.fa-circle-6:before {
+  content: "\e0f3";
+}
+
+.fa-waves-sine:before {
+  content: "\e65d";
+}
+
+.fa-arrow-alt-left:before, .fa-left:before {
+  content: "\f355";
+}
+
+.fa-file-word:before {
+  content: "\f1c2";
+}
+
+.fa-file-powerpoint:before {
+  content: "\f1c4";
+}
+
+.fa-arrow-alt-square-down:before, .fa-square-down:before {
+  content: "\f350";
+}
+
+.fa-objects-align-center-vertical:before {
+  content: "\e3bd";
+}
+
+.fa-arrows-h:before, .fa-arrows-left-right:before {
+  content: "\f07e";
+}
+
+.fa-house-lock:before {
+  content: "\e510";
+}
+
+.fa-cloud-arrow-down:before, .fa-cloud-download-alt:before, .fa-cloud-download:before {
+  content: "\f0ed";
+}
+
+.fa-wreath:before {
+  content: "\f7e2";
+}
+
+.fa-children:before {
+  content: "\e4e1";
+}
+
+.fa-meter-droplet:before {
+  content: "\e1ea";
+}
+
+.fa-blackboard:before, .fa-chalkboard:before {
+  content: "\f51b";
+}
+
+.fa-user-alt-slash:before, .fa-user-large-slash:before {
+  content: "\f4fa";
+}
+
+.fa-signal-4:before, .fa-signal-strong:before {
+  content: "\f68f";
+}
+
+.fa-lollipop:before, .fa-lollypop:before {
+  content: "\e424";
+}
+
+.fa-list-tree:before {
+  content: "\e1d2";
+}
+
+.fa-envelope-open:before {
+  content: "\f2b6";
+}
+
+.fa-draw-circle:before {
+  content: "\f5ed";
+}
+
+.fa-cat-space:before {
+  content: "\e001";
+}
+
+.fa-handshake-alt-slash:before, .fa-handshake-simple-slash:before {
+  content: "\e05f";
+}
+
+.fa-rabbit-fast:before, .fa-rabbit-running:before {
+  content: "\f709";
+}
+
+.fa-memo-pad:before {
+  content: "\e1da";
+}
+
+.fa-mattress-pillow:before {
+  content: "\e525";
+}
+
+.fa-alarm-plus:before {
+  content: "\f844";
+}
+
+.fa-alicorn:before {
+  content: "\f6b0";
+}
+
+.fa-comment-question:before {
+  content: "\e14b";
+}
+
+.fa-gingerbread-man:before {
+  content: "\f79d";
+}
+
+.fa-guarani-sign:before {
+  content: "\e19a";
+}
+
+.fa-burger-fries:before {
+  content: "\e0cd";
+}
+
+.fa-mug-tea:before {
+  content: "\f875";
+}
+
+.fa-border-top:before {
+  content: "\f855";
+}
+
+.fa-arrows-rotate:before, .fa-refresh:before, .fa-sync:before {
+  content: "\f021";
+}
+
+.fa-book-circle:before, .fa-circle-book-open:before {
+  content: "\e0ff";
+}
+
+.fa-arrows-to-dotted-line:before {
+  content: "\e0a6";
+}
+
+.fa-fire-extinguisher:before {
+  content: "\f134";
+}
+
+.fa-magnifying-glass-arrows-rotate:before {
+  content: "\e65e";
+}
+
+.fa-garage-open:before {
+  content: "\e00b";
+}
+
+.fa-shelves-empty:before {
+  content: "\e246";
+}
+
+.fa-cruzeiro-sign:before {
+  content: "\e152";
+}
+
+.fa-watch-apple:before {
+  content: "\e2cb";
+}
+
+.fa-watch-calculator:before {
+  content: "\f8f0";
+}
+
+.fa-list-dropdown:before {
+  content: "\e1cf";
+}
+
+.fa-cabinet-filing:before {
+  content: "\f64b";
+}
+
+.fa-burger-soda:before {
+  content: "\f858";
+}
+
+.fa-arrow-square-up:before, .fa-square-arrow-up:before {
+  content: "\f33c";
+}
+
+.fa-greater-than-equal:before {
+  content: "\f532";
+}
+
+.fa-pallet-box:before {
+  content: "\e208";
+}
+
+.fa-face-confounded:before {
+  content: "\e36c";
+}
+
+.fa-shield-alt:before, .fa-shield-halved:before {
+  content: "\f3ed";
+}
+
+.fa-truck-plow:before {
+  content: "\f7de";
+}
+
+.fa-atlas:before, .fa-book-atlas:before {
+  content: "\f558";
+}
+
+.fa-virus:before {
+  content: "\e074";
+}
+
+.fa-grid-round-2:before {
+  content: "\e5db";
+}
+
+.fa-comment-middle-top:before {
+  content: "\e14a";
+}
+
+.fa-wave:before {
+  content: "\e65b";
+}
+
+.fa-envelope-circle-check:before {
+  content: "\e4e8";
+}
+
+.fa-layer-group:before {
+  content: "\f5fd";
+}
+
+.fa-restroom-simple:before {
+  content: "\e23a";
+}
+
+.fa-arrows-to-dot:before {
+  content: "\e4be";
+}
+
+.fa-border-outer:before {
+  content: "\f851";
+}
+
+.fa-hashtag-lock:before {
+  content: "\e415";
+}
+
+.fa-clock-two-thirty:before {
+  content: "\e35b";
+}
+
+.fa-archway:before {
+  content: "\f557";
+}
+
+.fa-heart-circle-check:before {
+  content: "\e4fd";
+}
+
+.fa-house-chimney-crack:before, .fa-house-damage:before {
+  content: "\f6f1";
+}
+
+.fa-file-archive:before, .fa-file-zipper:before {
+  content: "\f1c6";
+}
+
+.fa-ticket-perforated:before {
+  content: "\e63e";
+}
+
+.fa-heart-half:before {
+  content: "\e1ab";
+}
+
+.fa-comment-check:before {
+  content: "\f4ac";
+}
+
+.fa-square:before {
+  content: "\f0c8";
+}
+
+.fa-memo:before {
+  content: "\e1d8";
+}
+
+.fa-glass-martini:before, .fa-martini-glass-empty:before {
+  content: "\f000";
+}
+
+.fa-couch:before {
+  content: "\f4b8";
+}
+
+.fa-cedi-sign:before {
+  content: "\e0df";
+}
+
+.fa-italic:before {
+  content: "\f033";
+}
+
+.fa-glass-citrus:before {
+  content: "\f869";
+}
+
+.fa-calendar-lines-pen:before {
+  content: "\e472";
+}
+
+.fa-table-cells-column-lock:before {
+  content: "\e678";
+}
+
+.fa-church:before {
+  content: "\f51d";
+}
+
+.fa-person-snowmobiling:before, .fa-snowmobile:before {
+  content: "\f7d1";
+}
+
+.fa-face-hushed:before {
+  content: "\e37b";
+}
+
+.fa-comments-dollar:before {
+  content: "\f653";
+}
+
+.fa-tickets-simple:before {
+  content: "\e659";
+}
+
+.fa-pickaxe:before {
+  content: "\e5bf";
+}
+
+.fa-link-simple-slash:before {
+  content: "\e1ce";
+}
+
+.fa-democrat:before {
+  content: "\f747";
+}
+
+.fa-face-confused:before {
+  content: "\e36d";
+}
+
+.fa-pinball:before {
+  content: "\e229";
+}
+
+.fa-z:before {
+  content: "\5a";
+}
+
+.fa-person-skiing:before, .fa-skiing:before {
+  content: "\f7c9";
+}
+
+.fa-deer:before {
+  content: "\f78e";
+}
+
+.fa-input-pipe:before {
+  content: "\e1be";
+}
+
+.fa-road-lock:before {
+  content: "\e567";
+}
+
+.fa-a:before {
+  content: "\41";
+}
+
+.fa-bookmark-slash:before {
+  content: "\e0c2";
+}
+
+.fa-temperature-arrow-down:before, .fa-temperature-down:before {
+  content: "\e03f";
+}
+
+.fa-mace:before {
+  content: "\f6f8";
+}
+
+.fa-feather-alt:before, .fa-feather-pointed:before {
+  content: "\f56b";
+}
+
+.fa-sausage:before {
+  content: "\f820";
+}
+
+.fa-trash-can-clock:before {
+  content: "\e2aa";
+}
+
+.fa-p:before {
+  content: "\50";
+}
+
+.fa-broom-wide:before {
+  content: "\e5d1";
+}
+
+.fa-snowflake:before {
+  content: "\f2dc";
+}
+
+.fa-stomach:before {
+  content: "\f623";
+}
+
+.fa-newspaper:before {
+  content: "\f1ea";
+}
+
+.fa-ad:before, .fa-rectangle-ad:before {
+  content: "\f641";
+}
+
+.fa-guitar-electric:before {
+  content: "\f8be";
+}
+
+.fa-arrow-turn-down-right:before {
+  content: "\e3d6";
+}
+
+.fa-moon-cloud:before {
+  content: "\f754";
+}
+
+.fa-bread-slice-butter:before {
+  content: "\e3e1";
+}
+
+.fa-arrow-circle-right:before, .fa-circle-arrow-right:before {
+  content: "\f0a9";
+}
+
+.fa-user-group-crown:before, .fa-users-crown:before {
+  content: "\f6a5";
+}
+
+.fa-circle-i:before {
+  content: "\e111";
+}
+
+.fa-toilet-paper-check:before {
+  content: "\e5b2";
+}
+
+.fa-filter-circle-xmark:before {
+  content: "\e17b";
+}
+
+.fa-locust:before {
+  content: "\e520";
+}
+
+.fa-sort:before, .fa-unsorted:before {
+  content: "\f0dc";
+}
+
+.fa-list-1-2:before, .fa-list-numeric:before, .fa-list-ol:before {
+  content: "\f0cb";
+}
+
+.fa-chart-waterfall:before {
+  content: "\e0eb";
+}
+
+.fa-sparkle:before {
+  content: "\e5d6";
+}
+
+.fa-face-party:before {
+  content: "\e383";
+}
+
+.fa-kidneys:before {
+  content: "\f5fb";
+}
+
+.fa-wifi-exclamation:before {
+  content: "\e2cf";
+}
+
+.fa-chart-network:before {
+  content: "\f78a";
+}
+
+.fa-person-dress-burst:before {
+  content: "\e544";
+}
+
+.fa-dice-d4:before {
+  content: "\f6d0";
+}
+
+.fa-money-check-alt:before, .fa-money-check-dollar:before {
+  content: "\f53d";
+}
+
+.fa-vector-square:before {
+  content: "\f5cb";
+}
+
+.fa-bread-slice:before {
+  content: "\f7ec";
+}
+
+.fa-language:before {
+  content: "\f1ab";
+}
+
+.fa-wheat-awn-slash:before {
+  content: "\e338";
+}
+
+.fa-face-kiss-wink-heart:before, .fa-kiss-wink-heart:before {
+  content: "\f598";
+}
+
+.fa-dagger:before {
+  content: "\f6cb";
+}
+
+.fa-podium:before {
+  content: "\f680";
+}
+
+.fa-memo-circle-check:before {
+  content: "\e1d9";
+}
+
+.fa-route-highway:before {
+  content: "\f61a";
+}
+
+.fa-arrow-alt-to-bottom:before, .fa-down-to-line:before {
+  content: "\f34a";
+}
+
+.fa-filter:before {
+  content: "\f0b0";
+}
+
+.fa-square-g:before {
+  content: "\e271";
+}
+
+.fa-circle-phone:before, .fa-phone-circle:before {
+  content: "\e11b";
+}
+
+.fa-clipboard-prescription:before {
+  content: "\f5e8";
+}
+
+.fa-user-nurse-hair:before {
+  content: "\e45d";
+}
+
+.fa-question:before {
+  content: "\3f";
+}
+
+.fa-file-signature:before {
+  content: "\f573";
+}
+
+.fa-toggle-large-on:before {
+  content: "\e5b1";
+}
+
+.fa-arrows-alt:before, .fa-up-down-left-right:before {
+  content: "\f0b2";
+}
+
+.fa-dryer-alt:before, .fa-dryer-heat:before {
+  content: "\f862";
+}
+
+.fa-house-chimney-user:before {
+  content: "\e065";
+}
+
+.fa-hand-holding-heart:before {
+  content: "\f4be";
+}
+
+.fa-arrow-up-small-big:before, .fa-sort-size-up-alt:before {
+  content: "\f88f";
+}
+
+.fa-train-track:before {
+  content: "\e453";
+}
+
+.fa-puzzle-piece:before {
+  content: "\f12e";
+}
+
+.fa-money-check:before {
+  content: "\f53c";
+}
+
+.fa-star-half-alt:before, .fa-star-half-stroke:before {
+  content: "\f5c0";
+}
+
+.fa-file-exclamation:before {
+  content: "\f31a";
+}
+
+.fa-code:before {
+  content: "\f121";
+}
+
+.fa-glass-whiskey:before, .fa-whiskey-glass:before {
+  content: "\f7a0";
+}
+
+.fa-moon-stars:before {
+  content: "\f755";
+}
+
+.fa-building-circle-exclamation:before {
+  content: "\e4d3";
+}
+
+.fa-clothes-hanger:before {
+  content: "\e136";
+}
+
+.fa-mobile-iphone:before, .fa-mobile-notch:before {
+  content: "\e1ee";
+}
+
+.fa-magnifying-glass-chart:before {
+  content: "\e522";
+}
+
+.fa-arrow-up-right-from-square:before, .fa-external-link:before {
+  content: "\f08e";
+}
+
+.fa-cubes-stacked:before {
+  content: "\e4e6";
+}
+
+.fa-images-user:before {
+  content: "\e1b9";
+}
+
+.fa-krw:before, .fa-won-sign:before, .fa-won:before {
+  content: "\f159";
+}
+
+.fa-image-polaroid-user:before {
+  content: "\e1b6";
+}
+
+.fa-virus-covid:before {
+  content: "\e4a8";
+}
+
+.fa-square-ellipsis:before {
+  content: "\e26e";
+}
+
+.fa-pie:before {
+  content: "\f705";
+}
+
+.fa-chess-knight-alt:before, .fa-chess-knight-piece:before {
+  content: "\f442";
+}
+
+.fa-austral-sign:before {
+  content: "\e0a9";
+}
+
+.fa-cloud-plus:before {
+  content: "\e35e";
+}
+
+.fa-f:before {
+  content: "\46";
+}
+
+.fa-leaf:before {
+  content: "\f06c";
+}
+
+.fa-bed-bunk:before {
+  content: "\f8f8";
+}
+
+.fa-road:before {
+  content: "\f018";
+}
+
+.fa-cab:before, .fa-taxi:before {
+  content: "\f1ba";
+}
+
+.fa-person-circle-plus:before {
+  content: "\e541";
+}
+
+.fa-chart-pie:before, .fa-pie-chart:before {
+  content: "\f200";
+}
+
+.fa-bolt-lightning:before {
+  content: "\e0b7";
+}
+
+.fa-clock-eight:before {
+  content: "\e345";
+}
+
+.fa-sack-xmark:before {
+  content: "\e56a";
+}
+
+.fa-file-xls:before {
+  content: "\e64d";
+}
+
+.fa-file-excel:before {
+  content: "\f1c3";
+}
+
+.fa-file-contract:before {
+  content: "\f56c";
+}
+
+.fa-fish-fins:before {
+  content: "\e4f2";
+}
+
+.fa-circle-q:before {
+  content: "\e11e";
+}
+
+.fa-building-flag:before {
+  content: "\e4d5";
+}
+
+.fa-face-grin-beam:before, .fa-grin-beam:before {
+  content: "\f582";
+}
+
+.fa-object-ungroup:before {
+  content: "\f248";
+}
+
+.fa-face-disguise:before {
+  content: "\e370";
+}
+
+.fa-circle-arrow-down-right:before {
+  content: "\e0fa";
+}
+
+.fa-alien-8bit:before, .fa-alien-monster:before {
+  content: "\f8f6";
+}
+
+.fa-hand-point-ribbon:before {
+  content: "\e1a6";
+}
+
+.fa-poop:before {
+  content: "\f619";
+}
+
+.fa-object-exclude:before {
+  content: "\e49c";
+}
+
+.fa-telescope:before {
+  content: "\e03e";
+}
+
+.fa-location-pin:before, .fa-map-marker:before {
+  content: "\f041";
+}
+
+.fa-square-list:before {
+  content: "\e489";
+}
+
+.fa-kaaba:before {
+  content: "\f66b";
+}
+
+.fa-toilet-paper:before {
+  content: "\f71e";
+}
+
+.fa-hard-hat:before, .fa-hat-hard:before, .fa-helmet-safety:before {
+  content: "\f807";
+}
+
+.fa-comment-code:before {
+  content: "\e147";
+}
+
+.fa-sim-cards:before {
+  content: "\e251";
+}
+
+.fa-starship:before {
+  content: "\e039";
+}
+
+.fa-eject:before {
+  content: "\f052";
+}
+
+.fa-arrow-alt-circle-right:before, .fa-circle-right:before {
+  content: "\f35a";
+}
+
+.fa-plane-circle-check:before {
+  content: "\e555";
+}
+
+.fa-seal:before {
+  content: "\e241";
+}
+
+.fa-user-cowboy:before {
+  content: "\f8ea";
+}
+
+.fa-hexagon-vertical-nft:before {
+  content: "\e505";
+}
+
+.fa-face-rolling-eyes:before, .fa-meh-rolling-eyes:before {
+  content: "\f5a5";
+}
+
+.fa-bread-loaf:before {
+  content: "\f7eb";
+}
+
+.fa-rings-wedding:before {
+  content: "\f81b";
+}
+
+.fa-object-group:before {
+  content: "\f247";
+}
+
+.fa-french-fries:before {
+  content: "\f803";
+}
+
+.fa-chart-line:before, .fa-line-chart:before {
+  content: "\f201";
+}
+
+.fa-calendar-arrow-down:before, .fa-calendar-download:before {
+  content: "\e0d0";
+}
+
+.fa-send-back:before {
+  content: "\f87e";
+}
+
+.fa-mask-ventilator:before {
+  content: "\e524";
+}
+
+.fa-tickets:before {
+  content: "\e658";
+}
+
+.fa-signature-lock:before {
+  content: "\e3ca";
+}
+
+.fa-arrow-right:before {
+  content: "\f061";
+}
+
+.fa-map-signs:before, .fa-signs-post:before {
+  content: "\f277";
+}
+
+.fa-octagon-plus:before, .fa-plus-octagon:before {
+  content: "\f301";
+}
+
+.fa-cash-register:before {
+  content: "\f788";
+}
+
+.fa-person-circle-question:before {
+  content: "\e542";
+}
+
+.fa-melon-slice:before {
+  content: "\e311";
+}
+
+.fa-space-station-moon:before {
+  content: "\e033";
+}
+
+.fa-comment-alt-smile:before, .fa-message-smile:before {
+  content: "\f4aa";
+}
+
+.fa-cup-straw:before {
+  content: "\e363";
+}
+
+.fa-arrow-alt-from-right:before, .fa-left-from-line:before {
+  content: "\f348";
+}
+
+.fa-h:before {
+  content: "\48";
+}
+
+.fa-basket-shopping-simple:before, .fa-shopping-basket-alt:before {
+  content: "\e0af";
+}
+
+.fa-hands-heart:before, .fa-hands-holding-heart:before {
+  content: "\f4c3";
+}
+
+.fa-clock-nine:before {
+  content: "\e34c";
+}
+
+.fa-hammer-brush:before {
+  content: "\e620";
+}
+
+.fa-tarp:before {
+  content: "\e57b";
+}
+
+.fa-face-sleepy:before {
+  content: "\e38e";
+}
+
+.fa-hand-horns:before {
+  content: "\e1a9";
+}
+
+.fa-screwdriver-wrench:before, .fa-tools:before {
+  content: "\f7d9";
+}
+
+.fa-arrows-to-eye:before {
+  content: "\e4bf";
+}
+
+.fa-circle-three-quarters:before {
+  content: "\e125";
+}
+
+.fa-trophy-alt:before, .fa-trophy-star:before {
+  content: "\f2eb";
+}
+
+.fa-plug-circle-bolt:before {
+  content: "\e55b";
+}
+
+.fa-face-thermometer:before {
+  content: "\e39a";
+}
+
+.fa-grid-round-4:before {
+  content: "\e5dd";
+}
+
+.fa-sign-posts-wrench:before {
+  content: "\e626";
+}
+
+.fa-shirt-running:before {
+  content: "\e3c8";
+}
+
+.fa-book-circle-arrow-up:before {
+  content: "\e0bd";
+}
+
+.fa-face-nauseated:before {
+  content: "\e381";
+}
+
+.fa-heart:before {
+  content: "\f004";
+}
+
+.fa-file-chart-pie:before {
+  content: "\f65a";
+}
+
+.fa-mars-and-venus:before {
+  content: "\f224";
+}
+
+.fa-home-user:before, .fa-house-user:before {
+  content: "\e1b0";
+}
+
+.fa-circle-arrow-down-left:before {
+  content: "\e0f9";
+}
+
+.fa-dumpster-fire:before {
+  content: "\f794";
+}
+
+.fa-hexagon-minus:before, .fa-minus-hexagon:before {
+  content: "\f307";
+}
+
+.fa-arrow-alt-to-left:before, .fa-left-to-line:before {
+  content: "\f34b";
+}
+
+.fa-house-crack:before {
+  content: "\e3b1";
+}
+
+.fa-paw-alt:before, .fa-paw-simple:before {
+  content: "\f701";
+}
+
+.fa-arrow-left-long-to-line:before {
+  content: "\e3d4";
+}
+
+.fa-brackets-round:before, .fa-parentheses:before {
+  content: "\e0c5";
+}
+
+.fa-cocktail:before, .fa-martini-glass-citrus:before {
+  content: "\f561";
+}
+
+.fa-user-shakespeare:before {
+  content: "\e2c2";
+}
+
+.fa-arrow-right-to-arc:before {
+  content: "\e4b2";
+}
+
+.fa-face-surprise:before, .fa-surprise:before {
+  content: "\f5c2";
+}
+
+.fa-bottle-water:before {
+  content: "\e4c5";
+}
+
+.fa-circle-pause:before, .fa-pause-circle:before {
+  content: "\f28b";
+}
+
+.fa-gauge-circle-plus:before {
+  content: "\e498";
+}
+
+.fa-folders:before {
+  content: "\f660";
+}
+
+.fa-angel:before {
+  content: "\f779";
+}
+
+.fa-value-absolute:before {
+  content: "\f6a6";
+}
+
+.fa-rabbit:before {
+  content: "\f708";
+}
+
+.fa-toilet-paper-slash:before {
+  content: "\e072";
+}
+
+.fa-circle-euro:before {
+  content: "\e5ce";
+}
+
+.fa-apple-alt:before, .fa-apple-whole:before {
+  content: "\f5d1";
+}
+
+.fa-kitchen-set:before {
+  content: "\e51a";
+}
+
+.fa-diamond-half:before {
+  content: "\e5b7";
+}
+
+.fa-lock-alt:before, .fa-lock-keyhole:before {
+  content: "\f30d";
+}
+
+.fa-r:before {
+  content: "\52";
+}
+
+.fa-temperature-1:before, .fa-temperature-quarter:before, .fa-thermometer-1:before, .fa-thermometer-quarter:before {
+  content: "\f2ca";
+}
+
+.fa-info-square:before, .fa-square-info:before {
+  content: "\f30f";
+}
+
+.fa-wifi-slash:before {
+  content: "\f6ac";
+}
+
+.fa-toilet-paper-xmark:before {
+  content: "\e5b3";
+}
+
+.fa-hands-holding-dollar:before, .fa-hands-usd:before {
+  content: "\f4c5";
+}
+
+.fa-cube:before {
+  content: "\f1b2";
+}
+
+.fa-arrow-down-triangle-square:before, .fa-sort-shapes-down:before {
+  content: "\f888";
+}
+
+.fa-bitcoin-sign:before {
+  content: "\e0b4";
+}
+
+.fa-shutters:before {
+  content: "\e449";
+}
+
+.fa-shield-dog:before {
+  content: "\e573";
+}
+
+.fa-solar-panel:before {
+  content: "\f5ba";
+}
+
+.fa-lock-open:before {
+  content: "\f3c1";
+}
+
+.fa-table-tree:before {
+  content: "\e293";
+}
+
+.fa-house-chimney-heart:before {
+  content: "\e1b2";
+}
+
+.fa-tally-3:before {
+  content: "\e296";
+}
+
+.fa-elevator:before {
+  content: "\e16d";
+}
+
+.fa-money-bill-transfer:before {
+  content: "\e528";
+}
+
+.fa-money-bill-trend-up:before {
+  content: "\e529";
+}
+
+.fa-house-flood-water-circle-arrow-right:before {
+  content: "\e50f";
+}
+
+.fa-poll-h:before, .fa-square-poll-horizontal:before {
+  content: "\f682";
+}
+
+.fa-circle:before {
+  content: "\f111";
+}
+
+.fa-left-to-bracket:before {
+  content: "\e66d";
+}
+
+.fa-cart-circle-exclamation:before {
+  content: "\e3f2";
+}
+
+.fa-sword:before {
+  content: "\f71c";
+}
+
+.fa-backward-fast:before, .fa-fast-backward:before {
+  content: "\f049";
+}
+
+.fa-recycle:before {
+  content: "\f1b8";
+}
+
+.fa-user-astronaut:before {
+  content: "\f4fb";
+}
+
+.fa-interrobang:before {
+  content: "\e5ba";
+}
+
+.fa-plane-slash:before {
+  content: "\e069";
+}
+
+.fa-circle-dashed:before {
+  content: "\e105";
+}
+
+.fa-trademark:before {
+  content: "\f25c";
+}
+
+.fa-basketball-ball:before, .fa-basketball:before {
+  content: "\f434";
+}
+
+.fa-fork-knife:before, .fa-utensils-alt:before {
+  content: "\f2e6";
+}
+
+.fa-satellite-dish:before {
+  content: "\f7c0";
+}
+
+.fa-badge-check:before {
+  content: "\f336";
+}
+
+.fa-arrow-alt-circle-up:before, .fa-circle-up:before {
+  content: "\f35b";
+}
+
+.fa-slider:before {
+  content: "\e252";
+}
+
+.fa-mobile-alt:before, .fa-mobile-screen-button:before {
+  content: "\f3cd";
+}
+
+.fa-clock-one-thirty:before {
+  content: "\e34f";
+}
+
+.fa-inbox-arrow-up:before, .fa-inbox-out:before {
+  content: "\f311";
+}
+
+.fa-cloud-slash:before {
+  content: "\e137";
+}
+
+.fa-volume-high:before, .fa-volume-up:before {
+  content: "\f028";
+}
+
+.fa-users-rays:before {
+  content: "\e593";
+}
+
+.fa-wallet:before {
+  content: "\f555";
+}
+
+.fa-octagon-check:before {
+  content: "\e426";
+}
+
+.fa-flatbread-stuffed:before {
+  content: "\e40c";
+}
+
+.fa-clipboard-check:before {
+  content: "\f46c";
+}
+
+.fa-cart-circle-plus:before {
+  content: "\e3f3";
+}
+
+.fa-shipping-timed:before, .fa-truck-clock:before {
+  content: "\f48c";
+}
+
+.fa-pool-8-ball:before {
+  content: "\e3c5";
+}
+
+.fa-file-audio:before {
+  content: "\f1c7";
+}
+
+.fa-turn-down-left:before {
+  content: "\e331";
+}
+
+.fa-lock-hashtag:before {
+  content: "\e423";
+}
+
+.fa-chart-radar:before {
+  content: "\e0e7";
+}
+
+.fa-staff:before {
+  content: "\f71b";
+}
+
+.fa-burger:before, .fa-hamburger:before {
+  content: "\f805";
+}
+
+.fa-utility-pole:before {
+  content: "\e2c3";
+}
+
+.fa-transporter-6:before {
+  content: "\e2a7";
+}
+
+.fa-arrow-turn-left:before {
+  content: "\e632";
+}
+
+.fa-wrench:before {
+  content: "\f0ad";
+}
+
+.fa-bugs:before {
+  content: "\e4d0";
+}
+
+.fa-vector-polygon:before {
+  content: "\e2c7";
+}
+
+.fa-diagram-nested:before {
+  content: "\e157";
+}
+
+.fa-rupee-sign:before, .fa-rupee:before {
+  content: "\f156";
+}
+
+.fa-file-image:before {
+  content: "\f1c5";
+}
+
+.fa-circle-question:before, .fa-question-circle:before {
+  content: "\f059";
+}
+
+.fa-tickets-perforated:before {
+  content: "\e63f";
+}
+
+.fa-image-user:before {
+  content: "\e1b8";
+}
+
+.fa-buoy:before {
+  content: "\e5b5";
+}
+
+.fa-plane-departure:before {
+  content: "\f5b0";
+}
+
+.fa-handshake-slash:before {
+  content: "\e060";
+}
+
+.fa-book-bookmark:before {
+  content: "\e0bb";
+}
+
+.fa-border-center-h:before {
+  content: "\f89c";
+}
+
+.fa-can-food:before {
+  content: "\e3e6";
+}
+
+.fa-typewriter:before {
+  content: "\f8e7";
+}
+
+.fa-arrow-right-from-arc:before {
+  content: "\e4b1";
+}
+
+.fa-circle-k:before {
+  content: "\e113";
+}
+
+.fa-face-hand-over-mouth:before {
+  content: "\e378";
+}
+
+.fa-popcorn:before {
+  content: "\f819";
+}
+
+.fa-house-flood:before, .fa-house-water:before {
+  content: "\f74f";
+}
+
+.fa-object-subtract:before {
+  content: "\e49e";
+}
+
+.fa-code-branch:before {
+  content: "\f126";
+}
+
+.fa-warehouse-alt:before, .fa-warehouse-full:before {
+  content: "\f495";
+}
+
+.fa-hat-cowboy:before {
+  content: "\f8c0";
+}
+
+.fa-bridge:before {
+  content: "\e4c8";
+}
+
+.fa-phone-alt:before, .fa-phone-flip:before {
+  content: "\f879";
+}
+
+.fa-arrow-down-from-dotted-line:before {
+  content: "\e090";
+}
+
+.fa-file-doc:before {
+  content: "\e5ed";
+}
+
+.fa-square-quarters:before {
+  content: "\e44e";
+}
+
+.fa-truck-front:before {
+  content: "\e2b7";
+}
+
+.fa-cat:before {
+  content: "\f6be";
+}
+
+.fa-trash-xmark:before {
+  content: "\e2b4";
+}
+
+.fa-caret-circle-left:before, .fa-circle-caret-left:before {
+  content: "\f32e";
+}
+
+.fa-files:before {
+  content: "\e178";
+}
+
+.fa-anchor-circle-exclamation:before {
+  content: "\e4ab";
+}
+
+.fa-face-clouds:before {
+  content: "\e47d";
+}
+
+.fa-user-crown:before {
+  content: "\f6a4";
+}
+
+.fa-basket-shopping-plus:before {
+  content: "\e653";
+}
+
+.fa-truck-field:before {
+  content: "\e58d";
+}
+
+.fa-route:before {
+  content: "\f4d7";
+}
+
+.fa-cart-circle-check:before {
+  content: "\e3f1";
+}
+
+.fa-clipboard-question:before {
+  content: "\e4e3";
+}
+
+.fa-panorama:before {
+  content: "\e209";
+}
+
+.fa-comment-medical:before {
+  content: "\f7f5";
+}
+
+.fa-teeth-open:before {
+  content: "\f62f";
+}
+
+.fa-user-tie-hair-long:before {
+  content: "\e460";
+}
+
+.fa-file-circle-minus:before {
+  content: "\e4ed";
+}
+
+.fa-head-side-medical:before {
+  content: "\f809";
+}
+
+.fa-arrow-turn-right:before {
+  content: "\e635";
+}
+
+.fa-tags:before {
+  content: "\f02c";
+}
+
+.fa-wine-glass:before {
+  content: "\f4e3";
+}
+
+.fa-fast-forward:before, .fa-forward-fast:before {
+  content: "\f050";
+}
+
+.fa-face-meh-blank:before, .fa-meh-blank:before {
+  content: "\f5a4";
+}
+
+.fa-user-robot:before {
+  content: "\e04b";
+}
+
+.fa-parking:before, .fa-square-parking:before {
+  content: "\f540";
+}
+
+.fa-card-diamond:before {
+  content: "\e3ea";
+}
+
+.fa-face-zipper:before {
+  content: "\e3a5";
+}
+
+.fa-face-raised-eyebrow:before {
+  content: "\e388";
+}
+
+.fa-house-signal:before {
+  content: "\e012";
+}
+
+.fa-chevron-square-up:before, .fa-square-chevron-up:before {
+  content: "\f32c";
+}
+
+.fa-bars-progress:before, .fa-tasks-alt:before {
+  content: "\f828";
+}
+
+.fa-faucet-drip:before {
+  content: "\e006";
+}
+
+.fa-arrows-to-line:before {
+  content: "\e0a7";
+}
+
+.fa-dolphin:before {
+  content: "\e168";
+}
+
+.fa-arrow-up-right:before {
+  content: "\e09f";
+}
+
+.fa-circle-r:before {
+  content: "\e120";
+}
+
+.fa-cart-flatbed:before, .fa-dolly-flatbed:before {
+  content: "\f474";
+}
+
+.fa-ban-smoking:before, .fa-smoking-ban:before {
+  content: "\f54d";
+}
+
+.fa-circle-sort-up:before, .fa-sort-circle-up:before {
+  content: "\e032";
+}
+
+.fa-terminal:before {
+  content: "\f120";
+}
+
+.fa-mobile-button:before {
+  content: "\f10b";
+}
+
+.fa-house-medical-flag:before {
+  content: "\e514";
+}
+
+.fa-basket-shopping:before, .fa-shopping-basket:before {
+  content: "\f291";
+}
+
+.fa-tape:before {
+  content: "\f4db";
+}
+
+.fa-chestnut:before {
+  content: "\e3f6";
+}
+
+.fa-bus-alt:before, .fa-bus-simple:before {
+  content: "\f55e";
+}
+
+.fa-eye:before {
+  content: "\f06e";
+}
+
+.fa-face-sad-cry:before, .fa-sad-cry:before {
+  content: "\f5b3";
+}
+
+.fa-heat:before {
+  content: "\e00c";
+}
+
+.fa-ticket-airline:before, .fa-ticket-perforated-plane:before, .fa-ticket-plane:before {
+  content: "\e29a";
+}
+
+.fa-boot-heeled:before {
+  content: "\e33f";
+}
+
+.fa-arrows-minimize:before, .fa-compress-arrows:before {
+  content: "\e0a5";
+}
+
+.fa-audio-description:before {
+  content: "\f29e";
+}
+
+.fa-person-military-to-person:before {
+  content: "\e54c";
+}
+
+.fa-file-shield:before {
+  content: "\e4f0";
+}
+
+.fa-hexagon:before {
+  content: "\f312";
+}
+
+.fa-manhole:before {
+  content: "\e1d6";
+}
+
+.fa-user-slash:before {
+  content: "\f506";
+}
+
+.fa-pen:before {
+  content: "\f304";
+}
+
+.fa-tower-observation:before {
+  content: "\e586";
+}
+
+.fa-floppy-disks:before {
+  content: "\e183";
+}
+
+.fa-toilet-paper-blank-under:before, .fa-toilet-paper-reverse-alt:before {
+  content: "\e29f";
+}
+
+.fa-file-code:before {
+  content: "\f1c9";
+}
+
+.fa-signal-5:before, .fa-signal-perfect:before, .fa-signal:before {
+  content: "\f012";
+}
+
+.fa-pump:before {
+  content: "\e442";
+}
+
+.fa-bus:before {
+  content: "\f207";
+}
+
+.fa-heart-circle-xmark:before {
+  content: "\e501";
+}
+
+.fa-arrow-up-left-from-circle:before {
+  content: "\e09e";
+}
+
+.fa-home-lg:before, .fa-house-chimney:before {
+  content: "\e3af";
+}
+
+.fa-window-maximize:before {
+  content: "\f2d0";
+}
+
+.fa-dryer:before {
+  content: "\f861";
+}
+
+.fa-face-frown:before, .fa-frown:before {
+  content: "\f119";
+}
+
+.fa-chess-bishop-alt:before, .fa-chess-bishop-piece:before {
+  content: "\f43b";
+}
+
+.fa-shirt-tank-top:before {
+  content: "\e3c9";
+}
+
+.fa-diploma:before, .fa-scroll-ribbon:before {
+  content: "\f5ea";
+}
+
+.fa-screencast:before {
+  content: "\e23e";
+}
+
+.fa-walker:before {
+  content: "\f831";
+}
+
+.fa-prescription:before {
+  content: "\f5b1";
+}
+
+.fa-shop:before, .fa-store-alt:before {
+  content: "\f54f";
+}
+
+.fa-floppy-disk:before, .fa-save:before {
+  content: "\f0c7";
+}
+
+.fa-vihara:before {
+  content: "\f6a7";
+}
+
+.fa-face-kiss-closed-eyes:before {
+  content: "\e37d";
+}
+
+.fa-balance-scale-left:before, .fa-scale-unbalanced:before {
+  content: "\f515";
+}
+
+.fa-file-user:before {
+  content: "\f65c";
+}
+
+.fa-user-police-tie:before {
+  content: "\e334";
+}
+
+.fa-face-tongue-money:before {
+  content: "\e39d";
+}
+
+.fa-tennis-ball:before {
+  content: "\f45e";
+}
+
+.fa-square-l:before {
+  content: "\e275";
+}
+
+.fa-sort-asc:before, .fa-sort-up:before {
+  content: "\f0de";
+}
+
+.fa-calendar-arrow-up:before, .fa-calendar-upload:before {
+  content: "\e0d1";
+}
+
+.fa-comment-dots:before, .fa-commenting:before {
+  content: "\f4ad";
+}
+
+.fa-plant-wilt:before {
+  content: "\e5aa";
+}
+
+.fa-scarf:before {
+  content: "\f7c1";
+}
+
+.fa-album-circle-plus:before {
+  content: "\e48c";
+}
+
+.fa-user-nurse-hair-long:before {
+  content: "\e45e";
+}
+
+.fa-diamond:before {
+  content: "\f219";
+}
+
+.fa-arrow-alt-square-left:before, .fa-square-left:before {
+  content: "\f351";
+}
+
+.fa-face-grin-squint:before, .fa-grin-squint:before {
+  content: "\f585";
+}
+
+.fa-circle-ellipsis-vertical:before {
+  content: "\e10b";
+}
+
+.fa-hand-holding-dollar:before, .fa-hand-holding-usd:before {
+  content: "\f4c0";
+}
+
+.fa-grid-dividers:before {
+  content: "\e3ad";
+}
+
+.fa-bacterium:before {
+  content: "\e05a";
+}
+
+.fa-hand-pointer:before {
+  content: "\f25a";
+}
+
+.fa-drum-steelpan:before {
+  content: "\f56a";
+}
+
+.fa-hand-scissors:before {
+  content: "\f257";
+}
+
+.fa-hands-praying:before, .fa-praying-hands:before {
+  content: "\f684";
+}
+
+.fa-face-pensive:before {
+  content: "\e384";
+}
+
+.fa-user-music:before {
+  content: "\f8eb";
+}
+
+.fa-arrow-right-rotate:before, .fa-arrow-rotate-forward:before, .fa-arrow-rotate-right:before, .fa-redo:before {
+  content: "\f01e";
+}
+
+.fa-comments-alt-dollar:before, .fa-messages-dollar:before {
+  content: "\f652";
+}
+
+.fa-sensor-on:before {
+  content: "\e02b";
+}
+
+.fa-balloon:before {
+  content: "\e2e3";
+}
+
+.fa-biohazard:before {
+  content: "\f780";
+}
+
+.fa-chess-queen-alt:before, .fa-chess-queen-piece:before {
+  content: "\f446";
+}
+
+.fa-location-crosshairs:before, .fa-location:before {
+  content: "\f601";
+}
+
+.fa-mars-double:before {
+  content: "\f227";
+}
+
+.fa-left-from-bracket:before {
+  content: "\e66c";
+}
+
+.fa-house-leave:before, .fa-house-person-depart:before, .fa-house-person-leave:before {
+  content: "\e00f";
+}
+
+.fa-ruler-triangle:before {
+  content: "\f61c";
+}
+
+.fa-card-club:before {
+  content: "\e3e9";
+}
+
+.fa-child-dress:before {
+  content: "\e59c";
+}
+
+.fa-users-between-lines:before {
+  content: "\e591";
+}
+
+.fa-lungs-virus:before {
+  content: "\e067";
+}
+
+.fa-spinner-third:before {
+  content: "\f3f4";
+}
+
+.fa-face-grin-tears:before, .fa-grin-tears:before {
+  content: "\f588";
+}
+
+.fa-phone:before {
+  content: "\f095";
+}
+
+.fa-computer-mouse-scrollwheel:before, .fa-mouse-alt:before {
+  content: "\f8cd";
+}
+
+.fa-calendar-times:before, .fa-calendar-xmark:before {
+  content: "\f273";
+}
+
+.fa-child-reaching:before {
+  content: "\e59d";
+}
+
+.fa-table-layout:before {
+  content: "\e290";
+}
+
+.fa-narwhal:before {
+  content: "\f6fe";
+}
+
+.fa-ramp-loading:before {
+  content: "\f4d4";
+}
+
+.fa-calendar-circle-plus:before {
+  content: "\e470";
+}
+
+.fa-toothbrush:before {
+  content: "\f635";
+}
+
+.fa-border-inner:before {
+  content: "\f84e";
+}
+
+.fa-paw-claws:before {
+  content: "\f702";
+}
+
+.fa-kiwi-fruit:before {
+  content: "\e30c";
+}
+
+.fa-traffic-light-slow:before {
+  content: "\f639";
+}
+
+.fa-rectangle-code:before {
+  content: "\e322";
+}
+
+.fa-head-side-virus:before {
+  content: "\e064";
+}
+
+.fa-keyboard-brightness:before {
+  content: "\e1c0";
+}
+
+.fa-books-medical:before {
+  content: "\f7e8";
+}
+
+.fa-lightbulb-slash:before {
+  content: "\f673";
+}
+
+.fa-home-blank:before, .fa-house-blank:before {
+  content: "\e487";
+}
+
+.fa-square-5:before {
+  content: "\e25a";
+}
+
+.fa-heart-square:before, .fa-square-heart:before {
+  content: "\f4c8";
+}
+
+.fa-puzzle:before {
+  content: "\e443";
+}
+
+.fa-user-cog:before, .fa-user-gear:before {
+  content: "\f4fe";
+}
+
+.fa-pipe-circle-check:before {
+  content: "\e436";
+}
+
+.fa-arrow-up-1-9:before, .fa-sort-numeric-up:before {
+  content: "\f163";
+}
+
+.fa-octagon-exclamation:before {
+  content: "\e204";
+}
+
+.fa-dial-low:before {
+  content: "\e15d";
+}
+
+.fa-door-closed:before {
+  content: "\f52a";
+}
+
+.fa-laptop-mobile:before, .fa-phone-laptop:before {
+  content: "\f87a";
+}
+
+.fa-conveyor-belt-alt:before, .fa-conveyor-belt-boxes:before {
+  content: "\f46f";
+}
+
+.fa-shield-virus:before {
+  content: "\e06c";
+}
+
+.fa-starfighter-alt-advanced:before, .fa-starfighter-twin-ion-engine-advanced:before {
+  content: "\e28e";
+}
+
+.fa-dice-six:before {
+  content: "\f526";
+}
+
+.fa-starfighter-alt:before, .fa-starfighter-twin-ion-engine:before {
+  content: "\e038";
+}
+
+.fa-rocket-launch:before {
+  content: "\e027";
+}
+
+.fa-mosquito-net:before {
+  content: "\e52c";
+}
+
+.fa-vent-damper:before {
+  content: "\e465";
+}
+
+.fa-bridge-water:before {
+  content: "\e4ce";
+}
+
+.fa-ban-bug:before, .fa-debug:before {
+  content: "\f7f9";
+}
+
+.fa-person-booth:before {
+  content: "\f756";
+}
+
+.fa-text-width:before {
+  content: "\f035";
+}
+
+.fa-garage-car:before {
+  content: "\e00a";
+}
+
+.fa-square-kanban:before {
+  content: "\e488";
+}
+
+.fa-hat-wizard:before {
+  content: "\f6e8";
+}
+
+.fa-chart-kanban:before {
+  content: "\e64f";
+}
+
+.fa-pen-fancy:before {
+  content: "\f5ac";
+}
+
+.fa-coffee-pot:before {
+  content: "\e002";
+}
+
+.fa-mouse-field:before {
+  content: "\e5a8";
+}
+
+.fa-digging:before, .fa-person-digging:before {
+  content: "\f85e";
+}
+
+.fa-shower-alt:before, .fa-shower-down:before {
+  content: "\e24d";
+}
+
+.fa-box-circle-check:before {
+  content: "\e0c4";
+}
+
+.fa-brightness:before {
+  content: "\e0c9";
+}
+
+.fa-car-side-bolt:before {
+  content: "\e344";
+}
+
+.fa-file-xml:before {
+  content: "\e654";
+}
+
+.fa-ornament:before {
+  content: "\f7b8";
+}
+
+.fa-phone-arrow-down-left:before, .fa-phone-arrow-down:before, .fa-phone-incoming:before {
+  content: "\e223";
+}
+
+.fa-cloud-word:before {
+  content: "\e138";
+}
+
+.fa-hand-fingers-crossed:before {
+  content: "\e1a3";
+}
+
+.fa-trash:before {
+  content: "\f1f8";
+}
+
+.fa-gauge-simple-med:before, .fa-gauge-simple:before, .fa-tachometer-average:before {
+  content: "\f629";
+}
+
+.fa-arrow-down-small-big:before, .fa-sort-size-down-alt:before {
+  content: "\f88d";
+}
+
+.fa-book-medical:before {
+  content: "\f7e6";
+}
+
+.fa-face-melting:before {
+  content: "\e483";
+}
+
+.fa-poo:before {
+  content: "\f2fe";
+}
+
+.fa-pen-alt-slash:before, .fa-pen-clip-slash:before {
+  content: "\e20f";
+}
+
+.fa-quote-right-alt:before, .fa-quote-right:before {
+  content: "\f10e";
+}
+
+.fa-scroll-old:before {
+  content: "\f70f";
+}
+
+.fa-guitars:before {
+  content: "\f8bf";
+}
+
+.fa-phone-xmark:before {
+  content: "\e227";
+}
+
+.fa-hose:before {
+  content: "\e419";
+}
+
+.fa-clock-six:before {
+  content: "\e352";
+}
+
+.fa-shirt:before, .fa-t-shirt:before, .fa-tshirt:before {
+  content: "\f553";
+}
+
+.fa-billboard:before {
+  content: "\e5cd";
+}
+
+.fa-square-r:before {
+  content: "\e27c";
+}
+
+.fa-cubes:before {
+  content: "\f1b3";
+}
+
+.fa-envelope-open-dollar:before {
+  content: "\f657";
+}
+
+.fa-divide:before {
+  content: "\f529";
+}
+
+.fa-sun-cloud:before {
+  content: "\f763";
+}
+
+.fa-lamp-floor:before {
+  content: "\e015";
+}
+
+.fa-square-7:before {
+  content: "\e25c";
+}
+
+.fa-tenge-sign:before, .fa-tenge:before {
+  content: "\f7d7";
+}
+
+.fa-headphones:before {
+  content: "\f025";
+}
+
+.fa-hands-holding:before {
+  content: "\f4c2";
+}
+
+.fa-campfire:before {
+  content: "\f6ba";
+}
+
+.fa-circle-ampersand:before {
+  content: "\e0f8";
+}
+
+.fa-snowflakes:before {
+  content: "\f7cf";
+}
+
+.fa-hands-clapping:before {
+  content: "\e1a8";
+}
+
+.fa-republican:before {
+  content: "\f75e";
+}
+
+.fa-leaf-maple:before {
+  content: "\f6f6";
+}
+
+.fa-arrow-left:before {
+  content: "\f060";
+}
+
+.fa-person-circle-xmark:before {
+  content: "\e543";
+}
+
+.fa-ruler:before {
+  content: "\f545";
+}
+
+.fa-arrow-left-from-bracket:before {
+  content: "\e668";
+}
+
+.fa-cup-straw-swoosh:before {
+  content: "\e364";
+}
+
+.fa-temperature-hot:before, .fa-temperature-sun:before {
+  content: "\f76a";
+}
+
+.fa-align-left:before {
+  content: "\f036";
+}
+
+.fa-dice-d6:before {
+  content: "\f6d1";
+}
+
+.fa-restroom:before {
+  content: "\f7bd";
+}
+
+.fa-high-definition:before, .fa-rectangle-hd:before {
+  content: "\e1ae";
+}
+
+.fa-j:before {
+  content: "\4a";
+}
+
+.fa-galaxy:before {
+  content: "\e008";
+}
+
+.fa-users-viewfinder:before {
+  content: "\e595";
+}
+
+.fa-file-video:before {
+  content: "\f1c8";
+}
+
+.fa-cherries:before {
+  content: "\e0ec";
+}
+
+.fa-external-link-alt:before, .fa-up-right-from-square:before {
+  content: "\f35d";
+}
+
+.fa-circle-sort:before, .fa-sort-circle:before {
+  content: "\e030";
+}
+
+.fa-table-cells:before, .fa-th:before {
+  content: "\f00a";
+}
+
+.fa-bag-shopping-minus:before {
+  content: "\e650";
+}
+
+.fa-file-pdf:before {
+  content: "\f1c1";
+}
+
+.fa-siren:before {
+  content: "\e02d";
+}
+
+.fa-arrow-up-to-dotted-line:before {
+  content: "\e0a1";
+}
+
+.fa-image-landscape:before, .fa-landscape:before {
+  content: "\e1b5";
+}
+
+.fa-tank-water:before {
+  content: "\e452";
+}
+
+.fa-curling-stone:before, .fa-curling:before {
+  content: "\f44a";
+}
+
+.fa-gamepad-alt:before, .fa-gamepad-modern:before {
+  content: "\e5a2";
+}
+
+.fa-messages-question:before {
+  content: "\e1e7";
+}
+
+.fa-bible:before, .fa-book-bible:before {
+  content: "\f647";
+}
+
+.fa-o:before {
+  content: "\4f";
+}
+
+.fa-medkit:before, .fa-suitcase-medical:before {
+  content: "\f0fa";
+}
+
+.fa-briefcase-arrow-right:before {
+  content: "\e2f2";
+}
+
+.fa-expand-wide:before {
+  content: "\f320";
+}
+
+.fa-clock-eleven-thirty:before {
+  content: "\e348";
+}
+
+.fa-rv:before {
+  content: "\f7be";
+}
+
+.fa-user-secret:before {
+  content: "\f21b";
+}
+
+.fa-otter:before {
+  content: "\f700";
+}
+
+.fa-dreidel:before {
+  content: "\f792";
+}
+
+.fa-female:before, .fa-person-dress:before {
+  content: "\f182";
+}
+
+.fa-comment-dollar:before {
+  content: "\f651";
+}
+
+.fa-briefcase-clock:before, .fa-business-time:before {
+  content: "\f64a";
+}
+
+.fa-flower-tulip:before {
+  content: "\f801";
+}
+
+.fa-people-pants-simple:before {
+  content: "\e21a";
+}
+
+.fa-cloud-drizzle:before {
+  content: "\f738";
+}
+
+.fa-table-cells-large:before, .fa-th-large:before {
+  content: "\f009";
+}
+
+.fa-book-tanakh:before, .fa-tanakh:before {
+  content: "\f827";
+}
+
+.fa-solar-system:before {
+  content: "\e02f";
+}
+
+.fa-seal-question:before {
+  content: "\e243";
+}
+
+.fa-phone-volume:before, .fa-volume-control-phone:before {
+  content: "\f2a0";
+}
+
+.fa-disc-drive:before {
+  content: "\f8b5";
+}
+
+.fa-hat-cowboy-side:before {
+  content: "\f8c1";
+}
+
+.fa-rows:before, .fa-table-rows:before {
+  content: "\e292";
+}
+
+.fa-location-exclamation:before, .fa-map-marker-exclamation:before {
+  content: "\f608";
+}
+
+.fa-face-fearful:before {
+  content: "\e375";
+}
+
+.fa-clipboard-user:before {
+  content: "\f7f3";
+}
+
+.fa-bus-school:before {
+  content: "\f5dd";
+}
+
+.fa-film-slash:before {
+  content: "\e179";
+}
+
+.fa-square-arrow-down-right:before {
+  content: "\e262";
+}
+
+.fa-book-sparkles:before, .fa-book-spells:before {
+  content: "\f6b8";
+}
+
+.fa-washer:before, .fa-washing-machine:before {
+  content: "\f898";
+}
+
+.fa-child:before {
+  content: "\f1ae";
+}
+
+.fa-lira-sign:before {
+  content: "\f195";
+}
+
+.fa-user-visor:before {
+  content: "\e04c";
+}
+
+.fa-file-plus-minus:before {
+  content: "\e177";
+}
+
+.fa-chess-clock-alt:before, .fa-chess-clock-flip:before {
+  content: "\f43e";
+}
+
+.fa-satellite:before {
+  content: "\f7bf";
+}
+
+.fa-truck-fire:before {
+  content: "\e65a";
+}
+
+.fa-plane-lock:before {
+  content: "\e558";
+}
+
+.fa-steering-wheel:before {
+  content: "\f622";
+}
+
+.fa-tag:before {
+  content: "\f02b";
+}
+
+.fa-stretcher:before {
+  content: "\f825";
+}
+
+.fa-book-law:before, .fa-book-section:before {
+  content: "\e0c1";
+}
+
+.fa-inboxes:before {
+  content: "\e1bb";
+}
+
+.fa-coffee-bean:before {
+  content: "\e13e";
+}
+
+.fa-circle-yen:before {
+  content: "\e5d0";
+}
+
+.fa-brackets-curly:before {
+  content: "\f7ea";
+}
+
+.fa-ellipsis-stroke-vertical:before, .fa-ellipsis-v-alt:before {
+  content: "\f39c";
+}
+
+.fa-comment:before {
+  content: "\f075";
+}
+
+.fa-square-1:before {
+  content: "\e256";
+}
+
+.fa-birthday-cake:before, .fa-cake-candles:before, .fa-cake:before {
+  content: "\f1fd";
+}
+
+.fa-head-side:before {
+  content: "\f6e9";
+}
+
+.fa-truck-ladder:before {
+  content: "\e657";
+}
+
+.fa-envelope:before {
+  content: "\f0e0";
+}
+
+.fa-dolly-empty:before {
+  content: "\f473";
+}
+
+.fa-face-tissue:before {
+  content: "\e39c";
+}
+
+.fa-angle-double-up:before, .fa-angles-up:before {
+  content: "\f102";
+}
+
+.fa-bin-recycle:before {
+  content: "\e5f7";
+}
+
+.fa-paperclip:before {
+  content: "\f0c6";
+}
+
+.fa-chart-line-down:before {
+  content: "\f64d";
+}
+
+.fa-arrow-right-to-city:before {
+  content: "\e4b3";
+}
+
+.fa-lock-a:before {
+  content: "\e422";
+}
+
+.fa-ribbon:before {
+  content: "\f4d6";
+}
+
+.fa-lungs:before {
+  content: "\f604";
+}
+
+.fa-person-pinball:before {
+  content: "\e21d";
+}
+
+.fa-arrow-up-9-1:before, .fa-sort-numeric-up-alt:before {
+  content: "\f887";
+}
+
+.fa-apple-core:before {
+  content: "\e08f";
+}
+
+.fa-circle-y:before {
+  content: "\e12f";
+}
+
+.fa-h6:before {
+  content: "\e413";
+}
+
+.fa-litecoin-sign:before {
+  content: "\e1d3";
+}
+
+.fa-bottle-baby:before {
+  content: "\e673";
+}
+
+.fa-circle-small:before {
+  content: "\e122";
+}
+
+.fa-border-none:before {
+  content: "\f850";
+}
+
+.fa-arrow-turn-down-left:before {
+  content: "\e2e1";
+}
+
+.fa-circle-wifi-circle-wifi:before, .fa-circle-wifi-group:before {
+  content: "\e67e";
+}
+
+.fa-circle-nodes:before {
+  content: "\e4e2";
+}
+
+.fa-parachute-box:before {
+  content: "\f4cd";
+}
+
+.fa-reflect-horizontal:before {
+  content: "\e664";
+}
+
+.fa-comment-alt-medical:before, .fa-message-medical:before {
+  content: "\f7f4";
+}
+
+.fa-rugby-ball:before {
+  content: "\e3c6";
+}
+
+.fa-comment-music:before {
+  content: "\f8b0";
+}
+
+.fa-indent:before {
+  content: "\f03c";
+}
+
+.fa-tree-alt:before, .fa-tree-deciduous:before {
+  content: "\f400";
+}
+
+.fa-puzzle-piece-alt:before, .fa-puzzle-piece-simple:before {
+  content: "\e231";
+}
+
+.fa-truck-field-un:before {
+  content: "\e58e";
+}
+
+.fa-nfc-trash:before {
+  content: "\e1fd";
+}
+
+.fa-hourglass-empty:before, .fa-hourglass:before {
+  content: "\f254";
+}
+
+.fa-mountain:before {
+  content: "\f6fc";
+}
+
+.fa-file-times:before, .fa-file-xmark:before {
+  content: "\f317";
+}
+
+.fa-home-heart:before, .fa-house-heart:before {
+  content: "\f4c9";
+}
+
+.fa-house-chimney-blank:before {
+  content: "\e3b0";
+}
+
+.fa-meter-bolt:before {
+  content: "\e1e9";
+}
+
+.fa-user-doctor:before, .fa-user-md:before {
+  content: "\f0f0";
+}
+
+.fa-slash-back:before {
+  content: "\5c";
+}
+
+.fa-circle-info:before, .fa-info-circle:before {
+  content: "\f05a";
+}
+
+.fa-fishing-rod:before {
+  content: "\e3a8";
+}
+
+.fa-hammer-crash:before {
+  content: "\e414";
+}
+
+.fa-message-heart:before {
+  content: "\e5c9";
+}
+
+.fa-cloud-meatball:before {
+  content: "\f73b";
+}
+
+.fa-camera-polaroid:before {
+  content: "\f8aa";
+}
+
+.fa-camera-alt:before, .fa-camera:before {
+  content: "\f030";
+}
+
+.fa-square-virus:before {
+  content: "\e578";
+}
+
+.fa-cart-arrow-up:before {
+  content: "\e3ee";
+}
+
+.fa-meteor:before {
+  content: "\f753";
+}
+
+.fa-car-on:before {
+  content: "\e4dd";
+}
+
+.fa-sleigh:before {
+  content: "\f7cc";
+}
+
+.fa-arrow-down-1-9:before, .fa-sort-numeric-asc:before, .fa-sort-numeric-down:before {
+  content: "\f162";
+}
+
+.fa-buoy-mooring:before {
+  content: "\e5b6";
+}
+
+.fa-square-4:before {
+  content: "\e259";
+}
+
+.fa-hand-holding-droplet:before, .fa-hand-holding-water:before {
+  content: "\f4c1";
+}
+
+.fa-file-eps:before {
+  content: "\e644";
+}
+
+.fa-tricycle-adult:before {
+  content: "\e5c4";
+}
+
+.fa-waveform:before {
+  content: "\f8f1";
+}
+
+.fa-water:before {
+  content: "\f773";
+}
+
+.fa-star-sharp-half-alt:before, .fa-star-sharp-half-stroke:before {
+  content: "\e28d";
+}
+
+.fa-nfc-signal:before {
+  content: "\e1fb";
+}
+
+.fa-plane-prop:before {
+  content: "\e22b";
+}
+
+.fa-calendar-check:before {
+  content: "\f274";
+}
+
+.fa-clock-desk:before {
+  content: "\e134";
+}
+
+.fa-calendar-clock:before, .fa-calendar-time:before {
+  content: "\e0d2";
+}
+
+.fa-braille:before {
+  content: "\f2a1";
+}
+
+.fa-prescription-bottle-alt:before, .fa-prescription-bottle-medical:before {
+  content: "\f486";
+}
+
+.fa-plate-utensils:before {
+  content: "\e43b";
+}
+
+.fa-family-pants:before {
+  content: "\e302";
+}
+
+.fa-hose-reel:before {
+  content: "\e41a";
+}
+
+.fa-house-window:before {
+  content: "\e3b3";
+}
+
+.fa-landmark:before {
+  content: "\f66f";
+}
+
+.fa-truck:before {
+  content: "\f0d1";
+}
+
+.fa-music-magnifying-glass:before {
+  content: "\e662";
+}
+
+.fa-crosshairs:before {
+  content: "\f05b";
+}
+
+.fa-cloud-rainbow:before {
+  content: "\f73e";
+}
+
+.fa-person-cane:before {
+  content: "\e53c";
+}
+
+.fa-alien:before {
+  content: "\f8f5";
+}
+
+.fa-tent:before {
+  content: "\e57d";
+}
+
+.fa-laptop-binary:before {
+  content: "\e5e7";
+}
+
+.fa-vest-patches:before {
+  content: "\e086";
+}
+
+.fa-people-dress-simple:before {
+  content: "\e218";
+}
+
+.fa-check-double:before {
+  content: "\f560";
+}
+
+.fa-arrow-down-a-z:before, .fa-sort-alpha-asc:before, .fa-sort-alpha-down:before {
+  content: "\f15d";
+}
+
+.fa-bowling-ball-pin:before {
+  content: "\e0c3";
+}
+
+.fa-bell-school-slash:before {
+  content: "\f5d6";
+}
+
+.fa-plus-large:before {
+  content: "\e59e";
+}
+
+.fa-money-bill-wheat:before {
+  content: "\e52a";
+}
+
+.fa-camera-viewfinder:before, .fa-screenshot:before {
+  content: "\e0da";
+}
+
+.fa-comment-alt-music:before, .fa-message-music:before {
+  content: "\f8af";
+}
+
+.fa-car-building:before {
+  content: "\f859";
+}
+
+.fa-border-bottom-right:before, .fa-border-style-alt:before {
+  content: "\f854";
+}
+
+.fa-octagon:before {
+  content: "\f306";
+}
+
+.fa-comment-arrow-up-right:before {
+  content: "\e145";
+}
+
+.fa-octagon-divide:before {
+  content: "\e203";
+}
+
+.fa-cookie:before {
+  content: "\f563";
+}
+
+.fa-arrow-left-rotate:before, .fa-arrow-rotate-back:before, .fa-arrow-rotate-backward:before, .fa-arrow-rotate-left:before, .fa-undo:before {
+  content: "\f0e2";
+}
+
+.fa-tv-music:before {
+  content: "\f8e6";
+}
+
+.fa-hard-drive:before, .fa-hdd:before {
+  content: "\f0a0";
+}
+
+.fa-reel:before {
+  content: "\e238";
+}
+
+.fa-face-grin-squint-tears:before, .fa-grin-squint-tears:before {
+  content: "\f586";
+}
+
+.fa-dumbbell:before {
+  content: "\f44b";
+}
+
+.fa-list-alt:before, .fa-rectangle-list:before {
+  content: "\f022";
+}
+
+.fa-tarp-droplet:before {
+  content: "\e57c";
+}
+
+.fa-alarm-exclamation:before {
+  content: "\f843";
+}
+
+.fa-house-medical-circle-check:before {
+  content: "\e511";
+}
+
+.fa-traffic-cone:before {
+  content: "\f636";
+}
+
+.fa-grate:before {
+  content: "\e193";
+}
+
+.fa-arrow-down-right:before {
+  content: "\e093";
+}
+
+.fa-person-skiing-nordic:before, .fa-skiing-nordic:before {
+  content: "\f7ca";
+}
+
+.fa-calendar-plus:before {
+  content: "\f271";
+}
+
+.fa-person-from-portal:before, .fa-portal-exit:before {
+  content: "\e023";
+}
+
+.fa-plane-arrival:before {
+  content: "\f5af";
+}
+
+.fa-cowbell-circle-plus:before, .fa-cowbell-more:before {
+  content: "\f8b4";
+}
+
+.fa-arrow-alt-circle-left:before, .fa-circle-left:before {
+  content: "\f359";
+}
+
+.fa-distribute-spacing-vertical:before {
+  content: "\e366";
+}
+
+.fa-signal-alt-2:before, .fa-signal-bars-fair:before {
+  content: "\f692";
+}
+
+.fa-sportsball:before {
+  content: "\e44b";
+}
+
+.fa-game-console-handheld-crank:before {
+  content: "\e5b9";
+}
+
+.fa-subway:before, .fa-train-subway:before {
+  content: "\f239";
+}
+
+.fa-chart-gantt:before {
+  content: "\e0e4";
+}
+
+.fa-face-smile-upside-down:before {
+  content: "\e395";
+}
+
+.fa-ball-pile:before {
+  content: "\f77e";
+}
+
+.fa-badge-dollar:before {
+  content: "\f645";
+}
+
+.fa-money-bills-alt:before, .fa-money-bills-simple:before {
+  content: "\e1f4";
+}
+
+.fa-list-timeline:before {
+  content: "\e1d1";
+}
+
+.fa-indian-rupee-sign:before, .fa-indian-rupee:before, .fa-inr:before {
+  content: "\e1bc";
+}
+
+.fa-crop-alt:before, .fa-crop-simple:before {
+  content: "\f565";
+}
+
+.fa-money-bill-1:before, .fa-money-bill-alt:before {
+  content: "\f3d1";
+}
+
+.fa-left-long:before, .fa-long-arrow-alt-left:before {
+  content: "\f30a";
+}
+
+.fa-keyboard-down:before {
+  content: "\e1c2";
+}
+
+.fa-circle-up-right:before {
+  content: "\e129";
+}
+
+.fa-cloud-bolt-moon:before, .fa-thunderstorm-moon:before {
+  content: "\f76d";
+}
+
+.fa-turn-left-up:before {
+  content: "\e638";
+}
+
+.fa-dna:before {
+  content: "\f471";
+}
+
+.fa-virus-slash:before {
+  content: "\e075";
+}
+
+.fa-bracket-round-right:before {
+  content: "\29";
+}
+
+.fa-circle-sterling:before {
+  content: "\e5cf";
+}
+
+.fa-circle-5:before {
+  content: "\e0f2";
+}
+
+.fa-minus:before, .fa-subtract:before {
+  content: "\f068";
+}
+
+.fa-fire-flame:before, .fa-flame:before {
+  content: "\f6df";
+}
+
+.fa-arrow-alt-to-right:before, .fa-right-to-line:before {
+  content: "\f34c";
+}
+
+.fa-gif:before {
+  content: "\e190";
+}
+
+.fa-chess:before {
+  content: "\f439";
+}
+
+.fa-trash-slash:before {
+  content: "\e2b3";
+}
+
+.fa-arrow-left-long:before, .fa-long-arrow-left:before {
+  content: "\f177";
+}
+
+.fa-plug-circle-check:before {
+  content: "\e55c";
+}
+
+.fa-font-case:before {
+  content: "\f866";
+}
+
+.fa-street-view:before {
+  content: "\f21d";
+}
+
+.fa-arrow-down-left:before {
+  content: "\e091";
+}
+
+.fa-franc-sign:before {
+  content: "\e18f";
+}
+
+.fa-flask-poison:before, .fa-flask-round-poison:before {
+  content: "\f6e0";
+}
+
+.fa-volume-off:before {
+  content: "\f026";
+}
+
+.fa-book-circle-arrow-right:before {
+  content: "\e0bc";
+}
+
+.fa-chart-user:before, .fa-user-chart:before {
+  content: "\f6a3";
+}
+
+.fa-american-sign-language-interpreting:before, .fa-asl-interpreting:before, .fa-hands-american-sign-language-interpreting:before, .fa-hands-asl-interpreting:before {
+  content: "\f2a3";
+}
+
+.fa-presentation-screen:before, .fa-presentation:before {
+  content: "\f685";
+}
+
+.fa-circle-bolt:before {
+  content: "\e0fe";
+}
+
+.fa-face-smile-halo:before {
+  content: "\e38f";
+}
+
+.fa-cart-circle-arrow-down:before {
+  content: "\e3ef";
+}
+
+.fa-house-person-arrive:before, .fa-house-person-return:before, .fa-house-return:before {
+  content: "\e011";
+}
+
+.fa-comment-alt-times:before, .fa-message-times:before, .fa-message-xmark:before {
+  content: "\f4ab";
+}
+
+.fa-file-award:before, .fa-file-certificate:before {
+  content: "\f5f3";
+}
+
+.fa-user-doctor-hair-long:before {
+  content: "\e459";
+}
+
+.fa-camera-home:before, .fa-camera-security:before {
+  content: "\f8fe";
+}
+
+.fa-cog:before, .fa-gear:before {
+  content: "\f013";
+}
+
+.fa-droplet-slash:before, .fa-tint-slash:before {
+  content: "\f5c7";
+}
+
+.fa-book-heart:before {
+  content: "\f499";
+}
+
+.fa-mosque:before {
+  content: "\f678";
+}
+
+.fa-duck:before {
+  content: "\f6d8";
+}
+
+.fa-mosquito:before {
+  content: "\e52b";
+}
+
+.fa-star-of-david:before {
+  content: "\f69a";
+}
+
+.fa-flag-alt:before, .fa-flag-swallowtail:before {
+  content: "\f74c";
+}
+
+.fa-person-military-rifle:before {
+  content: "\e54b";
+}
+
+.fa-car-garage:before {
+  content: "\f5e2";
+}
+
+.fa-cart-shopping:before, .fa-shopping-cart:before {
+  content: "\f07a";
+}
+
+.fa-book-font:before {
+  content: "\e0bf";
+}
+
+.fa-shield-plus:before {
+  content: "\e24a";
+}
+
+.fa-vials:before {
+  content: "\f493";
+}
+
+.fa-eye-dropper-full:before {
+  content: "\e172";
+}
+
+.fa-distribute-spacing-horizontal:before {
+  content: "\e365";
+}
+
+.fa-tablet-rugged:before {
+  content: "\f48f";
+}
+
+.fa-temperature-frigid:before, .fa-temperature-snow:before {
+  content: "\f768";
+}
+
+.fa-moped:before {
+  content: "\e3b9";
+}
+
+.fa-face-smile-plus:before, .fa-smile-plus:before {
+  content: "\f5b9";
+}
+
+.fa-radio-alt:before, .fa-radio-tuner:before {
+  content: "\f8d8";
+}
+
+.fa-face-swear:before {
+  content: "\e399";
+}
+
+.fa-water-arrow-down:before, .fa-water-lower:before {
+  content: "\f774";
+}
+
+.fa-scanner-touchscreen:before {
+  content: "\f48a";
+}
+
+.fa-circle-7:before {
+  content: "\e0f4";
+}
+
+.fa-plug-circle-plus:before {
+  content: "\e55f";
+}
+
+.fa-person-ski-jumping:before, .fa-ski-jump:before {
+  content: "\f7c7";
+}
+
+.fa-place-of-worship:before {
+  content: "\f67f";
+}
+
+.fa-water-arrow-up:before, .fa-water-rise:before {
+  content: "\f775";
+}
+
+.fa-waveform-lines:before, .fa-waveform-path:before {
+  content: "\f8f2";
+}
+
+.fa-split:before {
+  content: "\e254";
+}
+
+.fa-film-canister:before, .fa-film-cannister:before {
+  content: "\f8b7";
+}
+
+.fa-folder-times:before, .fa-folder-xmark:before {
+  content: "\f65f";
+}
+
+.fa-toilet-paper-alt:before, .fa-toilet-paper-blank:before {
+  content: "\f71f";
+}
+
+.fa-tablet-android-alt:before, .fa-tablet-screen:before {
+  content: "\f3fc";
+}
+
+.fa-hexagon-vertical-nft-slanted:before {
+  content: "\e506";
+}
+
+.fa-folder-music:before {
+  content: "\e18d";
+}
+
+.fa-desktop-medical:before, .fa-display-medical:before {
+  content: "\e166";
+}
+
+.fa-share-all:before {
+  content: "\f367";
+}
+
+.fa-peapod:before {
+  content: "\e31c";
+}
+
+.fa-chess-clock:before {
+  content: "\f43d";
+}
+
+.fa-axe:before {
+  content: "\f6b2";
+}
+
+.fa-square-d:before {
+  content: "\e268";
+}
+
+.fa-grip-vertical:before {
+  content: "\f58e";
+}
+
+.fa-mobile-signal-out:before {
+  content: "\e1f0";
+}
+
+.fa-arrow-turn-up:before, .fa-level-up:before {
+  content: "\f148";
+}
+
+.fa-u:before {
+  content: "\55";
+}
+
+.fa-arrow-up-from-dotted-line:before {
+  content: "\e09b";
+}
+
+.fa-square-root-alt:before, .fa-square-root-variable:before {
+  content: "\f698";
+}
+
+.fa-light-switch-on:before {
+  content: "\e019";
+}
+
+.fa-arrow-down-arrow-up:before, .fa-sort-alt:before {
+  content: "\f883";
+}
+
+.fa-raindrops:before {
+  content: "\f75c";
+}
+
+.fa-dash:before, .fa-minus-large:before {
+  content: "\e404";
+}
+
+.fa-clock-four:before, .fa-clock:before {
+  content: "\f017";
+}
+
+.fa-input-numeric:before {
+  content: "\e1bd";
+}
+
+.fa-truck-tow:before {
+  content: "\e2b8";
+}
+
+.fa-backward-step:before, .fa-step-backward:before {
+  content: "\f048";
+}
+
+.fa-pallet:before {
+  content: "\f482";
+}
+
+.fa-car-bolt:before {
+  content: "\e341";
+}
+
+.fa-arrows-maximize:before, .fa-expand-arrows:before {
+  content: "\f31d";
+}
+
+.fa-faucet:before {
+  content: "\e005";
+}
+
+.fa-cloud-sleet:before {
+  content: "\f741";
+}
+
+.fa-lamp-street:before {
+  content: "\e1c5";
+}
+
+.fa-list-radio:before {
+  content: "\e1d0";
+}
+
+.fa-pen-nib-slash:before {
+  content: "\e4a1";
+}
+
+.fa-baseball-bat-ball:before {
+  content: "\f432";
+}
+
+.fa-square-up-left:before {
+  content: "\e282";
+}
+
+.fa-overline:before {
+  content: "\f876";
+}
+
+.fa-s:before {
+  content: "\53";
+}
+
+.fa-timeline:before {
+  content: "\e29c";
+}
+
+.fa-keyboard:before {
+  content: "\f11c";
+}
+
+.fa-arrows-from-dotted-line:before {
+  content: "\e0a3";
+}
+
+.fa-usb-drive:before {
+  content: "\f8e9";
+}
+
+.fa-ballot:before {
+  content: "\f732";
+}
+
+.fa-caret-down:before {
+  content: "\f0d7";
+}
+
+.fa-location-dot-slash:before, .fa-map-marker-alt-slash:before {
+  content: "\f605";
+}
+
+.fa-cards:before {
+  content: "\e3ed";
+}
+
+.fa-clinic-medical:before, .fa-house-chimney-medical:before {
+  content: "\f7f2";
+}
+
+.fa-boxing-glove:before, .fa-glove-boxing:before {
+  content: "\f438";
+}
+
+.fa-temperature-3:before, .fa-temperature-three-quarters:before, .fa-thermometer-3:before, .fa-thermometer-three-quarters:before {
+  content: "\f2c8";
+}
+
+.fa-bell-school:before {
+  content: "\f5d5";
+}
+
+.fa-mobile-android-alt:before, .fa-mobile-screen:before {
+  content: "\f3cf";
+}
+
+.fa-plane-up:before {
+  content: "\e22d";
+}
+
+.fa-folder-heart:before {
+  content: "\e189";
+}
+
+.fa-circle-location-arrow:before, .fa-location-circle:before {
+  content: "\f602";
+}
+
+.fa-face-head-bandage:before {
+  content: "\e37a";
+}
+
+.fa-maki-roll:before, .fa-makizushi:before, .fa-sushi-roll:before {
+  content: "\e48b";
+}
+
+.fa-car-bump:before {
+  content: "\f5e0";
+}
+
+.fa-piggy-bank:before {
+  content: "\f4d3";
+}
+
+.fa-racquet:before {
+  content: "\f45a";
+}
+
+.fa-car-mirrors:before {
+  content: "\e343";
+}
+
+.fa-industry-alt:before, .fa-industry-windows:before {
+  content: "\f3b3";
+}
+
+.fa-bolt-auto:before {
+  content: "\e0b6";
+}
+
+.fa-battery-3:before, .fa-battery-half:before {
+  content: "\f242";
+}
+
+.fa-flux-capacitor:before {
+  content: "\f8ba";
+}
+
+.fa-mountain-city:before {
+  content: "\e52e";
+}
+
+.fa-coins:before {
+  content: "\f51e";
+}
+
+.fa-honey-pot:before {
+  content: "\e418";
+}
+
+.fa-olive:before {
+  content: "\e316";
+}
+
+.fa-khanda:before {
+  content: "\f66d";
+}
+
+.fa-filter-list:before {
+  content: "\e17c";
+}
+
+.fa-outlet:before {
+  content: "\e01c";
+}
+
+.fa-sliders-h:before, .fa-sliders:before {
+  content: "\f1de";
+}
+
+.fa-cauldron:before {
+  content: "\f6bf";
+}
+
+.fa-people:before {
+  content: "\e216";
+}
+
+.fa-folder-tree:before {
+  content: "\f802";
+}
+
+.fa-network-wired:before {
+  content: "\f6ff";
+}
+
+.fa-croissant:before {
+  content: "\f7f6";
+}
+
+.fa-map-pin:before {
+  content: "\f276";
+}
+
+.fa-hamsa:before {
+  content: "\f665";
+}
+
+.fa-cent-sign:before {
+  content: "\e3f5";
+}
+
+.fa-swords-laser:before {
+  content: "\e03d";
+}
+
+.fa-flask:before {
+  content: "\f0c3";
+}
+
+.fa-person-pregnant:before {
+  content: "\e31e";
+}
+
+.fa-square-u:before {
+  content: "\e281";
+}
+
+.fa-wand-sparkles:before {
+  content: "\f72b";
+}
+
+.fa-router:before {
+  content: "\f8da";
+}
+
+.fa-ellipsis-v:before, .fa-ellipsis-vertical:before {
+  content: "\f142";
+}
+
+.fa-sword-laser-alt:before {
+  content: "\e03c";
+}
+
+.fa-ticket:before {
+  content: "\f145";
+}
+
+.fa-power-off:before {
+  content: "\f011";
+}
+
+.fa-coin:before {
+  content: "\f85c";
+}
+
+.fa-laptop-slash:before {
+  content: "\e1c7";
+}
+
+.fa-long-arrow-alt-right:before, .fa-right-long:before {
+  content: "\f30b";
+}
+
+.fa-circle-b:before {
+  content: "\e0fd";
+}
+
+.fa-person-dress-simple:before {
+  content: "\e21c";
+}
+
+.fa-pipe-collar:before {
+  content: "\e437";
+}
+
+.fa-lights-holiday:before {
+  content: "\f7b2";
+}
+
+.fa-citrus:before {
+  content: "\e2f4";
+}
+
+.fa-flag-usa:before {
+  content: "\f74d";
+}
+
+.fa-laptop-file:before {
+  content: "\e51d";
+}
+
+.fa-teletype:before, .fa-tty:before {
+  content: "\f1e4";
+}
+
+.fa-chart-tree-map:before {
+  content: "\e0ea";
+}
+
+.fa-diagram-next:before {
+  content: "\e476";
+}
+
+.fa-person-rifle:before {
+  content: "\e54e";
+}
+
+.fa-clock-five-thirty:before {
+  content: "\e34a";
+}
+
+.fa-pipe-valve:before {
+  content: "\e439";
+}
+
+.fa-arrow-up-from-arc:before {
+  content: "\e4b4";
+}
+
+.fa-face-spiral-eyes:before {
+  content: "\e485";
+}
+
+.fa-compress-wide:before {
+  content: "\f326";
+}
+
+.fa-circle-phone-hangup:before, .fa-phone-circle-down:before {
+  content: "\e11d";
+}
+
+.fa-gear-complex-code:before {
+  content: "\e5eb";
+}
+
+.fa-house-medical-circle-exclamation:before {
+  content: "\e512";
+}
+
+.fa-badminton:before {
+  content: "\e33a";
+}
+
+.fa-closed-captioning:before {
+  content: "\f20a";
+}
+
+.fa-hiking:before, .fa-person-hiking:before {
+  content: "\f6ec";
+}
+
+.fa-arrow-alt-from-left:before, .fa-right-from-line:before {
+  content: "\f347";
+}
+
+.fa-venus-double:before {
+  content: "\f226";
+}
+
+.fa-images:before {
+  content: "\f302";
+}
+
+.fa-calculator:before {
+  content: "\f1ec";
+}
+
+.fa-shuttlecock:before {
+  content: "\f45b";
+}
+
+.fa-user-hair:before {
+  content: "\e45a";
+}
+
+.fa-eye-evil:before {
+  content: "\f6db";
+}
+
+.fa-people-pulling:before {
+  content: "\e535";
+}
+
+.fa-n:before {
+  content: "\4e";
+}
+
+.fa-swap:before {
+  content: "\e609";
+}
+
+.fa-garage:before {
+  content: "\e009";
+}
+
+.fa-cable-car:before, .fa-tram:before {
+  content: "\f7da";
+}
+
+.fa-shovel-snow:before {
+  content: "\f7c3";
+}
+
+.fa-cloud-rain:before {
+  content: "\f73d";
+}
+
+.fa-face-lying:before {
+  content: "\e37e";
+}
+
+.fa-sprinkler:before {
+  content: "\e035";
+}
+
+.fa-building-circle-xmark:before {
+  content: "\e4d4";
+}
+
+.fa-person-sledding:before, .fa-sledding:before {
+  content: "\f7cb";
+}
+
+.fa-game-console-handheld:before {
+  content: "\f8bb";
+}
+
+.fa-ship:before {
+  content: "\f21a";
+}
+
+.fa-clock-six-thirty:before {
+  content: "\e353";
+}
+
+.fa-battery-slash:before {
+  content: "\f377";
+}
+
+.fa-tugrik-sign:before {
+  content: "\e2ba";
+}
+
+.fa-arrows-down-to-line:before {
+  content: "\e4b8";
+}
+
+.fa-download:before {
+  content: "\f019";
+}
+
+.fa-angles-up-down:before {
+  content: "\e60d";
+}
+
+.fa-inventory:before, .fa-shelves:before {
+  content: "\f480";
+}
+
+.fa-cloud-snow:before {
+  content: "\f742";
+}
+
+.fa-face-grin:before, .fa-grin:before {
+  content: "\f580";
+}
+
+.fa-backspace:before, .fa-delete-left:before {
+  content: "\f55a";
+}
+
+.fa-oven:before {
+  content: "\e01d";
+}
+
+.fa-cloud-binary:before {
+  content: "\e601";
+}
+
+.fa-eye-dropper-empty:before, .fa-eye-dropper:before, .fa-eyedropper:before {
+  content: "\f1fb";
+}
+
+.fa-comment-captions:before {
+  content: "\e146";
+}
+
+.fa-comments-question:before {
+  content: "\e14e";
+}
+
+.fa-scribble:before {
+  content: "\e23f";
+}
+
+.fa-rotate-exclamation:before {
+  content: "\e23c";
+}
+
+.fa-file-circle-check:before {
+  content: "\e5a0";
+}
+
+.fa-glass:before {
+  content: "\f804";
+}
+
+.fa-loader:before {
+  content: "\e1d4";
+}
+
+.fa-forward:before {
+  content: "\f04e";
+}
+
+.fa-user-pilot:before {
+  content: "\e2c0";
+}
+
+.fa-mobile-android:before, .fa-mobile-phone:before, .fa-mobile:before {
+  content: "\f3ce";
+}
+
+.fa-code-pull-request-closed:before {
+  content: "\e3f9";
+}
+
+.fa-face-meh:before, .fa-meh:before {
+  content: "\f11a";
+}
+
+.fa-align-center:before {
+  content: "\f037";
+}
+
+.fa-book-dead:before, .fa-book-skull:before {
+  content: "\f6b7";
+}
+
+.fa-drivers-license:before, .fa-id-card:before {
+  content: "\f2c2";
+}
+
+.fa-face-dotted:before {
+  content: "\e47f";
+}
+
+.fa-face-worried:before {
+  content: "\e3a3";
+}
+
+.fa-dedent:before, .fa-outdent:before {
+  content: "\f03b";
+}
+
+.fa-court-sport:before {
+  content: "\e643";
+}
+
+.fa-heart-circle-exclamation:before {
+  content: "\e4fe";
+}
+
+.fa-home-alt:before, .fa-home-lg-alt:before, .fa-home:before, .fa-house:before {
+  content: "\f015";
+}
+
+.fa-vector-circle:before {
+  content: "\e2c6";
+}
+
+.fa-car-circle-bolt:before {
+  content: "\e342";
+}
+
+.fa-calendar-week:before {
+  content: "\f784";
+}
+
+.fa-flying-disc:before {
+  content: "\e3a9";
+}
+
+.fa-laptop-medical:before {
+  content: "\f812";
+}
+
+.fa-square-down-right:before {
+  content: "\e26c";
+}
+
+.fa-b:before {
+  content: "\42";
+}
+
+.fa-seat-airline:before {
+  content: "\e244";
+}
+
+.fa-eclipse-alt:before, .fa-moon-over-sun:before {
+  content: "\f74a";
+}
+
+.fa-pipe:before {
+  content: "\7c";
+}
+
+.fa-file-medical:before {
+  content: "\f477";
+}
+
+.fa-potato:before {
+  content: "\e440";
+}
+
+.fa-dice-one:before {
+  content: "\f525";
+}
+
+.fa-circle-a:before {
+  content: "\e0f7";
+}
+
+.fa-helmet-battle:before {
+  content: "\f6eb";
+}
+
+.fa-butter:before {
+  content: "\e3e4";
+}
+
+.fa-blanket-fire:before {
+  content: "\e3da";
+}
+
+.fa-kiwi-bird:before {
+  content: "\f535";
+}
+
+.fa-castle:before {
+  content: "\e0de";
+}
+
+.fa-golf-club:before {
+  content: "\f451";
+}
+
+.fa-arrow-right-arrow-left:before, .fa-exchange:before {
+  content: "\f0ec";
+}
+
+.fa-redo-alt:before, .fa-rotate-forward:before, .fa-rotate-right:before {
+  content: "\f2f9";
+}
+
+.fa-cutlery:before, .fa-utensils:before {
+  content: "\f2e7";
+}
+
+.fa-arrow-up-wide-short:before, .fa-sort-amount-up:before {
+  content: "\f161";
+}
+
+.fa-chart-pie-simple-circle-dollar:before {
+  content: "\e605";
+}
+
+.fa-balloons:before {
+  content: "\e2e4";
+}
+
+.fa-mill-sign:before {
+  content: "\e1ed";
+}
+
+.fa-bowl-rice:before {
+  content: "\e2eb";
+}
+
+.fa-timeline-arrow:before {
+  content: "\e29d";
+}
+
+.fa-skull:before {
+  content: "\f54c";
+}
+
+.fa-game-board-alt:before, .fa-game-board-simple:before {
+  content: "\f868";
+}
+
+.fa-circle-video:before, .fa-video-circle:before {
+  content: "\e12b";
+}
+
+.fa-chart-scatter-bubble:before {
+  content: "\e0e9";
+}
+
+.fa-house-turret:before {
+  content: "\e1b4";
+}
+
+.fa-banana:before {
+  content: "\e2e5";
+}
+
+.fa-hand-holding-skull:before {
+  content: "\e1a4";
+}
+
+.fa-people-dress:before {
+  content: "\e217";
+}
+
+.fa-couch-small:before, .fa-loveseat:before {
+  content: "\f4cc";
+}
+
+.fa-broadcast-tower:before, .fa-tower-broadcast:before {
+  content: "\f519";
+}
+
+.fa-truck-pickup:before {
+  content: "\f63c";
+}
+
+.fa-block-quote:before {
+  content: "\e0b5";
+}
+
+.fa-long-arrow-alt-up:before, .fa-up-long:before {
+  content: "\f30c";
+}
+
+.fa-stop:before {
+  content: "\f04d";
+}
+
+.fa-code-merge:before {
+  content: "\f387";
+}
+
+.fa-money-check-dollar-pen:before, .fa-money-check-edit-alt:before {
+  content: "\f873";
+}
+
+.fa-arrow-alt-from-bottom:before, .fa-up-from-line:before {
+  content: "\f346";
+}
+
+.fa-upload:before {
+  content: "\f093";
+}
+
+.fa-hurricane:before {
+  content: "\f751";
+}
+
+.fa-grid-round-2-plus:before {
+  content: "\e5dc";
+}
+
+.fa-people-pants:before {
+  content: "\e219";
+}
+
+.fa-mound:before {
+  content: "\e52d";
+}
+
+.fa-windsock:before {
+  content: "\f777";
+}
+
+.fa-circle-half:before {
+  content: "\e110";
+}
+
+.fa-brake-warning:before {
+  content: "\e0c7";
+}
+
+.fa-toilet-portable:before {
+  content: "\e583";
+}
+
+.fa-compact-disc:before {
+  content: "\f51f";
+}
+
+.fa-file-arrow-down:before, .fa-file-download:before {
+  content: "\f56d";
+}
+
+.fa-sax-hot:before, .fa-saxophone-fire:before {
+  content: "\f8db";
+}
+
+.fa-camera-web-slash:before, .fa-webcam-slash:before {
+  content: "\f833";
+}
+
+.fa-folder-medical:before {
+  content: "\e18c";
+}
+
+.fa-folder-cog:before, .fa-folder-gear:before {
+  content: "\e187";
+}
+
+.fa-hand-wave:before {
+  content: "\e1a7";
+}
+
+.fa-arrow-up-arrow-down:before, .fa-sort-up-down:before {
+  content: "\e099";
+}
+
+.fa-caravan:before {
+  content: "\f8ff";
+}
+
+.fa-shield-cat:before {
+  content: "\e572";
+}
+
+.fa-comment-alt-slash:before, .fa-message-slash:before {
+  content: "\f4a9";
+}
+
+.fa-bolt:before, .fa-zap:before {
+  content: "\f0e7";
+}
+
+.fa-trash-can-check:before {
+  content: "\e2a9";
+}
+
+.fa-glass-water:before {
+  content: "\e4f4";
+}
+
+.fa-oil-well:before {
+  content: "\e532";
+}
+
+.fa-person-simple:before {
+  content: "\e220";
+}
+
+.fa-arrow-turn-left-up:before {
+  content: "\e634";
+}
+
+.fa-vault:before {
+  content: "\e2c5";
+}
+
+.fa-mars:before {
+  content: "\f222";
+}
+
+.fa-toilet:before {
+  content: "\f7d8";
+}
+
+.fa-plane-circle-xmark:before {
+  content: "\e557";
+}
+
+.fa-cny:before, .fa-jpy:before, .fa-rmb:before, .fa-yen-sign:before, .fa-yen:before {
+  content: "\f157";
+}
+
+.fa-gear-code:before {
+  content: "\e5e8";
+}
+
+.fa-notes:before {
+  content: "\e202";
+}
+
+.fa-rouble:before, .fa-rub:before, .fa-ruble-sign:before, .fa-ruble:before {
+  content: "\f158";
+}
+
+.fa-trash-arrow-turn-left:before, .fa-trash-undo:before {
+  content: "\f895";
+}
+
+.fa-champagne-glass:before, .fa-glass-champagne:before {
+  content: "\f79e";
+}
+
+.fa-objects-align-center-horizontal:before {
+  content: "\e3bc";
+}
+
+.fa-sun:before {
+  content: "\f185";
+}
+
+.fa-trash-alt-slash:before, .fa-trash-can-slash:before {
+  content: "\e2ad";
+}
+
+.fa-screen-users:before, .fa-users-class:before {
+  content: "\f63d";
+}
+
+.fa-guitar:before {
+  content: "\f7a6";
+}
+
+.fa-arrow-square-left:before, .fa-square-arrow-left:before {
+  content: "\f33a";
+}
+
+.fa-square-8:before {
+  content: "\e25d";
+}
+
+.fa-face-smile-hearts:before {
+  content: "\e390";
+}
+
+.fa-brackets-square:before, .fa-brackets:before {
+  content: "\f7e9";
+}
+
+.fa-laptop-arrow-down:before {
+  content: "\e1c6";
+}
+
+.fa-hockey-stick-puck:before {
+  content: "\e3ae";
+}
+
+.fa-house-tree:before {
+  content: "\e1b3";
+}
+
+.fa-signal-2:before, .fa-signal-fair:before {
+  content: "\f68d";
+}
+
+.fa-face-laugh-wink:before, .fa-laugh-wink:before {
+  content: "\f59c";
+}
+
+.fa-circle-dollar:before, .fa-dollar-circle:before, .fa-usd-circle:before {
+  content: "\f2e8";
+}
+
+.fa-horse-head:before {
+  content: "\f7ab";
+}
+
+.fa-arrows-repeat:before, .fa-repeat-alt:before {
+  content: "\f364";
+}
+
+.fa-bore-hole:before {
+  content: "\e4c3";
+}
+
+.fa-industry:before {
+  content: "\f275";
+}
+
+.fa-image-polaroid:before {
+  content: "\f8c4";
+}
+
+.fa-wave-triangle:before {
+  content: "\f89a";
+}
+
+.fa-turn-left-down:before {
+  content: "\e637";
+}
+
+.fa-person-running-fast:before {
+  content: "\e5ff";
+}
+
+.fa-arrow-alt-circle-down:before, .fa-circle-down:before {
+  content: "\f358";
+}
+
+.fa-grill:before {
+  content: "\e5a3";
+}
+
+.fa-arrows-turn-to-dots:before {
+  content: "\e4c1";
+}
+
+.fa-analytics:before, .fa-chart-mixed:before {
+  content: "\f643";
+}
+
+.fa-florin-sign:before {
+  content: "\e184";
+}
+
+.fa-arrow-down-short-wide:before, .fa-sort-amount-desc:before, .fa-sort-amount-down-alt:before {
+  content: "\f884";
+}
+
+.fa-less-than:before {
+  content: "\3c";
+}
+
+.fa-desktop-code:before, .fa-display-code:before {
+  content: "\e165";
+}
+
+.fa-face-drooling:before {
+  content: "\e372";
+}
+
+.fa-oil-temp:before, .fa-oil-temperature:before {
+  content: "\f614";
+}
+
+.fa-question-square:before, .fa-square-question:before {
+  content: "\f2fd";
+}
+
+.fa-air-conditioner:before {
+  content: "\f8f4";
+}
+
+.fa-angle-down:before {
+  content: "\f107";
+}
+
+.fa-mountains:before {
+  content: "\f6fd";
+}
+
+.fa-omega:before {
+  content: "\f67a";
+}
+
+.fa-car-tunnel:before {
+  content: "\e4de";
+}
+
+.fa-person-dolly-empty:before {
+  content: "\f4d1";
+}
+
+.fa-pan-food:before {
+  content: "\e42b";
+}
+
+.fa-head-side-cough:before {
+  content: "\e061";
+}
+
+.fa-grip-lines:before {
+  content: "\f7a4";
+}
+
+.fa-thumbs-down:before {
+  content: "\f165";
+}
+
+.fa-user-lock:before {
+  content: "\f502";
+}
+
+.fa-arrow-right-long:before, .fa-long-arrow-right:before {
+  content: "\f178";
+}
+
+.fa-tickets-airline:before, .fa-tickets-perforated-plane:before, .fa-tickets-plane:before {
+  content: "\e29b";
+}
+
+.fa-tent-double-peak:before {
+  content: "\e627";
+}
+
+.fa-anchor-circle-xmark:before {
+  content: "\e4ac";
+}
+
+.fa-ellipsis-h:before, .fa-ellipsis:before {
+  content: "\f141";
+}
+
+.fa-nfc-slash:before {
+  content: "\e1fc";
+}
+
+.fa-chess-pawn:before {
+  content: "\f443";
+}
+
+.fa-first-aid:before, .fa-kit-medical:before {
+  content: "\f479";
+}
+
+.fa-grid-2-plus:before {
+  content: "\e197";
+}
+
+.fa-bells:before {
+  content: "\f77f";
+}
+
+.fa-person-through-window:before {
+  content: "\e5a9";
+}
+
+.fa-toolbox:before {
+  content: "\f552";
+}
+
+.fa-envelope-badge:before, .fa-envelope-dot:before {
+  content: "\e16f";
+}
+
+.fa-magnifying-glass-waveform:before {
+  content: "\e661";
+}
+
+.fa-hands-holding-circle:before {
+  content: "\e4fb";
+}
+
+.fa-bug:before {
+  content: "\f188";
+}
+
+.fa-bowl-chopsticks:before {
+  content: "\e2e9";
+}
+
+.fa-credit-card-alt:before, .fa-credit-card:before {
+  content: "\f09d";
+}
+
+.fa-circle-s:before {
+  content: "\e121";
+}
+
+.fa-box-ballot:before {
+  content: "\f735";
+}
+
+.fa-automobile:before, .fa-car:before {
+  content: "\f1b9";
+}
+
+.fa-hand-holding-hand:before {
+  content: "\e4f7";
+}
+
+.fa-user-tie-hair:before {
+  content: "\e45f";
+}
+
+.fa-podium-star:before {
+  content: "\f758";
+}
+
+.fa-business-front:before, .fa-party-back:before, .fa-trian-balbot:before, .fa-user-hair-mullet:before {
+  content: "\e45c";
+}
+
+.fa-microphone-stand:before {
+  content: "\f8cb";
+}
+
+.fa-book-open-reader:before, .fa-book-reader:before {
+  content: "\f5da";
+}
+
+.fa-family-dress:before {
+  content: "\e301";
+}
+
+.fa-circle-x:before {
+  content: "\e12e";
+}
+
+.fa-cabin:before {
+  content: "\e46d";
+}
+
+.fa-mountain-sun:before {
+  content: "\e52f";
+}
+
+.fa-chart-simple-horizontal:before {
+  content: "\e474";
+}
+
+.fa-arrows-left-right-to-line:before {
+  content: "\e4ba";
+}
+
+.fa-hand-back-point-left:before {
+  content: "\e19f";
+}
+
+.fa-comment-alt-dots:before, .fa-message-dots:before, .fa-messaging:before {
+  content: "\f4a3";
+}
+
+.fa-file-heart:before {
+  content: "\e176";
+}
+
+.fa-beer-foam:before, .fa-beer-mug:before {
+  content: "\e0b3";
+}
+
+.fa-dice-d20:before {
+  content: "\f6cf";
+}
+
+.fa-drone:before {
+  content: "\f85f";
+}
+
+.fa-truck-droplet:before {
+  content: "\e58c";
+}
+
+.fa-file-circle-xmark:before {
+  content: "\e5a1";
+}
+
+.fa-temperature-arrow-up:before, .fa-temperature-up:before {
+  content: "\e040";
+}
+
+.fa-medal:before {
+  content: "\f5a2";
+}
+
+.fa-person-fairy:before {
+  content: "\e608";
+}
+
+.fa-bed:before {
+  content: "\f236";
+}
+
+.fa-book-copy:before {
+  content: "\e0be";
+}
+
+.fa-h-square:before, .fa-square-h:before {
+  content: "\f0fd";
+}
+
+.fa-square-c:before {
+  content: "\e266";
+}
+
+.fa-clock-two:before {
+  content: "\e35a";
+}
+
+.fa-square-ellipsis-vertical:before {
+  content: "\e26f";
+}
+
+.fa-calendar-users:before {
+  content: "\e5e2";
+}
+
+.fa-podcast:before {
+  content: "\f2ce";
+}
+
+.fa-bee:before {
+  content: "\e0b2";
+}
+
+.fa-temperature-4:before, .fa-temperature-full:before, .fa-thermometer-4:before, .fa-thermometer-full:before {
+  content: "\f2c7";
+}
+
+.fa-bell:before {
+  content: "\f0f3";
+}
+
+.fa-candy-bar:before, .fa-chocolate-bar:before {
+  content: "\e3e8";
+}
+
+.fa-xmark-large:before {
+  content: "\e59b";
+}
+
+.fa-pinata:before {
+  content: "\e3c3";
+}
+
+.fa-file-ppt:before {
+  content: "\e64a";
+}
+
+.fa-arrows-from-line:before {
+  content: "\e0a4";
+}
+
+.fa-superscript:before {
+  content: "\f12b";
+}
+
+.fa-bowl-spoon:before {
+  content: "\e3e0";
+}
+
+.fa-hexagon-check:before {
+  content: "\e416";
+}
+
+.fa-plug-circle-xmark:before {
+  content: "\e560";
+}
+
+.fa-star-of-life:before {
+  content: "\f621";
+}
+
+.fa-phone-slash:before {
+  content: "\f3dd";
+}
+
+.fa-traffic-light-stop:before {
+  content: "\f63a";
+}
+
+.fa-paint-roller:before {
+  content: "\f5aa";
+}
+
+.fa-accent-grave:before {
+  content: "\60";
+}
+
+.fa-hands-helping:before, .fa-handshake-angle:before {
+  content: "\f4c4";
+}
+
+.fa-circle-0:before {
+  content: "\e0ed";
+}
+
+.fa-dial-med-low:before {
+  content: "\e160";
+}
+
+.fa-location-dot:before, .fa-map-marker-alt:before {
+  content: "\f3c5";
+}
+
+.fa-crab:before {
+  content: "\e3ff";
+}
+
+.fa-box-full:before, .fa-box-open-full:before {
+  content: "\f49c";
+}
+
+.fa-file:before {
+  content: "\f15b";
+}
+
+.fa-greater-than:before {
+  content: "\3e";
+}
+
+.fa-quotes:before {
+  content: "\e234";
+}
+
+.fa-pretzel:before {
+  content: "\e441";
+}
+
+.fa-t-rex:before {
+  content: "\e629";
+}
+
+.fa-person-swimming:before, .fa-swimmer:before {
+  content: "\f5c4";
+}
+
+.fa-arrow-down:before {
+  content: "\f063";
+}
+
+.fa-user-robot-xmarks:before {
+  content: "\e4a7";
+}
+
+.fa-comment-alt-quote:before, .fa-message-quote:before {
+  content: "\e1e4";
+}
+
+.fa-candy-corn:before {
+  content: "\f6bd";
+}
+
+.fa-folder-magnifying-glass:before, .fa-folder-search:before {
+  content: "\e18b";
+}
+
+.fa-notebook:before {
+  content: "\e201";
+}
+
+.fa-circle-wifi:before {
+  content: "\e67d";
+}
+
+.fa-droplet:before, .fa-tint:before {
+  content: "\f043";
+}
+
+.fa-bullseye-pointer:before {
+  content: "\f649";
+}
+
+.fa-eraser:before {
+  content: "\f12d";
+}
+
+.fa-hexagon-image:before {
+  content: "\e504";
+}
+
+.fa-earth-america:before, .fa-earth-americas:before, .fa-earth:before, .fa-globe-americas:before {
+  content: "\f57d";
+}
+
+.fa-file-svg:before {
+  content: "\e64b";
+}
+
+.fa-crate-apple:before {
+  content: "\f6b1";
+}
+
+.fa-apple-crate:before {
+  content: "\f6b1";
+}
+
+.fa-person-burst:before {
+  content: "\e53b";
+}
+
+.fa-game-board:before {
+  content: "\f867";
+}
+
+.fa-hat-chef:before {
+  content: "\f86b";
+}
+
+.fa-hand-back-point-right:before {
+  content: "\e1a1";
+}
+
+.fa-dove:before {
+  content: "\f4ba";
+}
+
+.fa-snowflake-droplets:before {
+  content: "\e5c1";
+}
+
+.fa-battery-0:before, .fa-battery-empty:before {
+  content: "\f244";
+}
+
+.fa-grid-4:before {
+  content: "\e198";
+}
+
+.fa-socks:before {
+  content: "\f696";
+}
+
+.fa-face-sunglasses:before {
+  content: "\e398";
+}
+
+.fa-inbox:before {
+  content: "\f01c";
+}
+
+.fa-square-0:before {
+  content: "\e255";
+}
+
+.fa-section:before {
+  content: "\e447";
+}
+
+.fa-box-up:before, .fa-square-this-way-up:before {
+  content: "\f49f";
+}
+
+.fa-gauge-high:before, .fa-tachometer-alt-fast:before, .fa-tachometer-alt:before {
+  content: "\f625";
+}
+
+.fa-square-ampersand:before {
+  content: "\e260";
+}
+
+.fa-envelope-open-text:before {
+  content: "\f658";
+}
+
+.fa-lamp-desk:before {
+  content: "\e014";
+}
+
+.fa-hospital-alt:before, .fa-hospital-wide:before, .fa-hospital:before {
+  content: "\f0f8";
+}
+
+.fa-poll-people:before {
+  content: "\f759";
+}
+
+.fa-glass-whiskey-rocks:before, .fa-whiskey-glass-ice:before {
+  content: "\f7a1";
+}
+
+.fa-wine-bottle:before {
+  content: "\f72f";
+}
+
+.fa-chess-rook:before {
+  content: "\f447";
+}
+
+.fa-user-bounty-hunter:before {
+  content: "\e2bf";
+}
+
+.fa-bars-staggered:before, .fa-reorder:before, .fa-stream:before {
+  content: "\f550";
+}
+
+.fa-diagram-sankey:before {
+  content: "\e158";
+}
+
+.fa-cloud-hail-mixed:before {
+  content: "\f73a";
+}
+
+.fa-circle-up-left:before {
+  content: "\e128";
+}
+
+.fa-dharmachakra:before {
+  content: "\f655";
+}
+
+.fa-objects-align-left:before {
+  content: "\e3be";
+}
+
+.fa-oil-can-drip:before {
+  content: "\e205";
+}
+
+.fa-face-smiling-hands:before {
+  content: "\e396";
+}
+
+.fa-broccoli:before {
+  content: "\e3e2";
+}
+
+.fa-route-interstate:before {
+  content: "\f61b";
+}
+
+.fa-ear-muffs:before {
+  content: "\f795";
+}
+
+.fa-hotdog:before {
+  content: "\f80f";
+}
+
+.fa-transporter-empty:before {
+  content: "\e046";
+}
+
+.fa-blind:before, .fa-person-walking-with-cane:before {
+  content: "\f29d";
+}
+
+.fa-angle-90:before {
+  content: "\e08d";
+}
+
+.fa-rectangle-terminal:before {
+  content: "\e236";
+}
+
+.fa-kite:before {
+  content: "\f6f4";
+}
+
+.fa-drum:before {
+  content: "\f569";
+}
+
+.fa-scrubber:before {
+  content: "\f2f8";
+}
+
+.fa-ice-cream:before {
+  content: "\f810";
+}
+
+.fa-heart-circle-bolt:before {
+  content: "\e4fc";
+}
+
+.fa-fish-bones:before {
+  content: "\e304";
+}
+
+.fa-deer-rudolph:before {
+  content: "\f78f";
+}
+
+.fa-fax:before {
+  content: "\f1ac";
+}
+
+.fa-paragraph:before {
+  content: "\f1dd";
+}
+
+.fa-head-side-heart:before {
+  content: "\e1aa";
+}
+
+.fa-square-e:before {
+  content: "\e26d";
+}
+
+.fa-meter-fire:before {
+  content: "\e1eb";
+}
+
+.fa-cloud-hail:before {
+  content: "\f739";
+}
+
+.fa-check-to-slot:before, .fa-vote-yea:before {
+  content: "\f772";
+}
+
+.fa-money-from-bracket:before {
+  content: "\e312";
+}
+
+.fa-star-half:before {
+  content: "\f089";
+}
+
+.fa-car-bus:before {
+  content: "\f85a";
+}
+
+.fa-speaker:before {
+  content: "\f8df";
+}
+
+.fa-timer:before {
+  content: "\e29e";
+}
+
+.fa-boxes-alt:before, .fa-boxes-stacked:before, .fa-boxes:before {
+  content: "\f468";
+}
+
+.fa-landmark-magnifying-glass:before {
+  content: "\e622";
+}
+
+.fa-grill-hot:before {
+  content: "\e5a5";
+}
+
+.fa-ballot-check:before {
+  content: "\f733";
+}
+
+.fa-chain:before, .fa-link:before {
+  content: "\f0c1";
+}
+
+.fa-assistive-listening-systems:before, .fa-ear-listen:before {
+  content: "\f2a2";
+}
+
+.fa-file-minus:before {
+  content: "\f318";
+}
+
+.fa-tree-city:before {
+  content: "\e587";
+}
+
+.fa-play:before {
+  content: "\f04b";
+}
+
+.fa-font:before {
+  content: "\f031";
+}
+
+.fa-coffee-togo:before, .fa-cup-togo:before {
+  content: "\f6c5";
+}
+
+.fa-square-down-left:before {
+  content: "\e26b";
+}
+
+.fa-burger-lettuce:before {
+  content: "\e3e3";
+}
+
+.fa-table-cells-row-lock:before {
+  content: "\e67a";
+}
+
+.fa-rupiah-sign:before {
+  content: "\e23d";
+}
+
+.fa-magnifying-glass:before, .fa-search:before {
+  content: "\f002";
+}
+
+.fa-ping-pong-paddle-ball:before, .fa-table-tennis-paddle-ball:before, .fa-table-tennis:before {
+  content: "\f45d";
+}
+
+.fa-diagnoses:before, .fa-person-dots-from-line:before {
+  content: "\f470";
+}
+
+.fa-chevron-double-down:before, .fa-chevrons-down:before {
+  content: "\f322";
+}
+
+.fa-trash-can-arrow-up:before, .fa-trash-restore-alt:before {
+  content: "\f82a";
+}
+
+.fa-signal-3:before, .fa-signal-good:before {
+  content: "\f68e";
+}
+
+.fa-location-question:before, .fa-map-marker-question:before {
+  content: "\f60b";
+}
+
+.fa-floppy-disk-circle-xmark:before, .fa-floppy-disk-times:before, .fa-save-circle-xmark:before, .fa-save-times:before {
+  content: "\e181";
+}
+
+.fa-naira-sign:before {
+  content: "\e1f6";
+}
+
+.fa-peach:before {
+  content: "\e20b";
+}
+
+.fa-taxi-bus:before {
+  content: "\e298";
+}
+
+.fa-bracket-curly-left:before, .fa-bracket-curly:before {
+  content: "\7b";
+}
+
+.fa-lobster:before {
+  content: "\e421";
+}
+
+.fa-cart-flatbed-empty:before, .fa-dolly-flatbed-empty:before {
+  content: "\f476";
+}
+
+.fa-colon:before {
+  content: "\3a";
+}
+
+.fa-cart-arrow-down:before {
+  content: "\f218";
+}
+
+.fa-wand:before {
+  content: "\f72a";
+}
+
+.fa-walkie-talkie:before {
+  content: "\f8ef";
+}
+
+.fa-file-edit:before, .fa-file-pen:before {
+  content: "\f31c";
+}
+
+.fa-receipt:before {
+  content: "\f543";
+}
+
+.fa-table-picnic:before {
+  content: "\e32d";
+}
+
+.fa-pen-square:before, .fa-pencil-square:before, .fa-square-pen:before {
+  content: "\f14b";
+}
+
+.fa-circle-microphone-lines:before, .fa-microphone-circle-alt:before {
+  content: "\e117";
+}
+
+.fa-desktop-slash:before, .fa-display-slash:before {
+  content: "\e2fa";
+}
+
+.fa-suitcase-rolling:before {
+  content: "\f5c1";
+}
+
+.fa-person-circle-exclamation:before {
+  content: "\e53f";
+}
+
+.fa-transporter-2:before {
+  content: "\e044";
+}
+
+.fa-hand-receiving:before, .fa-hands-holding-diamond:before {
+  content: "\f47c";
+}
+
+.fa-money-bill-simple-wave:before {
+  content: "\e1f2";
+}
+
+.fa-chevron-down:before {
+  content: "\f078";
+}
+
+.fa-battery-5:before, .fa-battery-full:before, .fa-battery:before {
+  content: "\f240";
+}
+
+.fa-bell-plus:before {
+  content: "\f849";
+}
+
+.fa-book-arrow-right:before {
+  content: "\e0b9";
+}
+
+.fa-hospitals:before {
+  content: "\f80e";
+}
+
+.fa-club:before {
+  content: "\f327";
+}
+
+.fa-skull-crossbones:before {
+  content: "\f714";
+}
+
+.fa-dewpoint:before, .fa-droplet-degree:before {
+  content: "\f748";
+}
+
+.fa-code-compare:before {
+  content: "\e13a";
+}
+
+.fa-list-dots:before, .fa-list-ul:before {
+  content: "\f0ca";
+}
+
+.fa-hand-holding-magic:before {
+  content: "\f6e5";
+}
+
+.fa-watermelon-slice:before {
+  content: "\e337";
+}
+
+.fa-circle-ellipsis:before {
+  content: "\e10a";
+}
+
+.fa-school-lock:before {
+  content: "\e56f";
+}
+
+.fa-tower-cell:before {
+  content: "\e585";
+}
+
+.fa-sd-cards:before {
+  content: "\e240";
+}
+
+.fa-jug-bottle:before {
+  content: "\e5fb";
+}
+
+.fa-down-long:before, .fa-long-arrow-alt-down:before {
+  content: "\f309";
+}
+
+.fa-envelopes:before {
+  content: "\e170";
+}
+
+.fa-phone-office:before {
+  content: "\f67d";
+}
+
+.fa-ranking-star:before {
+  content: "\e561";
+}
+
+.fa-chess-king:before {
+  content: "\f43f";
+}
+
+.fa-nfc-pen:before {
+  content: "\e1fa";
+}
+
+.fa-person-harassing:before {
+  content: "\e549";
+}
+
+.fa-magnifying-glass-play:before {
+  content: "\e660";
+}
+
+.fa-hat-winter:before {
+  content: "\f7a8";
+}
+
+.fa-brazilian-real-sign:before {
+  content: "\e46c";
+}
+
+.fa-landmark-alt:before, .fa-landmark-dome:before {
+  content: "\f752";
+}
+
+.fa-bone-break:before {
+  content: "\f5d8";
+}
+
+.fa-arrow-up:before {
+  content: "\f062";
+}
+
+.fa-down-from-dotted-line:before {
+  content: "\e407";
+}
+
+.fa-television:before, .fa-tv-alt:before, .fa-tv:before {
+  content: "\f26c";
+}
+
+.fa-border-left:before {
+  content: "\f84f";
+}
+
+.fa-circle-divide:before {
+  content: "\e106";
+}
+
+.fa-shrimp:before {
+  content: "\e448";
+}
+
+.fa-list-check:before, .fa-tasks:before {
+  content: "\f0ae";
+}
+
+.fa-diagram-subtask:before {
+  content: "\e479";
+}
+
+.fa-jug-detergent:before {
+  content: "\e519";
+}
+
+.fa-circle-user:before, .fa-user-circle:before {
+  content: "\f2bd";
+}
+
+.fa-square-y:before {
+  content: "\e287";
+}
+
+.fa-user-doctor-hair:before {
+  content: "\e458";
+}
+
+.fa-planet-ringed:before {
+  content: "\e020";
+}
+
+.fa-mushroom:before {
+  content: "\e425";
+}
+
+.fa-user-shield:before {
+  content: "\f505";
+}
+
+.fa-megaphone:before {
+  content: "\f675";
+}
+
+.fa-wreath-laurel:before {
+  content: "\e5d2";
+}
+
+.fa-circle-exclamation-check:before {
+  content: "\e10d";
+}
+
+.fa-wind:before {
+  content: "\f72e";
+}
+
+.fa-box-dollar:before, .fa-box-usd:before {
+  content: "\f4a0";
+}
+
+.fa-car-burst:before, .fa-car-crash:before {
+  content: "\f5e1";
+}
+
+.fa-y:before {
+  content: "\59";
+}
+
+.fa-user-headset:before {
+  content: "\f82d";
+}
+
+.fa-arrows-retweet:before, .fa-retweet-alt:before {
+  content: "\f361";
+}
+
+.fa-person-snowboarding:before, .fa-snowboarding:before {
+  content: "\f7ce";
+}
+
+.fa-chevron-square-right:before, .fa-square-chevron-right:before {
+  content: "\f32b";
+}
+
+.fa-lacrosse-stick-ball:before {
+  content: "\e3b6";
+}
+
+.fa-shipping-fast:before, .fa-truck-fast:before {
+  content: "\f48b";
+}
+
+.fa-user-magnifying-glass:before {
+  content: "\e5c5";
+}
+
+.fa-star-sharp:before {
+  content: "\e28b";
+}
+
+.fa-comment-heart:before {
+  content: "\e5c8";
+}
+
+.fa-circle-1:before {
+  content: "\e0ee";
+}
+
+.fa-circle-star:before, .fa-star-circle:before {
+  content: "\e123";
+}
+
+.fa-fish:before {
+  content: "\f578";
+}
+
+.fa-cloud-fog:before, .fa-fog:before {
+  content: "\f74e";
+}
+
+.fa-waffle:before {
+  content: "\e466";
+}
+
+.fa-music-alt:before, .fa-music-note:before {
+  content: "\f8cf";
+}
+
+.fa-hexagon-exclamation:before {
+  content: "\e417";
+}
+
+.fa-cart-shopping-fast:before {
+  content: "\e0dc";
+}
+
+.fa-object-union:before {
+  content: "\e49f";
+}
+
+.fa-user-graduate:before {
+  content: "\f501";
+}
+
+.fa-starfighter:before {
+  content: "\e037";
+}
+
+.fa-adjust:before, .fa-circle-half-stroke:before {
+  content: "\f042";
+}
+
+.fa-arrow-right-long-to-line:before {
+  content: "\e3d5";
+}
+
+.fa-arrow-square-down:before, .fa-square-arrow-down:before {
+  content: "\f339";
+}
+
+.fa-diamond-half-stroke:before {
+  content: "\e5b8";
+}
+
+.fa-clapperboard:before {
+  content: "\e131";
+}
+
+.fa-chevron-square-left:before, .fa-square-chevron-left:before {
+  content: "\f32a";
+}
+
+.fa-phone-intercom:before {
+  content: "\e434";
+}
+
+.fa-chain-horizontal:before, .fa-link-horizontal:before {
+  content: "\e1cb";
+}
+
+.fa-mango:before {
+  content: "\e30f";
+}
+
+.fa-music-alt-slash:before, .fa-music-note-slash:before {
+  content: "\f8d0";
+}
+
+.fa-circle-radiation:before, .fa-radiation-alt:before {
+  content: "\f7ba";
+}
+
+.fa-face-tongue-sweat:before {
+  content: "\e39e";
+}
+
+.fa-globe-stand:before {
+  content: "\f5f6";
+}
+
+.fa-baseball-ball:before, .fa-baseball:before {
+  content: "\f433";
+}
+
+.fa-circle-p:before {
+  content: "\e11a";
+}
+
+.fa-award-simple:before {
+  content: "\e0ab";
+}
+
+.fa-jet-fighter-up:before {
+  content: "\e518";
+}
+
+.fa-diagram-project:before, .fa-project-diagram:before {
+  content: "\f542";
+}
+
+.fa-pedestal:before {
+  content: "\e20d";
+}
+
+.fa-chart-pyramid:before {
+  content: "\e0e6";
+}
+
+.fa-sidebar:before {
+  content: "\e24e";
+}
+
+.fa-frosty-head:before, .fa-snowman-head:before {
+  content: "\f79b";
+}
+
+.fa-copy:before {
+  content: "\f0c5";
+}
+
+.fa-burger-glass:before {
+  content: "\e0ce";
+}
+
+.fa-volume-mute:before, .fa-volume-times:before, .fa-volume-xmark:before {
+  content: "\f6a9";
+}
+
+.fa-hand-sparkles:before {
+  content: "\e05d";
+}
+
+.fa-bars-filter:before {
+  content: "\e0ad";
+}
+
+.fa-paintbrush-pencil:before {
+  content: "\e206";
+}
+
+.fa-party-bell:before {
+  content: "\e31a";
+}
+
+.fa-user-vneck-hair:before {
+  content: "\e462";
+}
+
+.fa-jack-o-lantern:before {
+  content: "\f30e";
+}
+
+.fa-grip-horizontal:before, .fa-grip:before {
+  content: "\f58d";
+}
+
+.fa-share-from-square:before, .fa-share-square:before {
+  content: "\f14d";
+}
+
+.fa-keynote:before {
+  content: "\f66c";
+}
+
+.fa-child-combatant:before, .fa-child-rifle:before {
+  content: "\e4e0";
+}
+
+.fa-gun:before {
+  content: "\e19b";
+}
+
+.fa-phone-square:before, .fa-square-phone:before {
+  content: "\f098";
+}
+
+.fa-hat-beach:before {
+  content: "\e606";
+}
+
+.fa-add:before, .fa-plus:before {
+  content: "\2b";
+}
+
+.fa-expand:before {
+  content: "\f065";
+}
+
+.fa-computer:before {
+  content: "\e4e5";
+}
+
+.fa-fort:before {
+  content: "\e486";
+}
+
+.fa-cloud-check:before {
+  content: "\e35c";
+}
+
+.fa-close:before, .fa-multiply:before, .fa-remove:before, .fa-times:before, .fa-xmark:before {
+  content: "\f00d";
+}
+
+.fa-face-smirking:before {
+  content: "\e397";
+}
+
+.fa-arrows-up-down-left-right:before, .fa-arrows:before {
+  content: "\f047";
+}
+
+.fa-chalkboard-teacher:before, .fa-chalkboard-user:before {
+  content: "\f51c";
+}
+
+.fa-rhombus:before {
+  content: "\e23b";
+}
+
+.fa-claw-marks:before {
+  content: "\f6c2";
+}
+
+.fa-peso-sign:before {
+  content: "\e222";
+}
+
+.fa-face-smile-tongue:before {
+  content: "\e394";
+}
+
+.fa-cart-circle-xmark:before {
+  content: "\e3f4";
+}
+
+.fa-building-shield:before {
+  content: "\e4d8";
+}
+
+.fa-circle-phone-flip:before, .fa-phone-circle-alt:before {
+  content: "\e11c";
+}
+
+.fa-baby:before {
+  content: "\f77c";
+}
+
+.fa-users-line:before {
+  content: "\e592";
+}
+
+.fa-quote-left-alt:before, .fa-quote-left:before {
+  content: "\f10d";
+}
+
+.fa-tractor:before {
+  content: "\f722";
+}
+
+.fa-down-from-bracket:before {
+  content: "\e66b";
+}
+
+.fa-key-skeleton:before {
+  content: "\f6f3";
+}
+
+.fa-trash-arrow-up:before, .fa-trash-restore:before {
+  content: "\f829";
+}
+
+.fa-arrow-down-up-lock:before {
+  content: "\e4b0";
+}
+
+.fa-arrow-down-to-bracket:before {
+  content: "\e094";
+}
+
+.fa-lines-leaning:before {
+  content: "\e51e";
+}
+
+.fa-square-q:before {
+  content: "\e27b";
+}
+
+.fa-ruler-combined:before {
+  content: "\f546";
+}
+
+.fa-icons-alt:before, .fa-symbols:before {
+  content: "\f86e";
+}
+
+.fa-copyright:before {
+  content: "\f1f9";
+}
+
+.fa-flask-gear:before {
+  content: "\e5f1";
+}
+
+.fa-highlighter-line:before {
+  content: "\e1af";
+}
+
+.fa-bracket-left:before, .fa-bracket-square:before, .fa-bracket:before {
+  content: "\5b";
+}
+
+.fa-island-tree-palm:before, .fa-island-tropical:before {
+  content: "\f811";
+}
+
+.fa-arrow-from-left:before, .fa-arrow-right-from-line:before {
+  content: "\f343";
+}
+
+.fa-h2:before {
+  content: "\f314";
+}
+
+.fa-equals:before {
+  content: "\3d";
+}
+
+.fa-cake-slice:before, .fa-shortcake:before {
+  content: "\e3e5";
+}
+
+.fa-building-magnifying-glass:before {
+  content: "\e61c";
+}
+
+.fa-peanut:before {
+  content: "\e430";
+}
+
+.fa-wrench-simple:before {
+  content: "\e2d1";
+}
+
+.fa-blender:before {
+  content: "\f517";
+}
+
+.fa-teeth:before {
+  content: "\f62e";
+}
+
+.fa-tally-2:before {
+  content: "\e295";
+}
+
+.fa-ils:before, .fa-shekel-sign:before, .fa-shekel:before, .fa-sheqel-sign:before, .fa-sheqel:before {
+  content: "\f20b";
+}
+
+.fa-cars:before {
+  content: "\f85b";
+}
+
+.fa-axe-battle:before {
+  content: "\f6b3";
+}
+
+.fa-user-hair-long:before {
+  content: "\e45b";
+}
+
+.fa-map:before {
+  content: "\f279";
+}
+
+.fa-arrow-left-from-arc:before {
+  content: "\e615";
+}
+
+.fa-file-circle-info:before {
+  content: "\e493";
+}
+
+.fa-face-disappointed:before {
+  content: "\e36f";
+}
+
+.fa-lasso-sparkles:before {
+  content: "\e1c9";
+}
+
+.fa-clock-eleven:before {
+  content: "\e347";
+}
+
+.fa-rocket:before {
+  content: "\f135";
+}
+
+.fa-siren-on:before {
+  content: "\e02e";
+}
+
+.fa-clock-ten:before {
+  content: "\e354";
+}
+
+.fa-candle-holder:before {
+  content: "\f6bc";
+}
+
+.fa-video-arrow-down-left:before {
+  content: "\e2c8";
+}
+
+.fa-photo-film:before, .fa-photo-video:before {
+  content: "\f87c";
+}
+
+.fa-floppy-disk-circle-arrow-right:before, .fa-save-circle-arrow-right:before {
+  content: "\e180";
+}
+
+.fa-folder-minus:before {
+  content: "\f65d";
+}
+
+.fa-planet-moon:before {
+  content: "\e01f";
+}
+
+.fa-face-eyes-xmarks:before {
+  content: "\e374";
+}
+
+.fa-chart-scatter:before {
+  content: "\f7ee";
+}
+
+.fa-circle-gf:before {
+  content: "\e67f";
+}
+
+.fa-display-arrow-down:before {
+  content: "\e164";
+}
+
+.fa-store:before {
+  content: "\f54e";
+}
+
+.fa-arrow-trend-up:before {
+  content: "\e098";
+}
+
+.fa-plug-circle-minus:before {
+  content: "\e55e";
+}
+
+.fa-olive-branch:before {
+  content: "\e317";
+}
+
+.fa-angle:before {
+  content: "\e08c";
+}
+
+.fa-vacuum-robot:before {
+  content: "\e04e";
+}
+
+.fa-sign-hanging:before, .fa-sign:before {
+  content: "\f4d9";
+}
+
+.fa-square-divide:before {
+  content: "\e26a";
+}
+
+.fa-folder-check:before {
+  content: "\e64e";
+}
+
+.fa-signal-stream-slash:before {
+  content: "\e250";
+}
+
+.fa-bezier-curve:before {
+  content: "\f55b";
+}
+
+.fa-eye-dropper-half:before {
+  content: "\e173";
+}
+
+.fa-store-lock:before {
+  content: "\e4a6";
+}
+
+.fa-bell-slash:before {
+  content: "\f1f6";
+}
+
+.fa-cloud-bolt-sun:before, .fa-thunderstorm-sun:before {
+  content: "\f76e";
+}
+
+.fa-camera-slash:before {
+  content: "\e0d9";
+}
+
+.fa-comment-quote:before {
+  content: "\e14c";
+}
+
+.fa-tablet-android:before, .fa-tablet:before {
+  content: "\f3fb";
+}
+
+.fa-school-flag:before {
+  content: "\e56e";
+}
+
+.fa-message-code:before {
+  content: "\e1df";
+}
+
+.fa-glass-half-empty:before, .fa-glass-half-full:before, .fa-glass-half:before {
+  content: "\e192";
+}
+
+.fa-fill:before {
+  content: "\f575";
+}
+
+.fa-comment-alt-minus:before, .fa-message-minus:before {
+  content: "\f4a7";
+}
+
+.fa-angle-up:before {
+  content: "\f106";
+}
+
+.fa-dinosaur:before {
+  content: "\e5fe";
+}
+
+.fa-drumstick-bite:before {
+  content: "\f6d7";
+}
+
+.fa-chain-horizontal-slash:before, .fa-link-horizontal-slash:before {
+  content: "\e1cc";
+}
+
+.fa-holly-berry:before {
+  content: "\f7aa";
+}
+
+.fa-nose:before {
+  content: "\e5bd";
+}
+
+.fa-arrow-left-to-arc:before {
+  content: "\e616";
+}
+
+.fa-chevron-left:before {
+  content: "\f053";
+}
+
+.fa-bacteria:before {
+  content: "\e059";
+}
+
+.fa-clouds:before {
+  content: "\f744";
+}
+
+.fa-money-bill-simple:before {
+  content: "\e1f1";
+}
+
+.fa-hand-lizard:before {
+  content: "\f258";
+}
+
+.fa-table-pivot:before {
+  content: "\e291";
+}
+
+.fa-filter-slash:before {
+  content: "\e17d";
+}
+
+.fa-trash-can-arrow-turn-left:before, .fa-trash-can-undo:before, .fa-trash-undo-alt:before {
+  content: "\f896";
+}
+
+.fa-notdef:before {
+  content: "\e1fe";
+}
+
+.fa-disease:before {
+  content: "\f7fa";
+}
+
+.fa-person-to-door:before {
+  content: "\e433";
+}
+
+.fa-turntable:before {
+  content: "\f8e4";
+}
+
+.fa-briefcase-medical:before {
+  content: "\f469";
+}
+
+.fa-genderless:before {
+  content: "\f22d";
+}
+
+.fa-chevron-right:before {
+  content: "\f054";
+}
+
+.fa-signal-1:before, .fa-signal-weak:before {
+  content: "\f68c";
+}
+
+.fa-clock-five:before {
+  content: "\e349";
+}
+
+.fa-retweet:before {
+  content: "\f079";
+}
+
+.fa-car-alt:before, .fa-car-rear:before {
+  content: "\f5de";
+}
+
+.fa-pump-soap:before {
+  content: "\e06b";
+}
+
+.fa-computer-classic:before {
+  content: "\f8b1";
+}
+
+.fa-frame:before {
+  content: "\e495";
+}
+
+.fa-video-slash:before {
+  content: "\f4e2";
+}
+
+.fa-battery-2:before, .fa-battery-quarter:before {
+  content: "\f243";
+}
+
+.fa-ellipsis-h-alt:before, .fa-ellipsis-stroke:before {
+  content: "\f39b";
+}
+
+.fa-radio:before {
+  content: "\f8d7";
+}
+
+.fa-baby-carriage:before, .fa-carriage-baby:before {
+  content: "\f77d";
+}
+
+.fa-face-expressionless:before {
+  content: "\e373";
+}
+
+.fa-down-to-dotted-line:before {
+  content: "\e408";
+}
+
+.fa-cloud-music:before {
+  content: "\f8ae";
+}
+
+.fa-traffic-light:before {
+  content: "\f637";
+}
+
+.fa-cloud-minus:before {
+  content: "\e35d";
+}
+
+.fa-thermometer:before {
+  content: "\f491";
+}
+
+.fa-shield-minus:before {
+  content: "\e249";
+}
+
+.fa-vr-cardboard:before {
+  content: "\f729";
+}
+
+.fa-car-tilt:before {
+  content: "\f5e5";
+}
+
+.fa-gauge-circle-minus:before {
+  content: "\e497";
+}
+
+.fa-brightness-low:before {
+  content: "\e0ca";
+}
+
+.fa-hand-middle-finger:before {
+  content: "\f806";
+}
+
+.fa-percent:before, .fa-percentage:before {
+  content: "\25";
+}
+
+.fa-truck-moving:before {
+  content: "\f4df";
+}
+
+.fa-glass-water-droplet:before {
+  content: "\e4f5";
+}
+
+.fa-conveyor-belt:before {
+  content: "\f46e";
+}
+
+.fa-location-check:before, .fa-map-marker-check:before {
+  content: "\f606";
+}
+
+.fa-coin-vertical:before {
+  content: "\e3fd";
+}
+
+.fa-display:before {
+  content: "\e163";
+}
+
+.fa-person-sign:before {
+  content: "\f757";
+}
+
+.fa-face-smile:before, .fa-smile:before {
+  content: "\f118";
+}
+
+.fa-phone-hangup:before {
+  content: "\e225";
+}
+
+.fa-signature-slash:before {
+  content: "\e3cb";
+}
+
+.fa-thumb-tack:before, .fa-thumbtack:before {
+  content: "\f08d";
+}
+
+.fa-wheat-slash:before {
+  content: "\e339";
+}
+
+.fa-trophy:before {
+  content: "\f091";
+}
+
+.fa-clouds-sun:before {
+  content: "\f746";
+}
+
+.fa-person-praying:before, .fa-pray:before {
+  content: "\f683";
+}
+
+.fa-hammer:before {
+  content: "\f6e3";
+}
+
+.fa-face-vomit:before {
+  content: "\e3a0";
+}
+
+.fa-speakers:before {
+  content: "\f8e0";
+}
+
+.fa-teletype-answer:before, .fa-tty-answer:before {
+  content: "\e2b9";
+}
+
+.fa-mug-tea-saucer:before {
+  content: "\e1f5";
+}
+
+.fa-diagram-lean-canvas:before {
+  content: "\e156";
+}
+
+.fa-alt:before {
+  content: "\e08a";
+}
+
+.fa-dial-med-high:before, .fa-dial:before {
+  content: "\e15b";
+}
+
+.fa-hand-peace:before {
+  content: "\f25b";
+}
+
+.fa-circle-trash:before, .fa-trash-circle:before {
+  content: "\e126";
+}
+
+.fa-rotate:before, .fa-sync-alt:before {
+  content: "\f2f1";
+}
+
+.fa-circle-quarters:before {
+  content: "\e3f8";
+}
+
+.fa-spinner:before {
+  content: "\f110";
+}
+
+.fa-tower-control:before {
+  content: "\e2a2";
+}
+
+.fa-arrow-up-triangle-square:before, .fa-sort-shapes-up:before {
+  content: "\f88a";
+}
+
+.fa-whale:before {
+  content: "\f72c";
+}
+
+.fa-robot:before {
+  content: "\f544";
+}
+
+.fa-peace:before {
+  content: "\f67c";
+}
+
+.fa-party-horn:before {
+  content: "\e31b";
+}
+
+.fa-cogs:before, .fa-gears:before {
+  content: "\f085";
+}
+
+.fa-sun-alt:before, .fa-sun-bright:before {
+  content: "\e28f";
+}
+
+.fa-warehouse:before {
+  content: "\f494";
+}
+
+.fa-conveyor-belt-arm:before {
+  content: "\e5f8";
+}
+
+.fa-lock-keyhole-open:before, .fa-lock-open-alt:before {
+  content: "\f3c2";
+}
+
+.fa-box-fragile:before, .fa-square-fragile:before, .fa-square-wine-glass-crack:before {
+  content: "\f49b";
+}
+
+.fa-arrow-up-right-dots:before {
+  content: "\e4b7";
+}
+
+.fa-square-n:before {
+  content: "\e277";
+}
+
+.fa-splotch:before {
+  content: "\f5bc";
+}
+
+.fa-face-grin-hearts:before, .fa-grin-hearts:before {
+  content: "\f584";
+}
+
+.fa-meter:before {
+  content: "\e1e8";
+}
+
+.fa-mandolin:before {
+  content: "\f6f9";
+}
+
+.fa-dice-four:before {
+  content: "\f524";
+}
+
+.fa-sim-card:before {
+  content: "\f7c4";
+}
+
+.fa-transgender-alt:before, .fa-transgender:before {
+  content: "\f225";
+}
+
+.fa-mercury:before {
+  content: "\f223";
+}
+
+.fa-up-from-bracket:before {
+  content: "\e590";
+}
+
+.fa-knife-kitchen:before {
+  content: "\f6f5";
+}
+
+.fa-border-right:before {
+  content: "\f852";
+}
+
+.fa-arrow-turn-down:before, .fa-level-down:before {
+  content: "\f149";
+}
+
+.fa-spade:before {
+  content: "\f2f4";
+}
+
+.fa-card-spade:before {
+  content: "\e3ec";
+}
+
+.fa-line-columns:before {
+  content: "\f870";
+}
+
+.fa-ant:before {
+  content: "\e680";
+}
+
+.fa-arrow-right-to-line:before, .fa-arrow-to-right:before {
+  content: "\f340";
+}
+
+.fa-person-falling-burst:before {
+  content: "\e547";
+}
+
+.fa-flag-pennant:before, .fa-pennant:before {
+  content: "\f456";
+}
+
+.fa-conveyor-belt-empty:before {
+  content: "\e150";
+}
+
+.fa-user-group-simple:before {
+  content: "\e603";
+}
+
+.fa-award:before {
+  content: "\f559";
+}
+
+.fa-ticket-alt:before, .fa-ticket-simple:before {
+  content: "\f3ff";
+}
+
+.fa-building:before {
+  content: "\f1ad";
+}
+
+.fa-angle-double-left:before, .fa-angles-left:before {
+  content: "\f100";
+}
+
+.fa-camcorder:before, .fa-video-handheld:before {
+  content: "\f8a8";
+}
+
+.fa-pancakes:before {
+  content: "\e42d";
+}
+
+.fa-album-circle-user:before {
+  content: "\e48d";
+}
+
+.fa-subtitles-slash:before {
+  content: "\e610";
+}
+
+.fa-qrcode:before {
+  content: "\f029";
+}
+
+.fa-dice-d10:before {
+  content: "\f6cd";
+}
+
+.fa-fireplace:before {
+  content: "\f79a";
+}
+
+.fa-browser:before {
+  content: "\f37e";
+}
+
+.fa-pen-paintbrush:before, .fa-pencil-paintbrush:before {
+  content: "\f618";
+}
+
+.fa-fish-cooked:before {
+  content: "\f7fe";
+}
+
+.fa-chair-office:before {
+  content: "\f6c1";
+}
+
+.fa-magnifying-glass-music:before {
+  content: "\e65f";
+}
+
+.fa-nesting-dolls:before {
+  content: "\e3ba";
+}
+
+.fa-clock-rotate-left:before, .fa-history:before {
+  content: "\f1da";
+}
+
+.fa-trumpet:before {
+  content: "\f8e3";
+}
+
+.fa-face-grin-beam-sweat:before, .fa-grin-beam-sweat:before {
+  content: "\f583";
+}
+
+.fa-fire-smoke:before {
+  content: "\f74b";
+}
+
+.fa-phone-missed:before {
+  content: "\e226";
+}
+
+.fa-arrow-right-from-file:before, .fa-file-export:before {
+  content: "\f56e";
+}
+
+.fa-shield-blank:before, .fa-shield:before {
+  content: "\f132";
+}
+
+.fa-arrow-up-short-wide:before, .fa-sort-amount-up-alt:before {
+  content: "\f885";
+}
+
+.fa-arrows-repeat-1:before, .fa-repeat-1-alt:before {
+  content: "\f366";
+}
+
+.fa-gun-slash:before {
+  content: "\e19c";
+}
+
+.fa-avocado:before {
+  content: "\e0aa";
+}
+
+.fa-binary:before {
+  content: "\e33b";
+}
+
+.fa-glasses-alt:before, .fa-glasses-round:before {
+  content: "\f5f5";
+}
+
+.fa-phone-plus:before {
+  content: "\f4d2";
+}
+
+.fa-ditto:before {
+  content: "\22";
+}
+
+.fa-person-seat:before {
+  content: "\e21e";
+}
+
+.fa-house-medical:before {
+  content: "\e3b2";
+}
+
+.fa-golf-ball-tee:before, .fa-golf-ball:before {
+  content: "\f450";
+}
+
+.fa-chevron-circle-left:before, .fa-circle-chevron-left:before {
+  content: "\f137";
+}
+
+.fa-house-chimney-window:before {
+  content: "\e00d";
+}
+
+.fa-scythe:before {
+  content: "\f710";
+}
+
+.fa-pen-nib:before {
+  content: "\f5ad";
+}
+
+.fa-ban-parking:before, .fa-parking-circle-slash:before {
+  content: "\f616";
+}
+
+.fa-tent-arrow-turn-left:before {
+  content: "\e580";
+}
+
+.fa-face-diagonal-mouth:before {
+  content: "\e47e";
+}
+
+.fa-diagram-cells:before {
+  content: "\e475";
+}
+
+.fa-cricket-bat-ball:before, .fa-cricket:before {
+  content: "\f449";
+}
+
+.fa-tents:before {
+  content: "\e582";
+}
+
+.fa-magic:before, .fa-wand-magic:before {
+  content: "\f0d0";
+}
+
+.fa-dog:before {
+  content: "\f6d3";
+}
+
+.fa-pen-line:before {
+  content: "\e212";
+}
+
+.fa-atom-alt:before, .fa-atom-simple:before {
+  content: "\f5d3";
+}
+
+.fa-ampersand:before {
+  content: "\26";
+}
+
+.fa-carrot:before {
+  content: "\f787";
+}
+
+.fa-arrow-from-bottom:before, .fa-arrow-up-from-line:before {
+  content: "\f342";
+}
+
+.fa-moon:before {
+  content: "\f186";
+}
+
+.fa-pen-slash:before {
+  content: "\e213";
+}
+
+.fa-wine-glass-alt:before, .fa-wine-glass-empty:before {
+  content: "\f5ce";
+}
+
+.fa-square-star:before {
+  content: "\e27f";
+}
+
+.fa-cheese:before {
+  content: "\f7ef";
+}
+
+.fa-send-backward:before {
+  content: "\f87f";
+}
+
+.fa-yin-yang:before {
+  content: "\f6ad";
+}
+
+.fa-music:before {
+  content: "\f001";
+}
+
+.fa-compass-slash:before {
+  content: "\f5e9";
+}
+
+.fa-clock-one:before {
+  content: "\e34e";
+}
+
+.fa-file-music:before {
+  content: "\f8b6";
+}
+
+.fa-code-commit:before {
+  content: "\f386";
+}
+
+.fa-temperature-low:before {
+  content: "\f76b";
+}
+
+.fa-biking:before, .fa-person-biking:before {
+  content: "\f84a";
+}
+
+.fa-display-chart-up-circle-currency:before {
+  content: "\e5e5";
+}
+
+.fa-skeleton:before {
+  content: "\f620";
+}
+
+.fa-circle-g:before {
+  content: "\e10f";
+}
+
+.fa-circle-arrow-up-left:before {
+  content: "\e0fb";
+}
+
+.fa-coin-blank:before {
+  content: "\e3fb";
+}
+
+.fa-broom:before {
+  content: "\f51a";
+}
+
+.fa-vacuum:before {
+  content: "\e04d";
+}
+
+.fa-shield-heart:before {
+  content: "\e574";
+}
+
+.fa-card-heart:before {
+  content: "\e3eb";
+}
+
+.fa-lightbulb-cfl-on:before {
+  content: "\e5a7";
+}
+
+.fa-melon:before {
+  content: "\e310";
+}
+
+.fa-gopuram:before {
+  content: "\f664";
+}
+
+.fa-earth-oceania:before, .fa-globe-oceania:before {
+  content: "\e47b";
+}
+
+.fa-container-storage:before {
+  content: "\f4b7";
+}
+
+.fa-face-pouting:before {
+  content: "\e387";
+}
+
+.fa-square-xmark:before, .fa-times-square:before, .fa-xmark-square:before {
+  content: "\f2d3";
+}
+
+.fa-exploding-head:before, .fa-face-explode:before {
+  content: "\e2fe";
+}
+
+.fa-hashtag:before {
+  content: "\23";
+}
+
+.fa-expand-alt:before, .fa-up-right-and-down-left-from-center:before {
+  content: "\f424";
+}
+
+.fa-oil-can:before {
+  content: "\f613";
+}
+
+.fa-t:before {
+  content: "\54";
+}
+
+.fa-transformer-bolt:before {
+  content: "\e2a4";
+}
+
+.fa-hippo:before {
+  content: "\f6ed";
+}
+
+.fa-chart-column:before {
+  content: "\e0e3";
+}
+
+.fa-cassette-vhs:before, .fa-vhs:before {
+  content: "\f8ec";
+}
+
+.fa-infinity:before {
+  content: "\f534";
+}
+
+.fa-vial-circle-check:before {
+  content: "\e596";
+}
+
+.fa-chimney:before {
+  content: "\f78b";
+}
+
+.fa-object-intersect:before {
+  content: "\e49d";
+}
+
+.fa-person-arrow-down-to-line:before {
+  content: "\e538";
+}
+
+.fa-voicemail:before {
+  content: "\f897";
+}
+
+.fa-block-brick:before, .fa-wall-brick:before {
+  content: "\e3db";
+}
+
+.fa-fan:before {
+  content: "\f863";
+}
+
+.fa-bags-shopping:before {
+  content: "\f847";
+}
+
+.fa-paragraph-left:before, .fa-paragraph-rtl:before {
+  content: "\f878";
+}
+
+.fa-person-walking-luggage:before {
+  content: "\e554";
+}
+
+.fa-caravan-alt:before, .fa-caravan-simple:before {
+  content: "\e000";
+}
+
+.fa-turtle:before {
+  content: "\f726";
+}
+
+.fa-pencil-mechanical:before {
+  content: "\e5ca";
+}
+
+.fa-arrows-alt-v:before, .fa-up-down:before {
+  content: "\f338";
+}
+
+.fa-cloud-moon-rain:before {
+  content: "\f73c";
+}
+
+.fa-booth-curtain:before {
+  content: "\f734";
+}
+
+.fa-calendar:before {
+  content: "\f133";
+}
+
+.fa-box-heart:before {
+  content: "\f49d";
+}
+
+.fa-trailer:before {
+  content: "\e041";
+}
+
+.fa-user-doctor-message:before, .fa-user-md-chat:before {
+  content: "\f82e";
+}
+
+.fa-bahai:before, .fa-haykal:before {
+  content: "\f666";
+}
+
+.fa-lighthouse:before {
+  content: "\e612";
+}
+
+.fa-amp-guitar:before {
+  content: "\f8a1";
+}
+
+.fa-sd-card:before {
+  content: "\f7c2";
+}
+
+.fa-volume-slash:before {
+  content: "\f2e2";
+}
+
+.fa-border-bottom:before {
+  content: "\f84d";
+}
+
+.fa-wifi-1:before, .fa-wifi-weak:before {
+  content: "\f6aa";
+}
+
+.fa-dragon:before {
+  content: "\f6d5";
+}
+
+.fa-shoe-prints:before {
+  content: "\f54b";
+}
+
+.fa-circle-plus:before, .fa-plus-circle:before {
+  content: "\f055";
+}
+
+.fa-face-grin-tongue-wink:before, .fa-grin-tongue-wink:before {
+  content: "\f58b";
+}
+
+.fa-hand-holding:before {
+  content: "\f4bd";
+}
+
+.fa-plug-circle-exclamation:before {
+  content: "\e55d";
+}
+
+.fa-chain-broken:before, .fa-chain-slash:before, .fa-link-slash:before, .fa-unlink:before {
+  content: "\f127";
+}
+
+.fa-clone:before {
+  content: "\f24d";
+}
+
+.fa-person-walking-arrow-loop-left:before {
+  content: "\e551";
+}
+
+.fa-arrow-up-z-a:before, .fa-sort-alpha-up-alt:before {
+  content: "\f882";
+}
+
+.fa-fire-alt:before, .fa-fire-flame-curved:before {
+  content: "\f7e4";
+}
+
+.fa-tornado:before {
+  content: "\f76f";
+}
+
+.fa-file-circle-plus:before {
+  content: "\e494";
+}
+
+.fa-delete-right:before {
+  content: "\e154";
+}
+
+.fa-book-quran:before, .fa-quran:before {
+  content: "\f687";
+}
+
+.fa-circle-quarter:before {
+  content: "\e11f";
+}
+
+.fa-anchor:before {
+  content: "\f13d";
+}
+
+.fa-border-all:before {
+  content: "\f84c";
+}
+
+.fa-function:before {
+  content: "\f661";
+}
+
+.fa-angry:before, .fa-face-angry:before {
+  content: "\f556";
+}
+
+.fa-people-simple:before {
+  content: "\e21b";
+}
+
+.fa-cookie-bite:before {
+  content: "\f564";
+}
+
+.fa-arrow-trend-down:before {
+  content: "\e097";
+}
+
+.fa-feed:before, .fa-rss:before {
+  content: "\f09e";
+}
+
+.fa-face-monocle:before {
+  content: "\e380";
+}
+
+.fa-draw-polygon:before {
+  content: "\f5ee";
+}
+
+.fa-balance-scale:before, .fa-scale-balanced:before {
+  content: "\f24e";
+}
+
+.fa-calendar-lines:before, .fa-calendar-note:before {
+  content: "\e0d5";
+}
+
+.fa-arrow-down-big-small:before, .fa-sort-size-down:before {
+  content: "\f88c";
+}
+
+.fa-gauge-simple-high:before, .fa-tachometer-fast:before, .fa-tachometer:before {
+  content: "\f62a";
+}
+
+.fa-do-not-enter:before {
+  content: "\f5ec";
+}
+
+.fa-shower:before {
+  content: "\f2cc";
+}
+
+.fa-dice-d8:before {
+  content: "\f6d2";
+}
+
+.fa-desktop-alt:before, .fa-desktop:before {
+  content: "\f390";
+}
+
+.fa-m:before {
+  content: "\4d";
+}
+
+.fa-spinner-scale:before {
+  content: "\e62a";
+}
+
+.fa-grip-dots-vertical:before {
+  content: "\e411";
+}
+
+.fa-face-viewfinder:before {
+  content: "\e2ff";
+}
+
+.fa-creemee:before, .fa-soft-serve:before {
+  content: "\e400";
+}
+
+.fa-h5:before {
+  content: "\e412";
+}
+
+.fa-hand-back-point-down:before {
+  content: "\e19e";
+}
+
+.fa-table-list:before, .fa-th-list:before {
+  content: "\f00b";
+}
+
+.fa-basket-shopping-minus:before {
+  content: "\e652";
+}
+
+.fa-comment-sms:before, .fa-sms:before {
+  content: "\f7cd";
+}
+
+.fa-rectangle-landscape:before, .fa-rectangle:before {
+  content: "\f2fa";
+}
+
+.fa-clipboard-list-check:before {
+  content: "\f737";
+}
+
+.fa-turkey:before {
+  content: "\f725";
+}
+
+.fa-book:before {
+  content: "\f02d";
+}
+
+.fa-user-plus:before {
+  content: "\f234";
+}
+
+.fa-ice-skate:before {
+  content: "\f7ac";
+}
+
+.fa-check:before {
+  content: "\f00c";
+}
+
+.fa-battery-4:before, .fa-battery-three-quarters:before {
+  content: "\f241";
+}
+
+.fa-tomato:before {
+  content: "\e330";
+}
+
+.fa-sword-laser:before {
+  content: "\e03b";
+}
+
+.fa-house-circle-check:before {
+  content: "\e509";
+}
+
+.fa-buildings:before {
+  content: "\e0cc";
+}
+
+.fa-angle-left:before {
+  content: "\f104";
+}
+
+.fa-cart-flatbed-boxes:before, .fa-dolly-flatbed-alt:before {
+  content: "\f475";
+}
+
+.fa-diagram-successor:before {
+  content: "\e47a";
+}
+
+.fa-truck-arrow-right:before {
+  content: "\e58b";
+}
+
+.fa-square-w:before {
+  content: "\e285";
+}
+
+.fa-arrows-split-up-and-left:before {
+  content: "\e4bc";
+}
+
+.fa-lamp:before {
+  content: "\f4ca";
+}
+
+.fa-airplay:before {
+  content: "\e089";
+}
+
+.fa-fist-raised:before, .fa-hand-fist:before {
+  content: "\f6de";
+}
+
+.fa-shield-quartered:before {
+  content: "\e575";
+}
+
+.fa-slash-forward:before {
+  content: "\2f";
+}
+
+.fa-location-pen:before, .fa-map-marker-edit:before {
+  content: "\f607";
+}
+
+.fa-cloud-moon:before {
+  content: "\f6c3";
+}
+
+.fa-pot-food:before {
+  content: "\e43f";
+}
+
+.fa-briefcase:before {
+  content: "\f0b1";
+}
+
+.fa-person-falling:before {
+  content: "\e546";
+}
+
+.fa-image-portrait:before, .fa-portrait:before {
+  content: "\f3e0";
+}
+
+.fa-user-tag:before {
+  content: "\f507";
+}
+
+.fa-rug:before {
+  content: "\e569";
+}
+
+.fa-print-slash:before {
+  content: "\f686";
+}
+
+.fa-earth-europe:before, .fa-globe-europe:before {
+  content: "\f7a2";
+}
+
+.fa-cart-flatbed-suitcase:before, .fa-luggage-cart:before {
+  content: "\f59d";
+}
+
+.fa-hand-back-point-ribbon:before {
+  content: "\e1a0";
+}
+
+.fa-rectangle-times:before, .fa-rectangle-xmark:before, .fa-times-rectangle:before, .fa-window-close:before {
+  content: "\f410";
+}
+
+.fa-tire-rugged:before {
+  content: "\f634";
+}
+
+.fa-lightbulb-dollar:before {
+  content: "\f670";
+}
+
+.fa-cowbell:before {
+  content: "\f8b3";
+}
+
+.fa-baht-sign:before {
+  content: "\e0ac";
+}
+
+.fa-corner:before {
+  content: "\e3fe";
+}
+
+.fa-chevron-double-right:before, .fa-chevrons-right:before {
+  content: "\f324";
+}
+
+.fa-book-open:before {
+  content: "\f518";
+}
+
+.fa-book-journal-whills:before, .fa-journal-whills:before {
+  content: "\f66a";
+}
+
+.fa-inhaler:before {
+  content: "\f5f9";
+}
+
+.fa-handcuffs:before {
+  content: "\e4f8";
+}
+
+.fa-snake:before {
+  content: "\f716";
+}
+
+.fa-exclamation-triangle:before, .fa-triangle-exclamation:before, .fa-warning:before {
+  content: "\f071";
+}
+
+.fa-note-medical:before {
+  content: "\e200";
+}
+
+.fa-database:before {
+  content: "\f1c0";
+}
+
+.fa-down-left:before {
+  content: "\e16a";
+}
+
+.fa-mail-forward:before, .fa-share:before {
+  content: "\f064";
+}
+
+.fa-face-thinking:before {
+  content: "\e39b";
+}
+
+.fa-turn-down-right:before {
+  content: "\e455";
+}
+
+.fa-bottle-droplet:before {
+  content: "\e4c4";
+}
+
+.fa-mask-face:before {
+  content: "\e1d7";
+}
+
+.fa-hill-rockslide:before {
+  content: "\e508";
+}
+
+.fa-scanner-keyboard:before {
+  content: "\f489";
+}
+
+.fa-circle-o:before {
+  content: "\e119";
+}
+
+.fa-grid-horizontal:before {
+  content: "\e307";
+}
+
+.fa-comment-alt-dollar:before, .fa-message-dollar:before {
+  content: "\f650";
+}
+
+.fa-exchange-alt:before, .fa-right-left:before {
+  content: "\f362";
+}
+
+.fa-columns-3:before {
+  content: "\e361";
+}
+
+.fa-paper-plane:before {
+  content: "\f1d8";
+}
+
+.fa-road-circle-exclamation:before {
+  content: "\e565";
+}
+
+.fa-dungeon:before {
+  content: "\f6d9";
+}
+
+.fa-hand-holding-box:before {
+  content: "\f47b";
+}
+
+.fa-input-text:before {
+  content: "\e1bf";
+}
+
+.fa-window-alt:before, .fa-window-flip:before {
+  content: "\f40f";
+}
+
+.fa-align-right:before {
+  content: "\f038";
+}
+
+.fa-scanner-gun:before, .fa-scanner:before {
+  content: "\f488";
+}
+
+.fa-tire:before {
+  content: "\f631";
+}
+
+.fa-engine:before {
+  content: "\e16e";
+}
+
+.fa-money-bill-1-wave:before, .fa-money-bill-wave-alt:before {
+  content: "\f53b";
+}
+
+.fa-life-ring:before {
+  content: "\f1cd";
+}
+
+.fa-hands:before, .fa-sign-language:before, .fa-signing:before {
+  content: "\f2a7";
+}
+
+.fa-caret-circle-right:before, .fa-circle-caret-right:before {
+  content: "\f330";
+}
+
+.fa-turn-left:before {
+  content: "\e636";
+}
+
+.fa-wheat:before {
+  content: "\f72d";
+}
+
+.fa-file-spreadsheet:before {
+  content: "\f65b";
+}
+
+.fa-audio-description-slash:before {
+  content: "\e0a8";
+}
+
+.fa-bell-ring:before {
+  content: "\e62c";
+}
+
+.fa-calendar-day:before {
+  content: "\f783";
+}
+
+.fa-ladder-water:before, .fa-swimming-pool:before, .fa-water-ladder:before {
+  content: "\f5c5";
+}
+
+.fa-arrows-up-down:before, .fa-arrows-v:before {
+  content: "\f07d";
+}
+
+.fa-chess-pawn-alt:before, .fa-chess-pawn-piece:before {
+  content: "\f444";
+}
+
+.fa-face-grimace:before, .fa-grimace:before {
+  content: "\f57f";
+}
+
+.fa-wheelchair-alt:before, .fa-wheelchair-move:before {
+  content: "\e2ce";
+}
+
+.fa-level-down-alt:before, .fa-turn-down:before {
+  content: "\f3be";
+}
+
+.fa-square-s:before {
+  content: "\e27d";
+}
+
+.fa-barcode-alt:before, .fa-rectangle-barcode:before {
+  content: "\f463";
+}
+
+.fa-person-walking-arrow-right:before {
+  content: "\e552";
+}
+
+.fa-envelope-square:before, .fa-square-envelope:before {
+  content: "\f199";
+}
+
+.fa-dice:before {
+  content: "\f522";
+}
+
+.fa-unicorn:before {
+  content: "\f727";
+}
+
+.fa-bowling-ball:before {
+  content: "\f436";
+}
+
+.fa-pompebled:before {
+  content: "\e43d";
+}
+
+.fa-brain:before {
+  content: "\f5dc";
+}
+
+.fa-watch-smart:before {
+  content: "\e2cc";
+}
+
+.fa-book-user:before {
+  content: "\f7e7";
+}
+
+.fa-sensor-cloud:before, .fa-sensor-smoke:before {
+  content: "\e02c";
+}
+
+.fa-clapperboard-play:before {
+  content: "\e132";
+}
+
+.fa-band-aid:before, .fa-bandage:before {
+  content: "\f462";
+}
+
+.fa-calendar-minus:before {
+  content: "\f272";
+}
+
+.fa-circle-xmark:before, .fa-times-circle:before, .fa-xmark-circle:before {
+  content: "\f057";
+}
+
+.fa-circle-4:before {
+  content: "\e0f1";
+}
+
+.fa-gifts:before {
+  content: "\f79c";
+}
+
+.fa-album-collection:before {
+  content: "\f8a0";
+}
+
+.fa-hotel:before {
+  content: "\f594";
+}
+
+.fa-earth-asia:before, .fa-globe-asia:before {
+  content: "\f57e";
+}
+
+.fa-id-card-alt:before, .fa-id-card-clip:before {
+  content: "\f47f";
+}
+
+.fa-magnifying-glass-plus:before, .fa-search-plus:before {
+  content: "\f00e";
+}
+
+.fa-thumbs-up:before {
+  content: "\f164";
+}
+
+.fa-cloud-showers:before {
+  content: "\f73f";
+}
+
+.fa-user-clock:before {
+  content: "\f4fd";
+}
+
+.fa-onion:before {
+  content: "\e427";
+}
+
+.fa-clock-twelve-thirty:before {
+  content: "\e359";
+}
+
+.fa-arrow-down-to-dotted-line:before {
+  content: "\e095";
+}
+
+.fa-allergies:before, .fa-hand-dots:before {
+  content: "\f461";
+}
+
+.fa-file-invoice:before {
+  content: "\f570";
+}
+
+.fa-window-minimize:before {
+  content: "\f2d1";
+}
+
+.fa-rectangle-wide:before {
+  content: "\f2fc";
+}
+
+.fa-comment-arrow-up:before {
+  content: "\e144";
+}
+
+.fa-garlic:before {
+  content: "\e40e";
+}
+
+.fa-coffee:before, .fa-mug-saucer:before {
+  content: "\f0f4";
+}
+
+.fa-brush:before {
+  content: "\f55d";
+}
+
+.fa-tree-decorated:before {
+  content: "\f7dc";
+}
+
+.fa-mask:before {
+  content: "\f6fa";
+}
+
+.fa-calendar-heart:before {
+  content: "\e0d3";
+}
+
+.fa-magnifying-glass-minus:before, .fa-search-minus:before {
+  content: "\f010";
+}
+
+.fa-flower:before {
+  content: "\f7ff";
+}
+
+.fa-arrow-down-from-arc:before {
+  content: "\e614";
+}
+
+.fa-right-left-large:before {
+  content: "\e5e1";
+}
+
+.fa-ruler-vertical:before {
+  content: "\f548";
+}
+
+.fa-circles-overlap:before {
+  content: "\e600";
+}
+
+.fa-user-alt:before, .fa-user-large:before {
+  content: "\f406";
+}
+
+.fa-starship-freighter:before {
+  content: "\e03a";
+}
+
+.fa-train-tram:before {
+  content: "\e5b4";
+}
+
+.fa-bridge-suspension:before {
+  content: "\e4cd";
+}
+
+.fa-trash-check:before {
+  content: "\e2af";
+}
+
+.fa-user-nurse:before {
+  content: "\f82f";
+}
+
+.fa-boombox:before {
+  content: "\f8a5";
+}
+
+.fa-syringe:before {
+  content: "\f48e";
+}
+
+.fa-cloud-sun:before {
+  content: "\f6c4";
+}
+
+.fa-shield-exclamation:before {
+  content: "\e247";
+}
+
+.fa-stopwatch-20:before {
+  content: "\e06f";
+}
+
+.fa-square-full:before {
+  content: "\f45c";
+}
+
+.fa-grip-dots:before {
+  content: "\e410";
+}
+
+.fa-comment-exclamation:before {
+  content: "\f4af";
+}
+
+.fa-pen-swirl:before {
+  content: "\e214";
+}
+
+.fa-falafel:before {
+  content: "\e40a";
+}
+
+.fa-circle-2:before {
+  content: "\e0ef";
+}
+
+.fa-magnet:before {
+  content: "\f076";
+}
+
+.fa-jar:before {
+  content: "\e516";
+}
+
+.fa-gramophone:before {
+  content: "\f8bd";
+}
+
+.fa-dice-d12:before {
+  content: "\f6ce";
+}
+
+.fa-note-sticky:before, .fa-sticky-note:before {
+  content: "\f249";
+}
+
+.fa-arrow-alt-down:before, .fa-down:before {
+  content: "\f354";
+}
+
+.fa-100:before, .fa-hundred-points:before {
+  content: "\e41c";
+}
+
+.fa-paperclip-vertical:before {
+  content: "\e3c2";
+}
+
+.fa-wind-circle-exclamation:before, .fa-wind-warning:before {
+  content: "\f776";
+}
+
+.fa-location-pin-slash:before, .fa-map-marker-slash:before {
+  content: "\f60c";
+}
+
+.fa-face-sad-sweat:before {
+  content: "\e38a";
+}
+
+.fa-bug-slash:before {
+  content: "\e490";
+}
+
+.fa-cupcake:before {
+  content: "\e402";
+}
+
+.fa-light-switch-off:before {
+  content: "\e018";
+}
+
+.fa-toggle-large-off:before {
+  content: "\e5b0";
+}
+
+.fa-pen-fancy-slash:before {
+  content: "\e210";
+}
+
+.fa-truck-container:before {
+  content: "\f4dc";
+}
+
+.fa-boot:before {
+  content: "\f782";
+}
+
+.fa-arrow-up-from-water-pump:before {
+  content: "\e4b6";
+}
+
+.fa-file-check:before {
+  content: "\f316";
+}
+
+.fa-bone:before {
+  content: "\f5d7";
+}
+
+.fa-cards-blank:before {
+  content: "\e4df";
+}
+
+.fa-circle-3:before {
+  content: "\e0f0";
+}
+
+.fa-bench-tree:before {
+  content: "\e2e7";
+}
+
+.fa-keyboard-brightness-low:before {
+  content: "\e1c1";
+}
+
+.fa-ski-boot-ski:before {
+  content: "\e3cd";
+}
+
+.fa-brain-circuit:before {
+  content: "\e0c6";
+}
+
+.fa-user-injured:before {
+  content: "\f728";
+}
+
+.fa-block-brick-fire:before, .fa-firewall:before {
+  content: "\e3dc";
+}
+
+.fa-face-sad-tear:before, .fa-sad-tear:before {
+  content: "\f5b4";
+}
+
+.fa-plane:before {
+  content: "\f072";
+}
+
+.fa-tent-arrows-down:before {
+  content: "\e581";
+}
+
+.fa-exclamation:before {
+  content: "\21";
+}
+
+.fa-arrows-spin:before {
+  content: "\e4bb";
+}
+
+.fa-face-smile-relaxed:before {
+  content: "\e392";
+}
+
+.fa-comment-times:before, .fa-comment-xmark:before {
+  content: "\f4b5";
+}
+
+.fa-print:before {
+  content: "\f02f";
+}
+
+.fa-try:before, .fa-turkish-lira-sign:before, .fa-turkish-lira:before {
+  content: "\e2bb";
+}
+
+.fa-face-nose-steam:before {
+  content: "\e382";
+}
+
+.fa-circle-waveform-lines:before, .fa-waveform-circle:before {
+  content: "\e12d";
+}
+
+.fa-dollar-sign:before, .fa-dollar:before, .fa-usd:before {
+  content: "\24";
+}
+
+.fa-ferris-wheel:before {
+  content: "\e174";
+}
+
+.fa-computer-speaker:before {
+  content: "\f8b2";
+}
+
+.fa-skull-cow:before {
+  content: "\f8de";
+}
+
+.fa-x:before {
+  content: "\58";
+}
+
+.fa-magnifying-glass-dollar:before, .fa-search-dollar:before {
+  content: "\f688";
+}
+
+.fa-users-cog:before, .fa-users-gear:before {
+  content: "\f509";
+}
+
+.fa-person-military-pointing:before {
+  content: "\e54a";
+}
+
+.fa-bank:before, .fa-building-columns:before, .fa-institution:before, .fa-museum:before, .fa-university:before {
+  content: "\f19c";
+}
+
+.fa-circle-t:before {
+  content: "\e124";
+}
+
+.fa-sack:before {
+  content: "\f81c";
+}
+
+.fa-grid-2:before {
+  content: "\e196";
+}
+
+.fa-camera-cctv:before, .fa-cctv:before {
+  content: "\f8ac";
+}
+
+.fa-umbrella:before {
+  content: "\f0e9";
+}
+
+.fa-trowel:before {
+  content: "\e589";
+}
+
+.fa-horizontal-rule:before {
+  content: "\f86c";
+}
+
+.fa-bed-alt:before, .fa-bed-front:before {
+  content: "\f8f7";
+}
+
+.fa-d:before {
+  content: "\44";
+}
+
+.fa-stapler:before {
+  content: "\e5af";
+}
+
+.fa-masks-theater:before, .fa-theater-masks:before {
+  content: "\f630";
+}
+
+.fa-file-gif:before {
+  content: "\e645";
+}
+
+.fa-kip-sign:before {
+  content: "\e1c4";
+}
+
+.fa-face-woozy:before {
+  content: "\e3a2";
+}
+
+.fa-cloud-question:before {
+  content: "\e492";
+}
+
+.fa-pineapple:before {
+  content: "\e31f";
+}
+
+.fa-hand-point-left:before {
+  content: "\f0a5";
+}
+
+.fa-gallery-thumbnails:before {
+  content: "\e3aa";
+}
+
+.fa-circle-j:before {
+  content: "\e112";
+}
+
+.fa-eyes:before {
+  content: "\e367";
+}
+
+.fa-handshake-alt:before, .fa-handshake-simple:before {
+  content: "\f4c6";
+}
+
+.fa-file-caret-up:before, .fa-page-caret-up:before {
+  content: "\e42a";
+}
+
+.fa-fighter-jet:before, .fa-jet-fighter:before {
+  content: "\f0fb";
+}
+
+.fa-comet:before {
+  content: "\e003";
+}
+
+.fa-share-alt-square:before, .fa-square-share-nodes:before {
+  content: "\f1e1";
+}
+
+.fa-reflect-vertical:before {
+  content: "\e665";
+}
+
+.fa-shield-keyhole:before {
+  content: "\e248";
+}
+
+.fa-file-mp4:before {
+  content: "\e649";
+}
+
+.fa-barcode:before {
+  content: "\f02a";
+}
+
+.fa-bulldozer:before {
+  content: "\e655";
+}
+
+.fa-plus-minus:before {
+  content: "\e43c";
+}
+
+.fa-sliders-v-square:before, .fa-square-sliders-vertical:before {
+  content: "\f3f2";
+}
+
+.fa-video-camera:before, .fa-video:before {
+  content: "\f03d";
+}
+
+.fa-comment-middle-alt:before, .fa-message-middle:before {
+  content: "\e1e1";
+}
+
+.fa-graduation-cap:before, .fa-mortar-board:before {
+  content: "\f19d";
+}
+
+.fa-hand-holding-medical:before {
+  content: "\e05c";
+}
+
+.fa-person-circle-check:before {
+  content: "\e53e";
+}
+
+.fa-square-z:before {
+  content: "\e288";
+}
+
+.fa-comment-alt-text:before, .fa-message-text:before {
+  content: "\e1e6";
+}
+
+.fa-level-up-alt:before, .fa-turn-up:before {
+  content: "\f3bf";
+}
+
+.fa-sr-only, .fa-sr-only-focusable:not(:focus), .sr-only, .sr-only-focusable:not(:focus) {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  margin: -1px;
+  overflow: hidden;
+  clip: rect(0,0,0,0);
+  white-space: nowrap;
+  border-width: 0;
+}
+
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Brands-9f495c22369544f2a6865c9d60b59dee.woff2 b/WebContentt/public/assets/fonts/Font Awesome 5 Brands-9f495c22369544f2a6865c9d60b59dee.woff2
new file mode 100644
index 0000000..7ba04fd
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Brands-9f495c22369544f2a6865c9d60b59dee.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Brands-ea242bb20f9fe7db35296896fae9867f.ttf b/WebContentt/public/assets/fonts/Font Awesome 5 Brands-ea242bb20f9fe7db35296896fae9867f.ttf
new file mode 100644
index 0000000..0a9bbcb
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Brands-ea242bb20f9fe7db35296896fae9867f.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-0609b5442e186979b732d3eecf885c57.ttf b/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-0609b5442e186979b732d3eecf885c57.ttf
new file mode 100644
index 0000000..3bf6124
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-0609b5442e186979b732d3eecf885c57.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2 b/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2
new file mode 100644
index 0000000..5610392
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf
new file mode 100644
index 0000000..e19253e
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-813a01e49b4431cc33412a84ca94d347.woff2 b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-813a01e49b4431cc33412a84ca94d347.woff2
new file mode 100644
index 0000000..cab6e63
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-813a01e49b4431cc33412a84ca94d347.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2 b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2
new file mode 100644
index 0000000..2d6e8f9
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-87a1b179a40953ca88a6205650aa32c9.ttf b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-87a1b179a40953ca88a6205650aa32c9.ttf
new file mode 100644
index 0000000..c1f8cb4
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-87a1b179a40953ca88a6205650aa32c9.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-8a781dd91fd45555bafe112b5008c208.ttf b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-8a781dd91fd45555bafe112b5008c208.ttf
new file mode 100644
index 0000000..dea07d6
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-8a781dd91fd45555bafe112b5008c208.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 5 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2 b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2
new file mode 100644
index 0000000..fdfc265
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 5 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Brands-9f495c22369544f2a6865c9d60b59dee.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Brands-9f495c22369544f2a6865c9d60b59dee.woff2
new file mode 100644
index 0000000..7ba04fd
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Brands-9f495c22369544f2a6865c9d60b59dee.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Brands-ea242bb20f9fe7db35296896fae9867f.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Brands-ea242bb20f9fe7db35296896fae9867f.ttf
new file mode 100644
index 0000000..0a9bbcb
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Brands-ea242bb20f9fe7db35296896fae9867f.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-0609b5442e186979b732d3eecf885c57.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-0609b5442e186979b732d3eecf885c57.ttf
new file mode 100644
index 0000000..3bf6124
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-0609b5442e186979b732d3eecf885c57.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2
new file mode 100644
index 0000000..5610392
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Duotone-941715f4aecfe6f923ad4d98b8e09408.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf
new file mode 100644
index 0000000..e19253e
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-3724e0236c1ca473e4d73f7065e5de28.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-4eda3069f6f64ce115228a4726aef19f.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-4eda3069f6f64ce115228a4726aef19f.ttf
new file mode 100644
index 0000000..d692a62
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-4eda3069f6f64ce115228a4726aef19f.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-61d823b3361d879c119cf056e85d3dbf.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-61d823b3361d879c119cf056e85d3dbf.woff2
new file mode 100644
index 0000000..131fe6d
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-61d823b3361d879c119cf056e85d3dbf.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-813a01e49b4431cc33412a84ca94d347.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-813a01e49b4431cc33412a84ca94d347.woff2
new file mode 100644
index 0000000..cab6e63
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-813a01e49b4431cc33412a84ca94d347.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2
new file mode 100644
index 0000000..2d6e8f9
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-82e3029674e5d3395e37aea7b40ecc63.woff2 differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-87a1b179a40953ca88a6205650aa32c9.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-87a1b179a40953ca88a6205650aa32c9.ttf
new file mode 100644
index 0000000..c1f8cb4
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-87a1b179a40953ca88a6205650aa32c9.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-8a781dd91fd45555bafe112b5008c208.ttf b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-8a781dd91fd45555bafe112b5008c208.ttf
new file mode 100644
index 0000000..dea07d6
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-8a781dd91fd45555bafe112b5008c208.ttf differ
diff --git a/WebContentt/public/assets/fonts/Font Awesome 6 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2 b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2
new file mode 100644
index 0000000..fdfc265
Binary files /dev/null and b/WebContentt/public/assets/fonts/Font Awesome 6 Pro-e17c2daa07b98413686eaeccf1f5e65a.woff2 differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-01b9ff0cac2f6363c217c19d5787b037.ttf b/WebContentt/public/assets/fonts/FontAwesome-01b9ff0cac2f6363c217c19d5787b037.ttf
new file mode 100644
index 0000000..d39f4a8
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-01b9ff0cac2f6363c217c19d5787b037.ttf differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-3724e0236c1ca473e4d73f7065e5de28.ttf b/WebContentt/public/assets/fonts/FontAwesome-3724e0236c1ca473e4d73f7065e5de28.ttf
new file mode 100644
index 0000000..e19253e
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-3724e0236c1ca473e4d73f7065e5de28.ttf differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-817c19ff4bd5fc55e3922afce45e4117.woff2 b/WebContentt/public/assets/fonts/FontAwesome-817c19ff4bd5fc55e3922afce45e4117.woff2
new file mode 100644
index 0000000..66bc34b
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-817c19ff4bd5fc55e3922afce45e4117.woff2 differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-82e3029674e5d3395e37aea7b40ecc63.woff2 b/WebContentt/public/assets/fonts/FontAwesome-82e3029674e5d3395e37aea7b40ecc63.woff2
new file mode 100644
index 0000000..2d6e8f9
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-82e3029674e5d3395e37aea7b40ecc63.woff2 differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-8a781dd91fd45555bafe112b5008c208.ttf b/WebContentt/public/assets/fonts/FontAwesome-8a781dd91fd45555bafe112b5008c208.ttf
new file mode 100644
index 0000000..dea07d6
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-8a781dd91fd45555bafe112b5008c208.ttf differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-9f495c22369544f2a6865c9d60b59dee.woff2 b/WebContentt/public/assets/fonts/FontAwesome-9f495c22369544f2a6865c9d60b59dee.woff2
new file mode 100644
index 0000000..7ba04fd
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-9f495c22369544f2a6865c9d60b59dee.woff2 differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-e17c2daa07b98413686eaeccf1f5e65a.woff2 b/WebContentt/public/assets/fonts/FontAwesome-e17c2daa07b98413686eaeccf1f5e65a.woff2
new file mode 100644
index 0000000..fdfc265
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-e17c2daa07b98413686eaeccf1f5e65a.woff2 differ
diff --git a/WebContentt/public/assets/fonts/FontAwesome-ea242bb20f9fe7db35296896fae9867f.ttf b/WebContentt/public/assets/fonts/FontAwesome-ea242bb20f9fe7db35296896fae9867f.ttf
new file mode 100644
index 0000000..0a9bbcb
Binary files /dev/null and b/WebContentt/public/assets/fonts/FontAwesome-ea242bb20f9fe7db35296896fae9867f.ttf differ
diff --git a/WebContentt/public/assets/js/app.js b/WebContentt/public/assets/js/app.js
new file mode 100644
index 0000000..bf1a8d0
--- /dev/null
+++ b/WebContentt/public/assets/js/app.js
@@ -0,0 +1,14 @@
+
+
+function indexload(){
+    console.log("Index loaded");
+
+}
+
+function settingload(){
+    console.log("Setting loaded");
+}
+
+function loginload(){
+    console.log("Login loaded");
+}
\ No newline at end of file
diff --git a/WebContentt/public/assets/js/jquery-3.7.1.js b/WebContentt/public/assets/js/jquery-3.7.1.js
new file mode 100644
index 0000000..1a86433
--- /dev/null
+++ b/WebContentt/public/assets/js/jquery-3.7.1.js
@@ -0,0 +1,10716 @@
+/*!
+ * jQuery JavaScript Library v3.7.1
+ * https://jquery.com/
+ *
+ * Copyright OpenJS Foundation and other contributors
+ * Released under the MIT license
+ * https://jquery.org/license
+ *
+ * Date: 2023-08-28T13:37Z
+ */
+( function( global, factory ) {
+
+	"use strict";
+
+	if ( typeof module === "object" && typeof module.exports === "object" ) {
+
+		// For CommonJS and CommonJS-like environments where a proper `window`
+		// is present, execute the factory and get jQuery.
+		// For environments that do not have a `window` with a `document`
+		// (such as Node.js), expose a factory as module.exports.
+		// This accentuates the need for the creation of a real `window`.
+		// e.g. var jQuery = require("jquery")(window);
+		// See ticket trac-14549 for more info.
+		module.exports = global.document ?
+			factory( global, true ) :
+			function( w ) {
+				if ( !w.document ) {
+					throw new Error( "jQuery requires a window with a document" );
+				}
+				return factory( w );
+			};
+	} else {
+		factory( global );
+	}
+
+// Pass this if window is not defined yet
+} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+
+// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
+// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
+// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
+// enough that all such attempts are guarded in a try block.
+"use strict";
+
+var arr = [];
+
+var getProto = Object.getPrototypeOf;
+
+var slice = arr.slice;
+
+var flat = arr.flat ? function( array ) {
+	return arr.flat.call( array );
+} : function( array ) {
+	return arr.concat.apply( [], array );
+};
+
+
+var push = arr.push;
+
+var indexOf = arr.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var fnToString = hasOwn.toString;
+
+var ObjectFunctionString = fnToString.call( Object );
+
+var support = {};
+
+var isFunction = function isFunction( obj ) {
+
+		// Support: Chrome <=57, Firefox <=52
+		// In some browsers, typeof returns "function" for HTML <object> elements
+		// (i.e., `typeof document.createElement( "object" ) === "function"`).
+		// We don't want to classify *any* DOM node as a function.
+		// Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5
+		// Plus for old WebKit, typeof returns "function" for HTML collections
+		// (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756)
+		return typeof obj === "function" && typeof obj.nodeType !== "number" &&
+			typeof obj.item !== "function";
+	};
+
+
+var isWindow = function isWindow( obj ) {
+		return obj != null && obj === obj.window;
+	};
+
+
+var document = window.document;
+
+
+
+	var preservedScriptAttributes = {
+		type: true,
+		src: true,
+		nonce: true,
+		noModule: true
+	};
+
+	function DOMEval( code, node, doc ) {
+		doc = doc || document;
+
+		var i, val,
+			script = doc.createElement( "script" );
+
+		script.text = code;
+		if ( node ) {
+			for ( i in preservedScriptAttributes ) {
+
+				// Support: Firefox 64+, Edge 18+
+				// Some browsers don't support the "nonce" property on scripts.
+				// On the other hand, just using `getAttribute` is not enough as
+				// the `nonce` attribute is reset to an empty string whenever it
+				// becomes browsing-context connected.
+				// See https://github.com/whatwg/html/issues/2369
+				// See https://html.spec.whatwg.org/#nonce-attributes
+				// The `node.getAttribute` check was added for the sake of
+				// `jQuery.globalEval` so that it can fake a nonce-containing node
+				// via an object.
+				val = node[ i ] || node.getAttribute && node.getAttribute( i );
+				if ( val ) {
+					script.setAttribute( i, val );
+				}
+			}
+		}
+		doc.head.appendChild( script ).parentNode.removeChild( script );
+	}
+
+
+function toType( obj ) {
+	if ( obj == null ) {
+		return obj + "";
+	}
+
+	// Support: Android <=2.3 only (functionish RegExp)
+	return typeof obj === "object" || typeof obj === "function" ?
+		class2type[ toString.call( obj ) ] || "object" :
+		typeof obj;
+}
+/* global Symbol */
+// Defining this global in .eslintrc.json would create a danger of using the global
+// unguarded in another place, it seems safer to define global only for this module
+
+
+
+var version = "3.7.1",
+
+	rhtmlSuffix = /HTML$/i,
+
+	// Define a local copy of jQuery
+	jQuery = function( selector, context ) {
+
+		// The jQuery object is actually just the init constructor 'enhanced'
+		// Need init if jQuery is called (just allow error to be thrown if not included)
+		return new jQuery.fn.init( selector, context );
+	};
+
+jQuery.fn = jQuery.prototype = {
+
+	// The current version of jQuery being used
+	jquery: version,
+
+	constructor: jQuery,
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	toArray: function() {
+		return slice.call( this );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+
+		// Return all the elements in a clean array
+		if ( num == null ) {
+			return slice.call( this );
+		}
+
+		// Return just the one element from the set
+		return num < 0 ? this[ num + this.length ] : this[ num ];
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems ) {
+
+		// Build a new jQuery matched element set
+		var ret = jQuery.merge( this.constructor(), elems );
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	each: function( callback ) {
+		return jQuery.each( this, callback );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map( this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		} ) );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ) );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	even: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return ( i + 1 ) % 2;
+		} ) );
+	},
+
+	odd: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return i % 2;
+		} ) );
+	},
+
+	eq: function( i ) {
+		var len = this.length,
+			j = +i + ( i < 0 ? len : 0 );
+		return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
+	},
+
+	end: function() {
+		return this.prevObject || this.constructor();
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: arr.sort,
+	splice: arr.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+	var options, name, src, copy, copyIsArray, clone,
+		target = arguments[ 0 ] || {},
+		i = 1,
+		length = arguments.length,
+		deep = false;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+
+		// Skip the boolean and the target
+		target = arguments[ i ] || {};
+		i++;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !isFunction( target ) ) {
+		target = {};
+	}
+
+	// Extend jQuery itself if only one argument is passed
+	if ( i === length ) {
+		target = this;
+		i--;
+	}
+
+	for ( ; i < length; i++ ) {
+
+		// Only deal with non-null/undefined values
+		if ( ( options = arguments[ i ] ) != null ) {
+
+			// Extend the base object
+			for ( name in options ) {
+				copy = options[ name ];
+
+				// Prevent Object.prototype pollution
+				// Prevent never-ending loop
+				if ( name === "__proto__" || target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging plain objects or arrays
+				if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+					( copyIsArray = Array.isArray( copy ) ) ) ) {
+					src = target[ name ];
+
+					// Ensure proper type for the source value
+					if ( copyIsArray && !Array.isArray( src ) ) {
+						clone = [];
+					} else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) {
+						clone = {};
+					} else {
+						clone = src;
+					}
+					copyIsArray = false;
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend( {
+
+	// Unique for each copy of jQuery on the page
+	expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+	// Assume jQuery is ready without the ready module
+	isReady: true,
+
+	error: function( msg ) {
+		throw new Error( msg );
+	},
+
+	noop: function() {},
+
+	isPlainObject: function( obj ) {
+		var proto, Ctor;
+
+		// Detect obvious negatives
+		// Use toString instead of jQuery.type to catch host objects
+		if ( !obj || toString.call( obj ) !== "[object Object]" ) {
+			return false;
+		}
+
+		proto = getProto( obj );
+
+		// Objects with no prototype (e.g., `Object.create( null )`) are plain
+		if ( !proto ) {
+			return true;
+		}
+
+		// Objects with prototype are plain iff they were constructed by a global Object function
+		Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
+		return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
+	},
+
+	isEmptyObject: function( obj ) {
+		var name;
+
+		for ( name in obj ) {
+			return false;
+		}
+		return true;
+	},
+
+	// Evaluates a script in a provided context; falls back to the global one
+	// if not specified.
+	globalEval: function( code, options, doc ) {
+		DOMEval( code, { nonce: options && options.nonce }, doc );
+	},
+
+	each: function( obj, callback ) {
+		var length, i = 0;
+
+		if ( isArrayLike( obj ) ) {
+			length = obj.length;
+			for ( ; i < length; i++ ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		} else {
+			for ( i in obj ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		}
+
+		return obj;
+	},
+
+
+	// Retrieve the text value of an array of DOM nodes
+	text: function( elem ) {
+		var node,
+			ret = "",
+			i = 0,
+			nodeType = elem.nodeType;
+
+		if ( !nodeType ) {
+
+			// If no nodeType, this is expected to be an array
+			while ( ( node = elem[ i++ ] ) ) {
+
+				// Do not traverse comment nodes
+				ret += jQuery.text( node );
+			}
+		}
+		if ( nodeType === 1 || nodeType === 11 ) {
+			return elem.textContent;
+		}
+		if ( nodeType === 9 ) {
+			return elem.documentElement.textContent;
+		}
+		if ( nodeType === 3 || nodeType === 4 ) {
+			return elem.nodeValue;
+		}
+
+		// Do not include comment or processing instruction nodes
+
+		return ret;
+	},
+
+	// results is for internal usage only
+	makeArray: function( arr, results ) {
+		var ret = results || [];
+
+		if ( arr != null ) {
+			if ( isArrayLike( Object( arr ) ) ) {
+				jQuery.merge( ret,
+					typeof arr === "string" ?
+						[ arr ] : arr
+				);
+			} else {
+				push.call( ret, arr );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, arr, i ) {
+		return arr == null ? -1 : indexOf.call( arr, elem, i );
+	},
+
+	isXMLDoc: function( elem ) {
+		var namespace = elem && elem.namespaceURI,
+			docElem = elem && ( elem.ownerDocument || elem ).documentElement;
+
+		// Assume HTML when documentElement doesn't yet exist, such as inside
+		// document fragments.
+		return !rhtmlSuffix.test( namespace || docElem && docElem.nodeName || "HTML" );
+	},
+
+	// Support: Android <=4.0 only, PhantomJS 1 only
+	// push.apply(_, arraylike) throws on ancient WebKit
+	merge: function( first, second ) {
+		var len = +second.length,
+			j = 0,
+			i = first.length;
+
+		for ( ; j < len; j++ ) {
+			first[ i++ ] = second[ j ];
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, invert ) {
+		var callbackInverse,
+			matches = [],
+			i = 0,
+			length = elems.length,
+			callbackExpect = !invert;
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( ; i < length; i++ ) {
+			callbackInverse = !callback( elems[ i ], i );
+			if ( callbackInverse !== callbackExpect ) {
+				matches.push( elems[ i ] );
+			}
+		}
+
+		return matches;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var length, value,
+			i = 0,
+			ret = [];
+
+		// Go through the array, translating each of the items to their new values
+		if ( isArrayLike( elems ) ) {
+			length = elems.length;
+			for ( ; i < length; i++ ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+
+		// Go through every key on the object,
+		} else {
+			for ( i in elems ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+		}
+
+		// Flatten any nested arrays
+		return flat( ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	// jQuery.support is not used in Core but other projects attach their
+	// properties to it so it needs to exist.
+	support: support
+} );
+
+if ( typeof Symbol === "function" ) {
+	jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
+}
+
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+	function( _i, name ) {
+		class2type[ "[object " + name + "]" ] = name.toLowerCase();
+	} );
+
+function isArrayLike( obj ) {
+
+	// Support: real iOS 8.2 only (not reproducible in simulator)
+	// `in` check used to prevent JIT error (gh-2145)
+	// hasOwn isn't used here due to false negatives
+	// regarding Nodelist length in IE
+	var length = !!obj && "length" in obj && obj.length,
+		type = toType( obj );
+
+	if ( isFunction( obj ) || isWindow( obj ) ) {
+		return false;
+	}
+
+	return type === "array" || length === 0 ||
+		typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+
+
+function nodeName( elem, name ) {
+
+	return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+
+}
+var pop = arr.pop;
+
+
+var sort = arr.sort;
+
+
+var splice = arr.splice;
+
+
+var whitespace = "[\\x20\\t\\r\\n\\f]";
+
+
+var rtrimCSS = new RegExp(
+	"^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$",
+	"g"
+);
+
+
+
+
+// Note: an element does not contain itself
+jQuery.contains = function( a, b ) {
+	var bup = b && b.parentNode;
+
+	return a === bup || !!( bup && bup.nodeType === 1 && (
+
+		// Support: IE 9 - 11+
+		// IE doesn't have `contains` on SVG.
+		a.contains ?
+			a.contains( bup ) :
+			a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+	) );
+};
+
+
+
+
+// CSS string/identifier serialization
+// https://drafts.csswg.org/cssom/#common-serializing-idioms
+var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
+
+function fcssescape( ch, asCodePoint ) {
+	if ( asCodePoint ) {
+
+		// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+		if ( ch === "\0" ) {
+			return "\uFFFD";
+		}
+
+		// Control characters and (dependent upon position) numbers get escaped as code points
+		return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
+	}
+
+	// Other potentially-special ASCII characters get backslash-escaped
+	return "\\" + ch;
+}
+
+jQuery.escapeSelector = function( sel ) {
+	return ( sel + "" ).replace( rcssescape, fcssescape );
+};
+
+
+
+
+var preferredDoc = document,
+	pushNative = push;
+
+( function() {
+
+var i,
+	Expr,
+	outermostContext,
+	sortInput,
+	hasDuplicate,
+	push = pushNative,
+
+	// Local document vars
+	document,
+	documentElement,
+	documentIsHTML,
+	rbuggyQSA,
+	matches,
+
+	// Instance-specific data
+	expando = jQuery.expando,
+	dirruns = 0,
+	done = 0,
+	classCache = createCache(),
+	tokenCache = createCache(),
+	compilerCache = createCache(),
+	nonnativeSelectorCache = createCache(),
+	sortOrder = function( a, b ) {
+		if ( a === b ) {
+			hasDuplicate = true;
+		}
+		return 0;
+	},
+
+	booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|" +
+		"loop|multiple|open|readonly|required|scoped",
+
+	// Regular expressions
+
+	// https://www.w3.org/TR/css-syntax-3/#ident-token-diagram
+	identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace +
+		"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",
+
+	// Attribute selectors: https://www.w3.org/TR/selectors/#attribute-selectors
+	attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+
+		// Operator (capture 2)
+		"*([*^$|!~]?=)" + whitespace +
+
+		// "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
+		"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" +
+		whitespace + "*\\]",
+
+	pseudos = ":(" + identifier + ")(?:\\((" +
+
+		// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+		// 1. quoted (capture 3; capture 4 or capture 5)
+		"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+
+		// 2. simple (capture 6)
+		"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+
+		// 3. anything else (capture 2)
+		".*" +
+		")\\)|)",
+
+	// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+	rwhitespace = new RegExp( whitespace + "+", "g" ),
+
+	rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+	rleadingCombinator = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" +
+		whitespace + "*" ),
+	rdescend = new RegExp( whitespace + "|>" ),
+
+	rpseudo = new RegExp( pseudos ),
+	ridentifier = new RegExp( "^" + identifier + "$" ),
+
+	matchExpr = {
+		ID: new RegExp( "^#(" + identifier + ")" ),
+		CLASS: new RegExp( "^\\.(" + identifier + ")" ),
+		TAG: new RegExp( "^(" + identifier + "|[*])" ),
+		ATTR: new RegExp( "^" + attributes ),
+		PSEUDO: new RegExp( "^" + pseudos ),
+		CHILD: new RegExp(
+			"^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" +
+				whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" +
+				whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+		bool: new RegExp( "^(?:" + booleans + ")$", "i" ),
+
+		// For use in libraries implementing .is()
+		// We use this for POS matching in `select`
+		needsContext: new RegExp( "^" + whitespace +
+			"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace +
+			"*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+	},
+
+	rinputs = /^(?:input|select|textarea|button)$/i,
+	rheader = /^h\d$/i,
+
+	// Easily-parseable/retrievable ID or TAG or CLASS selectors
+	rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+	rsibling = /[+~]/,
+
+	// CSS escapes
+	// https://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+	runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace +
+		"?|\\\\([^\\r\\n\\f])", "g" ),
+	funescape = function( escape, nonHex ) {
+		var high = "0x" + escape.slice( 1 ) - 0x10000;
+
+		if ( nonHex ) {
+
+			// Strip the backslash prefix from a non-hex escape sequence
+			return nonHex;
+		}
+
+		// Replace a hexadecimal escape sequence with the encoded Unicode code point
+		// Support: IE <=11+
+		// For values outside the Basic Multilingual Plane (BMP), manually construct a
+		// surrogate pair
+		return high < 0 ?
+			String.fromCharCode( high + 0x10000 ) :
+			String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+	},
+
+	// Used for iframes; see `setDocument`.
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// Removing the function wrapper causes a "Permission Denied"
+	// error in IE/Edge.
+	unloadHandler = function() {
+		setDocument();
+	},
+
+	inDisabledFieldset = addCombinator(
+		function( elem ) {
+			return elem.disabled === true && nodeName( elem, "fieldset" );
+		},
+		{ dir: "parentNode", next: "legend" }
+	);
+
+// Support: IE <=9 only
+// Accessing document.activeElement can throw unexpectedly
+// https://bugs.jquery.com/ticket/13393
+function safeActiveElement() {
+	try {
+		return document.activeElement;
+	} catch ( err ) { }
+}
+
+// Optimize for push.apply( _, NodeList )
+try {
+	push.apply(
+		( arr = slice.call( preferredDoc.childNodes ) ),
+		preferredDoc.childNodes
+	);
+
+	// Support: Android <=4.0
+	// Detect silently failing push.apply
+	// eslint-disable-next-line no-unused-expressions
+	arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+	push = {
+		apply: function( target, els ) {
+			pushNative.apply( target, slice.call( els ) );
+		},
+		call: function( target ) {
+			pushNative.apply( target, slice.call( arguments, 1 ) );
+		}
+	};
+}
+
+function find( selector, context, results, seed ) {
+	var m, i, elem, nid, match, groups, newSelector,
+		newContext = context && context.ownerDocument,
+
+		// nodeType defaults to 9, since context defaults to document
+		nodeType = context ? context.nodeType : 9;
+
+	results = results || [];
+
+	// Return early from calls with invalid selector or context
+	if ( typeof selector !== "string" || !selector ||
+		nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
+
+		return results;
+	}
+
+	// Try to shortcut find operations (as opposed to filters) in HTML documents
+	if ( !seed ) {
+		setDocument( context );
+		context = context || document;
+
+		if ( documentIsHTML ) {
+
+			// If the selector is sufficiently simple, try using a "get*By*" DOM method
+			// (excepting DocumentFragment context, where the methods don't exist)
+			if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) {
+
+				// ID selector
+				if ( ( m = match[ 1 ] ) ) {
+
+					// Document context
+					if ( nodeType === 9 ) {
+						if ( ( elem = context.getElementById( m ) ) ) {
+
+							// Support: IE 9 only
+							// getElementById can match elements by name instead of ID
+							if ( elem.id === m ) {
+								push.call( results, elem );
+								return results;
+							}
+						} else {
+							return results;
+						}
+
+					// Element context
+					} else {
+
+						// Support: IE 9 only
+						// getElementById can match elements by name instead of ID
+						if ( newContext && ( elem = newContext.getElementById( m ) ) &&
+							find.contains( context, elem ) &&
+							elem.id === m ) {
+
+							push.call( results, elem );
+							return results;
+						}
+					}
+
+				// Type selector
+				} else if ( match[ 2 ] ) {
+					push.apply( results, context.getElementsByTagName( selector ) );
+					return results;
+
+				// Class selector
+				} else if ( ( m = match[ 3 ] ) && context.getElementsByClassName ) {
+					push.apply( results, context.getElementsByClassName( m ) );
+					return results;
+				}
+			}
+
+			// Take advantage of querySelectorAll
+			if ( !nonnativeSelectorCache[ selector + " " ] &&
+				( !rbuggyQSA || !rbuggyQSA.test( selector ) ) ) {
+
+				newSelector = selector;
+				newContext = context;
+
+				// qSA considers elements outside a scoping root when evaluating child or
+				// descendant combinators, which is not what we want.
+				// In such cases, we work around the behavior by prefixing every selector in the
+				// list with an ID selector referencing the scope context.
+				// The technique has to be used as well when a leading combinator is used
+				// as such selectors are not recognized by querySelectorAll.
+				// Thanks to Andrew Dupont for this technique.
+				if ( nodeType === 1 &&
+					( rdescend.test( selector ) || rleadingCombinator.test( selector ) ) ) {
+
+					// Expand context for sibling selectors
+					newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+						context;
+
+					// We can use :scope instead of the ID hack if the browser
+					// supports it & if we're not changing the context.
+					// Support: IE 11+, Edge 17 - 18+
+					// IE/Edge sometimes throw a "Permission denied" error when
+					// strict-comparing two documents; shallow comparisons work.
+					// eslint-disable-next-line eqeqeq
+					if ( newContext != context || !support.scope ) {
+
+						// Capture the context ID, setting it first if necessary
+						if ( ( nid = context.getAttribute( "id" ) ) ) {
+							nid = jQuery.escapeSelector( nid );
+						} else {
+							context.setAttribute( "id", ( nid = expando ) );
+						}
+					}
+
+					// Prefix every selector in the list
+					groups = tokenize( selector );
+					i = groups.length;
+					while ( i-- ) {
+						groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " +
+							toSelector( groups[ i ] );
+					}
+					newSelector = groups.join( "," );
+				}
+
+				try {
+					push.apply( results,
+						newContext.querySelectorAll( newSelector )
+					);
+					return results;
+				} catch ( qsaError ) {
+					nonnativeSelectorCache( selector, true );
+				} finally {
+					if ( nid === expando ) {
+						context.removeAttribute( "id" );
+					}
+				}
+			}
+		}
+	}
+
+	// All others
+	return select( selector.replace( rtrimCSS, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ *	property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ *	deleting the oldest entry
+ */
+function createCache() {
+	var keys = [];
+
+	function cache( key, value ) {
+
+		// Use (key + " ") to avoid collision with native prototype properties
+		// (see https://github.com/jquery/sizzle/issues/157)
+		if ( keys.push( key + " " ) > Expr.cacheLength ) {
+
+			// Only keep the most recent entries
+			delete cache[ keys.shift() ];
+		}
+		return ( cache[ key + " " ] = value );
+	}
+	return cache;
+}
+
+/**
+ * Mark a function for special use by jQuery selector module
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+	fn[ expando ] = true;
+	return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created element and returns a boolean result
+ */
+function assert( fn ) {
+	var el = document.createElement( "fieldset" );
+
+	try {
+		return !!fn( el );
+	} catch ( e ) {
+		return false;
+	} finally {
+
+		// Remove from its parent by default
+		if ( el.parentNode ) {
+			el.parentNode.removeChild( el );
+		}
+
+		// release memory in IE
+		el = null;
+	}
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+	return function( elem ) {
+		return nodeName( elem, "input" ) && elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+	return function( elem ) {
+		return ( nodeName( elem, "input" ) || nodeName( elem, "button" ) ) &&
+			elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for :enabled/:disabled
+ * @param {Boolean} disabled true for :disabled; false for :enabled
+ */
+function createDisabledPseudo( disabled ) {
+
+	// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
+	return function( elem ) {
+
+		// Only certain elements can match :enabled or :disabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
+		if ( "form" in elem ) {
+
+			// Check for inherited disabledness on relevant non-disabled elements:
+			// * listed form-associated elements in a disabled fieldset
+			//   https://html.spec.whatwg.org/multipage/forms.html#category-listed
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
+			// * option elements in a disabled optgroup
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
+			// All such elements have a "form" property.
+			if ( elem.parentNode && elem.disabled === false ) {
+
+				// Option elements defer to a parent optgroup if present
+				if ( "label" in elem ) {
+					if ( "label" in elem.parentNode ) {
+						return elem.parentNode.disabled === disabled;
+					} else {
+						return elem.disabled === disabled;
+					}
+				}
+
+				// Support: IE 6 - 11+
+				// Use the isDisabled shortcut property to check for disabled fieldset ancestors
+				return elem.isDisabled === disabled ||
+
+					// Where there is no isDisabled, check manually
+					elem.isDisabled !== !disabled &&
+						inDisabledFieldset( elem ) === disabled;
+			}
+
+			return elem.disabled === disabled;
+
+		// Try to winnow out elements that can't be disabled before trusting the disabled property.
+		// Some victims get caught in our net (label, legend, menu, track), but it shouldn't
+		// even exist on them, let alone have a boolean value.
+		} else if ( "label" in elem ) {
+			return elem.disabled === disabled;
+		}
+
+		// Remaining elements are neither :enabled nor :disabled
+		return false;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+	return markFunction( function( argument ) {
+		argument = +argument;
+		return markFunction( function( seed, matches ) {
+			var j,
+				matchIndexes = fn( [], seed.length, argument ),
+				i = matchIndexes.length;
+
+			// Match elements found at the specified indexes
+			while ( i-- ) {
+				if ( seed[ ( j = matchIndexes[ i ] ) ] ) {
+					seed[ j ] = !( matches[ j ] = seed[ j ] );
+				}
+			}
+		} );
+	} );
+}
+
+/**
+ * Checks a node for validity as a jQuery selector context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+	return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [node] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+function setDocument( node ) {
+	var subWindow,
+		doc = node ? node.ownerDocument || node : preferredDoc;
+
+	// Return early if doc is invalid or already selected
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) {
+		return document;
+	}
+
+	// Update global variables
+	document = doc;
+	documentElement = document.documentElement;
+	documentIsHTML = !jQuery.isXMLDoc( document );
+
+	// Support: iOS 7 only, IE 9 - 11+
+	// Older browsers didn't support unprefixed `matches`.
+	matches = documentElement.matches ||
+		documentElement.webkitMatchesSelector ||
+		documentElement.msMatchesSelector;
+
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// Accessing iframe documents after unload throws "permission denied" errors
+	// (see trac-13936).
+	// Limit the fix to IE & Edge Legacy; despite Edge 15+ implementing `matches`,
+	// all IE 9+ and Edge Legacy versions implement `msMatchesSelector` as well.
+	if ( documentElement.msMatchesSelector &&
+
+		// Support: IE 11+, Edge 17 - 18+
+		// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+		// two documents; shallow comparisons work.
+		// eslint-disable-next-line eqeqeq
+		preferredDoc != document &&
+		( subWindow = document.defaultView ) && subWindow.top !== subWindow ) {
+
+		// Support: IE 9 - 11+, Edge 12 - 18+
+		subWindow.addEventListener( "unload", unloadHandler );
+	}
+
+	// Support: IE <10
+	// Check if getElementById returns elements by name
+	// The broken getElementById methods don't pick up programmatically-set names,
+	// so use a roundabout getElementsByName test
+	support.getById = assert( function( el ) {
+		documentElement.appendChild( el ).id = jQuery.expando;
+		return !document.getElementsByName ||
+			!document.getElementsByName( jQuery.expando ).length;
+	} );
+
+	// Support: IE 9 only
+	// Check to see if it's possible to do matchesSelector
+	// on a disconnected node.
+	support.disconnectedMatch = assert( function( el ) {
+		return matches.call( el, "*" );
+	} );
+
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// IE/Edge don't support the :scope pseudo-class.
+	support.scope = assert( function() {
+		return document.querySelectorAll( ":scope" );
+	} );
+
+	// Support: Chrome 105 - 111 only, Safari 15.4 - 16.3 only
+	// Make sure the `:has()` argument is parsed unforgivingly.
+	// We include `*` in the test to detect buggy implementations that are
+	// _selectively_ forgiving (specifically when the list includes at least
+	// one valid selector).
+	// Note that we treat complete lack of support for `:has()` as if it were
+	// spec-compliant support, which is fine because use of `:has()` in such
+	// environments will fail in the qSA path and fall back to jQuery traversal
+	// anyway.
+	support.cssHas = assert( function() {
+		try {
+			document.querySelector( ":has(*,:jqfake)" );
+			return false;
+		} catch ( e ) {
+			return true;
+		}
+	} );
+
+	// ID filter and find
+	if ( support.getById ) {
+		Expr.filter.ID = function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				return elem.getAttribute( "id" ) === attrId;
+			};
+		};
+		Expr.find.ID = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var elem = context.getElementById( id );
+				return elem ? [ elem ] : [];
+			}
+		};
+	} else {
+		Expr.filter.ID =  function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				var node = typeof elem.getAttributeNode !== "undefined" &&
+					elem.getAttributeNode( "id" );
+				return node && node.value === attrId;
+			};
+		};
+
+		// Support: IE 6 - 7 only
+		// getElementById is not reliable as a find shortcut
+		Expr.find.ID = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var node, i, elems,
+					elem = context.getElementById( id );
+
+				if ( elem ) {
+
+					// Verify the id attribute
+					node = elem.getAttributeNode( "id" );
+					if ( node && node.value === id ) {
+						return [ elem ];
+					}
+
+					// Fall back on getElementsByName
+					elems = context.getElementsByName( id );
+					i = 0;
+					while ( ( elem = elems[ i++ ] ) ) {
+						node = elem.getAttributeNode( "id" );
+						if ( node && node.value === id ) {
+							return [ elem ];
+						}
+					}
+				}
+
+				return [];
+			}
+		};
+	}
+
+	// Tag
+	Expr.find.TAG = function( tag, context ) {
+		if ( typeof context.getElementsByTagName !== "undefined" ) {
+			return context.getElementsByTagName( tag );
+
+		// DocumentFragment nodes don't have gEBTN
+		} else {
+			return context.querySelectorAll( tag );
+		}
+	};
+
+	// Class
+	Expr.find.CLASS = function( className, context ) {
+		if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+			return context.getElementsByClassName( className );
+		}
+	};
+
+	/* QSA/matchesSelector
+	---------------------------------------------------------------------- */
+
+	// QSA and matchesSelector support
+
+	rbuggyQSA = [];
+
+	// Build QSA regex
+	// Regex strategy adopted from Diego Perini
+	assert( function( el ) {
+
+		var input;
+
+		documentElement.appendChild( el ).innerHTML =
+			"<a id='" + expando + "' href='' disabled='disabled'></a>" +
+			"<select id='" + expando + "-\r\\' disabled='disabled'>" +
+			"<option selected=''></option></select>";
+
+		// Support: iOS <=7 - 8 only
+		// Boolean attributes and "value" are not treated correctly in some XML documents
+		if ( !el.querySelectorAll( "[selected]" ).length ) {
+			rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+		}
+
+		// Support: iOS <=7 - 8 only
+		if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+			rbuggyQSA.push( "~=" );
+		}
+
+		// Support: iOS 8 only
+		// https://bugs.webkit.org/show_bug.cgi?id=136851
+		// In-page `selector#id sibling-combinator selector` fails
+		if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
+			rbuggyQSA.push( ".#.+[+~]" );
+		}
+
+		// Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+
+		// In some of the document kinds, these selectors wouldn't work natively.
+		// This is probably OK but for backwards compatibility we want to maintain
+		// handling them through jQuery traversal in jQuery 3.x.
+		if ( !el.querySelectorAll( ":checked" ).length ) {
+			rbuggyQSA.push( ":checked" );
+		}
+
+		// Support: Windows 8 Native Apps
+		// The type and name attributes are restricted during .innerHTML assignment
+		input = document.createElement( "input" );
+		input.setAttribute( "type", "hidden" );
+		el.appendChild( input ).setAttribute( "name", "D" );
+
+		// Support: IE 9 - 11+
+		// IE's :disabled selector does not pick up the children of disabled fieldsets
+		// Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+
+		// In some of the document kinds, these selectors wouldn't work natively.
+		// This is probably OK but for backwards compatibility we want to maintain
+		// handling them through jQuery traversal in jQuery 3.x.
+		documentElement.appendChild( el ).disabled = true;
+		if ( el.querySelectorAll( ":disabled" ).length !== 2 ) {
+			rbuggyQSA.push( ":enabled", ":disabled" );
+		}
+
+		// Support: IE 11+, Edge 15 - 18+
+		// IE 11/Edge don't find elements on a `[name='']` query in some cases.
+		// Adding a temporary attribute to the document before the selection works
+		// around the issue.
+		// Interestingly, IE 10 & older don't seem to have the issue.
+		input = document.createElement( "input" );
+		input.setAttribute( "name", "" );
+		el.appendChild( input );
+		if ( !el.querySelectorAll( "[name='']" ).length ) {
+			rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" +
+				whitespace + "*(?:''|\"\")" );
+		}
+	} );
+
+	if ( !support.cssHas ) {
+
+		// Support: Chrome 105 - 110+, Safari 15.4 - 16.3+
+		// Our regular `try-catch` mechanism fails to detect natively-unsupported
+		// pseudo-classes inside `:has()` (such as `:has(:contains("Foo"))`)
+		// in browsers that parse the `:has()` argument as a forgiving selector list.
+		// https://drafts.csswg.org/selectors/#relational now requires the argument
+		// to be parsed unforgivingly, but browsers have not yet fully adjusted.
+		rbuggyQSA.push( ":has" );
+	}
+
+	rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) );
+
+	/* Sorting
+	---------------------------------------------------------------------- */
+
+	// Document order sorting
+	sortOrder = function( a, b ) {
+
+		// Flag for duplicate removal
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+		}
+
+		// Sort on method existence if only one input has compareDocumentPosition
+		var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+		if ( compare ) {
+			return compare;
+		}
+
+		// Calculate position if both inputs belong to the same document
+		// Support: IE 11+, Edge 17 - 18+
+		// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+		// two documents; shallow comparisons work.
+		// eslint-disable-next-line eqeqeq
+		compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ?
+			a.compareDocumentPosition( b ) :
+
+			// Otherwise we know they are disconnected
+			1;
+
+		// Disconnected nodes
+		if ( compare & 1 ||
+			( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) {
+
+			// Choose the first element that is related to our preferred document
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( a === document || a.ownerDocument == preferredDoc &&
+				find.contains( preferredDoc, a ) ) {
+				return -1;
+			}
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( b === document || b.ownerDocument == preferredDoc &&
+				find.contains( preferredDoc, b ) ) {
+				return 1;
+			}
+
+			// Maintain original order
+			return sortInput ?
+				( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) :
+				0;
+		}
+
+		return compare & 4 ? -1 : 1;
+	};
+
+	return document;
+}
+
+find.matches = function( expr, elements ) {
+	return find( expr, null, null, elements );
+};
+
+find.matchesSelector = function( elem, expr ) {
+	setDocument( elem );
+
+	if ( documentIsHTML &&
+		!nonnativeSelectorCache[ expr + " " ] &&
+		( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
+
+		try {
+			var ret = matches.call( elem, expr );
+
+			// IE 9's matchesSelector returns false on disconnected nodes
+			if ( ret || support.disconnectedMatch ||
+
+					// As well, disconnected nodes are said to be in a document
+					// fragment in IE 9
+					elem.document && elem.document.nodeType !== 11 ) {
+				return ret;
+			}
+		} catch ( e ) {
+			nonnativeSelectorCache( expr, true );
+		}
+	}
+
+	return find( expr, document, null, [ elem ] ).length > 0;
+};
+
+find.contains = function( context, elem ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( context.ownerDocument || context ) != document ) {
+		setDocument( context );
+	}
+	return jQuery.contains( context, elem );
+};
+
+
+find.attr = function( elem, name ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( elem.ownerDocument || elem ) != document ) {
+		setDocument( elem );
+	}
+
+	var fn = Expr.attrHandle[ name.toLowerCase() ],
+
+		// Don't get fooled by Object.prototype properties (see trac-13807)
+		val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+			fn( elem, name, !documentIsHTML ) :
+			undefined;
+
+	if ( val !== undefined ) {
+		return val;
+	}
+
+	return elem.getAttribute( name );
+};
+
+find.error = function( msg ) {
+	throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+jQuery.uniqueSort = function( results ) {
+	var elem,
+		duplicates = [],
+		j = 0,
+		i = 0;
+
+	// Unless we *know* we can detect duplicates, assume their presence
+	//
+	// Support: Android <=4.0+
+	// Testing for detecting duplicates is unpredictable so instead assume we can't
+	// depend on duplicate detection in all browsers without a stable sort.
+	hasDuplicate = !support.sortStable;
+	sortInput = !support.sortStable && slice.call( results, 0 );
+	sort.call( results, sortOrder );
+
+	if ( hasDuplicate ) {
+		while ( ( elem = results[ i++ ] ) ) {
+			if ( elem === results[ i ] ) {
+				j = duplicates.push( i );
+			}
+		}
+		while ( j-- ) {
+			splice.call( results, duplicates[ j ], 1 );
+		}
+	}
+
+	// Clear input after sorting to release objects
+	// See https://github.com/jquery/sizzle/pull/225
+	sortInput = null;
+
+	return results;
+};
+
+jQuery.fn.uniqueSort = function() {
+	return this.pushStack( jQuery.uniqueSort( slice.apply( this ) ) );
+};
+
+Expr = jQuery.expr = {
+
+	// Can be adjusted by the user
+	cacheLength: 50,
+
+	createPseudo: markFunction,
+
+	match: matchExpr,
+
+	attrHandle: {},
+
+	find: {},
+
+	relative: {
+		">": { dir: "parentNode", first: true },
+		" ": { dir: "parentNode" },
+		"+": { dir: "previousSibling", first: true },
+		"~": { dir: "previousSibling" }
+	},
+
+	preFilter: {
+		ATTR: function( match ) {
+			match[ 1 ] = match[ 1 ].replace( runescape, funescape );
+
+			// Move the given value to match[3] whether quoted or unquoted
+			match[ 3 ] = ( match[ 3 ] || match[ 4 ] || match[ 5 ] || "" )
+				.replace( runescape, funescape );
+
+			if ( match[ 2 ] === "~=" ) {
+				match[ 3 ] = " " + match[ 3 ] + " ";
+			}
+
+			return match.slice( 0, 4 );
+		},
+
+		CHILD: function( match ) {
+
+			/* matches from matchExpr["CHILD"]
+				1 type (only|nth|...)
+				2 what (child|of-type)
+				3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+				4 xn-component of xn+y argument ([+-]?\d*n|)
+				5 sign of xn-component
+				6 x of xn-component
+				7 sign of y-component
+				8 y of y-component
+			*/
+			match[ 1 ] = match[ 1 ].toLowerCase();
+
+			if ( match[ 1 ].slice( 0, 3 ) === "nth" ) {
+
+				// nth-* requires argument
+				if ( !match[ 3 ] ) {
+					find.error( match[ 0 ] );
+				}
+
+				// numeric x and y parameters for Expr.filter.CHILD
+				// remember that false/true cast respectively to 0/1
+				match[ 4 ] = +( match[ 4 ] ?
+					match[ 5 ] + ( match[ 6 ] || 1 ) :
+					2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" )
+				);
+				match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" );
+
+			// other types prohibit arguments
+			} else if ( match[ 3 ] ) {
+				find.error( match[ 0 ] );
+			}
+
+			return match;
+		},
+
+		PSEUDO: function( match ) {
+			var excess,
+				unquoted = !match[ 6 ] && match[ 2 ];
+
+			if ( matchExpr.CHILD.test( match[ 0 ] ) ) {
+				return null;
+			}
+
+			// Accept quoted arguments as-is
+			if ( match[ 3 ] ) {
+				match[ 2 ] = match[ 4 ] || match[ 5 ] || "";
+
+			// Strip excess characters from unquoted arguments
+			} else if ( unquoted && rpseudo.test( unquoted ) &&
+
+				// Get excess from tokenize (recursively)
+				( excess = tokenize( unquoted, true ) ) &&
+
+				// advance to the next closing parenthesis
+				( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) {
+
+				// excess is a negative index
+				match[ 0 ] = match[ 0 ].slice( 0, excess );
+				match[ 2 ] = unquoted.slice( 0, excess );
+			}
+
+			// Return only captures needed by the pseudo filter method (type and argument)
+			return match.slice( 0, 3 );
+		}
+	},
+
+	filter: {
+
+		TAG: function( nodeNameSelector ) {
+			var expectedNodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+			return nodeNameSelector === "*" ?
+				function() {
+					return true;
+				} :
+				function( elem ) {
+					return nodeName( elem, expectedNodeName );
+				};
+		},
+
+		CLASS: function( className ) {
+			var pattern = classCache[ className + " " ];
+
+			return pattern ||
+				( pattern = new RegExp( "(^|" + whitespace + ")" + className +
+					"(" + whitespace + "|$)" ) ) &&
+				classCache( className, function( elem ) {
+					return pattern.test(
+						typeof elem.className === "string" && elem.className ||
+							typeof elem.getAttribute !== "undefined" &&
+								elem.getAttribute( "class" ) ||
+							""
+					);
+				} );
+		},
+
+		ATTR: function( name, operator, check ) {
+			return function( elem ) {
+				var result = find.attr( elem, name );
+
+				if ( result == null ) {
+					return operator === "!=";
+				}
+				if ( !operator ) {
+					return true;
+				}
+
+				result += "";
+
+				if ( operator === "=" ) {
+					return result === check;
+				}
+				if ( operator === "!=" ) {
+					return result !== check;
+				}
+				if ( operator === "^=" ) {
+					return check && result.indexOf( check ) === 0;
+				}
+				if ( operator === "*=" ) {
+					return check && result.indexOf( check ) > -1;
+				}
+				if ( operator === "$=" ) {
+					return check && result.slice( -check.length ) === check;
+				}
+				if ( operator === "~=" ) {
+					return ( " " + result.replace( rwhitespace, " " ) + " " )
+						.indexOf( check ) > -1;
+				}
+				if ( operator === "|=" ) {
+					return result === check || result.slice( 0, check.length + 1 ) === check + "-";
+				}
+
+				return false;
+			};
+		},
+
+		CHILD: function( type, what, _argument, first, last ) {
+			var simple = type.slice( 0, 3 ) !== "nth",
+				forward = type.slice( -4 ) !== "last",
+				ofType = what === "of-type";
+
+			return first === 1 && last === 0 ?
+
+				// Shortcut for :nth-*(n)
+				function( elem ) {
+					return !!elem.parentNode;
+				} :
+
+				function( elem, _context, xml ) {
+					var cache, outerCache, node, nodeIndex, start,
+						dir = simple !== forward ? "nextSibling" : "previousSibling",
+						parent = elem.parentNode,
+						name = ofType && elem.nodeName.toLowerCase(),
+						useCache = !xml && !ofType,
+						diff = false;
+
+					if ( parent ) {
+
+						// :(first|last|only)-(child|of-type)
+						if ( simple ) {
+							while ( dir ) {
+								node = elem;
+								while ( ( node = node[ dir ] ) ) {
+									if ( ofType ?
+										nodeName( node, name ) :
+										node.nodeType === 1 ) {
+
+										return false;
+									}
+								}
+
+								// Reverse direction for :only-* (if we haven't yet done so)
+								start = dir = type === "only" && !start && "nextSibling";
+							}
+							return true;
+						}
+
+						start = [ forward ? parent.firstChild : parent.lastChild ];
+
+						// non-xml :nth-child(...) stores cache data on `parent`
+						if ( forward && useCache ) {
+
+							// Seek `elem` from a previously-cached index
+							outerCache = parent[ expando ] || ( parent[ expando ] = {} );
+							cache = outerCache[ type ] || [];
+							nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+							diff = nodeIndex && cache[ 2 ];
+							node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+							while ( ( node = ++nodeIndex && node && node[ dir ] ||
+
+								// Fallback to seeking `elem` from the start
+								( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+								// When found, cache indexes on `parent` and break
+								if ( node.nodeType === 1 && ++diff && node === elem ) {
+									outerCache[ type ] = [ dirruns, nodeIndex, diff ];
+									break;
+								}
+							}
+
+						} else {
+
+							// Use previously-cached element index if available
+							if ( useCache ) {
+								outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+								cache = outerCache[ type ] || [];
+								nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+								diff = nodeIndex;
+							}
+
+							// xml :nth-child(...)
+							// or :nth-last-child(...) or :nth(-last)?-of-type(...)
+							if ( diff === false ) {
+
+								// Use the same loop as above to seek `elem` from the start
+								while ( ( node = ++nodeIndex && node && node[ dir ] ||
+									( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+									if ( ( ofType ?
+										nodeName( node, name ) :
+										node.nodeType === 1 ) &&
+										++diff ) {
+
+										// Cache the index of each encountered element
+										if ( useCache ) {
+											outerCache = node[ expando ] ||
+												( node[ expando ] = {} );
+											outerCache[ type ] = [ dirruns, diff ];
+										}
+
+										if ( node === elem ) {
+											break;
+										}
+									}
+								}
+							}
+						}
+
+						// Incorporate the offset, then check against cycle size
+						diff -= last;
+						return diff === first || ( diff % first === 0 && diff / first >= 0 );
+					}
+				};
+		},
+
+		PSEUDO: function( pseudo, argument ) {
+
+			// pseudo-class names are case-insensitive
+			// https://www.w3.org/TR/selectors/#pseudo-classes
+			// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+			// Remember that setFilters inherits from pseudos
+			var args,
+				fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+					find.error( "unsupported pseudo: " + pseudo );
+
+			// The user may use createPseudo to indicate that
+			// arguments are needed to create the filter function
+			// just as jQuery does
+			if ( fn[ expando ] ) {
+				return fn( argument );
+			}
+
+			// But maintain support for old signatures
+			if ( fn.length > 1 ) {
+				args = [ pseudo, pseudo, "", argument ];
+				return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+					markFunction( function( seed, matches ) {
+						var idx,
+							matched = fn( seed, argument ),
+							i = matched.length;
+						while ( i-- ) {
+							idx = indexOf.call( seed, matched[ i ] );
+							seed[ idx ] = !( matches[ idx ] = matched[ i ] );
+						}
+					} ) :
+					function( elem ) {
+						return fn( elem, 0, args );
+					};
+			}
+
+			return fn;
+		}
+	},
+
+	pseudos: {
+
+		// Potentially complex pseudos
+		not: markFunction( function( selector ) {
+
+			// Trim the selector passed to compile
+			// to avoid treating leading and trailing
+			// spaces as combinators
+			var input = [],
+				results = [],
+				matcher = compile( selector.replace( rtrimCSS, "$1" ) );
+
+			return matcher[ expando ] ?
+				markFunction( function( seed, matches, _context, xml ) {
+					var elem,
+						unmatched = matcher( seed, null, xml, [] ),
+						i = seed.length;
+
+					// Match elements unmatched by `matcher`
+					while ( i-- ) {
+						if ( ( elem = unmatched[ i ] ) ) {
+							seed[ i ] = !( matches[ i ] = elem );
+						}
+					}
+				} ) :
+				function( elem, _context, xml ) {
+					input[ 0 ] = elem;
+					matcher( input, null, xml, results );
+
+					// Don't keep the element
+					// (see https://github.com/jquery/sizzle/issues/299)
+					input[ 0 ] = null;
+					return !results.pop();
+				};
+		} ),
+
+		has: markFunction( function( selector ) {
+			return function( elem ) {
+				return find( selector, elem ).length > 0;
+			};
+		} ),
+
+		contains: markFunction( function( text ) {
+			text = text.replace( runescape, funescape );
+			return function( elem ) {
+				return ( elem.textContent || jQuery.text( elem ) ).indexOf( text ) > -1;
+			};
+		} ),
+
+		// "Whether an element is represented by a :lang() selector
+		// is based solely on the element's language value
+		// being equal to the identifier C,
+		// or beginning with the identifier C immediately followed by "-".
+		// The matching of C against the element's language value is performed case-insensitively.
+		// The identifier C does not have to be a valid language name."
+		// https://www.w3.org/TR/selectors/#lang-pseudo
+		lang: markFunction( function( lang ) {
+
+			// lang value must be a valid identifier
+			if ( !ridentifier.test( lang || "" ) ) {
+				find.error( "unsupported lang: " + lang );
+			}
+			lang = lang.replace( runescape, funescape ).toLowerCase();
+			return function( elem ) {
+				var elemLang;
+				do {
+					if ( ( elemLang = documentIsHTML ?
+						elem.lang :
+						elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) {
+
+						elemLang = elemLang.toLowerCase();
+						return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+					}
+				} while ( ( elem = elem.parentNode ) && elem.nodeType === 1 );
+				return false;
+			};
+		} ),
+
+		// Miscellaneous
+		target: function( elem ) {
+			var hash = window.location && window.location.hash;
+			return hash && hash.slice( 1 ) === elem.id;
+		},
+
+		root: function( elem ) {
+			return elem === documentElement;
+		},
+
+		focus: function( elem ) {
+			return elem === safeActiveElement() &&
+				document.hasFocus() &&
+				!!( elem.type || elem.href || ~elem.tabIndex );
+		},
+
+		// Boolean properties
+		enabled: createDisabledPseudo( false ),
+		disabled: createDisabledPseudo( true ),
+
+		checked: function( elem ) {
+
+			// In CSS3, :checked should return both checked and selected elements
+			// https://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			return ( nodeName( elem, "input" ) && !!elem.checked ) ||
+				( nodeName( elem, "option" ) && !!elem.selected );
+		},
+
+		selected: function( elem ) {
+
+			// Support: IE <=11+
+			// Accessing the selectedIndex property
+			// forces the browser to treat the default option as
+			// selected when in an optgroup.
+			if ( elem.parentNode ) {
+				// eslint-disable-next-line no-unused-expressions
+				elem.parentNode.selectedIndex;
+			}
+
+			return elem.selected === true;
+		},
+
+		// Contents
+		empty: function( elem ) {
+
+			// https://www.w3.org/TR/selectors/#empty-pseudo
+			// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+			//   but not by others (comment: 8; processing instruction: 7; etc.)
+			// nodeType < 6 works because attributes (2) do not appear as children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				if ( elem.nodeType < 6 ) {
+					return false;
+				}
+			}
+			return true;
+		},
+
+		parent: function( elem ) {
+			return !Expr.pseudos.empty( elem );
+		},
+
+		// Element/input types
+		header: function( elem ) {
+			return rheader.test( elem.nodeName );
+		},
+
+		input: function( elem ) {
+			return rinputs.test( elem.nodeName );
+		},
+
+		button: function( elem ) {
+			return nodeName( elem, "input" ) && elem.type === "button" ||
+				nodeName( elem, "button" );
+		},
+
+		text: function( elem ) {
+			var attr;
+			return nodeName( elem, "input" ) && elem.type === "text" &&
+
+				// Support: IE <10 only
+				// New HTML5 attribute values (e.g., "search") appear
+				// with elem.type === "text"
+				( ( attr = elem.getAttribute( "type" ) ) == null ||
+					attr.toLowerCase() === "text" );
+		},
+
+		// Position-in-collection
+		first: createPositionalPseudo( function() {
+			return [ 0 ];
+		} ),
+
+		last: createPositionalPseudo( function( _matchIndexes, length ) {
+			return [ length - 1 ];
+		} ),
+
+		eq: createPositionalPseudo( function( _matchIndexes, length, argument ) {
+			return [ argument < 0 ? argument + length : argument ];
+		} ),
+
+		even: createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 0;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		odd: createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 1;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		lt: createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i;
+
+			if ( argument < 0 ) {
+				i = argument + length;
+			} else if ( argument > length ) {
+				i = length;
+			} else {
+				i = argument;
+			}
+
+			for ( ; --i >= 0; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		gt: createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i = argument < 0 ? argument + length : argument;
+			for ( ; ++i < length; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} )
+	}
+};
+
+Expr.pseudos.nth = Expr.pseudos.eq;
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+	Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+	Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+function tokenize( selector, parseOnly ) {
+	var matched, match, tokens, type,
+		soFar, groups, preFilters,
+		cached = tokenCache[ selector + " " ];
+
+	if ( cached ) {
+		return parseOnly ? 0 : cached.slice( 0 );
+	}
+
+	soFar = selector;
+	groups = [];
+	preFilters = Expr.preFilter;
+
+	while ( soFar ) {
+
+		// Comma and first run
+		if ( !matched || ( match = rcomma.exec( soFar ) ) ) {
+			if ( match ) {
+
+				// Don't consume trailing commas as valid
+				soFar = soFar.slice( match[ 0 ].length ) || soFar;
+			}
+			groups.push( ( tokens = [] ) );
+		}
+
+		matched = false;
+
+		// Combinators
+		if ( ( match = rleadingCombinator.exec( soFar ) ) ) {
+			matched = match.shift();
+			tokens.push( {
+				value: matched,
+
+				// Cast descendant combinators to space
+				type: match[ 0 ].replace( rtrimCSS, " " )
+			} );
+			soFar = soFar.slice( matched.length );
+		}
+
+		// Filters
+		for ( type in Expr.filter ) {
+			if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] ||
+				( match = preFilters[ type ]( match ) ) ) ) {
+				matched = match.shift();
+				tokens.push( {
+					value: matched,
+					type: type,
+					matches: match
+				} );
+				soFar = soFar.slice( matched.length );
+			}
+		}
+
+		if ( !matched ) {
+			break;
+		}
+	}
+
+	// Return the length of the invalid excess
+	// if we're just parsing
+	// Otherwise, throw an error or return tokens
+	if ( parseOnly ) {
+		return soFar.length;
+	}
+
+	return soFar ?
+		find.error( selector ) :
+
+		// Cache the tokens
+		tokenCache( selector, groups ).slice( 0 );
+}
+
+function toSelector( tokens ) {
+	var i = 0,
+		len = tokens.length,
+		selector = "";
+	for ( ; i < len; i++ ) {
+		selector += tokens[ i ].value;
+	}
+	return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+	var dir = combinator.dir,
+		skip = combinator.next,
+		key = skip || dir,
+		checkNonElements = base && key === "parentNode",
+		doneName = done++;
+
+	return combinator.first ?
+
+		// Check against closest ancestor/preceding element
+		function( elem, context, xml ) {
+			while ( ( elem = elem[ dir ] ) ) {
+				if ( elem.nodeType === 1 || checkNonElements ) {
+					return matcher( elem, context, xml );
+				}
+			}
+			return false;
+		} :
+
+		// Check against all ancestor/preceding elements
+		function( elem, context, xml ) {
+			var oldCache, outerCache,
+				newCache = [ dirruns, doneName ];
+
+			// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+			if ( xml ) {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						if ( matcher( elem, context, xml ) ) {
+							return true;
+						}
+					}
+				}
+			} else {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+
+						if ( skip && nodeName( elem, skip ) ) {
+							elem = elem[ dir ] || elem;
+						} else if ( ( oldCache = outerCache[ key ] ) &&
+							oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+							// Assign to newCache so results back-propagate to previous elements
+							return ( newCache[ 2 ] = oldCache[ 2 ] );
+						} else {
+
+							// Reuse newcache so results back-propagate to previous elements
+							outerCache[ key ] = newCache;
+
+							// A match means we're done; a fail means we have to keep checking
+							if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) {
+								return true;
+							}
+						}
+					}
+				}
+			}
+			return false;
+		};
+}
+
+function elementMatcher( matchers ) {
+	return matchers.length > 1 ?
+		function( elem, context, xml ) {
+			var i = matchers.length;
+			while ( i-- ) {
+				if ( !matchers[ i ]( elem, context, xml ) ) {
+					return false;
+				}
+			}
+			return true;
+		} :
+		matchers[ 0 ];
+}
+
+function multipleContexts( selector, contexts, results ) {
+	var i = 0,
+		len = contexts.length;
+	for ( ; i < len; i++ ) {
+		find( selector, contexts[ i ], results );
+	}
+	return results;
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+	var elem,
+		newUnmatched = [],
+		i = 0,
+		len = unmatched.length,
+		mapped = map != null;
+
+	for ( ; i < len; i++ ) {
+		if ( ( elem = unmatched[ i ] ) ) {
+			if ( !filter || filter( elem, context, xml ) ) {
+				newUnmatched.push( elem );
+				if ( mapped ) {
+					map.push( i );
+				}
+			}
+		}
+	}
+
+	return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+	if ( postFilter && !postFilter[ expando ] ) {
+		postFilter = setMatcher( postFilter );
+	}
+	if ( postFinder && !postFinder[ expando ] ) {
+		postFinder = setMatcher( postFinder, postSelector );
+	}
+	return markFunction( function( seed, results, context, xml ) {
+		var temp, i, elem, matcherOut,
+			preMap = [],
+			postMap = [],
+			preexisting = results.length,
+
+			// Get initial elements from seed or context
+			elems = seed ||
+				multipleContexts( selector || "*",
+					context.nodeType ? [ context ] : context, [] ),
+
+			// Prefilter to get matcher input, preserving a map for seed-results synchronization
+			matcherIn = preFilter && ( seed || !selector ) ?
+				condense( elems, preMap, preFilter, context, xml ) :
+				elems;
+
+		if ( matcher ) {
+
+			// If we have a postFinder, or filtered seed, or non-seed postFilter
+			// or preexisting results,
+			matcherOut = postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+				// ...intermediate processing is necessary
+				[] :
+
+				// ...otherwise use results directly
+				results;
+
+			// Find primary matches
+			matcher( matcherIn, matcherOut, context, xml );
+		} else {
+			matcherOut = matcherIn;
+		}
+
+		// Apply postFilter
+		if ( postFilter ) {
+			temp = condense( matcherOut, postMap );
+			postFilter( temp, [], context, xml );
+
+			// Un-match failing elements by moving them back to matcherIn
+			i = temp.length;
+			while ( i-- ) {
+				if ( ( elem = temp[ i ] ) ) {
+					matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem );
+				}
+			}
+		}
+
+		if ( seed ) {
+			if ( postFinder || preFilter ) {
+				if ( postFinder ) {
+
+					// Get the final matcherOut by condensing this intermediate into postFinder contexts
+					temp = [];
+					i = matcherOut.length;
+					while ( i-- ) {
+						if ( ( elem = matcherOut[ i ] ) ) {
+
+							// Restore matcherIn since elem is not yet a final match
+							temp.push( ( matcherIn[ i ] = elem ) );
+						}
+					}
+					postFinder( null, ( matcherOut = [] ), temp, xml );
+				}
+
+				// Move matched elements from seed to results to keep them synchronized
+				i = matcherOut.length;
+				while ( i-- ) {
+					if ( ( elem = matcherOut[ i ] ) &&
+						( temp = postFinder ? indexOf.call( seed, elem ) : preMap[ i ] ) > -1 ) {
+
+						seed[ temp ] = !( results[ temp ] = elem );
+					}
+				}
+			}
+
+		// Add elements to results, through postFinder if defined
+		} else {
+			matcherOut = condense(
+				matcherOut === results ?
+					matcherOut.splice( preexisting, matcherOut.length ) :
+					matcherOut
+			);
+			if ( postFinder ) {
+				postFinder( null, results, matcherOut, xml );
+			} else {
+				push.apply( results, matcherOut );
+			}
+		}
+	} );
+}
+
+function matcherFromTokens( tokens ) {
+	var checkContext, matcher, j,
+		len = tokens.length,
+		leadingRelative = Expr.relative[ tokens[ 0 ].type ],
+		implicitRelative = leadingRelative || Expr.relative[ " " ],
+		i = leadingRelative ? 1 : 0,
+
+		// The foundational matcher ensures that elements are reachable from top-level context(s)
+		matchContext = addCombinator( function( elem ) {
+			return elem === checkContext;
+		}, implicitRelative, true ),
+		matchAnyContext = addCombinator( function( elem ) {
+			return indexOf.call( checkContext, elem ) > -1;
+		}, implicitRelative, true ),
+		matchers = [ function( elem, context, xml ) {
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			var ret = ( !leadingRelative && ( xml || context != outermostContext ) ) || (
+				( checkContext = context ).nodeType ?
+					matchContext( elem, context, xml ) :
+					matchAnyContext( elem, context, xml ) );
+
+			// Avoid hanging onto element
+			// (see https://github.com/jquery/sizzle/issues/299)
+			checkContext = null;
+			return ret;
+		} ];
+
+	for ( ; i < len; i++ ) {
+		if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) {
+			matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ];
+		} else {
+			matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches );
+
+			// Return special upon seeing a positional matcher
+			if ( matcher[ expando ] ) {
+
+				// Find the next relative operator (if any) for proper handling
+				j = ++i;
+				for ( ; j < len; j++ ) {
+					if ( Expr.relative[ tokens[ j ].type ] ) {
+						break;
+					}
+				}
+				return setMatcher(
+					i > 1 && elementMatcher( matchers ),
+					i > 1 && toSelector(
+
+						// If the preceding token was a descendant combinator, insert an implicit any-element `*`
+						tokens.slice( 0, i - 1 )
+							.concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } )
+					).replace( rtrimCSS, "$1" ),
+					matcher,
+					i < j && matcherFromTokens( tokens.slice( i, j ) ),
+					j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ),
+					j < len && toSelector( tokens )
+				);
+			}
+			matchers.push( matcher );
+		}
+	}
+
+	return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+	var bySet = setMatchers.length > 0,
+		byElement = elementMatchers.length > 0,
+		superMatcher = function( seed, context, xml, results, outermost ) {
+			var elem, j, matcher,
+				matchedCount = 0,
+				i = "0",
+				unmatched = seed && [],
+				setMatched = [],
+				contextBackup = outermostContext,
+
+				// We must always have either seed elements or outermost context
+				elems = seed || byElement && Expr.find.TAG( "*", outermost ),
+
+				// Use integer dirruns iff this is the outermost matcher
+				dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ),
+				len = elems.length;
+
+			if ( outermost ) {
+
+				// Support: IE 11+, Edge 17 - 18+
+				// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+				// two documents; shallow comparisons work.
+				// eslint-disable-next-line eqeqeq
+				outermostContext = context == document || context || outermost;
+			}
+
+			// Add elements passing elementMatchers directly to results
+			// Support: iOS <=7 - 9 only
+			// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching
+			// elements by id. (see trac-14142)
+			for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) {
+				if ( byElement && elem ) {
+					j = 0;
+
+					// Support: IE 11+, Edge 17 - 18+
+					// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+					// two documents; shallow comparisons work.
+					// eslint-disable-next-line eqeqeq
+					if ( !context && elem.ownerDocument != document ) {
+						setDocument( elem );
+						xml = !documentIsHTML;
+					}
+					while ( ( matcher = elementMatchers[ j++ ] ) ) {
+						if ( matcher( elem, context || document, xml ) ) {
+							push.call( results, elem );
+							break;
+						}
+					}
+					if ( outermost ) {
+						dirruns = dirrunsUnique;
+					}
+				}
+
+				// Track unmatched elements for set filters
+				if ( bySet ) {
+
+					// They will have gone through all possible matchers
+					if ( ( elem = !matcher && elem ) ) {
+						matchedCount--;
+					}
+
+					// Lengthen the array for every element, matched or not
+					if ( seed ) {
+						unmatched.push( elem );
+					}
+				}
+			}
+
+			// `i` is now the count of elements visited above, and adding it to `matchedCount`
+			// makes the latter nonnegative.
+			matchedCount += i;
+
+			// Apply set filters to unmatched elements
+			// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+			// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+			// no element matchers and no seed.
+			// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+			// case, which will result in a "00" `matchedCount` that differs from `i` but is also
+			// numerically zero.
+			if ( bySet && i !== matchedCount ) {
+				j = 0;
+				while ( ( matcher = setMatchers[ j++ ] ) ) {
+					matcher( unmatched, setMatched, context, xml );
+				}
+
+				if ( seed ) {
+
+					// Reintegrate element matches to eliminate the need for sorting
+					if ( matchedCount > 0 ) {
+						while ( i-- ) {
+							if ( !( unmatched[ i ] || setMatched[ i ] ) ) {
+								setMatched[ i ] = pop.call( results );
+							}
+						}
+					}
+
+					// Discard index placeholder values to get only actual matches
+					setMatched = condense( setMatched );
+				}
+
+				// Add matches to results
+				push.apply( results, setMatched );
+
+				// Seedless set matches succeeding multiple successful matchers stipulate sorting
+				if ( outermost && !seed && setMatched.length > 0 &&
+					( matchedCount + setMatchers.length ) > 1 ) {
+
+					jQuery.uniqueSort( results );
+				}
+			}
+
+			// Override manipulation of globals by nested matchers
+			if ( outermost ) {
+				dirruns = dirrunsUnique;
+				outermostContext = contextBackup;
+			}
+
+			return unmatched;
+		};
+
+	return bySet ?
+		markFunction( superMatcher ) :
+		superMatcher;
+}
+
+function compile( selector, match /* Internal Use Only */ ) {
+	var i,
+		setMatchers = [],
+		elementMatchers = [],
+		cached = compilerCache[ selector + " " ];
+
+	if ( !cached ) {
+
+		// Generate a function of recursive functions that can be used to check each element
+		if ( !match ) {
+			match = tokenize( selector );
+		}
+		i = match.length;
+		while ( i-- ) {
+			cached = matcherFromTokens( match[ i ] );
+			if ( cached[ expando ] ) {
+				setMatchers.push( cached );
+			} else {
+				elementMatchers.push( cached );
+			}
+		}
+
+		// Cache the compiled function
+		cached = compilerCache( selector,
+			matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+
+		// Save selector and tokenization
+		cached.selector = selector;
+	}
+	return cached;
+}
+
+/**
+ * A low-level selection function that works with jQuery's compiled
+ *  selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ *  selector function built with jQuery selector compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+function select( selector, context, results, seed ) {
+	var i, tokens, token, type, find,
+		compiled = typeof selector === "function" && selector,
+		match = !seed && tokenize( ( selector = compiled.selector || selector ) );
+
+	results = results || [];
+
+	// Try to minimize operations if there is only one selector in the list and no seed
+	// (the latter of which guarantees us context)
+	if ( match.length === 1 ) {
+
+		// Reduce context if the leading compound selector is an ID
+		tokens = match[ 0 ] = match[ 0 ].slice( 0 );
+		if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" &&
+				context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) {
+
+			context = ( Expr.find.ID(
+				token.matches[ 0 ].replace( runescape, funescape ),
+				context
+			) || [] )[ 0 ];
+			if ( !context ) {
+				return results;
+
+			// Precompiled matchers will still verify ancestry, so step up a level
+			} else if ( compiled ) {
+				context = context.parentNode;
+			}
+
+			selector = selector.slice( tokens.shift().value.length );
+		}
+
+		// Fetch a seed set for right-to-left matching
+		i = matchExpr.needsContext.test( selector ) ? 0 : tokens.length;
+		while ( i-- ) {
+			token = tokens[ i ];
+
+			// Abort if we hit a combinator
+			if ( Expr.relative[ ( type = token.type ) ] ) {
+				break;
+			}
+			if ( ( find = Expr.find[ type ] ) ) {
+
+				// Search, expanding context for leading sibling combinators
+				if ( ( seed = find(
+					token.matches[ 0 ].replace( runescape, funescape ),
+					rsibling.test( tokens[ 0 ].type ) &&
+						testContext( context.parentNode ) || context
+				) ) ) {
+
+					// If seed is empty or no tokens remain, we can return early
+					tokens.splice( i, 1 );
+					selector = seed.length && toSelector( tokens );
+					if ( !selector ) {
+						push.apply( results, seed );
+						return results;
+					}
+
+					break;
+				}
+			}
+		}
+	}
+
+	// Compile and execute a filtering function if one is not provided
+	// Provide `match` to avoid retokenization if we modified the selector above
+	( compiled || compile( selector, match ) )(
+		seed,
+		context,
+		!documentIsHTML,
+		results,
+		!context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+	);
+	return results;
+}
+
+// One-time assignments
+
+// Support: Android <=4.0 - 4.1+
+// Sort stability
+support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Android <=4.0 - 4.1+
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert( function( el ) {
+
+	// Should return 1, but returns 4 (following)
+	return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1;
+} );
+
+jQuery.find = find;
+
+// Deprecated
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.unique = jQuery.uniqueSort;
+
+// These have always been private, but they used to be documented as part of
+// Sizzle so let's maintain them for now for backwards compatibility purposes.
+find.compile = compile;
+find.select = select;
+find.setDocument = setDocument;
+find.tokenize = tokenize;
+
+find.escape = jQuery.escapeSelector;
+find.getText = jQuery.text;
+find.isXML = jQuery.isXMLDoc;
+find.selectors = jQuery.expr;
+find.support = jQuery.support;
+find.uniqueSort = jQuery.uniqueSort;
+
+	/* eslint-enable */
+
+} )();
+
+
+var dir = function( elem, dir, until ) {
+	var matched = [],
+		truncate = until !== undefined;
+
+	while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+		if ( elem.nodeType === 1 ) {
+			if ( truncate && jQuery( elem ).is( until ) ) {
+				break;
+			}
+			matched.push( elem );
+		}
+	}
+	return matched;
+};
+
+
+var siblings = function( n, elem ) {
+	var matched = [];
+
+	for ( ; n; n = n.nextSibling ) {
+		if ( n.nodeType === 1 && n !== elem ) {
+			matched.push( n );
+		}
+	}
+
+	return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
+
+
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+	if ( isFunction( qualifier ) ) {
+		return jQuery.grep( elements, function( elem, i ) {
+			return !!qualifier.call( elem, i, elem ) !== not;
+		} );
+	}
+
+	// Single element
+	if ( qualifier.nodeType ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( elem === qualifier ) !== not;
+		} );
+	}
+
+	// Arraylike of elements (jQuery, arguments, Array)
+	if ( typeof qualifier !== "string" ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
+		} );
+	}
+
+	// Filtered directly for both simple and complex selectors
+	return jQuery.filter( qualifier, elements, not );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+	var elem = elems[ 0 ];
+
+	if ( not ) {
+		expr = ":not(" + expr + ")";
+	}
+
+	if ( elems.length === 1 && elem.nodeType === 1 ) {
+		return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
+	}
+
+	return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+		return elem.nodeType === 1;
+	} ) );
+};
+
+jQuery.fn.extend( {
+	find: function( selector ) {
+		var i, ret,
+			len = this.length,
+			self = this;
+
+		if ( typeof selector !== "string" ) {
+			return this.pushStack( jQuery( selector ).filter( function() {
+				for ( i = 0; i < len; i++ ) {
+					if ( jQuery.contains( self[ i ], this ) ) {
+						return true;
+					}
+				}
+			} ) );
+		}
+
+		ret = this.pushStack( [] );
+
+		for ( i = 0; i < len; i++ ) {
+			jQuery.find( selector, self[ i ], ret );
+		}
+
+		return len > 1 ? jQuery.uniqueSort( ret ) : ret;
+	},
+	filter: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], false ) );
+	},
+	not: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], true ) );
+	},
+	is: function( selector ) {
+		return !!winnow(
+			this,
+
+			// If this is a positional/relative selector, check membership in the returned set
+			// so $("p:first").is("p:last") won't return true for a doc with two "p".
+			typeof selector === "string" && rneedsContext.test( selector ) ?
+				jQuery( selector ) :
+				selector || [],
+			false
+		).length;
+	}
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+	// A simple way to check for HTML strings
+	// Prioritize #id over <tag> to avoid XSS via location.hash (trac-9521)
+	// Strict HTML recognition (trac-11290: must start with <)
+	// Shortcut simple #id case for speed
+	rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
+
+	init = jQuery.fn.init = function( selector, context, root ) {
+		var match, elem;
+
+		// HANDLE: $(""), $(null), $(undefined), $(false)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Method init() accepts an alternate rootjQuery
+		// so migrate can support jQuery.sub (gh-2101)
+		root = root || rootjQuery;
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			if ( selector[ 0 ] === "<" &&
+				selector[ selector.length - 1 ] === ">" &&
+				selector.length >= 3 ) {
+
+				// Assume that strings that start and end with <> are HTML and skip the regex check
+				match = [ null, selector, null ];
+
+			} else {
+				match = rquickExpr.exec( selector );
+			}
+
+			// Match html or make sure no context is specified for #id
+			if ( match && ( match[ 1 ] || !context ) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[ 1 ] ) {
+					context = context instanceof jQuery ? context[ 0 ] : context;
+
+					// Option to run scripts is true for back-compat
+					// Intentionally let the error be thrown if parseHTML is not present
+					jQuery.merge( this, jQuery.parseHTML(
+						match[ 1 ],
+						context && context.nodeType ? context.ownerDocument || context : document,
+						true
+					) );
+
+					// HANDLE: $(html, props)
+					if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+						for ( match in context ) {
+
+							// Properties of context are called as methods if possible
+							if ( isFunction( this[ match ] ) ) {
+								this[ match ]( context[ match ] );
+
+							// ...and otherwise set as attributes
+							} else {
+								this.attr( match, context[ match ] );
+							}
+						}
+					}
+
+					return this;
+
+				// HANDLE: $(#id)
+				} else {
+					elem = document.getElementById( match[ 2 ] );
+
+					if ( elem ) {
+
+						// Inject the element directly into the jQuery object
+						this[ 0 ] = elem;
+						this.length = 1;
+					}
+					return this;
+				}
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return ( context || root ).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return this.constructor( context ).find( selector );
+			}
+
+		// HANDLE: $(DOMElement)
+		} else if ( selector.nodeType ) {
+			this[ 0 ] = selector;
+			this.length = 1;
+			return this;
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( isFunction( selector ) ) {
+			return root.ready !== undefined ?
+				root.ready( selector ) :
+
+				// Execute immediately if ready is not present
+				selector( jQuery );
+		}
+
+		return jQuery.makeArray( selector, this );
+	};
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+	// Methods guaranteed to produce a unique set when starting from a unique set
+	guaranteedUnique = {
+		children: true,
+		contents: true,
+		next: true,
+		prev: true
+	};
+
+jQuery.fn.extend( {
+	has: function( target ) {
+		var targets = jQuery( target, this ),
+			l = targets.length;
+
+		return this.filter( function() {
+			var i = 0;
+			for ( ; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[ i ] ) ) {
+					return true;
+				}
+			}
+		} );
+	},
+
+	closest: function( selectors, context ) {
+		var cur,
+			i = 0,
+			l = this.length,
+			matched = [],
+			targets = typeof selectors !== "string" && jQuery( selectors );
+
+		// Positional selectors never match, since there's no _selection_ context
+		if ( !rneedsContext.test( selectors ) ) {
+			for ( ; i < l; i++ ) {
+				for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+					// Always skip document fragments
+					if ( cur.nodeType < 11 && ( targets ?
+						targets.index( cur ) > -1 :
+
+						// Don't pass non-elements to jQuery#find
+						cur.nodeType === 1 &&
+							jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+						matched.push( cur );
+						break;
+					}
+				}
+			}
+		}
+
+		return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+	},
+
+	// Determine the position of an element within the set
+	index: function( elem ) {
+
+		// No argument, return index in parent
+		if ( !elem ) {
+			return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+		}
+
+		// Index in selector
+		if ( typeof elem === "string" ) {
+			return indexOf.call( jQuery( elem ), this[ 0 ] );
+		}
+
+		// Locate the position of the desired element
+		return indexOf.call( this,
+
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[ 0 ] : elem
+		);
+	},
+
+	add: function( selector, context ) {
+		return this.pushStack(
+			jQuery.uniqueSort(
+				jQuery.merge( this.get(), jQuery( selector, context ) )
+			)
+		);
+	},
+
+	addBack: function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	}
+} );
+
+function sibling( cur, dir ) {
+	while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
+	return cur;
+}
+
+jQuery.each( {
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, _i, until ) {
+		return dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return sibling( elem, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return sibling( elem, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, _i, until ) {
+		return dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, _i, until ) {
+		return dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return siblings( ( elem.parentNode || {} ).firstChild, elem );
+	},
+	children: function( elem ) {
+		return siblings( elem.firstChild );
+	},
+	contents: function( elem ) {
+		if ( elem.contentDocument != null &&
+
+			// Support: IE 11+
+			// <object> elements with no `data` attribute has an object
+			// `contentDocument` with a `null` prototype.
+			getProto( elem.contentDocument ) ) {
+
+			return elem.contentDocument;
+		}
+
+		// Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
+		// Treat the template element as a regular one in browsers that
+		// don't support it.
+		if ( nodeName( elem, "template" ) ) {
+			elem = elem.content || elem;
+		}
+
+		return jQuery.merge( [], elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var matched = jQuery.map( this, fn, until );
+
+		if ( name.slice( -5 ) !== "Until" ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			matched = jQuery.filter( selector, matched );
+		}
+
+		if ( this.length > 1 ) {
+
+			// Remove duplicates
+			if ( !guaranteedUnique[ name ] ) {
+				jQuery.uniqueSort( matched );
+			}
+
+			// Reverse order for parents* and prev-derivatives
+			if ( rparentsprev.test( name ) ) {
+				matched.reverse();
+			}
+		}
+
+		return this.pushStack( matched );
+	};
+} );
+var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+	var object = {};
+	jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
+		object[ flag ] = true;
+	} );
+	return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ *	options: an optional list of space-separated options that will change how
+ *			the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ *	once:			will ensure the callback list can only be fired once (like a Deferred)
+ *
+ *	memory:			will keep track of previous values and will call any callback added
+ *					after the list has been fired right away with the latest "memorized"
+ *					values (like a Deferred)
+ *
+ *	unique:			will ensure a callback can only be added once (no duplicate in the list)
+ *
+ *	stopOnFalse:	interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+	// Convert options from String-formatted to Object-formatted if needed
+	// (we check in cache first)
+	options = typeof options === "string" ?
+		createOptions( options ) :
+		jQuery.extend( {}, options );
+
+	var // Flag to know if list is currently firing
+		firing,
+
+		// Last fire value for non-forgettable lists
+		memory,
+
+		// Flag to know if list was already fired
+		fired,
+
+		// Flag to prevent firing
+		locked,
+
+		// Actual callback list
+		list = [],
+
+		// Queue of execution data for repeatable lists
+		queue = [],
+
+		// Index of currently firing callback (modified by add/remove as needed)
+		firingIndex = -1,
+
+		// Fire callbacks
+		fire = function() {
+
+			// Enforce single-firing
+			locked = locked || options.once;
+
+			// Execute callbacks for all pending executions,
+			// respecting firingIndex overrides and runtime changes
+			fired = firing = true;
+			for ( ; queue.length; firingIndex = -1 ) {
+				memory = queue.shift();
+				while ( ++firingIndex < list.length ) {
+
+					// Run callback and check for early termination
+					if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+						options.stopOnFalse ) {
+
+						// Jump to end and forget the data so .add doesn't re-fire
+						firingIndex = list.length;
+						memory = false;
+					}
+				}
+			}
+
+			// Forget the data if we're done with it
+			if ( !options.memory ) {
+				memory = false;
+			}
+
+			firing = false;
+
+			// Clean up if we're done firing for good
+			if ( locked ) {
+
+				// Keep an empty list if we have data for future add calls
+				if ( memory ) {
+					list = [];
+
+				// Otherwise, this object is spent
+				} else {
+					list = "";
+				}
+			}
+		},
+
+		// Actual Callbacks object
+		self = {
+
+			// Add a callback or a collection of callbacks to the list
+			add: function() {
+				if ( list ) {
+
+					// If we have memory from a past run, we should fire after adding
+					if ( memory && !firing ) {
+						firingIndex = list.length - 1;
+						queue.push( memory );
+					}
+
+					( function add( args ) {
+						jQuery.each( args, function( _, arg ) {
+							if ( isFunction( arg ) ) {
+								if ( !options.unique || !self.has( arg ) ) {
+									list.push( arg );
+								}
+							} else if ( arg && arg.length && toType( arg ) !== "string" ) {
+
+								// Inspect recursively
+								add( arg );
+							}
+						} );
+					} )( arguments );
+
+					if ( memory && !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Remove a callback from the list
+			remove: function() {
+				jQuery.each( arguments, function( _, arg ) {
+					var index;
+					while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+						list.splice( index, 1 );
+
+						// Handle firing indexes
+						if ( index <= firingIndex ) {
+							firingIndex--;
+						}
+					}
+				} );
+				return this;
+			},
+
+			// Check if a given callback is in the list.
+			// If no argument is given, return whether or not list has callbacks attached.
+			has: function( fn ) {
+				return fn ?
+					jQuery.inArray( fn, list ) > -1 :
+					list.length > 0;
+			},
+
+			// Remove all callbacks from the list
+			empty: function() {
+				if ( list ) {
+					list = [];
+				}
+				return this;
+			},
+
+			// Disable .fire and .add
+			// Abort any current/pending executions
+			// Clear all callbacks and values
+			disable: function() {
+				locked = queue = [];
+				list = memory = "";
+				return this;
+			},
+			disabled: function() {
+				return !list;
+			},
+
+			// Disable .fire
+			// Also disable .add unless we have memory (since it would have no effect)
+			// Abort any pending executions
+			lock: function() {
+				locked = queue = [];
+				if ( !memory && !firing ) {
+					list = memory = "";
+				}
+				return this;
+			},
+			locked: function() {
+				return !!locked;
+			},
+
+			// Call all callbacks with the given context and arguments
+			fireWith: function( context, args ) {
+				if ( !locked ) {
+					args = args || [];
+					args = [ context, args.slice ? args.slice() : args ];
+					queue.push( args );
+					if ( !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Call all the callbacks with the given arguments
+			fire: function() {
+				self.fireWith( this, arguments );
+				return this;
+			},
+
+			// To know if the callbacks have already been called at least once
+			fired: function() {
+				return !!fired;
+			}
+		};
+
+	return self;
+};
+
+
+function Identity( v ) {
+	return v;
+}
+function Thrower( ex ) {
+	throw ex;
+}
+
+function adoptValue( value, resolve, reject, noValue ) {
+	var method;
+
+	try {
+
+		// Check for promise aspect first to privilege synchronous behavior
+		if ( value && isFunction( ( method = value.promise ) ) ) {
+			method.call( value ).done( resolve ).fail( reject );
+
+		// Other thenables
+		} else if ( value && isFunction( ( method = value.then ) ) ) {
+			method.call( value, resolve, reject );
+
+		// Other non-thenables
+		} else {
+
+			// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
+			// * false: [ value ].slice( 0 ) => resolve( value )
+			// * true: [ value ].slice( 1 ) => resolve()
+			resolve.apply( undefined, [ value ].slice( noValue ) );
+		}
+
+	// For Promises/A+, convert exceptions into rejections
+	// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
+	// Deferred#then to conditionally suppress rejection.
+	} catch ( value ) {
+
+		// Support: Android 4.0 only
+		// Strict mode functions invoked without .call/.apply get global-object context
+		reject.apply( undefined, [ value ] );
+	}
+}
+
+jQuery.extend( {
+
+	Deferred: function( func ) {
+		var tuples = [
+
+				// action, add listener, callbacks,
+				// ... .then handlers, argument index, [final state]
+				[ "notify", "progress", jQuery.Callbacks( "memory" ),
+					jQuery.Callbacks( "memory" ), 2 ],
+				[ "resolve", "done", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 0, "resolved" ],
+				[ "reject", "fail", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 1, "rejected" ]
+			],
+			state = "pending",
+			promise = {
+				state: function() {
+					return state;
+				},
+				always: function() {
+					deferred.done( arguments ).fail( arguments );
+					return this;
+				},
+				"catch": function( fn ) {
+					return promise.then( null, fn );
+				},
+
+				// Keep pipe for back-compat
+				pipe: function( /* fnDone, fnFail, fnProgress */ ) {
+					var fns = arguments;
+
+					return jQuery.Deferred( function( newDefer ) {
+						jQuery.each( tuples, function( _i, tuple ) {
+
+							// Map tuples (progress, done, fail) to arguments (done, fail, progress)
+							var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
+
+							// deferred.progress(function() { bind to newDefer or newDefer.notify })
+							// deferred.done(function() { bind to newDefer or newDefer.resolve })
+							// deferred.fail(function() { bind to newDefer or newDefer.reject })
+							deferred[ tuple[ 1 ] ]( function() {
+								var returned = fn && fn.apply( this, arguments );
+								if ( returned && isFunction( returned.promise ) ) {
+									returned.promise()
+										.progress( newDefer.notify )
+										.done( newDefer.resolve )
+										.fail( newDefer.reject );
+								} else {
+									newDefer[ tuple[ 0 ] + "With" ](
+										this,
+										fn ? [ returned ] : arguments
+									);
+								}
+							} );
+						} );
+						fns = null;
+					} ).promise();
+				},
+				then: function( onFulfilled, onRejected, onProgress ) {
+					var maxDepth = 0;
+					function resolve( depth, deferred, handler, special ) {
+						return function() {
+							var that = this,
+								args = arguments,
+								mightThrow = function() {
+									var returned, then;
+
+									// Support: Promises/A+ section 2.3.3.3.3
+									// https://promisesaplus.com/#point-59
+									// Ignore double-resolution attempts
+									if ( depth < maxDepth ) {
+										return;
+									}
+
+									returned = handler.apply( that, args );
+
+									// Support: Promises/A+ section 2.3.1
+									// https://promisesaplus.com/#point-48
+									if ( returned === deferred.promise() ) {
+										throw new TypeError( "Thenable self-resolution" );
+									}
+
+									// Support: Promises/A+ sections 2.3.3.1, 3.5
+									// https://promisesaplus.com/#point-54
+									// https://promisesaplus.com/#point-75
+									// Retrieve `then` only once
+									then = returned &&
+
+										// Support: Promises/A+ section 2.3.4
+										// https://promisesaplus.com/#point-64
+										// Only check objects and functions for thenability
+										( typeof returned === "object" ||
+											typeof returned === "function" ) &&
+										returned.then;
+
+									// Handle a returned thenable
+									if ( isFunction( then ) ) {
+
+										// Special processors (notify) just wait for resolution
+										if ( special ) {
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special )
+											);
+
+										// Normal processors (resolve) also hook into progress
+										} else {
+
+											// ...and disregard older resolution values
+											maxDepth++;
+
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special ),
+												resolve( maxDepth, deferred, Identity,
+													deferred.notifyWith )
+											);
+										}
+
+									// Handle all other returned values
+									} else {
+
+										// Only substitute handlers pass on context
+										// and multiple values (non-spec behavior)
+										if ( handler !== Identity ) {
+											that = undefined;
+											args = [ returned ];
+										}
+
+										// Process the value(s)
+										// Default process is resolve
+										( special || deferred.resolveWith )( that, args );
+									}
+								},
+
+								// Only normal processors (resolve) catch and reject exceptions
+								process = special ?
+									mightThrow :
+									function() {
+										try {
+											mightThrow();
+										} catch ( e ) {
+
+											if ( jQuery.Deferred.exceptionHook ) {
+												jQuery.Deferred.exceptionHook( e,
+													process.error );
+											}
+
+											// Support: Promises/A+ section 2.3.3.3.4.1
+											// https://promisesaplus.com/#point-61
+											// Ignore post-resolution exceptions
+											if ( depth + 1 >= maxDepth ) {
+
+												// Only substitute handlers pass on context
+												// and multiple values (non-spec behavior)
+												if ( handler !== Thrower ) {
+													that = undefined;
+													args = [ e ];
+												}
+
+												deferred.rejectWith( that, args );
+											}
+										}
+									};
+
+							// Support: Promises/A+ section 2.3.3.3.1
+							// https://promisesaplus.com/#point-57
+							// Re-resolve promises immediately to dodge false rejection from
+							// subsequent errors
+							if ( depth ) {
+								process();
+							} else {
+
+								// Call an optional hook to record the error, in case of exception
+								// since it's otherwise lost when execution goes async
+								if ( jQuery.Deferred.getErrorHook ) {
+									process.error = jQuery.Deferred.getErrorHook();
+
+								// The deprecated alias of the above. While the name suggests
+								// returning the stack, not an error instance, jQuery just passes
+								// it directly to `console.warn` so both will work; an instance
+								// just better cooperates with source maps.
+								} else if ( jQuery.Deferred.getStackHook ) {
+									process.error = jQuery.Deferred.getStackHook();
+								}
+								window.setTimeout( process );
+							}
+						};
+					}
+
+					return jQuery.Deferred( function( newDefer ) {
+
+						// progress_handlers.add( ... )
+						tuples[ 0 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onProgress ) ?
+									onProgress :
+									Identity,
+								newDefer.notifyWith
+							)
+						);
+
+						// fulfilled_handlers.add( ... )
+						tuples[ 1 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onFulfilled ) ?
+									onFulfilled :
+									Identity
+							)
+						);
+
+						// rejected_handlers.add( ... )
+						tuples[ 2 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onRejected ) ?
+									onRejected :
+									Thrower
+							)
+						);
+					} ).promise();
+				},
+
+				// Get a promise for this deferred
+				// If obj is provided, the promise aspect is added to the object
+				promise: function( obj ) {
+					return obj != null ? jQuery.extend( obj, promise ) : promise;
+				}
+			},
+			deferred = {};
+
+		// Add list-specific methods
+		jQuery.each( tuples, function( i, tuple ) {
+			var list = tuple[ 2 ],
+				stateString = tuple[ 5 ];
+
+			// promise.progress = list.add
+			// promise.done = list.add
+			// promise.fail = list.add
+			promise[ tuple[ 1 ] ] = list.add;
+
+			// Handle state
+			if ( stateString ) {
+				list.add(
+					function() {
+
+						// state = "resolved" (i.e., fulfilled)
+						// state = "rejected"
+						state = stateString;
+					},
+
+					// rejected_callbacks.disable
+					// fulfilled_callbacks.disable
+					tuples[ 3 - i ][ 2 ].disable,
+
+					// rejected_handlers.disable
+					// fulfilled_handlers.disable
+					tuples[ 3 - i ][ 3 ].disable,
+
+					// progress_callbacks.lock
+					tuples[ 0 ][ 2 ].lock,
+
+					// progress_handlers.lock
+					tuples[ 0 ][ 3 ].lock
+				);
+			}
+
+			// progress_handlers.fire
+			// fulfilled_handlers.fire
+			// rejected_handlers.fire
+			list.add( tuple[ 3 ].fire );
+
+			// deferred.notify = function() { deferred.notifyWith(...) }
+			// deferred.resolve = function() { deferred.resolveWith(...) }
+			// deferred.reject = function() { deferred.rejectWith(...) }
+			deferred[ tuple[ 0 ] ] = function() {
+				deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
+				return this;
+			};
+
+			// deferred.notifyWith = list.fireWith
+			// deferred.resolveWith = list.fireWith
+			// deferred.rejectWith = list.fireWith
+			deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+		} );
+
+		// Make the deferred a promise
+		promise.promise( deferred );
+
+		// Call given func if any
+		if ( func ) {
+			func.call( deferred, deferred );
+		}
+
+		// All done!
+		return deferred;
+	},
+
+	// Deferred helper
+	when: function( singleValue ) {
+		var
+
+			// count of uncompleted subordinates
+			remaining = arguments.length,
+
+			// count of unprocessed arguments
+			i = remaining,
+
+			// subordinate fulfillment data
+			resolveContexts = Array( i ),
+			resolveValues = slice.call( arguments ),
+
+			// the primary Deferred
+			primary = jQuery.Deferred(),
+
+			// subordinate callback factory
+			updateFunc = function( i ) {
+				return function( value ) {
+					resolveContexts[ i ] = this;
+					resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+					if ( !( --remaining ) ) {
+						primary.resolveWith( resolveContexts, resolveValues );
+					}
+				};
+			};
+
+		// Single- and empty arguments are adopted like Promise.resolve
+		if ( remaining <= 1 ) {
+			adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject,
+				!remaining );
+
+			// Use .then() to unwrap secondary thenables (cf. gh-3000)
+			if ( primary.state() === "pending" ||
+				isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
+
+				return primary.then();
+			}
+		}
+
+		// Multiple arguments are aggregated like Promise.all array elements
+		while ( i-- ) {
+			adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject );
+		}
+
+		return primary.promise();
+	}
+} );
+
+
+// These usually indicate a programmer mistake during development,
+// warn about them ASAP rather than swallowing them by default.
+var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
+
+// If `jQuery.Deferred.getErrorHook` is defined, `asyncError` is an error
+// captured before the async barrier to get the original error cause
+// which may otherwise be hidden.
+jQuery.Deferred.exceptionHook = function( error, asyncError ) {
+
+	// Support: IE 8 - 9 only
+	// Console exists when dev tools are open, which can happen at any time
+	if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
+		window.console.warn( "jQuery.Deferred exception: " + error.message,
+			error.stack, asyncError );
+	}
+};
+
+
+
+
+jQuery.readyException = function( error ) {
+	window.setTimeout( function() {
+		throw error;
+	} );
+};
+
+
+
+
+// The deferred used on DOM ready
+var readyList = jQuery.Deferred();
+
+jQuery.fn.ready = function( fn ) {
+
+	readyList
+		.then( fn )
+
+		// Wrap jQuery.readyException in a function so that the lookup
+		// happens at the time of error handling instead of callback
+		// registration.
+		.catch( function( error ) {
+			jQuery.readyException( error );
+		} );
+
+	return this;
+};
+
+jQuery.extend( {
+
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+
+	// A counter to track how many items to wait for before
+	// the ready event fires. See trac-6781
+	readyWait: 1,
+
+	// Handle when the DOM is ready
+	ready: function( wait ) {
+
+		// Abort if there are pending holds or we're already ready
+		if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+			return;
+		}
+
+		// Remember that the DOM is ready
+		jQuery.isReady = true;
+
+		// If a normal DOM Ready event fired, decrement, and wait if need be
+		if ( wait !== true && --jQuery.readyWait > 0 ) {
+			return;
+		}
+
+		// If there are functions bound, to execute
+		readyList.resolveWith( document, [ jQuery ] );
+	}
+} );
+
+jQuery.ready.then = readyList.then;
+
+// The ready event handler and self cleanup method
+function completed() {
+	document.removeEventListener( "DOMContentLoaded", completed );
+	window.removeEventListener( "load", completed );
+	jQuery.ready();
+}
+
+// Catch cases where $(document).ready() is called
+// after the browser event has already occurred.
+// Support: IE <=9 - 10 only
+// Older IE sometimes signals "interactive" too soon
+if ( document.readyState === "complete" ||
+	( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+	// Handle it asynchronously to allow scripts the opportunity to delay ready
+	window.setTimeout( jQuery.ready );
+
+} else {
+
+	// Use the handy event callback
+	document.addEventListener( "DOMContentLoaded", completed );
+
+	// A fallback to window.onload, that will always work
+	window.addEventListener( "load", completed );
+}
+
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+	var i = 0,
+		len = elems.length,
+		bulk = key == null;
+
+	// Sets many values
+	if ( toType( key ) === "object" ) {
+		chainable = true;
+		for ( i in key ) {
+			access( elems, fn, i, key[ i ], true, emptyGet, raw );
+		}
+
+	// Sets one value
+	} else if ( value !== undefined ) {
+		chainable = true;
+
+		if ( !isFunction( value ) ) {
+			raw = true;
+		}
+
+		if ( bulk ) {
+
+			// Bulk operations run against the entire set
+			if ( raw ) {
+				fn.call( elems, value );
+				fn = null;
+
+			// ...except when executing function values
+			} else {
+				bulk = fn;
+				fn = function( elem, _key, value ) {
+					return bulk.call( jQuery( elem ), value );
+				};
+			}
+		}
+
+		if ( fn ) {
+			for ( ; i < len; i++ ) {
+				fn(
+					elems[ i ], key, raw ?
+						value :
+						value.call( elems[ i ], i, fn( elems[ i ], key ) )
+				);
+			}
+		}
+	}
+
+	if ( chainable ) {
+		return elems;
+	}
+
+	// Gets
+	if ( bulk ) {
+		return fn.call( elems );
+	}
+
+	return len ? fn( elems[ 0 ], key ) : emptyGet;
+};
+
+
+// Matches dashed string for camelizing
+var rmsPrefix = /^-ms-/,
+	rdashAlpha = /-([a-z])/g;
+
+// Used by camelCase as callback to replace()
+function fcamelCase( _all, letter ) {
+	return letter.toUpperCase();
+}
+
+// Convert dashed to camelCase; used by the css and data modules
+// Support: IE <=9 - 11, Edge 12 - 15
+// Microsoft forgot to hump their vendor prefix (trac-9572)
+function camelCase( string ) {
+	return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+}
+var acceptData = function( owner ) {
+
+	// Accepts only:
+	//  - Node
+	//    - Node.ELEMENT_NODE
+	//    - Node.DOCUMENT_NODE
+	//  - Object
+	//    - Any
+	return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
+};
+
+
+
+
+function Data() {
+	this.expando = jQuery.expando + Data.uid++;
+}
+
+Data.uid = 1;
+
+Data.prototype = {
+
+	cache: function( owner ) {
+
+		// Check if the owner object already has a cache
+		var value = owner[ this.expando ];
+
+		// If not, create one
+		if ( !value ) {
+			value = {};
+
+			// We can accept data for non-element nodes in modern browsers,
+			// but we should not, see trac-8335.
+			// Always return an empty object.
+			if ( acceptData( owner ) ) {
+
+				// If it is a node unlikely to be stringify-ed or looped over
+				// use plain assignment
+				if ( owner.nodeType ) {
+					owner[ this.expando ] = value;
+
+				// Otherwise secure it in a non-enumerable property
+				// configurable must be true to allow the property to be
+				// deleted when data is removed
+				} else {
+					Object.defineProperty( owner, this.expando, {
+						value: value,
+						configurable: true
+					} );
+				}
+			}
+		}
+
+		return value;
+	},
+	set: function( owner, data, value ) {
+		var prop,
+			cache = this.cache( owner );
+
+		// Handle: [ owner, key, value ] args
+		// Always use camelCase key (gh-2257)
+		if ( typeof data === "string" ) {
+			cache[ camelCase( data ) ] = value;
+
+		// Handle: [ owner, { properties } ] args
+		} else {
+
+			// Copy the properties one-by-one to the cache object
+			for ( prop in data ) {
+				cache[ camelCase( prop ) ] = data[ prop ];
+			}
+		}
+		return cache;
+	},
+	get: function( owner, key ) {
+		return key === undefined ?
+			this.cache( owner ) :
+
+			// Always use camelCase key (gh-2257)
+			owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];
+	},
+	access: function( owner, key, value ) {
+
+		// In cases where either:
+		//
+		//   1. No key was specified
+		//   2. A string key was specified, but no value provided
+		//
+		// Take the "read" path and allow the get method to determine
+		// which value to return, respectively either:
+		//
+		//   1. The entire cache object
+		//   2. The data stored at the key
+		//
+		if ( key === undefined ||
+				( ( key && typeof key === "string" ) && value === undefined ) ) {
+
+			return this.get( owner, key );
+		}
+
+		// When the key is not a string, or both a key and value
+		// are specified, set or extend (existing objects) with either:
+		//
+		//   1. An object of properties
+		//   2. A key and value
+		//
+		this.set( owner, key, value );
+
+		// Since the "set" path can have two possible entry points
+		// return the expected data based on which path was taken[*]
+		return value !== undefined ? value : key;
+	},
+	remove: function( owner, key ) {
+		var i,
+			cache = owner[ this.expando ];
+
+		if ( cache === undefined ) {
+			return;
+		}
+
+		if ( key !== undefined ) {
+
+			// Support array or space separated string of keys
+			if ( Array.isArray( key ) ) {
+
+				// If key is an array of keys...
+				// We always set camelCase keys, so remove that.
+				key = key.map( camelCase );
+			} else {
+				key = camelCase( key );
+
+				// If a key with the spaces exists, use it.
+				// Otherwise, create an array by matching non-whitespace
+				key = key in cache ?
+					[ key ] :
+					( key.match( rnothtmlwhite ) || [] );
+			}
+
+			i = key.length;
+
+			while ( i-- ) {
+				delete cache[ key[ i ] ];
+			}
+		}
+
+		// Remove the expando if there's no more data
+		if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
+
+			// Support: Chrome <=35 - 45
+			// Webkit & Blink performance suffers when deleting properties
+			// from DOM nodes, so set to undefined instead
+			// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
+			if ( owner.nodeType ) {
+				owner[ this.expando ] = undefined;
+			} else {
+				delete owner[ this.expando ];
+			}
+		}
+	},
+	hasData: function( owner ) {
+		var cache = owner[ this.expando ];
+		return cache !== undefined && !jQuery.isEmptyObject( cache );
+	}
+};
+var dataPriv = new Data();
+
+var dataUser = new Data();
+
+
+
+//	Implementation Summary
+//
+//	1. Enforce API surface and semantic compatibility with 1.9.x branch
+//	2. Improve the module's maintainability by reducing the storage
+//		paths to a single mechanism.
+//	3. Use the same single mechanism to support "private" and "user" data.
+//	4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
+//	5. Avoid exposing implementation details on user objects (eg. expando properties)
+//	6. Provide a clear path for implementation upgrade to WeakMap in 2014
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+	rmultiDash = /[A-Z]/g;
+
+function getData( data ) {
+	if ( data === "true" ) {
+		return true;
+	}
+
+	if ( data === "false" ) {
+		return false;
+	}
+
+	if ( data === "null" ) {
+		return null;
+	}
+
+	// Only convert to a number if it doesn't change the string
+	if ( data === +data + "" ) {
+		return +data;
+	}
+
+	if ( rbrace.test( data ) ) {
+		return JSON.parse( data );
+	}
+
+	return data;
+}
+
+function dataAttr( elem, key, data ) {
+	var name;
+
+	// If nothing was found internally, try to fetch any
+	// data from the HTML5 data-* attribute
+	if ( data === undefined && elem.nodeType === 1 ) {
+		name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
+		data = elem.getAttribute( name );
+
+		if ( typeof data === "string" ) {
+			try {
+				data = getData( data );
+			} catch ( e ) {}
+
+			// Make sure we set the data so it isn't changed later
+			dataUser.set( elem, key, data );
+		} else {
+			data = undefined;
+		}
+	}
+	return data;
+}
+
+jQuery.extend( {
+	hasData: function( elem ) {
+		return dataUser.hasData( elem ) || dataPriv.hasData( elem );
+	},
+
+	data: function( elem, name, data ) {
+		return dataUser.access( elem, name, data );
+	},
+
+	removeData: function( elem, name ) {
+		dataUser.remove( elem, name );
+	},
+
+	// TODO: Now that all calls to _data and _removeData have been replaced
+	// with direct calls to dataPriv methods, these can be deprecated.
+	_data: function( elem, name, data ) {
+		return dataPriv.access( elem, name, data );
+	},
+
+	_removeData: function( elem, name ) {
+		dataPriv.remove( elem, name );
+	}
+} );
+
+jQuery.fn.extend( {
+	data: function( key, value ) {
+		var i, name, data,
+			elem = this[ 0 ],
+			attrs = elem && elem.attributes;
+
+		// Gets all values
+		if ( key === undefined ) {
+			if ( this.length ) {
+				data = dataUser.get( elem );
+
+				if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
+					i = attrs.length;
+					while ( i-- ) {
+
+						// Support: IE 11 only
+						// The attrs elements can be null (trac-14894)
+						if ( attrs[ i ] ) {
+							name = attrs[ i ].name;
+							if ( name.indexOf( "data-" ) === 0 ) {
+								name = camelCase( name.slice( 5 ) );
+								dataAttr( elem, name, data[ name ] );
+							}
+						}
+					}
+					dataPriv.set( elem, "hasDataAttrs", true );
+				}
+			}
+
+			return data;
+		}
+
+		// Sets multiple values
+		if ( typeof key === "object" ) {
+			return this.each( function() {
+				dataUser.set( this, key );
+			} );
+		}
+
+		return access( this, function( value ) {
+			var data;
+
+			// The calling jQuery object (element matches) is not empty
+			// (and therefore has an element appears at this[ 0 ]) and the
+			// `value` parameter was not undefined. An empty jQuery object
+			// will result in `undefined` for elem = this[ 0 ] which will
+			// throw an exception if an attempt to read a data cache is made.
+			if ( elem && value === undefined ) {
+
+				// Attempt to get data from the cache
+				// The key will always be camelCased in Data
+				data = dataUser.get( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// Attempt to "discover" the data in
+				// HTML5 custom data-* attrs
+				data = dataAttr( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// We tried really hard, but the data doesn't exist.
+				return;
+			}
+
+			// Set the data...
+			this.each( function() {
+
+				// We always store the camelCased key
+				dataUser.set( this, key, value );
+			} );
+		}, null, value, arguments.length > 1, null, true );
+	},
+
+	removeData: function( key ) {
+		return this.each( function() {
+			dataUser.remove( this, key );
+		} );
+	}
+} );
+
+
+jQuery.extend( {
+	queue: function( elem, type, data ) {
+		var queue;
+
+		if ( elem ) {
+			type = ( type || "fx" ) + "queue";
+			queue = dataPriv.get( elem, type );
+
+			// Speed up dequeue by getting out quickly if this is just a lookup
+			if ( data ) {
+				if ( !queue || Array.isArray( data ) ) {
+					queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
+				} else {
+					queue.push( data );
+				}
+			}
+			return queue || [];
+		}
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ),
+			startLength = queue.length,
+			fn = queue.shift(),
+			hooks = jQuery._queueHooks( elem, type ),
+			next = function() {
+				jQuery.dequeue( elem, type );
+			};
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+			startLength--;
+		}
+
+		if ( fn ) {
+
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift( "inprogress" );
+			}
+
+			// Clear up the last queue stop function
+			delete hooks.stop;
+			fn.call( elem, next, hooks );
+		}
+
+		if ( !startLength && hooks ) {
+			hooks.empty.fire();
+		}
+	},
+
+	// Not public - generate a queueHooks object, or return the current one
+	_queueHooks: function( elem, type ) {
+		var key = type + "queueHooks";
+		return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
+			empty: jQuery.Callbacks( "once memory" ).add( function() {
+				dataPriv.remove( elem, [ type + "queue", key ] );
+			} )
+		} );
+	}
+} );
+
+jQuery.fn.extend( {
+	queue: function( type, data ) {
+		var setter = 2;
+
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+			setter--;
+		}
+
+		if ( arguments.length < setter ) {
+			return jQuery.queue( this[ 0 ], type );
+		}
+
+		return data === undefined ?
+			this :
+			this.each( function() {
+				var queue = jQuery.queue( this, type, data );
+
+				// Ensure a hooks for this queue
+				jQuery._queueHooks( this, type );
+
+				if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+					jQuery.dequeue( this, type );
+				}
+			} );
+	},
+	dequeue: function( type ) {
+		return this.each( function() {
+			jQuery.dequeue( this, type );
+		} );
+	},
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	},
+
+	// Get a promise resolved when queues of a certain type
+	// are emptied (fx is the type by default)
+	promise: function( type, obj ) {
+		var tmp,
+			count = 1,
+			defer = jQuery.Deferred(),
+			elements = this,
+			i = this.length,
+			resolve = function() {
+				if ( !( --count ) ) {
+					defer.resolveWith( elements, [ elements ] );
+				}
+			};
+
+		if ( typeof type !== "string" ) {
+			obj = type;
+			type = undefined;
+		}
+		type = type || "fx";
+
+		while ( i-- ) {
+			tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
+			if ( tmp && tmp.empty ) {
+				count++;
+				tmp.empty.add( resolve );
+			}
+		}
+		resolve();
+		return defer.promise( obj );
+	}
+} );
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var documentElement = document.documentElement;
+
+
+
+	var isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem );
+		},
+		composed = { composed: true };
+
+	// Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only
+	// Check attachment across shadow DOM boundaries when possible (gh-3504)
+	// Support: iOS 10.0-10.2 only
+	// Early iOS 10 versions support `attachShadow` but not `getRootNode`,
+	// leading to errors. We need to check for `getRootNode`.
+	if ( documentElement.getRootNode ) {
+		isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem ) ||
+				elem.getRootNode( composed ) === elem.ownerDocument;
+		};
+	}
+var isHiddenWithinTree = function( elem, el ) {
+
+		// isHiddenWithinTree might be called from jQuery#filter function;
+		// in that case, element will be second argument
+		elem = el || elem;
+
+		// Inline style trumps all
+		return elem.style.display === "none" ||
+			elem.style.display === "" &&
+
+			// Otherwise, check computed style
+			// Support: Firefox <=43 - 45
+			// Disconnected elements can have computed display: none, so first confirm that elem is
+			// in the document.
+			isAttached( elem ) &&
+
+			jQuery.css( elem, "display" ) === "none";
+	};
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+	var adjusted, scale,
+		maxIterations = 20,
+		currentValue = tween ?
+			function() {
+				return tween.cur();
+			} :
+			function() {
+				return jQuery.css( elem, prop, "" );
+			},
+		initial = currentValue(),
+		unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+		// Starting value computation is required for potential unit mismatches
+		initialInUnit = elem.nodeType &&
+			( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+			rcssNum.exec( jQuery.css( elem, prop ) );
+
+	if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+		// Support: Firefox <=54
+		// Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
+		initial = initial / 2;
+
+		// Trust units reported by jQuery.css
+		unit = unit || initialInUnit[ 3 ];
+
+		// Iteratively approximate from a nonzero starting point
+		initialInUnit = +initial || 1;
+
+		while ( maxIterations-- ) {
+
+			// Evaluate and update our best guess (doubling guesses that zero out).
+			// Finish if the scale equals or crosses 1 (making the old*new product non-positive).
+			jQuery.style( elem, prop, initialInUnit + unit );
+			if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {
+				maxIterations = 0;
+			}
+			initialInUnit = initialInUnit / scale;
+
+		}
+
+		initialInUnit = initialInUnit * 2;
+		jQuery.style( elem, prop, initialInUnit + unit );
+
+		// Make sure we update the tween properties later on
+		valueParts = valueParts || [];
+	}
+
+	if ( valueParts ) {
+		initialInUnit = +initialInUnit || +initial || 0;
+
+		// Apply relative offset (+=/-=) if specified
+		adjusted = valueParts[ 1 ] ?
+			initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+			+valueParts[ 2 ];
+		if ( tween ) {
+			tween.unit = unit;
+			tween.start = initialInUnit;
+			tween.end = adjusted;
+		}
+	}
+	return adjusted;
+}
+
+
+var defaultDisplayMap = {};
+
+function getDefaultDisplay( elem ) {
+	var temp,
+		doc = elem.ownerDocument,
+		nodeName = elem.nodeName,
+		display = defaultDisplayMap[ nodeName ];
+
+	if ( display ) {
+		return display;
+	}
+
+	temp = doc.body.appendChild( doc.createElement( nodeName ) );
+	display = jQuery.css( temp, "display" );
+
+	temp.parentNode.removeChild( temp );
+
+	if ( display === "none" ) {
+		display = "block";
+	}
+	defaultDisplayMap[ nodeName ] = display;
+
+	return display;
+}
+
+function showHide( elements, show ) {
+	var display, elem,
+		values = [],
+		index = 0,
+		length = elements.length;
+
+	// Determine new display value for elements that need to change
+	for ( ; index < length; index++ ) {
+		elem = elements[ index ];
+		if ( !elem.style ) {
+			continue;
+		}
+
+		display = elem.style.display;
+		if ( show ) {
+
+			// Since we force visibility upon cascade-hidden elements, an immediate (and slow)
+			// check is required in this first loop unless we have a nonempty display value (either
+			// inline or about-to-be-restored)
+			if ( display === "none" ) {
+				values[ index ] = dataPriv.get( elem, "display" ) || null;
+				if ( !values[ index ] ) {
+					elem.style.display = "";
+				}
+			}
+			if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
+				values[ index ] = getDefaultDisplay( elem );
+			}
+		} else {
+			if ( display !== "none" ) {
+				values[ index ] = "none";
+
+				// Remember what we're overwriting
+				dataPriv.set( elem, "display", display );
+			}
+		}
+	}
+
+	// Set the display of the elements in a second loop to avoid constant reflow
+	for ( index = 0; index < length; index++ ) {
+		if ( values[ index ] != null ) {
+			elements[ index ].style.display = values[ index ];
+		}
+	}
+
+	return elements;
+}
+
+jQuery.fn.extend( {
+	show: function() {
+		return showHide( this, true );
+	},
+	hide: function() {
+		return showHide( this );
+	},
+	toggle: function( state ) {
+		if ( typeof state === "boolean" ) {
+			return state ? this.show() : this.hide();
+		}
+
+		return this.each( function() {
+			if ( isHiddenWithinTree( this ) ) {
+				jQuery( this ).show();
+			} else {
+				jQuery( this ).hide();
+			}
+		} );
+	}
+} );
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
+
+var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i );
+
+var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i );
+
+
+
+( function() {
+	var fragment = document.createDocumentFragment(),
+		div = fragment.appendChild( document.createElement( "div" ) ),
+		input = document.createElement( "input" );
+
+	// Support: Android 4.0 - 4.3 only
+	// Check state lost if the name is set (trac-11217)
+	// Support: Windows Web Apps (WWA)
+	// `name` and `type` must use .setAttribute for WWA (trac-14901)
+	input.setAttribute( "type", "radio" );
+	input.setAttribute( "checked", "checked" );
+	input.setAttribute( "name", "t" );
+
+	div.appendChild( input );
+
+	// Support: Android <=4.1 only
+	// Older WebKit doesn't clone checked state correctly in fragments
+	support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+	// Support: IE <=11 only
+	// Make sure textarea (and checkbox) defaultValue is properly cloned
+	div.innerHTML = "<textarea>x</textarea>";
+	support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+	// Support: IE <=9 only
+	// IE <=9 replaces <option> tags with their contents when inserted outside of
+	// the select element.
+	div.innerHTML = "<option></option>";
+	support.option = !!div.lastChild;
+} )();
+
+
+// We have to close these tags to support XHTML (trac-13200)
+var wrapMap = {
+
+	// XHTML parsers do not magically insert elements in the
+	// same way that tag soup parsers do. So we cannot shorten
+	// this by omitting <tbody> or other required elements.
+	thead: [ 1, "<table>", "</table>" ],
+	col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
+	tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+	td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+	_default: [ 0, "", "" ]
+};
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// Support: IE <=9 only
+if ( !support.option ) {
+	wrapMap.optgroup = wrapMap.option = [ 1, "<select multiple='multiple'>", "</select>" ];
+}
+
+
+function getAll( context, tag ) {
+
+	// Support: IE <=9 - 11 only
+	// Use typeof to avoid zero-argument method invocation on host objects (trac-15151)
+	var ret;
+
+	if ( typeof context.getElementsByTagName !== "undefined" ) {
+		ret = context.getElementsByTagName( tag || "*" );
+
+	} else if ( typeof context.querySelectorAll !== "undefined" ) {
+		ret = context.querySelectorAll( tag || "*" );
+
+	} else {
+		ret = [];
+	}
+
+	if ( tag === undefined || tag && nodeName( context, tag ) ) {
+		return jQuery.merge( [ context ], ret );
+	}
+
+	return ret;
+}
+
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+	var i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		dataPriv.set(
+			elems[ i ],
+			"globalEval",
+			!refElements || dataPriv.get( refElements[ i ], "globalEval" )
+		);
+	}
+}
+
+
+var rhtml = /<|&#?\w+;/;
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+	var elem, tmp, tag, wrap, attached, j,
+		fragment = context.createDocumentFragment(),
+		nodes = [],
+		i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		elem = elems[ i ];
+
+		if ( elem || elem === 0 ) {
+
+			// Add nodes directly
+			if ( toType( elem ) === "object" ) {
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+			// Convert non-html into a text node
+			} else if ( !rhtml.test( elem ) ) {
+				nodes.push( context.createTextNode( elem ) );
+
+			// Convert html into DOM nodes
+			} else {
+				tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
+
+				// Deserialize a standard representation
+				tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+				wrap = wrapMap[ tag ] || wrapMap._default;
+				tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+				// Descend through wrappers to the right content
+				j = wrap[ 0 ];
+				while ( j-- ) {
+					tmp = tmp.lastChild;
+				}
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, tmp.childNodes );
+
+				// Remember the top-level container
+				tmp = fragment.firstChild;
+
+				// Ensure the created nodes are orphaned (trac-12392)
+				tmp.textContent = "";
+			}
+		}
+	}
+
+	// Remove wrapper from fragment
+	fragment.textContent = "";
+
+	i = 0;
+	while ( ( elem = nodes[ i++ ] ) ) {
+
+		// Skip elements already in the context collection (trac-4087)
+		if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+			if ( ignored ) {
+				ignored.push( elem );
+			}
+			continue;
+		}
+
+		attached = isAttached( elem );
+
+		// Append to fragment
+		tmp = getAll( fragment.appendChild( elem ), "script" );
+
+		// Preserve script evaluation history
+		if ( attached ) {
+			setGlobalEval( tmp );
+		}
+
+		// Capture executables
+		if ( scripts ) {
+			j = 0;
+			while ( ( elem = tmp[ j++ ] ) ) {
+				if ( rscriptType.test( elem.type || "" ) ) {
+					scripts.push( elem );
+				}
+			}
+		}
+	}
+
+	return fragment;
+}
+
+
+var rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+	return true;
+}
+
+function returnFalse() {
+	return false;
+}
+
+function on( elem, types, selector, data, fn, one ) {
+	var origFn, type;
+
+	// Types can be a map of types/handlers
+	if ( typeof types === "object" ) {
+
+		// ( types-Object, selector, data )
+		if ( typeof selector !== "string" ) {
+
+			// ( types-Object, data )
+			data = data || selector;
+			selector = undefined;
+		}
+		for ( type in types ) {
+			on( elem, type, selector, data, types[ type ], one );
+		}
+		return elem;
+	}
+
+	if ( data == null && fn == null ) {
+
+		// ( types, fn )
+		fn = selector;
+		data = selector = undefined;
+	} else if ( fn == null ) {
+		if ( typeof selector === "string" ) {
+
+			// ( types, selector, fn )
+			fn = data;
+			data = undefined;
+		} else {
+
+			// ( types, data, fn )
+			fn = data;
+			data = selector;
+			selector = undefined;
+		}
+	}
+	if ( fn === false ) {
+		fn = returnFalse;
+	} else if ( !fn ) {
+		return elem;
+	}
+
+	if ( one === 1 ) {
+		origFn = fn;
+		fn = function( event ) {
+
+			// Can use an empty set, since event contains the info
+			jQuery().off( event );
+			return origFn.apply( this, arguments );
+		};
+
+		// Use same guid so caller can remove using origFn
+		fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+	}
+	return elem.each( function() {
+		jQuery.event.add( this, types, fn, data, selector );
+	} );
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+	global: {},
+
+	add: function( elem, types, handler, data, selector ) {
+
+		var handleObjIn, eventHandle, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.get( elem );
+
+		// Only attach events to objects that accept data
+		if ( !acceptData( elem ) ) {
+			return;
+		}
+
+		// Caller can pass in an object of custom data in lieu of the handler
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+			selector = handleObjIn.selector;
+		}
+
+		// Ensure that invalid selectors throw exceptions at attach time
+		// Evaluate against documentElement in case elem is a non-element node (e.g., document)
+		if ( selector ) {
+			jQuery.find.matchesSelector( documentElement, selector );
+		}
+
+		// Make sure that the handler has a unique ID, used to find/remove it later
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure and main handler, if this is the first
+		if ( !( events = elemData.events ) ) {
+			events = elemData.events = Object.create( null );
+		}
+		if ( !( eventHandle = elemData.handle ) ) {
+			eventHandle = elemData.handle = function( e ) {
+
+				// Discard the second event of a jQuery.event.trigger() and
+				// when an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
+					jQuery.event.dispatch.apply( elem, arguments ) : undefined;
+			};
+		}
+
+		// Handle multiple events separated by a space
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// There *must* be a type, no attaching namespace-only handlers
+			if ( !type ) {
+				continue;
+			}
+
+			// If event changes its type, use the special event handlers for the changed type
+			special = jQuery.event.special[ type ] || {};
+
+			// If selector defined, determine special event api type, otherwise given type
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+
+			// Update special based on newly reset type
+			special = jQuery.event.special[ type ] || {};
+
+			// handleObj is passed to all event handlers
+			handleObj = jQuery.extend( {
+				type: type,
+				origType: origType,
+				data: data,
+				handler: handler,
+				guid: handler.guid,
+				selector: selector,
+				needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+				namespace: namespaces.join( "." )
+			}, handleObjIn );
+
+			// Init the event handler queue if we're the first
+			if ( !( handlers = events[ type ] ) ) {
+				handlers = events[ type ] = [];
+				handlers.delegateCount = 0;
+
+				// Only use addEventListener if the special events handler returns false
+				if ( !special.setup ||
+					special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle );
+					}
+				}
+			}
+
+			if ( special.add ) {
+				special.add.call( elem, handleObj );
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add to the element's handler list, delegates in front
+			if ( selector ) {
+				handlers.splice( handlers.delegateCount++, 0, handleObj );
+			} else {
+				handlers.push( handleObj );
+			}
+
+			// Keep track of which events have ever been used, for event optimization
+			jQuery.event.global[ type ] = true;
+		}
+
+	},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, selector, mappedTypes ) {
+
+		var j, origCount, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
+
+		if ( !elemData || !( events = elemData.events ) ) {
+			return;
+		}
+
+		// Once for each type.namespace in types; type may be omitted
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// Unbind all events (on this namespace, if provided) for the element
+			if ( !type ) {
+				for ( type in events ) {
+					jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+				}
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+			handlers = events[ type ] || [];
+			tmp = tmp[ 2 ] &&
+				new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
+
+			// Remove matching events
+			origCount = j = handlers.length;
+			while ( j-- ) {
+				handleObj = handlers[ j ];
+
+				if ( ( mappedTypes || origType === handleObj.origType ) &&
+					( !handler || handler.guid === handleObj.guid ) &&
+					( !tmp || tmp.test( handleObj.namespace ) ) &&
+					( !selector || selector === handleObj.selector ||
+						selector === "**" && handleObj.selector ) ) {
+					handlers.splice( j, 1 );
+
+					if ( handleObj.selector ) {
+						handlers.delegateCount--;
+					}
+					if ( special.remove ) {
+						special.remove.call( elem, handleObj );
+					}
+				}
+			}
+
+			// Remove generic event handler if we removed something and no more handlers exist
+			// (avoids potential for endless recursion during removal of special event handlers)
+			if ( origCount && !handlers.length ) {
+				if ( !special.teardown ||
+					special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
+					jQuery.removeEvent( elem, type, elemData.handle );
+				}
+
+				delete events[ type ];
+			}
+		}
+
+		// Remove data and the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			dataPriv.remove( elem, "handle events" );
+		}
+	},
+
+	dispatch: function( nativeEvent ) {
+
+		var i, j, ret, matched, handleObj, handlerQueue,
+			args = new Array( arguments.length ),
+
+			// Make a writable jQuery.Event from the native event object
+			event = jQuery.event.fix( nativeEvent ),
+
+			handlers = (
+				dataPriv.get( this, "events" ) || Object.create( null )
+			)[ event.type ] || [],
+			special = jQuery.event.special[ event.type ] || {};
+
+		// Use the fix-ed jQuery.Event rather than the (read-only) native event
+		args[ 0 ] = event;
+
+		for ( i = 1; i < arguments.length; i++ ) {
+			args[ i ] = arguments[ i ];
+		}
+
+		event.delegateTarget = this;
+
+		// Call the preDispatch hook for the mapped type, and let it bail if desired
+		if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+			return;
+		}
+
+		// Determine handlers
+		handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+		// Run delegates first; they may want to stop propagation beneath us
+		i = 0;
+		while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+			event.currentTarget = matched.elem;
+
+			j = 0;
+			while ( ( handleObj = matched.handlers[ j++ ] ) &&
+				!event.isImmediatePropagationStopped() ) {
+
+				// If the event is namespaced, then each handler is only invoked if it is
+				// specially universal or its namespaces are a superset of the event's.
+				if ( !event.rnamespace || handleObj.namespace === false ||
+					event.rnamespace.test( handleObj.namespace ) ) {
+
+					event.handleObj = handleObj;
+					event.data = handleObj.data;
+
+					ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+						handleObj.handler ).apply( matched.elem, args );
+
+					if ( ret !== undefined ) {
+						if ( ( event.result = ret ) === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+				}
+			}
+		}
+
+		// Call the postDispatch hook for the mapped type
+		if ( special.postDispatch ) {
+			special.postDispatch.call( this, event );
+		}
+
+		return event.result;
+	},
+
+	handlers: function( event, handlers ) {
+		var i, handleObj, sel, matchedHandlers, matchedSelectors,
+			handlerQueue = [],
+			delegateCount = handlers.delegateCount,
+			cur = event.target;
+
+		// Find delegate handlers
+		if ( delegateCount &&
+
+			// Support: IE <=9
+			// Black-hole SVG <use> instance trees (trac-13180)
+			cur.nodeType &&
+
+			// Support: Firefox <=42
+			// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
+			// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
+			// Support: IE 11 only
+			// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
+			!( event.type === "click" && event.button >= 1 ) ) {
+
+			for ( ; cur !== this; cur = cur.parentNode || this ) {
+
+				// Don't check non-elements (trac-13208)
+				// Don't process clicks on disabled elements (trac-6911, trac-8165, trac-11382, trac-11764)
+				if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
+					matchedHandlers = [];
+					matchedSelectors = {};
+					for ( i = 0; i < delegateCount; i++ ) {
+						handleObj = handlers[ i ];
+
+						// Don't conflict with Object.prototype properties (trac-13203)
+						sel = handleObj.selector + " ";
+
+						if ( matchedSelectors[ sel ] === undefined ) {
+							matchedSelectors[ sel ] = handleObj.needsContext ?
+								jQuery( sel, this ).index( cur ) > -1 :
+								jQuery.find( sel, this, null, [ cur ] ).length;
+						}
+						if ( matchedSelectors[ sel ] ) {
+							matchedHandlers.push( handleObj );
+						}
+					}
+					if ( matchedHandlers.length ) {
+						handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
+					}
+				}
+			}
+		}
+
+		// Add the remaining (directly-bound) handlers
+		cur = this;
+		if ( delegateCount < handlers.length ) {
+			handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
+		}
+
+		return handlerQueue;
+	},
+
+	addProp: function( name, hook ) {
+		Object.defineProperty( jQuery.Event.prototype, name, {
+			enumerable: true,
+			configurable: true,
+
+			get: isFunction( hook ) ?
+				function() {
+					if ( this.originalEvent ) {
+						return hook( this.originalEvent );
+					}
+				} :
+				function() {
+					if ( this.originalEvent ) {
+						return this.originalEvent[ name ];
+					}
+				},
+
+			set: function( value ) {
+				Object.defineProperty( this, name, {
+					enumerable: true,
+					configurable: true,
+					writable: true,
+					value: value
+				} );
+			}
+		} );
+	},
+
+	fix: function( originalEvent ) {
+		return originalEvent[ jQuery.expando ] ?
+			originalEvent :
+			new jQuery.Event( originalEvent );
+	},
+
+	special: {
+		load: {
+
+			// Prevent triggered image.load events from bubbling to window.load
+			noBubble: true
+		},
+		click: {
+
+			// Utilize native event to ensure correct state for checkable inputs
+			setup: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Claim the first handler
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					// dataPriv.set( el, "click", ... )
+					leverageNative( el, "click", true );
+				}
+
+				// Return false to allow normal processing in the caller
+				return false;
+			},
+			trigger: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Force setup before triggering a click
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					leverageNative( el, "click" );
+				}
+
+				// Return non-false to allow normal event-path propagation
+				return true;
+			},
+
+			// For cross-browser consistency, suppress native .click() on links
+			// Also prevent it if we're currently inside a leveraged native-event stack
+			_default: function( event ) {
+				var target = event.target;
+				return rcheckableType.test( target.type ) &&
+					target.click && nodeName( target, "input" ) &&
+					dataPriv.get( target, "click" ) ||
+					nodeName( target, "a" );
+			}
+		},
+
+		beforeunload: {
+			postDispatch: function( event ) {
+
+				// Support: Firefox 20+
+				// Firefox doesn't alert if the returnValue field is not set.
+				if ( event.result !== undefined && event.originalEvent ) {
+					event.originalEvent.returnValue = event.result;
+				}
+			}
+		}
+	}
+};
+
+// Ensure the presence of an event listener that handles manually-triggered
+// synthetic events by interrupting progress until reinvoked in response to
+// *native* events that it fires directly, ensuring that state changes have
+// already occurred before other listeners are invoked.
+function leverageNative( el, type, isSetup ) {
+
+	// Missing `isSetup` indicates a trigger call, which must force setup through jQuery.event.add
+	if ( !isSetup ) {
+		if ( dataPriv.get( el, type ) === undefined ) {
+			jQuery.event.add( el, type, returnTrue );
+		}
+		return;
+	}
+
+	// Register the controller as a special universal handler for all event namespaces
+	dataPriv.set( el, type, false );
+	jQuery.event.add( el, type, {
+		namespace: false,
+		handler: function( event ) {
+			var result,
+				saved = dataPriv.get( this, type );
+
+			if ( ( event.isTrigger & 1 ) && this[ type ] ) {
+
+				// Interrupt processing of the outer synthetic .trigger()ed event
+				if ( !saved ) {
+
+					// Store arguments for use when handling the inner native event
+					// There will always be at least one argument (an event object), so this array
+					// will not be confused with a leftover capture object.
+					saved = slice.call( arguments );
+					dataPriv.set( this, type, saved );
+
+					// Trigger the native event and capture its result
+					this[ type ]();
+					result = dataPriv.get( this, type );
+					dataPriv.set( this, type, false );
+
+					if ( saved !== result ) {
+
+						// Cancel the outer synthetic event
+						event.stopImmediatePropagation();
+						event.preventDefault();
+
+						return result;
+					}
+
+				// If this is an inner synthetic event for an event with a bubbling surrogate
+				// (focus or blur), assume that the surrogate already propagated from triggering
+				// the native event and prevent that from happening again here.
+				// This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the
+				// bubbling surrogate propagates *after* the non-bubbling base), but that seems
+				// less bad than duplication.
+				} else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) {
+					event.stopPropagation();
+				}
+
+			// If this is a native event triggered above, everything is now in order
+			// Fire an inner synthetic event with the original arguments
+			} else if ( saved ) {
+
+				// ...and capture the result
+				dataPriv.set( this, type, jQuery.event.trigger(
+					saved[ 0 ],
+					saved.slice( 1 ),
+					this
+				) );
+
+				// Abort handling of the native event by all jQuery handlers while allowing
+				// native handlers on the same element to run. On target, this is achieved
+				// by stopping immediate propagation just on the jQuery event. However,
+				// the native event is re-wrapped by a jQuery one on each level of the
+				// propagation so the only way to stop it for jQuery is to stop it for
+				// everyone via native `stopPropagation()`. This is not a problem for
+				// focus/blur which don't bubble, but it does also stop click on checkboxes
+				// and radios. We accept this limitation.
+				event.stopPropagation();
+				event.isImmediatePropagationStopped = returnTrue;
+			}
+		}
+	} );
+}
+
+jQuery.removeEvent = function( elem, type, handle ) {
+
+	// This "if" is needed for plain objects
+	if ( elem.removeEventListener ) {
+		elem.removeEventListener( type, handle );
+	}
+};
+
+jQuery.Event = function( src, props ) {
+
+	// Allow instantiation without the 'new' keyword
+	if ( !( this instanceof jQuery.Event ) ) {
+		return new jQuery.Event( src, props );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+
+		// Events bubbling up the document may have been marked as prevented
+		// by a handler lower down the tree; reflect the correct value.
+		this.isDefaultPrevented = src.defaultPrevented ||
+				src.defaultPrevented === undefined &&
+
+				// Support: Android <=2.3 only
+				src.returnValue === false ?
+			returnTrue :
+			returnFalse;
+
+		// Create target properties
+		// Support: Safari <=6 - 7 only
+		// Target should not be a text node (trac-504, trac-13143)
+		this.target = ( src.target && src.target.nodeType === 3 ) ?
+			src.target.parentNode :
+			src.target;
+
+		this.currentTarget = src.currentTarget;
+		this.relatedTarget = src.relatedTarget;
+
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// Put explicitly provided properties onto the event object
+	if ( props ) {
+		jQuery.extend( this, props );
+	}
+
+	// Create a timestamp if incoming event doesn't have one
+	this.timeStamp = src && src.timeStamp || Date.now();
+
+	// Mark it as fixed
+	this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	constructor: jQuery.Event,
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse,
+	isSimulated: false,
+
+	preventDefault: function() {
+		var e = this.originalEvent;
+
+		this.isDefaultPrevented = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.preventDefault();
+		}
+	},
+	stopPropagation: function() {
+		var e = this.originalEvent;
+
+		this.isPropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopPropagation();
+		}
+	},
+	stopImmediatePropagation: function() {
+		var e = this.originalEvent;
+
+		this.isImmediatePropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopImmediatePropagation();
+		}
+
+		this.stopPropagation();
+	}
+};
+
+// Includes all common event props including KeyEvent and MouseEvent specific props
+jQuery.each( {
+	altKey: true,
+	bubbles: true,
+	cancelable: true,
+	changedTouches: true,
+	ctrlKey: true,
+	detail: true,
+	eventPhase: true,
+	metaKey: true,
+	pageX: true,
+	pageY: true,
+	shiftKey: true,
+	view: true,
+	"char": true,
+	code: true,
+	charCode: true,
+	key: true,
+	keyCode: true,
+	button: true,
+	buttons: true,
+	clientX: true,
+	clientY: true,
+	offsetX: true,
+	offsetY: true,
+	pointerId: true,
+	pointerType: true,
+	screenX: true,
+	screenY: true,
+	targetTouches: true,
+	toElement: true,
+	touches: true,
+	which: true
+}, jQuery.event.addProp );
+
+jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) {
+
+	function focusMappedHandler( nativeEvent ) {
+		if ( document.documentMode ) {
+
+			// Support: IE 11+
+			// Attach a single focusin/focusout handler on the document while someone wants
+			// focus/blur. This is because the former are synchronous in IE while the latter
+			// are async. In other browsers, all those handlers are invoked synchronously.
+
+			// `handle` from private data would already wrap the event, but we need
+			// to change the `type` here.
+			var handle = dataPriv.get( this, "handle" ),
+				event = jQuery.event.fix( nativeEvent );
+			event.type = nativeEvent.type === "focusin" ? "focus" : "blur";
+			event.isSimulated = true;
+
+			// First, handle focusin/focusout
+			handle( nativeEvent );
+
+			// ...then, handle focus/blur
+			//
+			// focus/blur don't bubble while focusin/focusout do; simulate the former by only
+			// invoking the handler at the lower level.
+			if ( event.target === event.currentTarget ) {
+
+				// The setup part calls `leverageNative`, which, in turn, calls
+				// `jQuery.event.add`, so event handle will already have been set
+				// by this point.
+				handle( event );
+			}
+		} else {
+
+			// For non-IE browsers, attach a single capturing handler on the document
+			// while someone wants focusin/focusout.
+			jQuery.event.simulate( delegateType, nativeEvent.target,
+				jQuery.event.fix( nativeEvent ) );
+		}
+	}
+
+	jQuery.event.special[ type ] = {
+
+		// Utilize native event if possible so blur/focus sequence is correct
+		setup: function() {
+
+			var attaches;
+
+			// Claim the first handler
+			// dataPriv.set( this, "focus", ... )
+			// dataPriv.set( this, "blur", ... )
+			leverageNative( this, type, true );
+
+			if ( document.documentMode ) {
+
+				// Support: IE 9 - 11+
+				// We use the same native handler for focusin & focus (and focusout & blur)
+				// so we need to coordinate setup & teardown parts between those events.
+				// Use `delegateType` as the key as `type` is already used by `leverageNative`.
+				attaches = dataPriv.get( this, delegateType );
+				if ( !attaches ) {
+					this.addEventListener( delegateType, focusMappedHandler );
+				}
+				dataPriv.set( this, delegateType, ( attaches || 0 ) + 1 );
+			} else {
+
+				// Return false to allow normal processing in the caller
+				return false;
+			}
+		},
+		trigger: function() {
+
+			// Force setup before trigger
+			leverageNative( this, type );
+
+			// Return non-false to allow normal event-path propagation
+			return true;
+		},
+
+		teardown: function() {
+			var attaches;
+
+			if ( document.documentMode ) {
+				attaches = dataPriv.get( this, delegateType ) - 1;
+				if ( !attaches ) {
+					this.removeEventListener( delegateType, focusMappedHandler );
+					dataPriv.remove( this, delegateType );
+				} else {
+					dataPriv.set( this, delegateType, attaches );
+				}
+			} else {
+
+				// Return false to indicate standard teardown should be applied
+				return false;
+			}
+		},
+
+		// Suppress native focus or blur if we're currently inside
+		// a leveraged native-event stack
+		_default: function( event ) {
+			return dataPriv.get( event.target, type );
+		},
+
+		delegateType: delegateType
+	};
+
+	// Support: Firefox <=44
+	// Firefox doesn't have focus(in | out) events
+	// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
+	//
+	// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
+	// focus(in | out) events fire after focus & blur events,
+	// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
+	// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
+	//
+	// Support: IE 9 - 11+
+	// To preserve relative focusin/focus & focusout/blur event order guaranteed on the 3.x branch,
+	// attach a single handler for both events in IE.
+	jQuery.event.special[ delegateType ] = {
+		setup: function() {
+
+			// Handle: regular nodes (via `this.ownerDocument`), window
+			// (via `this.document`) & document (via `this`).
+			var doc = this.ownerDocument || this.document || this,
+				dataHolder = document.documentMode ? this : doc,
+				attaches = dataPriv.get( dataHolder, delegateType );
+
+			// Support: IE 9 - 11+
+			// We use the same native handler for focusin & focus (and focusout & blur)
+			// so we need to coordinate setup & teardown parts between those events.
+			// Use `delegateType` as the key as `type` is already used by `leverageNative`.
+			if ( !attaches ) {
+				if ( document.documentMode ) {
+					this.addEventListener( delegateType, focusMappedHandler );
+				} else {
+					doc.addEventListener( type, focusMappedHandler, true );
+				}
+			}
+			dataPriv.set( dataHolder, delegateType, ( attaches || 0 ) + 1 );
+		},
+		teardown: function() {
+			var doc = this.ownerDocument || this.document || this,
+				dataHolder = document.documentMode ? this : doc,
+				attaches = dataPriv.get( dataHolder, delegateType ) - 1;
+
+			if ( !attaches ) {
+				if ( document.documentMode ) {
+					this.removeEventListener( delegateType, focusMappedHandler );
+				} else {
+					doc.removeEventListener( type, focusMappedHandler, true );
+				}
+				dataPriv.remove( dataHolder, delegateType );
+			} else {
+				dataPriv.set( dataHolder, delegateType, attaches );
+			}
+		}
+	};
+} );
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
+	mouseenter: "mouseover",
+	mouseleave: "mouseout",
+	pointerenter: "pointerover",
+	pointerleave: "pointerout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		delegateType: fix,
+		bindType: fix,
+
+		handle: function( event ) {
+			var ret,
+				target = this,
+				related = event.relatedTarget,
+				handleObj = event.handleObj;
+
+			// For mouseenter/leave call the handler if related is outside the target.
+			// NB: No relatedTarget if the mouse left/entered the browser window
+			if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
+				event.type = handleObj.origType;
+				ret = handleObj.handler.apply( this, arguments );
+				event.type = fix;
+			}
+			return ret;
+		}
+	};
+} );
+
+jQuery.fn.extend( {
+
+	on: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn );
+	},
+	one: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn, 1 );
+	},
+	off: function( types, selector, fn ) {
+		var handleObj, type;
+		if ( types && types.preventDefault && types.handleObj ) {
+
+			// ( event )  dispatched jQuery.Event
+			handleObj = types.handleObj;
+			jQuery( types.delegateTarget ).off(
+				handleObj.namespace ?
+					handleObj.origType + "." + handleObj.namespace :
+					handleObj.origType,
+				handleObj.selector,
+				handleObj.handler
+			);
+			return this;
+		}
+		if ( typeof types === "object" ) {
+
+			// ( types-object [, selector] )
+			for ( type in types ) {
+				this.off( type, selector, types[ type ] );
+			}
+			return this;
+		}
+		if ( selector === false || typeof selector === "function" ) {
+
+			// ( types [, fn] )
+			fn = selector;
+			selector = undefined;
+		}
+		if ( fn === false ) {
+			fn = returnFalse;
+		}
+		return this.each( function() {
+			jQuery.event.remove( this, types, fn, selector );
+		} );
+	}
+} );
+
+
+var
+
+	// Support: IE <=10 - 11, Edge 12 - 13 only
+	// In IE/Edge using regex groups here causes severe slowdowns.
+	// See https://connect.microsoft.com/IE/feedback/details/1736512/
+	rnoInnerhtml = /<script|<style|<link/i,
+
+	// checked="checked" or checked
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+
+	rcleanScript = /^\s*<!\[CDATA\[|\]\]>\s*$/g;
+
+// Prefer a tbody over its parent table for containing new rows
+function manipulationTarget( elem, content ) {
+	if ( nodeName( elem, "table" ) &&
+		nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
+
+		return jQuery( elem ).children( "tbody" )[ 0 ] || elem;
+	}
+
+	return elem;
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+	elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
+	return elem;
+}
+function restoreScript( elem ) {
+	if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) {
+		elem.type = elem.type.slice( 5 );
+	} else {
+		elem.removeAttribute( "type" );
+	}
+
+	return elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+	var i, l, type, pdataOld, udataOld, udataCur, events;
+
+	if ( dest.nodeType !== 1 ) {
+		return;
+	}
+
+	// 1. Copy private data: events, handlers, etc.
+	if ( dataPriv.hasData( src ) ) {
+		pdataOld = dataPriv.get( src );
+		events = pdataOld.events;
+
+		if ( events ) {
+			dataPriv.remove( dest, "handle events" );
+
+			for ( type in events ) {
+				for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+					jQuery.event.add( dest, type, events[ type ][ i ] );
+				}
+			}
+		}
+	}
+
+	// 2. Copy user data
+	if ( dataUser.hasData( src ) ) {
+		udataOld = dataUser.access( src );
+		udataCur = jQuery.extend( {}, udataOld );
+
+		dataUser.set( dest, udataCur );
+	}
+}
+
+// Fix IE bugs, see support tests
+function fixInput( src, dest ) {
+	var nodeName = dest.nodeName.toLowerCase();
+
+	// Fails to persist the checked state of a cloned checkbox or radio button.
+	if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+		dest.checked = src.checked;
+
+	// Fails to return the selected option to the default selected state when cloning options
+	} else if ( nodeName === "input" || nodeName === "textarea" ) {
+		dest.defaultValue = src.defaultValue;
+	}
+}
+
+function domManip( collection, args, callback, ignored ) {
+
+	// Flatten any nested arrays
+	args = flat( args );
+
+	var fragment, first, scripts, hasScripts, node, doc,
+		i = 0,
+		l = collection.length,
+		iNoClone = l - 1,
+		value = args[ 0 ],
+		valueIsFunction = isFunction( value );
+
+	// We can't cloneNode fragments that contain checked, in WebKit
+	if ( valueIsFunction ||
+			( l > 1 && typeof value === "string" &&
+				!support.checkClone && rchecked.test( value ) ) ) {
+		return collection.each( function( index ) {
+			var self = collection.eq( index );
+			if ( valueIsFunction ) {
+				args[ 0 ] = value.call( this, index, self.html() );
+			}
+			domManip( self, args, callback, ignored );
+		} );
+	}
+
+	if ( l ) {
+		fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
+		first = fragment.firstChild;
+
+		if ( fragment.childNodes.length === 1 ) {
+			fragment = first;
+		}
+
+		// Require either new content or an interest in ignored elements to invoke the callback
+		if ( first || ignored ) {
+			scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+			hasScripts = scripts.length;
+
+			// Use the original fragment for the last item
+			// instead of the first because it can end up
+			// being emptied incorrectly in certain situations (trac-8070).
+			for ( ; i < l; i++ ) {
+				node = fragment;
+
+				if ( i !== iNoClone ) {
+					node = jQuery.clone( node, true, true );
+
+					// Keep references to cloned scripts for later restoration
+					if ( hasScripts ) {
+
+						// Support: Android <=4.0 only, PhantomJS 1 only
+						// push.apply(_, arraylike) throws on ancient WebKit
+						jQuery.merge( scripts, getAll( node, "script" ) );
+					}
+				}
+
+				callback.call( collection[ i ], node, i );
+			}
+
+			if ( hasScripts ) {
+				doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+				// Re-enable scripts
+				jQuery.map( scripts, restoreScript );
+
+				// Evaluate executable scripts on first document insertion
+				for ( i = 0; i < hasScripts; i++ ) {
+					node = scripts[ i ];
+					if ( rscriptType.test( node.type || "" ) &&
+						!dataPriv.access( node, "globalEval" ) &&
+						jQuery.contains( doc, node ) ) {
+
+						if ( node.src && ( node.type || "" ).toLowerCase()  !== "module" ) {
+
+							// Optional AJAX dependency, but won't run scripts if not present
+							if ( jQuery._evalUrl && !node.noModule ) {
+								jQuery._evalUrl( node.src, {
+									nonce: node.nonce || node.getAttribute( "nonce" )
+								}, doc );
+							}
+						} else {
+
+							// Unwrap a CDATA section containing script contents. This shouldn't be
+							// needed as in XML documents they're already not visible when
+							// inspecting element contents and in HTML documents they have no
+							// meaning but we're preserving that logic for backwards compatibility.
+							// This will be removed completely in 4.0. See gh-4904.
+							DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc );
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return collection;
+}
+
+function remove( elem, selector, keepData ) {
+	var node,
+		nodes = selector ? jQuery.filter( selector, elem ) : elem,
+		i = 0;
+
+	for ( ; ( node = nodes[ i ] ) != null; i++ ) {
+		if ( !keepData && node.nodeType === 1 ) {
+			jQuery.cleanData( getAll( node ) );
+		}
+
+		if ( node.parentNode ) {
+			if ( keepData && isAttached( node ) ) {
+				setGlobalEval( getAll( node, "script" ) );
+			}
+			node.parentNode.removeChild( node );
+		}
+	}
+
+	return elem;
+}
+
+jQuery.extend( {
+	htmlPrefilter: function( html ) {
+		return html;
+	},
+
+	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+		var i, l, srcElements, destElements,
+			clone = elem.cloneNode( true ),
+			inPage = isAttached( elem );
+
+		// Fix IE cloning issues
+		if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
+				!jQuery.isXMLDoc( elem ) ) {
+
+			// We eschew jQuery#find here for performance reasons:
+			// https://jsperf.com/getall-vs-sizzle/2
+			destElements = getAll( clone );
+			srcElements = getAll( elem );
+
+			for ( i = 0, l = srcElements.length; i < l; i++ ) {
+				fixInput( srcElements[ i ], destElements[ i ] );
+			}
+		}
+
+		// Copy the events from the original to the clone
+		if ( dataAndEvents ) {
+			if ( deepDataAndEvents ) {
+				srcElements = srcElements || getAll( elem );
+				destElements = destElements || getAll( clone );
+
+				for ( i = 0, l = srcElements.length; i < l; i++ ) {
+					cloneCopyEvent( srcElements[ i ], destElements[ i ] );
+				}
+			} else {
+				cloneCopyEvent( elem, clone );
+			}
+		}
+
+		// Preserve script evaluation history
+		destElements = getAll( clone, "script" );
+		if ( destElements.length > 0 ) {
+			setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+		}
+
+		// Return the cloned set
+		return clone;
+	},
+
+	cleanData: function( elems ) {
+		var data, elem, type,
+			special = jQuery.event.special,
+			i = 0;
+
+		for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
+			if ( acceptData( elem ) ) {
+				if ( ( data = elem[ dataPriv.expando ] ) ) {
+					if ( data.events ) {
+						for ( type in data.events ) {
+							if ( special[ type ] ) {
+								jQuery.event.remove( elem, type );
+
+							// This is a shortcut to avoid jQuery.event.remove's overhead
+							} else {
+								jQuery.removeEvent( elem, type, data.handle );
+							}
+						}
+					}
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataPriv.expando ] = undefined;
+				}
+				if ( elem[ dataUser.expando ] ) {
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataUser.expando ] = undefined;
+				}
+			}
+		}
+	}
+} );
+
+jQuery.fn.extend( {
+	detach: function( selector ) {
+		return remove( this, selector, true );
+	},
+
+	remove: function( selector ) {
+		return remove( this, selector );
+	},
+
+	text: function( value ) {
+		return access( this, function( value ) {
+			return value === undefined ?
+				jQuery.text( this ) :
+				this.empty().each( function() {
+					if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+						this.textContent = value;
+					}
+				} );
+		}, null, value, arguments.length );
+	},
+
+	append: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.appendChild( elem );
+			}
+		} );
+	},
+
+	prepend: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.insertBefore( elem, target.firstChild );
+			}
+		} );
+	},
+
+	before: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this );
+			}
+		} );
+	},
+
+	after: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			}
+		} );
+	},
+
+	empty: function() {
+		var elem,
+			i = 0;
+
+		for ( ; ( elem = this[ i ] ) != null; i++ ) {
+			if ( elem.nodeType === 1 ) {
+
+				// Prevent memory leaks
+				jQuery.cleanData( getAll( elem, false ) );
+
+				// Remove any remaining nodes
+				elem.textContent = "";
+			}
+		}
+
+		return this;
+	},
+
+	clone: function( dataAndEvents, deepDataAndEvents ) {
+		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+		return this.map( function() {
+			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+		} );
+	},
+
+	html: function( value ) {
+		return access( this, function( value ) {
+			var elem = this[ 0 ] || {},
+				i = 0,
+				l = this.length;
+
+			if ( value === undefined && elem.nodeType === 1 ) {
+				return elem.innerHTML;
+			}
+
+			// See if we can take a shortcut and just use innerHTML
+			if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+				!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
+
+				value = jQuery.htmlPrefilter( value );
+
+				try {
+					for ( ; i < l; i++ ) {
+						elem = this[ i ] || {};
+
+						// Remove element nodes and prevent memory leaks
+						if ( elem.nodeType === 1 ) {
+							jQuery.cleanData( getAll( elem, false ) );
+							elem.innerHTML = value;
+						}
+					}
+
+					elem = 0;
+
+				// If using innerHTML throws an exception, use the fallback method
+				} catch ( e ) {}
+			}
+
+			if ( elem ) {
+				this.empty().append( value );
+			}
+		}, null, value, arguments.length );
+	},
+
+	replaceWith: function() {
+		var ignored = [];
+
+		// Make the changes, replacing each non-ignored context element with the new content
+		return domManip( this, arguments, function( elem ) {
+			var parent = this.parentNode;
+
+			if ( jQuery.inArray( this, ignored ) < 0 ) {
+				jQuery.cleanData( getAll( this ) );
+				if ( parent ) {
+					parent.replaceChild( elem, this );
+				}
+			}
+
+		// Force callback invocation
+		}, ignored );
+	}
+} );
+
+jQuery.each( {
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var elems,
+			ret = [],
+			insert = jQuery( selector ),
+			last = insert.length - 1,
+			i = 0;
+
+		for ( ; i <= last; i++ ) {
+			elems = i === last ? this : this.clone( true );
+			jQuery( insert[ i ] )[ original ]( elems );
+
+			// Support: Android <=4.0 only, PhantomJS 1 only
+			// .get() because push.apply(_, arraylike) throws on ancient WebKit
+			push.apply( ret, elems.get() );
+		}
+
+		return this.pushStack( ret );
+	};
+} );
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
+
+var rcustomProp = /^--/;
+
+
+var getStyles = function( elem ) {
+
+		// Support: IE <=11 only, Firefox <=30 (trac-15098, trac-14150)
+		// IE throws on elements created in popups
+		// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
+		var view = elem.ownerDocument.defaultView;
+
+		if ( !view || !view.opener ) {
+			view = window;
+		}
+
+		return view.getComputedStyle( elem );
+	};
+
+var swap = function( elem, options, callback ) {
+	var ret, name,
+		old = {};
+
+	// Remember the old values, and insert the new ones
+	for ( name in options ) {
+		old[ name ] = elem.style[ name ];
+		elem.style[ name ] = options[ name ];
+	}
+
+	ret = callback.call( elem );
+
+	// Revert the old values
+	for ( name in options ) {
+		elem.style[ name ] = old[ name ];
+	}
+
+	return ret;
+};
+
+
+var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" );
+
+
+
+( function() {
+
+	// Executing both pixelPosition & boxSizingReliable tests require only one layout
+	// so they're executed at the same time to save the second computation.
+	function computeStyleTests() {
+
+		// This is a singleton, we need to execute it only once
+		if ( !div ) {
+			return;
+		}
+
+		container.style.cssText = "position:absolute;left:-11111px;width:60px;" +
+			"margin-top:1px;padding:0;border:0";
+		div.style.cssText =
+			"position:relative;display:block;box-sizing:border-box;overflow:scroll;" +
+			"margin:auto;border:1px;padding:1px;" +
+			"width:60%;top:1%";
+		documentElement.appendChild( container ).appendChild( div );
+
+		var divStyle = window.getComputedStyle( div );
+		pixelPositionVal = divStyle.top !== "1%";
+
+		// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
+		reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12;
+
+		// Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3
+		// Some styles come back with percentage values, even though they shouldn't
+		div.style.right = "60%";
+		pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36;
+
+		// Support: IE 9 - 11 only
+		// Detect misreporting of content dimensions for box-sizing:border-box elements
+		boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36;
+
+		// Support: IE 9 only
+		// Detect overflow:scroll screwiness (gh-3699)
+		// Support: Chrome <=64
+		// Don't get tricked when zoom affects offsetWidth (gh-4029)
+		div.style.position = "absolute";
+		scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12;
+
+		documentElement.removeChild( container );
+
+		// Nullify the div so it wouldn't be stored in the memory and
+		// it will also be a sign that checks already performed
+		div = null;
+	}
+
+	function roundPixelMeasures( measure ) {
+		return Math.round( parseFloat( measure ) );
+	}
+
+	var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,
+		reliableTrDimensionsVal, reliableMarginLeftVal,
+		container = document.createElement( "div" ),
+		div = document.createElement( "div" );
+
+	// Finish early in limited (non-browser) environments
+	if ( !div.style ) {
+		return;
+	}
+
+	// Support: IE <=9 - 11 only
+	// Style of cloned element affects source element cloned (trac-8908)
+	div.style.backgroundClip = "content-box";
+	div.cloneNode( true ).style.backgroundClip = "";
+	support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+	jQuery.extend( support, {
+		boxSizingReliable: function() {
+			computeStyleTests();
+			return boxSizingReliableVal;
+		},
+		pixelBoxStyles: function() {
+			computeStyleTests();
+			return pixelBoxStylesVal;
+		},
+		pixelPosition: function() {
+			computeStyleTests();
+			return pixelPositionVal;
+		},
+		reliableMarginLeft: function() {
+			computeStyleTests();
+			return reliableMarginLeftVal;
+		},
+		scrollboxSize: function() {
+			computeStyleTests();
+			return scrollboxSizeVal;
+		},
+
+		// Support: IE 9 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Behavior in IE 9 is more subtle than in newer versions & it passes
+		// some versions of this test; make sure not to make it pass there!
+		//
+		// Support: Firefox 70+
+		// Only Firefox includes border widths
+		// in computed dimensions. (gh-4529)
+		reliableTrDimensions: function() {
+			var table, tr, trChild, trStyle;
+			if ( reliableTrDimensionsVal == null ) {
+				table = document.createElement( "table" );
+				tr = document.createElement( "tr" );
+				trChild = document.createElement( "div" );
+
+				table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate";
+				tr.style.cssText = "box-sizing:content-box;border:1px solid";
+
+				// Support: Chrome 86+
+				// Height set through cssText does not get applied.
+				// Computed height then comes back as 0.
+				tr.style.height = "1px";
+				trChild.style.height = "9px";
+
+				// Support: Android 8 Chrome 86+
+				// In our bodyBackground.html iframe,
+				// display for all div elements is set to "inline",
+				// which causes a problem only in Android 8 Chrome 86.
+				// Ensuring the div is `display: block`
+				// gets around this issue.
+				trChild.style.display = "block";
+
+				documentElement
+					.appendChild( table )
+					.appendChild( tr )
+					.appendChild( trChild );
+
+				trStyle = window.getComputedStyle( tr );
+				reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) +
+					parseInt( trStyle.borderTopWidth, 10 ) +
+					parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight;
+
+				documentElement.removeChild( table );
+			}
+			return reliableTrDimensionsVal;
+		}
+	} );
+} )();
+
+
+function curCSS( elem, name, computed ) {
+	var width, minWidth, maxWidth, ret,
+		isCustomProp = rcustomProp.test( name ),
+
+		// Support: Firefox 51+
+		// Retrieving style before computed somehow
+		// fixes an issue with getting wrong values
+		// on detached elements
+		style = elem.style;
+
+	computed = computed || getStyles( elem );
+
+	// getPropertyValue is needed for:
+	//   .css('filter') (IE 9 only, trac-12537)
+	//   .css('--customProperty) (gh-3144)
+	if ( computed ) {
+
+		// Support: IE <=9 - 11+
+		// IE only supports `"float"` in `getPropertyValue`; in computed styles
+		// it's only available as `"cssFloat"`. We no longer modify properties
+		// sent to `.css()` apart from camelCasing, so we need to check both.
+		// Normally, this would create difference in behavior: if
+		// `getPropertyValue` returns an empty string, the value returned
+		// by `.css()` would be `undefined`. This is usually the case for
+		// disconnected elements. However, in IE even disconnected elements
+		// with no styles return `"none"` for `getPropertyValue( "float" )`
+		ret = computed.getPropertyValue( name ) || computed[ name ];
+
+		if ( isCustomProp && ret ) {
+
+			// Support: Firefox 105+, Chrome <=105+
+			// Spec requires trimming whitespace for custom properties (gh-4926).
+			// Firefox only trims leading whitespace. Chrome just collapses
+			// both leading & trailing whitespace to a single space.
+			//
+			// Fall back to `undefined` if empty string returned.
+			// This collapses a missing definition with property defined
+			// and set to an empty string but there's no standard API
+			// allowing us to differentiate them without a performance penalty
+			// and returning `undefined` aligns with older jQuery.
+			//
+			// rtrimCSS treats U+000D CARRIAGE RETURN and U+000C FORM FEED
+			// as whitespace while CSS does not, but this is not a problem
+			// because CSS preprocessing replaces them with U+000A LINE FEED
+			// (which *is* CSS whitespace)
+			// https://www.w3.org/TR/css-syntax-3/#input-preprocessing
+			ret = ret.replace( rtrimCSS, "$1" ) || undefined;
+		}
+
+		if ( ret === "" && !isAttached( elem ) ) {
+			ret = jQuery.style( elem, name );
+		}
+
+		// A tribute to the "awesome hack by Dean Edwards"
+		// Android Browser returns percentage for some values,
+		// but width seems to be reliably pixels.
+		// This is against the CSSOM draft spec:
+		// https://drafts.csswg.org/cssom/#resolved-values
+		if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) {
+
+			// Remember the original values
+			width = style.width;
+			minWidth = style.minWidth;
+			maxWidth = style.maxWidth;
+
+			// Put in the new values to get a computed value out
+			style.minWidth = style.maxWidth = style.width = ret;
+			ret = computed.width;
+
+			// Revert the changed values
+			style.width = width;
+			style.minWidth = minWidth;
+			style.maxWidth = maxWidth;
+		}
+	}
+
+	return ret !== undefined ?
+
+		// Support: IE <=9 - 11 only
+		// IE returns zIndex value as an integer.
+		ret + "" :
+		ret;
+}
+
+
+function addGetHookIf( conditionFn, hookFn ) {
+
+	// Define the hook, we'll check on the first run if it's really needed.
+	return {
+		get: function() {
+			if ( conditionFn() ) {
+
+				// Hook not needed (or it's not possible to use it due
+				// to missing dependency), remove it.
+				delete this.get;
+				return;
+			}
+
+			// Hook needed; redefine it so that the support test is not executed again.
+			return ( this.get = hookFn ).apply( this, arguments );
+		}
+	};
+}
+
+
+var cssPrefixes = [ "Webkit", "Moz", "ms" ],
+	emptyStyle = document.createElement( "div" ).style,
+	vendorProps = {};
+
+// Return a vendor-prefixed property or undefined
+function vendorPropName( name ) {
+
+	// Check for vendor prefixed names
+	var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
+		i = cssPrefixes.length;
+
+	while ( i-- ) {
+		name = cssPrefixes[ i ] + capName;
+		if ( name in emptyStyle ) {
+			return name;
+		}
+	}
+}
+
+// Return a potentially-mapped jQuery.cssProps or vendor prefixed property
+function finalPropName( name ) {
+	var final = jQuery.cssProps[ name ] || vendorProps[ name ];
+
+	if ( final ) {
+		return final;
+	}
+	if ( name in emptyStyle ) {
+		return name;
+	}
+	return vendorProps[ name ] = vendorPropName( name ) || name;
+}
+
+
+var
+
+	// Swappable if display is none or starts with table
+	// except "table", "table-cell", or "table-caption"
+	// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+	rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+	cssNormalTransform = {
+		letterSpacing: "0",
+		fontWeight: "400"
+	};
+
+function setPositiveNumber( _elem, value, subtract ) {
+
+	// Any relative (+/-) values have already been
+	// normalized at this point
+	var matches = rcssNum.exec( value );
+	return matches ?
+
+		// Guard against undefined "subtract", e.g., when used as in cssHooks
+		Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) :
+		value;
+}
+
+function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) {
+	var i = dimension === "width" ? 1 : 0,
+		extra = 0,
+		delta = 0,
+		marginDelta = 0;
+
+	// Adjustment may not be necessary
+	if ( box === ( isBorderBox ? "border" : "content" ) ) {
+		return 0;
+	}
+
+	for ( ; i < 4; i += 2 ) {
+
+		// Both box models exclude margin
+		// Count margin delta separately to only add it after scroll gutter adjustment.
+		// This is needed to make negative margins work with `outerHeight( true )` (gh-3982).
+		if ( box === "margin" ) {
+			marginDelta += jQuery.css( elem, box + cssExpand[ i ], true, styles );
+		}
+
+		// If we get here with a content-box, we're seeking "padding" or "border" or "margin"
+		if ( !isBorderBox ) {
+
+			// Add padding
+			delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+			// For "border" or "margin", add border
+			if ( box !== "padding" ) {
+				delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+
+			// But still keep track of it otherwise
+			} else {
+				extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+
+		// If we get here with a border-box (content + padding + border), we're seeking "content" or
+		// "padding" or "margin"
+		} else {
+
+			// For "content", subtract padding
+			if ( box === "content" ) {
+				delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+			}
+
+			// For "content" or "padding", subtract border
+			if ( box !== "margin" ) {
+				delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+		}
+	}
+
+	// Account for positive content-box scroll gutter when requested by providing computedVal
+	if ( !isBorderBox && computedVal >= 0 ) {
+
+		// offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border
+		// Assuming integer scroll gutter, subtract the rest and round down
+		delta += Math.max( 0, Math.ceil(
+			elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+			computedVal -
+			delta -
+			extra -
+			0.5
+
+		// If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter
+		// Use an explicit zero to avoid NaN (gh-3964)
+		) ) || 0;
+	}
+
+	return delta + marginDelta;
+}
+
+function getWidthOrHeight( elem, dimension, extra ) {
+
+	// Start with computed style
+	var styles = getStyles( elem ),
+
+		// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322).
+		// Fake content-box until we know it's needed to know the true value.
+		boxSizingNeeded = !support.boxSizingReliable() || extra,
+		isBorderBox = boxSizingNeeded &&
+			jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+		valueIsBorderBox = isBorderBox,
+
+		val = curCSS( elem, dimension, styles ),
+		offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 );
+
+	// Support: Firefox <=54
+	// Return a confounding non-pixel value or feign ignorance, as appropriate.
+	if ( rnumnonpx.test( val ) ) {
+		if ( !extra ) {
+			return val;
+		}
+		val = "auto";
+	}
+
+
+	// Support: IE 9 - 11 only
+	// Use offsetWidth/offsetHeight for when box sizing is unreliable.
+	// In those cases, the computed value can be trusted to be border-box.
+	if ( ( !support.boxSizingReliable() && isBorderBox ||
+
+		// Support: IE 10 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Interestingly, in some cases IE 9 doesn't suffer from this issue.
+		!support.reliableTrDimensions() && nodeName( elem, "tr" ) ||
+
+		// Fall back to offsetWidth/offsetHeight when value is "auto"
+		// This happens for inline elements with no explicit setting (gh-3571)
+		val === "auto" ||
+
+		// Support: Android <=4.1 - 4.3 only
+		// Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
+		!parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) &&
+
+		// Make sure the element is visible & connected
+		elem.getClientRects().length ) {
+
+		isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
+
+		// Where available, offsetWidth/offsetHeight approximate border box dimensions.
+		// Where not available (e.g., SVG), assume unreliable box-sizing and interpret the
+		// retrieved value as a content box dimension.
+		valueIsBorderBox = offsetProp in elem;
+		if ( valueIsBorderBox ) {
+			val = elem[ offsetProp ];
+		}
+	}
+
+	// Normalize "" and auto
+	val = parseFloat( val ) || 0;
+
+	// Adjust for the element's box model
+	return ( val +
+		boxModelAdjustment(
+			elem,
+			dimension,
+			extra || ( isBorderBox ? "border" : "content" ),
+			valueIsBorderBox,
+			styles,
+
+			// Provide the current computed size to request scroll gutter calculation (gh-3589)
+			val
+		)
+	) + "px";
+}
+
+jQuery.extend( {
+
+	// Add in style property hooks for overriding the default
+	// behavior of getting and setting a style property
+	cssHooks: {
+		opacity: {
+			get: function( elem, computed ) {
+				if ( computed ) {
+
+					// We should always get a number back from opacity
+					var ret = curCSS( elem, "opacity" );
+					return ret === "" ? "1" : ret;
+				}
+			}
+		}
+	},
+
+	// Don't automatically add "px" to these possibly-unitless properties
+	cssNumber: {
+		animationIterationCount: true,
+		aspectRatio: true,
+		borderImageSlice: true,
+		columnCount: true,
+		flexGrow: true,
+		flexShrink: true,
+		fontWeight: true,
+		gridArea: true,
+		gridColumn: true,
+		gridColumnEnd: true,
+		gridColumnStart: true,
+		gridRow: true,
+		gridRowEnd: true,
+		gridRowStart: true,
+		lineHeight: true,
+		opacity: true,
+		order: true,
+		orphans: true,
+		scale: true,
+		widows: true,
+		zIndex: true,
+		zoom: true,
+
+		// SVG-related
+		fillOpacity: true,
+		floodOpacity: true,
+		stopOpacity: true,
+		strokeMiterlimit: true,
+		strokeOpacity: true
+	},
+
+	// Add in properties whose names you wish to fix before
+	// setting or getting the value
+	cssProps: {},
+
+	// Get and set the style property on a DOM Node
+	style: function( elem, name, value, extra ) {
+
+		// Don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+			return;
+		}
+
+		// Make sure that we're working with the right name
+		var ret, type, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name ),
+			style = elem.style;
+
+		// Make sure that we're working with the right name. We don't
+		// want to query the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Gets hook for the prefixed version, then unprefixed version
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// Check if we're setting a value
+		if ( value !== undefined ) {
+			type = typeof value;
+
+			// Convert "+=" or "-=" to relative numbers (trac-7345)
+			if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
+				value = adjustCSS( elem, name, ret );
+
+				// Fixes bug trac-9237
+				type = "number";
+			}
+
+			// Make sure that null and NaN values aren't set (trac-7116)
+			if ( value == null || value !== value ) {
+				return;
+			}
+
+			// If a number was passed in, add the unit (except for certain CSS properties)
+			// The isCustomProp check can be removed in jQuery 4.0 when we only auto-append
+			// "px" to a few hardcoded values.
+			if ( type === "number" && !isCustomProp ) {
+				value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
+			}
+
+			// background-* props affect original clone's values
+			if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
+				style[ name ] = "inherit";
+			}
+
+			// If a hook was provided, use that value, otherwise just set the specified value
+			if ( !hooks || !( "set" in hooks ) ||
+				( value = hooks.set( elem, value, extra ) ) !== undefined ) {
+
+				if ( isCustomProp ) {
+					style.setProperty( name, value );
+				} else {
+					style[ name ] = value;
+				}
+			}
+
+		} else {
+
+			// If a hook was provided get the non-computed value from there
+			if ( hooks && "get" in hooks &&
+				( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
+
+				return ret;
+			}
+
+			// Otherwise just get the value from the style object
+			return style[ name ];
+		}
+	},
+
+	css: function( elem, name, extra, styles ) {
+		var val, num, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name );
+
+		// Make sure that we're working with the right name. We don't
+		// want to modify the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Try prefixed name followed by the unprefixed name
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// If a hook was provided get the computed value from there
+		if ( hooks && "get" in hooks ) {
+			val = hooks.get( elem, true, extra );
+		}
+
+		// Otherwise, if a way to get the computed value exists, use that
+		if ( val === undefined ) {
+			val = curCSS( elem, name, styles );
+		}
+
+		// Convert "normal" to computed value
+		if ( val === "normal" && name in cssNormalTransform ) {
+			val = cssNormalTransform[ name ];
+		}
+
+		// Make numeric if forced or a qualifier was provided and val looks numeric
+		if ( extra === "" || extra ) {
+			num = parseFloat( val );
+			return extra === true || isFinite( num ) ? num || 0 : val;
+		}
+
+		return val;
+	}
+} );
+
+jQuery.each( [ "height", "width" ], function( _i, dimension ) {
+	jQuery.cssHooks[ dimension ] = {
+		get: function( elem, computed, extra ) {
+			if ( computed ) {
+
+				// Certain elements can have dimension info if we invisibly show them
+				// but it must have a current display style that would benefit
+				return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
+
+					// Support: Safari 8+
+					// Table columns in Safari have non-zero offsetWidth & zero
+					// getBoundingClientRect().width unless display is changed.
+					// Support: IE <=11 only
+					// Running getBoundingClientRect on a disconnected node
+					// in IE throws an error.
+					( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?
+					swap( elem, cssShow, function() {
+						return getWidthOrHeight( elem, dimension, extra );
+					} ) :
+					getWidthOrHeight( elem, dimension, extra );
+			}
+		},
+
+		set: function( elem, value, extra ) {
+			var matches,
+				styles = getStyles( elem ),
+
+				// Only read styles.position if the test has a chance to fail
+				// to avoid forcing a reflow.
+				scrollboxSizeBuggy = !support.scrollboxSize() &&
+					styles.position === "absolute",
+
+				// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991)
+				boxSizingNeeded = scrollboxSizeBuggy || extra,
+				isBorderBox = boxSizingNeeded &&
+					jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+				subtract = extra ?
+					boxModelAdjustment(
+						elem,
+						dimension,
+						extra,
+						isBorderBox,
+						styles
+					) :
+					0;
+
+			// Account for unreliable border-box dimensions by comparing offset* to computed and
+			// faking a content-box to get border and padding (gh-3699)
+			if ( isBorderBox && scrollboxSizeBuggy ) {
+				subtract -= Math.ceil(
+					elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+					parseFloat( styles[ dimension ] ) -
+					boxModelAdjustment( elem, dimension, "border", false, styles ) -
+					0.5
+				);
+			}
+
+			// Convert to pixels if value adjustment is needed
+			if ( subtract && ( matches = rcssNum.exec( value ) ) &&
+				( matches[ 3 ] || "px" ) !== "px" ) {
+
+				elem.style[ dimension ] = value;
+				value = jQuery.css( elem, dimension );
+			}
+
+			return setPositiveNumber( elem, value, subtract );
+		}
+	};
+} );
+
+jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
+	function( elem, computed ) {
+		if ( computed ) {
+			return ( parseFloat( curCSS( elem, "marginLeft" ) ) ||
+				elem.getBoundingClientRect().left -
+					swap( elem, { marginLeft: 0 }, function() {
+						return elem.getBoundingClientRect().left;
+					} )
+			) + "px";
+		}
+	}
+);
+
+// These hooks are used by animate to expand properties
+jQuery.each( {
+	margin: "",
+	padding: "",
+	border: "Width"
+}, function( prefix, suffix ) {
+	jQuery.cssHooks[ prefix + suffix ] = {
+		expand: function( value ) {
+			var i = 0,
+				expanded = {},
+
+				// Assumes a single number if not a string
+				parts = typeof value === "string" ? value.split( " " ) : [ value ];
+
+			for ( ; i < 4; i++ ) {
+				expanded[ prefix + cssExpand[ i ] + suffix ] =
+					parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+			}
+
+			return expanded;
+		}
+	};
+
+	if ( prefix !== "margin" ) {
+		jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+	}
+} );
+
+jQuery.fn.extend( {
+	css: function( name, value ) {
+		return access( this, function( elem, name, value ) {
+			var styles, len,
+				map = {},
+				i = 0;
+
+			if ( Array.isArray( name ) ) {
+				styles = getStyles( elem );
+				len = name.length;
+
+				for ( ; i < len; i++ ) {
+					map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+				}
+
+				return map;
+			}
+
+			return value !== undefined ?
+				jQuery.style( elem, name, value ) :
+				jQuery.css( elem, name );
+		}, name, value, arguments.length > 1 );
+	}
+} );
+
+
+function Tween( elem, options, prop, end, easing ) {
+	return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+	constructor: Tween,
+	init: function( elem, options, prop, end, easing, unit ) {
+		this.elem = elem;
+		this.prop = prop;
+		this.easing = easing || jQuery.easing._default;
+		this.options = options;
+		this.start = this.now = this.cur();
+		this.end = end;
+		this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+	},
+	cur: function() {
+		var hooks = Tween.propHooks[ this.prop ];
+
+		return hooks && hooks.get ?
+			hooks.get( this ) :
+			Tween.propHooks._default.get( this );
+	},
+	run: function( percent ) {
+		var eased,
+			hooks = Tween.propHooks[ this.prop ];
+
+		if ( this.options.duration ) {
+			this.pos = eased = jQuery.easing[ this.easing ](
+				percent, this.options.duration * percent, 0, 1, this.options.duration
+			);
+		} else {
+			this.pos = eased = percent;
+		}
+		this.now = ( this.end - this.start ) * eased + this.start;
+
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		if ( hooks && hooks.set ) {
+			hooks.set( this );
+		} else {
+			Tween.propHooks._default.set( this );
+		}
+		return this;
+	}
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+	_default: {
+		get: function( tween ) {
+			var result;
+
+			// Use a property on the element directly when it is not a DOM element,
+			// or when there is no matching style property that exists.
+			if ( tween.elem.nodeType !== 1 ||
+				tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
+				return tween.elem[ tween.prop ];
+			}
+
+			// Passing an empty string as a 3rd parameter to .css will automatically
+			// attempt a parseFloat and fallback to a string if the parse fails.
+			// Simple values such as "10px" are parsed to Float;
+			// complex values such as "rotate(1rad)" are returned as-is.
+			result = jQuery.css( tween.elem, tween.prop, "" );
+
+			// Empty strings, null, undefined and "auto" are converted to 0.
+			return !result || result === "auto" ? 0 : result;
+		},
+		set: function( tween ) {
+
+			// Use step hook for back compat.
+			// Use cssHook if its there.
+			// Use .style if available and use plain properties where available.
+			if ( jQuery.fx.step[ tween.prop ] ) {
+				jQuery.fx.step[ tween.prop ]( tween );
+			} else if ( tween.elem.nodeType === 1 && (
+				jQuery.cssHooks[ tween.prop ] ||
+					tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) {
+				jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+			} else {
+				tween.elem[ tween.prop ] = tween.now;
+			}
+		}
+	}
+};
+
+// Support: IE <=9 only
+// Panic based approach to setting things on disconnected nodes
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+	set: function( tween ) {
+		if ( tween.elem.nodeType && tween.elem.parentNode ) {
+			tween.elem[ tween.prop ] = tween.now;
+		}
+	}
+};
+
+jQuery.easing = {
+	linear: function( p ) {
+		return p;
+	},
+	swing: function( p ) {
+		return 0.5 - Math.cos( p * Math.PI ) / 2;
+	},
+	_default: "swing"
+};
+
+jQuery.fx = Tween.prototype.init;
+
+// Back compat <1.8 extension point
+jQuery.fx.step = {};
+
+
+
+
+var
+	fxNow, inProgress,
+	rfxtypes = /^(?:toggle|show|hide)$/,
+	rrun = /queueHooks$/;
+
+function schedule() {
+	if ( inProgress ) {
+		if ( document.hidden === false && window.requestAnimationFrame ) {
+			window.requestAnimationFrame( schedule );
+		} else {
+			window.setTimeout( schedule, jQuery.fx.interval );
+		}
+
+		jQuery.fx.tick();
+	}
+}
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+	window.setTimeout( function() {
+		fxNow = undefined;
+	} );
+	return ( fxNow = Date.now() );
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+	var which,
+		i = 0,
+		attrs = { height: type };
+
+	// If we include width, step value is 1 to do all cssExpand values,
+	// otherwise step value is 2 to skip over Left and Right
+	includeWidth = includeWidth ? 1 : 0;
+	for ( ; i < 4; i += 2 - includeWidth ) {
+		which = cssExpand[ i ];
+		attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+	}
+
+	if ( includeWidth ) {
+		attrs.opacity = attrs.width = type;
+	}
+
+	return attrs;
+}
+
+function createTween( value, prop, animation ) {
+	var tween,
+		collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
+		index = 0,
+		length = collection.length;
+	for ( ; index < length; index++ ) {
+		if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
+
+			// We're done with this property
+			return tween;
+		}
+	}
+}
+
+function defaultPrefilter( elem, props, opts ) {
+	var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
+		isBox = "width" in props || "height" in props,
+		anim = this,
+		orig = {},
+		style = elem.style,
+		hidden = elem.nodeType && isHiddenWithinTree( elem ),
+		dataShow = dataPriv.get( elem, "fxshow" );
+
+	// Queue-skipping animations hijack the fx hooks
+	if ( !opts.queue ) {
+		hooks = jQuery._queueHooks( elem, "fx" );
+		if ( hooks.unqueued == null ) {
+			hooks.unqueued = 0;
+			oldfire = hooks.empty.fire;
+			hooks.empty.fire = function() {
+				if ( !hooks.unqueued ) {
+					oldfire();
+				}
+			};
+		}
+		hooks.unqueued++;
+
+		anim.always( function() {
+
+			// Ensure the complete handler is called before this completes
+			anim.always( function() {
+				hooks.unqueued--;
+				if ( !jQuery.queue( elem, "fx" ).length ) {
+					hooks.empty.fire();
+				}
+			} );
+		} );
+	}
+
+	// Detect show/hide animations
+	for ( prop in props ) {
+		value = props[ prop ];
+		if ( rfxtypes.test( value ) ) {
+			delete props[ prop ];
+			toggle = toggle || value === "toggle";
+			if ( value === ( hidden ? "hide" : "show" ) ) {
+
+				// Pretend to be hidden if this is a "show" and
+				// there is still data from a stopped show/hide
+				if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+					hidden = true;
+
+				// Ignore all other no-op show/hide data
+				} else {
+					continue;
+				}
+			}
+			orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
+		}
+	}
+
+	// Bail out if this is a no-op like .hide().hide()
+	propTween = !jQuery.isEmptyObject( props );
+	if ( !propTween && jQuery.isEmptyObject( orig ) ) {
+		return;
+	}
+
+	// Restrict "overflow" and "display" styles during box animations
+	if ( isBox && elem.nodeType === 1 ) {
+
+		// Support: IE <=9 - 11, Edge 12 - 15
+		// Record all 3 overflow attributes because IE does not infer the shorthand
+		// from identically-valued overflowX and overflowY and Edge just mirrors
+		// the overflowX value there.
+		opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+		// Identify a display type, preferring old show/hide data over the CSS cascade
+		restoreDisplay = dataShow && dataShow.display;
+		if ( restoreDisplay == null ) {
+			restoreDisplay = dataPriv.get( elem, "display" );
+		}
+		display = jQuery.css( elem, "display" );
+		if ( display === "none" ) {
+			if ( restoreDisplay ) {
+				display = restoreDisplay;
+			} else {
+
+				// Get nonempty value(s) by temporarily forcing visibility
+				showHide( [ elem ], true );
+				restoreDisplay = elem.style.display || restoreDisplay;
+				display = jQuery.css( elem, "display" );
+				showHide( [ elem ] );
+			}
+		}
+
+		// Animate inline elements as inline-block
+		if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) {
+			if ( jQuery.css( elem, "float" ) === "none" ) {
+
+				// Restore the original display value at the end of pure show/hide animations
+				if ( !propTween ) {
+					anim.done( function() {
+						style.display = restoreDisplay;
+					} );
+					if ( restoreDisplay == null ) {
+						display = style.display;
+						restoreDisplay = display === "none" ? "" : display;
+					}
+				}
+				style.display = "inline-block";
+			}
+		}
+	}
+
+	if ( opts.overflow ) {
+		style.overflow = "hidden";
+		anim.always( function() {
+			style.overflow = opts.overflow[ 0 ];
+			style.overflowX = opts.overflow[ 1 ];
+			style.overflowY = opts.overflow[ 2 ];
+		} );
+	}
+
+	// Implement show/hide animations
+	propTween = false;
+	for ( prop in orig ) {
+
+		// General show/hide setup for this element animation
+		if ( !propTween ) {
+			if ( dataShow ) {
+				if ( "hidden" in dataShow ) {
+					hidden = dataShow.hidden;
+				}
+			} else {
+				dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
+			}
+
+			// Store hidden/visible for toggle so `.stop().toggle()` "reverses"
+			if ( toggle ) {
+				dataShow.hidden = !hidden;
+			}
+
+			// Show elements before animating them
+			if ( hidden ) {
+				showHide( [ elem ], true );
+			}
+
+			/* eslint-disable no-loop-func */
+
+			anim.done( function() {
+
+				/* eslint-enable no-loop-func */
+
+				// The final step of a "hide" animation is actually hiding the element
+				if ( !hidden ) {
+					showHide( [ elem ] );
+				}
+				dataPriv.remove( elem, "fxshow" );
+				for ( prop in orig ) {
+					jQuery.style( elem, prop, orig[ prop ] );
+				}
+			} );
+		}
+
+		// Per-property setup
+		propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
+		if ( !( prop in dataShow ) ) {
+			dataShow[ prop ] = propTween.start;
+			if ( hidden ) {
+				propTween.end = propTween.start;
+				propTween.start = 0;
+			}
+		}
+	}
+}
+
+function propFilter( props, specialEasing ) {
+	var index, name, easing, value, hooks;
+
+	// camelCase, specialEasing and expand cssHook pass
+	for ( index in props ) {
+		name = camelCase( index );
+		easing = specialEasing[ name ];
+		value = props[ index ];
+		if ( Array.isArray( value ) ) {
+			easing = value[ 1 ];
+			value = props[ index ] = value[ 0 ];
+		}
+
+		if ( index !== name ) {
+			props[ name ] = value;
+			delete props[ index ];
+		}
+
+		hooks = jQuery.cssHooks[ name ];
+		if ( hooks && "expand" in hooks ) {
+			value = hooks.expand( value );
+			delete props[ name ];
+
+			// Not quite $.extend, this won't overwrite existing keys.
+			// Reusing 'index' because we have the correct "name"
+			for ( index in value ) {
+				if ( !( index in props ) ) {
+					props[ index ] = value[ index ];
+					specialEasing[ index ] = easing;
+				}
+			}
+		} else {
+			specialEasing[ name ] = easing;
+		}
+	}
+}
+
+function Animation( elem, properties, options ) {
+	var result,
+		stopped,
+		index = 0,
+		length = Animation.prefilters.length,
+		deferred = jQuery.Deferred().always( function() {
+
+			// Don't match elem in the :animated selector
+			delete tick.elem;
+		} ),
+		tick = function() {
+			if ( stopped ) {
+				return false;
+			}
+			var currentTime = fxNow || createFxNow(),
+				remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+
+				// Support: Android 2.3 only
+				// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (trac-12497)
+				temp = remaining / animation.duration || 0,
+				percent = 1 - temp,
+				index = 0,
+				length = animation.tweens.length;
+
+			for ( ; index < length; index++ ) {
+				animation.tweens[ index ].run( percent );
+			}
+
+			deferred.notifyWith( elem, [ animation, percent, remaining ] );
+
+			// If there's more to do, yield
+			if ( percent < 1 && length ) {
+				return remaining;
+			}
+
+			// If this was an empty animation, synthesize a final progress notification
+			if ( !length ) {
+				deferred.notifyWith( elem, [ animation, 1, 0 ] );
+			}
+
+			// Resolve the animation and report its conclusion
+			deferred.resolveWith( elem, [ animation ] );
+			return false;
+		},
+		animation = deferred.promise( {
+			elem: elem,
+			props: jQuery.extend( {}, properties ),
+			opts: jQuery.extend( true, {
+				specialEasing: {},
+				easing: jQuery.easing._default
+			}, options ),
+			originalProperties: properties,
+			originalOptions: options,
+			startTime: fxNow || createFxNow(),
+			duration: options.duration,
+			tweens: [],
+			createTween: function( prop, end ) {
+				var tween = jQuery.Tween( elem, animation.opts, prop, end,
+					animation.opts.specialEasing[ prop ] || animation.opts.easing );
+				animation.tweens.push( tween );
+				return tween;
+			},
+			stop: function( gotoEnd ) {
+				var index = 0,
+
+					// If we are going to the end, we want to run all the tweens
+					// otherwise we skip this part
+					length = gotoEnd ? animation.tweens.length : 0;
+				if ( stopped ) {
+					return this;
+				}
+				stopped = true;
+				for ( ; index < length; index++ ) {
+					animation.tweens[ index ].run( 1 );
+				}
+
+				// Resolve when we played the last frame; otherwise, reject
+				if ( gotoEnd ) {
+					deferred.notifyWith( elem, [ animation, 1, 0 ] );
+					deferred.resolveWith( elem, [ animation, gotoEnd ] );
+				} else {
+					deferred.rejectWith( elem, [ animation, gotoEnd ] );
+				}
+				return this;
+			}
+		} ),
+		props = animation.props;
+
+	propFilter( props, animation.opts.specialEasing );
+
+	for ( ; index < length; index++ ) {
+		result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
+		if ( result ) {
+			if ( isFunction( result.stop ) ) {
+				jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
+					result.stop.bind( result );
+			}
+			return result;
+		}
+	}
+
+	jQuery.map( props, createTween, animation );
+
+	if ( isFunction( animation.opts.start ) ) {
+		animation.opts.start.call( elem, animation );
+	}
+
+	// Attach callbacks from options
+	animation
+		.progress( animation.opts.progress )
+		.done( animation.opts.done, animation.opts.complete )
+		.fail( animation.opts.fail )
+		.always( animation.opts.always );
+
+	jQuery.fx.timer(
+		jQuery.extend( tick, {
+			elem: elem,
+			anim: animation,
+			queue: animation.opts.queue
+		} )
+	);
+
+	return animation;
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+	tweeners: {
+		"*": [ function( prop, value ) {
+			var tween = this.createTween( prop, value );
+			adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
+			return tween;
+		} ]
+	},
+
+	tweener: function( props, callback ) {
+		if ( isFunction( props ) ) {
+			callback = props;
+			props = [ "*" ];
+		} else {
+			props = props.match( rnothtmlwhite );
+		}
+
+		var prop,
+			index = 0,
+			length = props.length;
+
+		for ( ; index < length; index++ ) {
+			prop = props[ index ];
+			Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
+			Animation.tweeners[ prop ].unshift( callback );
+		}
+	},
+
+	prefilters: [ defaultPrefilter ],
+
+	prefilter: function( callback, prepend ) {
+		if ( prepend ) {
+			Animation.prefilters.unshift( callback );
+		} else {
+			Animation.prefilters.push( callback );
+		}
+	}
+} );
+
+jQuery.speed = function( speed, easing, fn ) {
+	var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+		complete: fn || !fn && easing ||
+			isFunction( speed ) && speed,
+		duration: speed,
+		easing: fn && easing || easing && !isFunction( easing ) && easing
+	};
+
+	// Go to the end state if fx are off
+	if ( jQuery.fx.off ) {
+		opt.duration = 0;
+
+	} else {
+		if ( typeof opt.duration !== "number" ) {
+			if ( opt.duration in jQuery.fx.speeds ) {
+				opt.duration = jQuery.fx.speeds[ opt.duration ];
+
+			} else {
+				opt.duration = jQuery.fx.speeds._default;
+			}
+		}
+	}
+
+	// Normalize opt.queue - true/undefined/null -> "fx"
+	if ( opt.queue == null || opt.queue === true ) {
+		opt.queue = "fx";
+	}
+
+	// Queueing
+	opt.old = opt.complete;
+
+	opt.complete = function() {
+		if ( isFunction( opt.old ) ) {
+			opt.old.call( this );
+		}
+
+		if ( opt.queue ) {
+			jQuery.dequeue( this, opt.queue );
+		}
+	};
+
+	return opt;
+};
+
+jQuery.fn.extend( {
+	fadeTo: function( speed, to, easing, callback ) {
+
+		// Show any hidden elements after setting opacity to 0
+		return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
+
+			// Animate to the value specified
+			.end().animate( { opacity: to }, speed, easing, callback );
+	},
+	animate: function( prop, speed, easing, callback ) {
+		var empty = jQuery.isEmptyObject( prop ),
+			optall = jQuery.speed( speed, easing, callback ),
+			doAnimation = function() {
+
+				// Operate on a copy of prop so per-property easing won't be lost
+				var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+				// Empty animations, or finishing resolves immediately
+				if ( empty || dataPriv.get( this, "finish" ) ) {
+					anim.stop( true );
+				}
+			};
+
+		doAnimation.finish = doAnimation;
+
+		return empty || optall.queue === false ?
+			this.each( doAnimation ) :
+			this.queue( optall.queue, doAnimation );
+	},
+	stop: function( type, clearQueue, gotoEnd ) {
+		var stopQueue = function( hooks ) {
+			var stop = hooks.stop;
+			delete hooks.stop;
+			stop( gotoEnd );
+		};
+
+		if ( typeof type !== "string" ) {
+			gotoEnd = clearQueue;
+			clearQueue = type;
+			type = undefined;
+		}
+		if ( clearQueue ) {
+			this.queue( type || "fx", [] );
+		}
+
+		return this.each( function() {
+			var dequeue = true,
+				index = type != null && type + "queueHooks",
+				timers = jQuery.timers,
+				data = dataPriv.get( this );
+
+			if ( index ) {
+				if ( data[ index ] && data[ index ].stop ) {
+					stopQueue( data[ index ] );
+				}
+			} else {
+				for ( index in data ) {
+					if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+						stopQueue( data[ index ] );
+					}
+				}
+			}
+
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this &&
+					( type == null || timers[ index ].queue === type ) ) {
+
+					timers[ index ].anim.stop( gotoEnd );
+					dequeue = false;
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Start the next in the queue if the last step wasn't forced.
+			// Timers currently will call their complete callbacks, which
+			// will dequeue but only if they were gotoEnd.
+			if ( dequeue || !gotoEnd ) {
+				jQuery.dequeue( this, type );
+			}
+		} );
+	},
+	finish: function( type ) {
+		if ( type !== false ) {
+			type = type || "fx";
+		}
+		return this.each( function() {
+			var index,
+				data = dataPriv.get( this ),
+				queue = data[ type + "queue" ],
+				hooks = data[ type + "queueHooks" ],
+				timers = jQuery.timers,
+				length = queue ? queue.length : 0;
+
+			// Enable finishing flag on private data
+			data.finish = true;
+
+			// Empty the queue first
+			jQuery.queue( this, type, [] );
+
+			if ( hooks && hooks.stop ) {
+				hooks.stop.call( this, true );
+			}
+
+			// Look for any active animations, and finish them
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+					timers[ index ].anim.stop( true );
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Look for any animations in the old queue and finish them
+			for ( index = 0; index < length; index++ ) {
+				if ( queue[ index ] && queue[ index ].finish ) {
+					queue[ index ].finish.call( this );
+				}
+			}
+
+			// Turn off finishing flag
+			delete data.finish;
+		} );
+	}
+} );
+
+jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) {
+	var cssFn = jQuery.fn[ name ];
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return speed == null || typeof speed === "boolean" ?
+			cssFn.apply( this, arguments ) :
+			this.animate( genFx( name, true ), speed, easing, callback );
+	};
+} );
+
+// Generate shortcuts for custom animations
+jQuery.each( {
+	slideDown: genFx( "show" ),
+	slideUp: genFx( "hide" ),
+	slideToggle: genFx( "toggle" ),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" },
+	fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return this.animate( props, speed, easing, callback );
+	};
+} );
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+	var timer,
+		i = 0,
+		timers = jQuery.timers;
+
+	fxNow = Date.now();
+
+	for ( ; i < timers.length; i++ ) {
+		timer = timers[ i ];
+
+		// Run the timer and safely remove it when done (allowing for external removal)
+		if ( !timer() && timers[ i ] === timer ) {
+			timers.splice( i--, 1 );
+		}
+	}
+
+	if ( !timers.length ) {
+		jQuery.fx.stop();
+	}
+	fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+	jQuery.timers.push( timer );
+	jQuery.fx.start();
+};
+
+jQuery.fx.interval = 13;
+jQuery.fx.start = function() {
+	if ( inProgress ) {
+		return;
+	}
+
+	inProgress = true;
+	schedule();
+};
+
+jQuery.fx.stop = function() {
+	inProgress = null;
+};
+
+jQuery.fx.speeds = {
+	slow: 600,
+	fast: 200,
+
+	// Default speed
+	_default: 400
+};
+
+
+// Based off of the plugin by Clint Helfers, with permission.
+jQuery.fn.delay = function( time, type ) {
+	time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+	type = type || "fx";
+
+	return this.queue( type, function( next, hooks ) {
+		var timeout = window.setTimeout( next, time );
+		hooks.stop = function() {
+			window.clearTimeout( timeout );
+		};
+	} );
+};
+
+
+( function() {
+	var input = document.createElement( "input" ),
+		select = document.createElement( "select" ),
+		opt = select.appendChild( document.createElement( "option" ) );
+
+	input.type = "checkbox";
+
+	// Support: Android <=4.3 only
+	// Default value for a checkbox should be "on"
+	support.checkOn = input.value !== "";
+
+	// Support: IE <=11 only
+	// Must access selectedIndex to make default options select
+	support.optSelected = opt.selected;
+
+	// Support: IE <=11 only
+	// An input loses its value after becoming a radio
+	input = document.createElement( "input" );
+	input.value = "t";
+	input.type = "radio";
+	support.radioValue = input.value === "t";
+} )();
+
+
+var boolHook,
+	attrHandle = jQuery.expr.attrHandle;
+
+jQuery.fn.extend( {
+	attr: function( name, value ) {
+		return access( this, jQuery.attr, name, value, arguments.length > 1 );
+	},
+
+	removeAttr: function( name ) {
+		return this.each( function() {
+			jQuery.removeAttr( this, name );
+		} );
+	}
+} );
+
+jQuery.extend( {
+	attr: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set attributes on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		// Fallback to prop when attributes are not supported
+		if ( typeof elem.getAttribute === "undefined" ) {
+			return jQuery.prop( elem, name, value );
+		}
+
+		// Attribute hooks are determined by the lowercase version
+		// Grab necessary hook if one is defined
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+			hooks = jQuery.attrHooks[ name.toLowerCase() ] ||
+				( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
+		}
+
+		if ( value !== undefined ) {
+			if ( value === null ) {
+				jQuery.removeAttr( elem, name );
+				return;
+			}
+
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			elem.setAttribute( name, value + "" );
+			return value;
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		ret = jQuery.find.attr( elem, name );
+
+		// Non-existent attributes return null, we normalize to undefined
+		return ret == null ? undefined : ret;
+	},
+
+	attrHooks: {
+		type: {
+			set: function( elem, value ) {
+				if ( !support.radioValue && value === "radio" &&
+					nodeName( elem, "input" ) ) {
+					var val = elem.value;
+					elem.setAttribute( "type", value );
+					if ( val ) {
+						elem.value = val;
+					}
+					return value;
+				}
+			}
+		}
+	},
+
+	removeAttr: function( elem, value ) {
+		var name,
+			i = 0,
+
+			// Attribute names can contain non-HTML whitespace characters
+			// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
+			attrNames = value && value.match( rnothtmlwhite );
+
+		if ( attrNames && elem.nodeType === 1 ) {
+			while ( ( name = attrNames[ i++ ] ) ) {
+				elem.removeAttribute( name );
+			}
+		}
+	}
+} );
+
+// Hooks for boolean attributes
+boolHook = {
+	set: function( elem, value, name ) {
+		if ( value === false ) {
+
+			// Remove boolean attributes when set to false
+			jQuery.removeAttr( elem, name );
+		} else {
+			elem.setAttribute( name, name );
+		}
+		return name;
+	}
+};
+
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) {
+	var getter = attrHandle[ name ] || jQuery.find.attr;
+
+	attrHandle[ name ] = function( elem, name, isXML ) {
+		var ret, handle,
+			lowercaseName = name.toLowerCase();
+
+		if ( !isXML ) {
+
+			// Avoid an infinite loop by temporarily removing this function from the getter
+			handle = attrHandle[ lowercaseName ];
+			attrHandle[ lowercaseName ] = ret;
+			ret = getter( elem, name, isXML ) != null ?
+				lowercaseName :
+				null;
+			attrHandle[ lowercaseName ] = handle;
+		}
+		return ret;
+	};
+} );
+
+
+
+
+var rfocusable = /^(?:input|select|textarea|button)$/i,
+	rclickable = /^(?:a|area)$/i;
+
+jQuery.fn.extend( {
+	prop: function( name, value ) {
+		return access( this, jQuery.prop, name, value, arguments.length > 1 );
+	},
+
+	removeProp: function( name ) {
+		return this.each( function() {
+			delete this[ jQuery.propFix[ name ] || name ];
+		} );
+	}
+} );
+
+jQuery.extend( {
+	prop: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set properties on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+
+			// Fix name and attach hooks
+			name = jQuery.propFix[ name ] || name;
+			hooks = jQuery.propHooks[ name ];
+		}
+
+		if ( value !== undefined ) {
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			return ( elem[ name ] = value );
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		return elem[ name ];
+	},
+
+	propHooks: {
+		tabIndex: {
+			get: function( elem ) {
+
+				// Support: IE <=9 - 11 only
+				// elem.tabIndex doesn't always return the
+				// correct value when it hasn't been explicitly set
+				// Use proper attribute retrieval (trac-12072)
+				var tabindex = jQuery.find.attr( elem, "tabindex" );
+
+				if ( tabindex ) {
+					return parseInt( tabindex, 10 );
+				}
+
+				if (
+					rfocusable.test( elem.nodeName ) ||
+					rclickable.test( elem.nodeName ) &&
+					elem.href
+				) {
+					return 0;
+				}
+
+				return -1;
+			}
+		}
+	},
+
+	propFix: {
+		"for": "htmlFor",
+		"class": "className"
+	}
+} );
+
+// Support: IE <=11 only
+// Accessing the selectedIndex property
+// forces the browser to respect setting selected
+// on the option
+// The getter ensures a default option is selected
+// when in an optgroup
+// eslint rule "no-unused-expressions" is disabled for this code
+// since it considers such accessions noop
+if ( !support.optSelected ) {
+	jQuery.propHooks.selected = {
+		get: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent && parent.parentNode ) {
+				parent.parentNode.selectedIndex;
+			}
+			return null;
+		},
+		set: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent ) {
+				parent.selectedIndex;
+
+				if ( parent.parentNode ) {
+					parent.parentNode.selectedIndex;
+				}
+			}
+		}
+	};
+}
+
+jQuery.each( [
+	"tabIndex",
+	"readOnly",
+	"maxLength",
+	"cellSpacing",
+	"cellPadding",
+	"rowSpan",
+	"colSpan",
+	"useMap",
+	"frameBorder",
+	"contentEditable"
+], function() {
+	jQuery.propFix[ this.toLowerCase() ] = this;
+} );
+
+
+
+
+	// Strip and collapse whitespace according to HTML spec
+	// https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace
+	function stripAndCollapse( value ) {
+		var tokens = value.match( rnothtmlwhite ) || [];
+		return tokens.join( " " );
+	}
+
+
+function getClass( elem ) {
+	return elem.getAttribute && elem.getAttribute( "class" ) || "";
+}
+
+function classesToArray( value ) {
+	if ( Array.isArray( value ) ) {
+		return value;
+	}
+	if ( typeof value === "string" ) {
+		return value.match( rnothtmlwhite ) || [];
+	}
+	return [];
+}
+
+jQuery.fn.extend( {
+	addClass: function( value ) {
+		var classNames, cur, curValue, className, i, finalValue;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		classNames = classesToArray( value );
+
+		if ( classNames.length ) {
+			return this.each( function() {
+				curValue = getClass( this );
+				cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					for ( i = 0; i < classNames.length; i++ ) {
+						className = classNames[ i ];
+						if ( cur.indexOf( " " + className + " " ) < 0 ) {
+							cur += className + " ";
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						this.setAttribute( "class", finalValue );
+					}
+				}
+			} );
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		var classNames, cur, curValue, className, i, finalValue;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		if ( !arguments.length ) {
+			return this.attr( "class", "" );
+		}
+
+		classNames = classesToArray( value );
+
+		if ( classNames.length ) {
+			return this.each( function() {
+				curValue = getClass( this );
+
+				// This expression is here for better compressibility (see addClass)
+				cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					for ( i = 0; i < classNames.length; i++ ) {
+						className = classNames[ i ];
+
+						// Remove *all* instances
+						while ( cur.indexOf( " " + className + " " ) > -1 ) {
+							cur = cur.replace( " " + className + " ", " " );
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						this.setAttribute( "class", finalValue );
+					}
+				}
+			} );
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var classNames, className, i, self,
+			type = typeof value,
+			isValidValue = type === "string" || Array.isArray( value );
+
+		if ( isFunction( value ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).toggleClass(
+					value.call( this, i, getClass( this ), stateVal ),
+					stateVal
+				);
+			} );
+		}
+
+		if ( typeof stateVal === "boolean" && isValidValue ) {
+			return stateVal ? this.addClass( value ) : this.removeClass( value );
+		}
+
+		classNames = classesToArray( value );
+
+		return this.each( function() {
+			if ( isValidValue ) {
+
+				// Toggle individual class names
+				self = jQuery( this );
+
+				for ( i = 0; i < classNames.length; i++ ) {
+					className = classNames[ i ];
+
+					// Check each className given, space separated list
+					if ( self.hasClass( className ) ) {
+						self.removeClass( className );
+					} else {
+						self.addClass( className );
+					}
+				}
+
+			// Toggle whole class name
+			} else if ( value === undefined || type === "boolean" ) {
+				className = getClass( this );
+				if ( className ) {
+
+					// Store className if set
+					dataPriv.set( this, "__className__", className );
+				}
+
+				// If the element has a class name or if we're passed `false`,
+				// then remove the whole classname (if there was one, the above saved it).
+				// Otherwise bring back whatever was previously saved (if anything),
+				// falling back to the empty string if nothing was stored.
+				if ( this.setAttribute ) {
+					this.setAttribute( "class",
+						className || value === false ?
+							"" :
+							dataPriv.get( this, "__className__" ) || ""
+					);
+				}
+			}
+		} );
+	},
+
+	hasClass: function( selector ) {
+		var className, elem,
+			i = 0;
+
+		className = " " + selector + " ";
+		while ( ( elem = this[ i++ ] ) ) {
+			if ( elem.nodeType === 1 &&
+				( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
+				return true;
+			}
+		}
+
+		return false;
+	}
+} );
+
+
+
+
+var rreturn = /\r/g;
+
+jQuery.fn.extend( {
+	val: function( value ) {
+		var hooks, ret, valueIsFunction,
+			elem = this[ 0 ];
+
+		if ( !arguments.length ) {
+			if ( elem ) {
+				hooks = jQuery.valHooks[ elem.type ] ||
+					jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+				if ( hooks &&
+					"get" in hooks &&
+					( ret = hooks.get( elem, "value" ) ) !== undefined
+				) {
+					return ret;
+				}
+
+				ret = elem.value;
+
+				// Handle most common string cases
+				if ( typeof ret === "string" ) {
+					return ret.replace( rreturn, "" );
+				}
+
+				// Handle cases where value is null/undef or number
+				return ret == null ? "" : ret;
+			}
+
+			return;
+		}
+
+		valueIsFunction = isFunction( value );
+
+		return this.each( function( i ) {
+			var val;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( valueIsFunction ) {
+				val = value.call( this, i, jQuery( this ).val() );
+			} else {
+				val = value;
+			}
+
+			// Treat null/undefined as ""; convert numbers to string
+			if ( val == null ) {
+				val = "";
+
+			} else if ( typeof val === "number" ) {
+				val += "";
+
+			} else if ( Array.isArray( val ) ) {
+				val = jQuery.map( val, function( value ) {
+					return value == null ? "" : value + "";
+				} );
+			}
+
+			hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+			// If set returns undefined, fall back to normal setting
+			if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
+				this.value = val;
+			}
+		} );
+	}
+} );
+
+jQuery.extend( {
+	valHooks: {
+		option: {
+			get: function( elem ) {
+
+				var val = jQuery.find.attr( elem, "value" );
+				return val != null ?
+					val :
+
+					// Support: IE <=10 - 11 only
+					// option.text throws exceptions (trac-14686, trac-14858)
+					// Strip and collapse whitespace
+					// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
+					stripAndCollapse( jQuery.text( elem ) );
+			}
+		},
+		select: {
+			get: function( elem ) {
+				var value, option, i,
+					options = elem.options,
+					index = elem.selectedIndex,
+					one = elem.type === "select-one",
+					values = one ? null : [],
+					max = one ? index + 1 : options.length;
+
+				if ( index < 0 ) {
+					i = max;
+
+				} else {
+					i = one ? index : 0;
+				}
+
+				// Loop through all the selected options
+				for ( ; i < max; i++ ) {
+					option = options[ i ];
+
+					// Support: IE <=9 only
+					// IE8-9 doesn't update selected after form reset (trac-2551)
+					if ( ( option.selected || i === index ) &&
+
+							// Don't return options that are disabled or in a disabled optgroup
+							!option.disabled &&
+							( !option.parentNode.disabled ||
+								!nodeName( option.parentNode, "optgroup" ) ) ) {
+
+						// Get the specific value for the option
+						value = jQuery( option ).val();
+
+						// We don't need an array for one selects
+						if ( one ) {
+							return value;
+						}
+
+						// Multi-Selects return an array
+						values.push( value );
+					}
+				}
+
+				return values;
+			},
+
+			set: function( elem, value ) {
+				var optionSet, option,
+					options = elem.options,
+					values = jQuery.makeArray( value ),
+					i = options.length;
+
+				while ( i-- ) {
+					option = options[ i ];
+
+					/* eslint-disable no-cond-assign */
+
+					if ( option.selected =
+						jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
+					) {
+						optionSet = true;
+					}
+
+					/* eslint-enable no-cond-assign */
+				}
+
+				// Force browsers to behave consistently when non-matching value is set
+				if ( !optionSet ) {
+					elem.selectedIndex = -1;
+				}
+				return values;
+			}
+		}
+	}
+} );
+
+// Radios and checkboxes getter/setter
+jQuery.each( [ "radio", "checkbox" ], function() {
+	jQuery.valHooks[ this ] = {
+		set: function( elem, value ) {
+			if ( Array.isArray( value ) ) {
+				return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
+			}
+		}
+	};
+	if ( !support.checkOn ) {
+		jQuery.valHooks[ this ].get = function( elem ) {
+			return elem.getAttribute( "value" ) === null ? "on" : elem.value;
+		};
+	}
+} );
+
+
+
+
+// Return jQuery for attributes-only inclusion
+var location = window.location;
+
+var nonce = { guid: Date.now() };
+
+var rquery = ( /\?/ );
+
+
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+	var xml, parserErrorElem;
+	if ( !data || typeof data !== "string" ) {
+		return null;
+	}
+
+	// Support: IE 9 - 11 only
+	// IE throws on parseFromString with invalid input.
+	try {
+		xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
+	} catch ( e ) {}
+
+	parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ];
+	if ( !xml || parserErrorElem ) {
+		jQuery.error( "Invalid XML: " + (
+			parserErrorElem ?
+				jQuery.map( parserErrorElem.childNodes, function( el ) {
+					return el.textContent;
+				} ).join( "\n" ) :
+				data
+		) );
+	}
+	return xml;
+};
+
+
+var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+	stopPropagationCallback = function( e ) {
+		e.stopPropagation();
+	};
+
+jQuery.extend( jQuery.event, {
+
+	trigger: function( event, data, elem, onlyHandlers ) {
+
+		var i, cur, tmp, bubbleType, ontype, handle, special, lastElement,
+			eventPath = [ elem || document ],
+			type = hasOwn.call( event, "type" ) ? event.type : event,
+			namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
+
+		cur = lastElement = tmp = elem = elem || document;
+
+		// Don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// focus/blur morphs to focusin/out; ensure we're not firing them right now
+		if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+			return;
+		}
+
+		if ( type.indexOf( "." ) > -1 ) {
+
+			// Namespaced trigger; create a regexp to match event type in handle()
+			namespaces = type.split( "." );
+			type = namespaces.shift();
+			namespaces.sort();
+		}
+		ontype = type.indexOf( ":" ) < 0 && "on" + type;
+
+		// Caller can pass in a jQuery.Event object, Object, or just an event type string
+		event = event[ jQuery.expando ] ?
+			event :
+			new jQuery.Event( type, typeof event === "object" && event );
+
+		// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+		event.isTrigger = onlyHandlers ? 2 : 3;
+		event.namespace = namespaces.join( "." );
+		event.rnamespace = event.namespace ?
+			new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
+			null;
+
+		// Clean up the event in case it is being reused
+		event.result = undefined;
+		if ( !event.target ) {
+			event.target = elem;
+		}
+
+		// Clone any incoming data and prepend the event, creating the handler arg list
+		data = data == null ?
+			[ event ] :
+			jQuery.makeArray( data, [ event ] );
+
+		// Allow special events to draw outside the lines
+		special = jQuery.event.special[ type ] || {};
+		if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+			return;
+		}
+
+		// Determine event propagation path in advance, per W3C events spec (trac-9951)
+		// Bubble up to document, then to window; watch for a global ownerDocument var (trac-9724)
+		if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) {
+
+			bubbleType = special.delegateType || type;
+			if ( !rfocusMorph.test( bubbleType + type ) ) {
+				cur = cur.parentNode;
+			}
+			for ( ; cur; cur = cur.parentNode ) {
+				eventPath.push( cur );
+				tmp = cur;
+			}
+
+			// Only add window if we got to document (e.g., not plain obj or detached DOM)
+			if ( tmp === ( elem.ownerDocument || document ) ) {
+				eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+			}
+		}
+
+		// Fire handlers on the event path
+		i = 0;
+		while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
+			lastElement = cur;
+			event.type = i > 1 ?
+				bubbleType :
+				special.bindType || type;
+
+			// jQuery handler
+			handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] &&
+				dataPriv.get( cur, "handle" );
+			if ( handle ) {
+				handle.apply( cur, data );
+			}
+
+			// Native handler
+			handle = ontype && cur[ ontype ];
+			if ( handle && handle.apply && acceptData( cur ) ) {
+				event.result = handle.apply( cur, data );
+				if ( event.result === false ) {
+					event.preventDefault();
+				}
+			}
+		}
+		event.type = type;
+
+		// If nobody prevented the default action, do it now
+		if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+			if ( ( !special._default ||
+				special._default.apply( eventPath.pop(), data ) === false ) &&
+				acceptData( elem ) ) {
+
+				// Call a native DOM method on the target with the same name as the event.
+				// Don't do default actions on window, that's where global variables be (trac-6170)
+				if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) {
+
+					// Don't re-trigger an onFOO event when we call its FOO() method
+					tmp = elem[ ontype ];
+
+					if ( tmp ) {
+						elem[ ontype ] = null;
+					}
+
+					// Prevent re-triggering of the same event, since we already bubbled it above
+					jQuery.event.triggered = type;
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.addEventListener( type, stopPropagationCallback );
+					}
+
+					elem[ type ]();
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.removeEventListener( type, stopPropagationCallback );
+					}
+
+					jQuery.event.triggered = undefined;
+
+					if ( tmp ) {
+						elem[ ontype ] = tmp;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	// Piggyback on a donor event to simulate a different one
+	// Used only for `focus(in | out)` events
+	simulate: function( type, elem, event ) {
+		var e = jQuery.extend(
+			new jQuery.Event(),
+			event,
+			{
+				type: type,
+				isSimulated: true
+			}
+		);
+
+		jQuery.event.trigger( e, null, elem );
+	}
+
+} );
+
+jQuery.fn.extend( {
+
+	trigger: function( type, data ) {
+		return this.each( function() {
+			jQuery.event.trigger( type, data, this );
+		} );
+	},
+	triggerHandler: function( type, data ) {
+		var elem = this[ 0 ];
+		if ( elem ) {
+			return jQuery.event.trigger( type, data, elem, true );
+		}
+	}
+} );
+
+
+var
+	rbracket = /\[\]$/,
+	rCRLF = /\r?\n/g,
+	rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+	rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+function buildParams( prefix, obj, traditional, add ) {
+	var name;
+
+	if ( Array.isArray( obj ) ) {
+
+		// Serialize array item.
+		jQuery.each( obj, function( i, v ) {
+			if ( traditional || rbracket.test( prefix ) ) {
+
+				// Treat each array item as a scalar.
+				add( prefix, v );
+
+			} else {
+
+				// Item is non-scalar (array or object), encode its numeric index.
+				buildParams(
+					prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
+					v,
+					traditional,
+					add
+				);
+			}
+		} );
+
+	} else if ( !traditional && toType( obj ) === "object" ) {
+
+		// Serialize object item.
+		for ( name in obj ) {
+			buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+		}
+
+	} else {
+
+		// Serialize scalar item.
+		add( prefix, obj );
+	}
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+	var prefix,
+		s = [],
+		add = function( key, valueOrFunction ) {
+
+			// If value is a function, invoke it and use its return value
+			var value = isFunction( valueOrFunction ) ?
+				valueOrFunction() :
+				valueOrFunction;
+
+			s[ s.length ] = encodeURIComponent( key ) + "=" +
+				encodeURIComponent( value == null ? "" : value );
+		};
+
+	if ( a == null ) {
+		return "";
+	}
+
+	// If an array was passed in, assume that it is an array of form elements.
+	if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+
+		// Serialize the form elements
+		jQuery.each( a, function() {
+			add( this.name, this.value );
+		} );
+
+	} else {
+
+		// If traditional, encode the "old" way (the way 1.3.2 or older
+		// did it), otherwise encode params recursively.
+		for ( prefix in a ) {
+			buildParams( prefix, a[ prefix ], traditional, add );
+		}
+	}
+
+	// Return the resulting serialization
+	return s.join( "&" );
+};
+
+jQuery.fn.extend( {
+	serialize: function() {
+		return jQuery.param( this.serializeArray() );
+	},
+	serializeArray: function() {
+		return this.map( function() {
+
+			// Can add propHook for "elements" to filter or add form elements
+			var elements = jQuery.prop( this, "elements" );
+			return elements ? jQuery.makeArray( elements ) : this;
+		} ).filter( function() {
+			var type = this.type;
+
+			// Use .is( ":disabled" ) so that fieldset[disabled] works
+			return this.name && !jQuery( this ).is( ":disabled" ) &&
+				rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+				( this.checked || !rcheckableType.test( type ) );
+		} ).map( function( _i, elem ) {
+			var val = jQuery( this ).val();
+
+			if ( val == null ) {
+				return null;
+			}
+
+			if ( Array.isArray( val ) ) {
+				return jQuery.map( val, function( val ) {
+					return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+				} );
+			}
+
+			return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+		} ).get();
+	}
+} );
+
+
+var
+	r20 = /%20/g,
+	rhash = /#.*$/,
+	rantiCache = /([?&])_=[^&]*/,
+	rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
+
+	// trac-7653, trac-8125, trac-8152: local protocol detection
+	rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+	rnoContent = /^(?:GET|HEAD)$/,
+	rprotocol = /^\/\//,
+
+	/* Prefilters
+	 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+	 * 2) These are called:
+	 *    - BEFORE asking for a transport
+	 *    - AFTER param serialization (s.data is a string if s.processData is true)
+	 * 3) key is the dataType
+	 * 4) the catchall symbol "*" can be used
+	 * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+	 */
+	prefilters = {},
+
+	/* Transports bindings
+	 * 1) key is the dataType
+	 * 2) the catchall symbol "*" can be used
+	 * 3) selection will start with transport dataType and THEN go to "*" if needed
+	 */
+	transports = {},
+
+	// Avoid comment-prolog char sequence (trac-10098); must appease lint and evade compression
+	allTypes = "*/".concat( "*" ),
+
+	// Anchor tag for parsing the document origin
+	originAnchor = document.createElement( "a" );
+
+originAnchor.href = location.href;
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+	// dataTypeExpression is optional and defaults to "*"
+	return function( dataTypeExpression, func ) {
+
+		if ( typeof dataTypeExpression !== "string" ) {
+			func = dataTypeExpression;
+			dataTypeExpression = "*";
+		}
+
+		var dataType,
+			i = 0,
+			dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];
+
+		if ( isFunction( func ) ) {
+
+			// For each dataType in the dataTypeExpression
+			while ( ( dataType = dataTypes[ i++ ] ) ) {
+
+				// Prepend if requested
+				if ( dataType[ 0 ] === "+" ) {
+					dataType = dataType.slice( 1 ) || "*";
+					( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
+
+				// Otherwise append
+				} else {
+					( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
+				}
+			}
+		}
+	};
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+	var inspected = {},
+		seekingTransport = ( structure === transports );
+
+	function inspect( dataType ) {
+		var selected;
+		inspected[ dataType ] = true;
+		jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+			var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+			if ( typeof dataTypeOrTransport === "string" &&
+				!seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+
+				options.dataTypes.unshift( dataTypeOrTransport );
+				inspect( dataTypeOrTransport );
+				return false;
+			} else if ( seekingTransport ) {
+				return !( selected = dataTypeOrTransport );
+			}
+		} );
+		return selected;
+	}
+
+	return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes trac-9887
+function ajaxExtend( target, src ) {
+	var key, deep,
+		flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+	for ( key in src ) {
+		if ( src[ key ] !== undefined ) {
+			( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+		}
+	}
+	if ( deep ) {
+		jQuery.extend( true, target, deep );
+	}
+
+	return target;
+}
+
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+	var ct, type, finalDataType, firstDataType,
+		contents = s.contents,
+		dataTypes = s.dataTypes;
+
+	// Remove auto dataType and get content-type in the process
+	while ( dataTypes[ 0 ] === "*" ) {
+		dataTypes.shift();
+		if ( ct === undefined ) {
+			ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
+		}
+	}
+
+	// Check if we're dealing with a known content-type
+	if ( ct ) {
+		for ( type in contents ) {
+			if ( contents[ type ] && contents[ type ].test( ct ) ) {
+				dataTypes.unshift( type );
+				break;
+			}
+		}
+	}
+
+	// Check to see if we have a response for the expected dataType
+	if ( dataTypes[ 0 ] in responses ) {
+		finalDataType = dataTypes[ 0 ];
+	} else {
+
+		// Try convertible dataTypes
+		for ( type in responses ) {
+			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
+				finalDataType = type;
+				break;
+			}
+			if ( !firstDataType ) {
+				firstDataType = type;
+			}
+		}
+
+		// Or just use first one
+		finalDataType = finalDataType || firstDataType;
+	}
+
+	// If we found a dataType
+	// We add the dataType to the list if needed
+	// and return the corresponding response
+	if ( finalDataType ) {
+		if ( finalDataType !== dataTypes[ 0 ] ) {
+			dataTypes.unshift( finalDataType );
+		}
+		return responses[ finalDataType ];
+	}
+}
+
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+	var conv2, current, conv, tmp, prev,
+		converters = {},
+
+		// Work with a copy of dataTypes in case we need to modify it for conversion
+		dataTypes = s.dataTypes.slice();
+
+	// Create converters map with lowercased keys
+	if ( dataTypes[ 1 ] ) {
+		for ( conv in s.converters ) {
+			converters[ conv.toLowerCase() ] = s.converters[ conv ];
+		}
+	}
+
+	current = dataTypes.shift();
+
+	// Convert to each sequential dataType
+	while ( current ) {
+
+		if ( s.responseFields[ current ] ) {
+			jqXHR[ s.responseFields[ current ] ] = response;
+		}
+
+		// Apply the dataFilter if provided
+		if ( !prev && isSuccess && s.dataFilter ) {
+			response = s.dataFilter( response, s.dataType );
+		}
+
+		prev = current;
+		current = dataTypes.shift();
+
+		if ( current ) {
+
+			// There's only work to do if current dataType is non-auto
+			if ( current === "*" ) {
+
+				current = prev;
+
+			// Convert response if prev dataType is non-auto and differs from current
+			} else if ( prev !== "*" && prev !== current ) {
+
+				// Seek a direct converter
+				conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+				// If none found, seek a pair
+				if ( !conv ) {
+					for ( conv2 in converters ) {
+
+						// If conv2 outputs current
+						tmp = conv2.split( " " );
+						if ( tmp[ 1 ] === current ) {
+
+							// If prev can be converted to accepted input
+							conv = converters[ prev + " " + tmp[ 0 ] ] ||
+								converters[ "* " + tmp[ 0 ] ];
+							if ( conv ) {
+
+								// Condense equivalence converters
+								if ( conv === true ) {
+									conv = converters[ conv2 ];
+
+								// Otherwise, insert the intermediate dataType
+								} else if ( converters[ conv2 ] !== true ) {
+									current = tmp[ 0 ];
+									dataTypes.unshift( tmp[ 1 ] );
+								}
+								break;
+							}
+						}
+					}
+				}
+
+				// Apply converter (if not an equivalence)
+				if ( conv !== true ) {
+
+					// Unless errors are allowed to bubble, catch and return them
+					if ( conv && s.throws ) {
+						response = conv( response );
+					} else {
+						try {
+							response = conv( response );
+						} catch ( e ) {
+							return {
+								state: "parsererror",
+								error: conv ? e : "No conversion from " + prev + " to " + current
+							};
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return { state: "success", data: response };
+}
+
+jQuery.extend( {
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
+
+	ajaxSettings: {
+		url: location.href,
+		type: "GET",
+		isLocal: rlocalProtocol.test( location.protocol ),
+		global: true,
+		processData: true,
+		async: true,
+		contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+
+		/*
+		timeout: 0,
+		data: null,
+		dataType: null,
+		username: null,
+		password: null,
+		cache: null,
+		throws: false,
+		traditional: false,
+		headers: {},
+		*/
+
+		accepts: {
+			"*": allTypes,
+			text: "text/plain",
+			html: "text/html",
+			xml: "application/xml, text/xml",
+			json: "application/json, text/javascript"
+		},
+
+		contents: {
+			xml: /\bxml\b/,
+			html: /\bhtml/,
+			json: /\bjson\b/
+		},
+
+		responseFields: {
+			xml: "responseXML",
+			text: "responseText",
+			json: "responseJSON"
+		},
+
+		// Data converters
+		// Keys separate source (or catchall "*") and destination types with a single space
+		converters: {
+
+			// Convert anything to text
+			"* text": String,
+
+			// Text to html (true = no transformation)
+			"text html": true,
+
+			// Evaluate text as a json expression
+			"text json": JSON.parse,
+
+			// Parse text as xml
+			"text xml": jQuery.parseXML
+		},
+
+		// For options that shouldn't be deep extended:
+		// you can add your own custom options here if
+		// and when you create one that shouldn't be
+		// deep extended (see ajaxExtend)
+		flatOptions: {
+			url: true,
+			context: true
+		}
+	},
+
+	// Creates a full fledged settings object into target
+	// with both ajaxSettings and settings fields.
+	// If target is omitted, writes into ajaxSettings.
+	ajaxSetup: function( target, settings ) {
+		return settings ?
+
+			// Building a settings object
+			ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+			// Extending ajaxSettings
+			ajaxExtend( jQuery.ajaxSettings, target );
+	},
+
+	ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+	ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+	// Main method
+	ajax: function( url, options ) {
+
+		// If url is an object, simulate pre-1.5 signature
+		if ( typeof url === "object" ) {
+			options = url;
+			url = undefined;
+		}
+
+		// Force options to be an object
+		options = options || {};
+
+		var transport,
+
+			// URL without anti-cache param
+			cacheURL,
+
+			// Response headers
+			responseHeadersString,
+			responseHeaders,
+
+			// timeout handle
+			timeoutTimer,
+
+			// Url cleanup var
+			urlAnchor,
+
+			// Request state (becomes false upon send and true upon completion)
+			completed,
+
+			// To know if global events are to be dispatched
+			fireGlobals,
+
+			// Loop variable
+			i,
+
+			// uncached part of the url
+			uncached,
+
+			// Create the final options object
+			s = jQuery.ajaxSetup( {}, options ),
+
+			// Callbacks context
+			callbackContext = s.context || s,
+
+			// Context for global events is callbackContext if it is a DOM node or jQuery collection
+			globalEventContext = s.context &&
+				( callbackContext.nodeType || callbackContext.jquery ) ?
+				jQuery( callbackContext ) :
+				jQuery.event,
+
+			// Deferreds
+			deferred = jQuery.Deferred(),
+			completeDeferred = jQuery.Callbacks( "once memory" ),
+
+			// Status-dependent callbacks
+			statusCode = s.statusCode || {},
+
+			// Headers (they are sent all at once)
+			requestHeaders = {},
+			requestHeadersNames = {},
+
+			// Default abort message
+			strAbort = "canceled",
+
+			// Fake xhr
+			jqXHR = {
+				readyState: 0,
+
+				// Builds headers hashtable if needed
+				getResponseHeader: function( key ) {
+					var match;
+					if ( completed ) {
+						if ( !responseHeaders ) {
+							responseHeaders = {};
+							while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
+								responseHeaders[ match[ 1 ].toLowerCase() + " " ] =
+									( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] )
+										.concat( match[ 2 ] );
+							}
+						}
+						match = responseHeaders[ key.toLowerCase() + " " ];
+					}
+					return match == null ? null : match.join( ", " );
+				},
+
+				// Raw string
+				getAllResponseHeaders: function() {
+					return completed ? responseHeadersString : null;
+				},
+
+				// Caches the header
+				setRequestHeader: function( name, value ) {
+					if ( completed == null ) {
+						name = requestHeadersNames[ name.toLowerCase() ] =
+							requestHeadersNames[ name.toLowerCase() ] || name;
+						requestHeaders[ name ] = value;
+					}
+					return this;
+				},
+
+				// Overrides response content-type header
+				overrideMimeType: function( type ) {
+					if ( completed == null ) {
+						s.mimeType = type;
+					}
+					return this;
+				},
+
+				// Status-dependent callbacks
+				statusCode: function( map ) {
+					var code;
+					if ( map ) {
+						if ( completed ) {
+
+							// Execute the appropriate callbacks
+							jqXHR.always( map[ jqXHR.status ] );
+						} else {
+
+							// Lazy-add the new callbacks in a way that preserves old ones
+							for ( code in map ) {
+								statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+							}
+						}
+					}
+					return this;
+				},
+
+				// Cancel the request
+				abort: function( statusText ) {
+					var finalText = statusText || strAbort;
+					if ( transport ) {
+						transport.abort( finalText );
+					}
+					done( 0, finalText );
+					return this;
+				}
+			};
+
+		// Attach deferreds
+		deferred.promise( jqXHR );
+
+		// Add protocol if not provided (prefilters might expect it)
+		// Handle falsy url in the settings object (trac-10093: consistency with old signature)
+		// We also use the url parameter if available
+		s.url = ( ( url || s.url || location.href ) + "" )
+			.replace( rprotocol, location.protocol + "//" );
+
+		// Alias method option to type as per ticket trac-12004
+		s.type = options.method || options.type || s.method || s.type;
+
+		// Extract dataTypes list
+		s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ];
+
+		// A cross-domain request is in order when the origin doesn't match the current origin.
+		if ( s.crossDomain == null ) {
+			urlAnchor = document.createElement( "a" );
+
+			// Support: IE <=8 - 11, Edge 12 - 15
+			// IE throws exception on accessing the href property if url is malformed,
+			// e.g. http://example.com:80x/
+			try {
+				urlAnchor.href = s.url;
+
+				// Support: IE <=8 - 11 only
+				// Anchor's host property isn't correctly set when s.url is relative
+				urlAnchor.href = urlAnchor.href;
+				s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
+					urlAnchor.protocol + "//" + urlAnchor.host;
+			} catch ( e ) {
+
+				// If there is an error parsing the URL, assume it is crossDomain,
+				// it can be rejected by the transport if it is invalid
+				s.crossDomain = true;
+			}
+		}
+
+		// Convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Apply prefilters
+		inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+		// If request was aborted inside a prefilter, stop there
+		if ( completed ) {
+			return jqXHR;
+		}
+
+		// We can fire global events as of now if asked to
+		// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (trac-15118)
+		fireGlobals = jQuery.event && s.global;
+
+		// Watch for a new set of requests
+		if ( fireGlobals && jQuery.active++ === 0 ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// Uppercase the type
+		s.type = s.type.toUpperCase();
+
+		// Determine if request has content
+		s.hasContent = !rnoContent.test( s.type );
+
+		// Save the URL in case we're toying with the If-Modified-Since
+		// and/or If-None-Match header later on
+		// Remove hash to simplify url manipulation
+		cacheURL = s.url.replace( rhash, "" );
+
+		// More options handling for requests with no content
+		if ( !s.hasContent ) {
+
+			// Remember the hash so we can put it back
+			uncached = s.url.slice( cacheURL.length );
+
+			// If data is available and should be processed, append data to url
+			if ( s.data && ( s.processData || typeof s.data === "string" ) ) {
+				cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
+
+				// trac-9682: remove data so that it's not used in an eventual retry
+				delete s.data;
+			}
+
+			// Add or update anti-cache param if needed
+			if ( s.cache === false ) {
+				cacheURL = cacheURL.replace( rantiCache, "$1" );
+				uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) +
+					uncached;
+			}
+
+			// Put hash and anti-cache on the URL that will be requested (gh-1732)
+			s.url = cacheURL + uncached;
+
+		// Change '%20' to '+' if this is encoded form body content (gh-2658)
+		} else if ( s.data && s.processData &&
+			( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
+			s.data = s.data.replace( r20, "+" );
+		}
+
+		// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+		if ( s.ifModified ) {
+			if ( jQuery.lastModified[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+			}
+			if ( jQuery.etag[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+			}
+		}
+
+		// Set the correct header, if data is being sent
+		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+			jqXHR.setRequestHeader( "Content-Type", s.contentType );
+		}
+
+		// Set the Accepts header for the server, depending on the dataType
+		jqXHR.setRequestHeader(
+			"Accept",
+			s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
+				s.accepts[ s.dataTypes[ 0 ] ] +
+					( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+				s.accepts[ "*" ]
+		);
+
+		// Check for headers option
+		for ( i in s.headers ) {
+			jqXHR.setRequestHeader( i, s.headers[ i ] );
+		}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend &&
+			( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {
+
+			// Abort if not done already and return
+			return jqXHR.abort();
+		}
+
+		// Aborting is no longer a cancellation
+		strAbort = "abort";
+
+		// Install callbacks on deferreds
+		completeDeferred.add( s.complete );
+		jqXHR.done( s.success );
+		jqXHR.fail( s.error );
+
+		// Get transport
+		transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+		// If no transport, we auto-abort
+		if ( !transport ) {
+			done( -1, "No Transport" );
+		} else {
+			jqXHR.readyState = 1;
+
+			// Send global event
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+			}
+
+			// If request was aborted inside ajaxSend, stop there
+			if ( completed ) {
+				return jqXHR;
+			}
+
+			// Timeout
+			if ( s.async && s.timeout > 0 ) {
+				timeoutTimer = window.setTimeout( function() {
+					jqXHR.abort( "timeout" );
+				}, s.timeout );
+			}
+
+			try {
+				completed = false;
+				transport.send( requestHeaders, done );
+			} catch ( e ) {
+
+				// Rethrow post-completion exceptions
+				if ( completed ) {
+					throw e;
+				}
+
+				// Propagate others as results
+				done( -1, e );
+			}
+		}
+
+		// Callback for when everything is done
+		function done( status, nativeStatusText, responses, headers ) {
+			var isSuccess, success, error, response, modified,
+				statusText = nativeStatusText;
+
+			// Ignore repeat invocations
+			if ( completed ) {
+				return;
+			}
+
+			completed = true;
+
+			// Clear timeout if it exists
+			if ( timeoutTimer ) {
+				window.clearTimeout( timeoutTimer );
+			}
+
+			// Dereference transport for early garbage collection
+			// (no matter how long the jqXHR object will be used)
+			transport = undefined;
+
+			// Cache response headers
+			responseHeadersString = headers || "";
+
+			// Set readyState
+			jqXHR.readyState = status > 0 ? 4 : 0;
+
+			// Determine if successful
+			isSuccess = status >= 200 && status < 300 || status === 304;
+
+			// Get response data
+			if ( responses ) {
+				response = ajaxHandleResponses( s, jqXHR, responses );
+			}
+
+			// Use a noop converter for missing script but not if jsonp
+			if ( !isSuccess &&
+				jQuery.inArray( "script", s.dataTypes ) > -1 &&
+				jQuery.inArray( "json", s.dataTypes ) < 0 ) {
+				s.converters[ "text script" ] = function() {};
+			}
+
+			// Convert no matter what (that way responseXXX fields are always set)
+			response = ajaxConvert( s, response, jqXHR, isSuccess );
+
+			// If successful, handle type chaining
+			if ( isSuccess ) {
+
+				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+				if ( s.ifModified ) {
+					modified = jqXHR.getResponseHeader( "Last-Modified" );
+					if ( modified ) {
+						jQuery.lastModified[ cacheURL ] = modified;
+					}
+					modified = jqXHR.getResponseHeader( "etag" );
+					if ( modified ) {
+						jQuery.etag[ cacheURL ] = modified;
+					}
+				}
+
+				// if no content
+				if ( status === 204 || s.type === "HEAD" ) {
+					statusText = "nocontent";
+
+				// if not modified
+				} else if ( status === 304 ) {
+					statusText = "notmodified";
+
+				// If we have data, let's convert it
+				} else {
+					statusText = response.state;
+					success = response.data;
+					error = response.error;
+					isSuccess = !error;
+				}
+			} else {
+
+				// Extract error from statusText and normalize for non-aborts
+				error = statusText;
+				if ( status || !statusText ) {
+					statusText = "error";
+					if ( status < 0 ) {
+						status = 0;
+					}
+				}
+			}
+
+			// Set data for the fake xhr object
+			jqXHR.status = status;
+			jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+			// Success/Error
+			if ( isSuccess ) {
+				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+			} else {
+				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+			}
+
+			// Status-dependent callbacks
+			jqXHR.statusCode( statusCode );
+			statusCode = undefined;
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+					[ jqXHR, s, isSuccess ? success : error ] );
+			}
+
+			// Complete
+			completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+
+				// Handle the global AJAX counter
+				if ( !( --jQuery.active ) ) {
+					jQuery.event.trigger( "ajaxStop" );
+				}
+			}
+		}
+
+		return jqXHR;
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get( url, data, callback, "json" );
+	},
+
+	getScript: function( url, callback ) {
+		return jQuery.get( url, undefined, callback, "script" );
+	}
+} );
+
+jQuery.each( [ "get", "post" ], function( _i, method ) {
+	jQuery[ method ] = function( url, data, callback, type ) {
+
+		// Shift arguments if data argument was omitted
+		if ( isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = undefined;
+		}
+
+		// The url can be an options object (which then must have .url)
+		return jQuery.ajax( jQuery.extend( {
+			url: url,
+			type: method,
+			dataType: type,
+			data: data,
+			success: callback
+		}, jQuery.isPlainObject( url ) && url ) );
+	};
+} );
+
+jQuery.ajaxPrefilter( function( s ) {
+	var i;
+	for ( i in s.headers ) {
+		if ( i.toLowerCase() === "content-type" ) {
+			s.contentType = s.headers[ i ] || "";
+		}
+	}
+} );
+
+
+jQuery._evalUrl = function( url, options, doc ) {
+	return jQuery.ajax( {
+		url: url,
+
+		// Make this explicit, since user can override this through ajaxSetup (trac-11264)
+		type: "GET",
+		dataType: "script",
+		cache: true,
+		async: false,
+		global: false,
+
+		// Only evaluate the response if it is successful (gh-4126)
+		// dataFilter is not invoked for failure responses, so using it instead
+		// of the default converter is kludgy but it works.
+		converters: {
+			"text script": function() {}
+		},
+		dataFilter: function( response ) {
+			jQuery.globalEval( response, options, doc );
+		}
+	} );
+};
+
+
+jQuery.fn.extend( {
+	wrapAll: function( html ) {
+		var wrap;
+
+		if ( this[ 0 ] ) {
+			if ( isFunction( html ) ) {
+				html = html.call( this[ 0 ] );
+			}
+
+			// The elements to wrap the target around
+			wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
+
+			if ( this[ 0 ].parentNode ) {
+				wrap.insertBefore( this[ 0 ] );
+			}
+
+			wrap.map( function() {
+				var elem = this;
+
+				while ( elem.firstElementChild ) {
+					elem = elem.firstElementChild;
+				}
+
+				return elem;
+			} ).append( this );
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( isFunction( html ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).wrapInner( html.call( this, i ) );
+			} );
+		}
+
+		return this.each( function() {
+			var self = jQuery( this ),
+				contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		} );
+	},
+
+	wrap: function( html ) {
+		var htmlIsFunction = isFunction( html );
+
+		return this.each( function( i ) {
+			jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html );
+		} );
+	},
+
+	unwrap: function( selector ) {
+		this.parent( selector ).not( "body" ).each( function() {
+			jQuery( this ).replaceWith( this.childNodes );
+		} );
+		return this;
+	}
+} );
+
+
+jQuery.expr.pseudos.hidden = function( elem ) {
+	return !jQuery.expr.pseudos.visible( elem );
+};
+jQuery.expr.pseudos.visible = function( elem ) {
+	return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );
+};
+
+
+
+
+jQuery.ajaxSettings.xhr = function() {
+	try {
+		return new window.XMLHttpRequest();
+	} catch ( e ) {}
+};
+
+var xhrSuccessStatus = {
+
+		// File protocol always yields status code 0, assume 200
+		0: 200,
+
+		// Support: IE <=9 only
+		// trac-1450: sometimes IE returns 1223 when it should be 204
+		1223: 204
+	},
+	xhrSupported = jQuery.ajaxSettings.xhr();
+
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+support.ajax = xhrSupported = !!xhrSupported;
+
+jQuery.ajaxTransport( function( options ) {
+	var callback, errorCallback;
+
+	// Cross domain only allowed if supported through XMLHttpRequest
+	if ( support.cors || xhrSupported && !options.crossDomain ) {
+		return {
+			send: function( headers, complete ) {
+				var i,
+					xhr = options.xhr();
+
+				xhr.open(
+					options.type,
+					options.url,
+					options.async,
+					options.username,
+					options.password
+				);
+
+				// Apply custom fields if provided
+				if ( options.xhrFields ) {
+					for ( i in options.xhrFields ) {
+						xhr[ i ] = options.xhrFields[ i ];
+					}
+				}
+
+				// Override mime type if needed
+				if ( options.mimeType && xhr.overrideMimeType ) {
+					xhr.overrideMimeType( options.mimeType );
+				}
+
+				// X-Requested-With header
+				// For cross-domain requests, seeing as conditions for a preflight are
+				// akin to a jigsaw puzzle, we simply never set it to be sure.
+				// (it can always be set on a per-request basis or even using ajaxSetup)
+				// For same-domain requests, won't change header if already provided.
+				if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
+					headers[ "X-Requested-With" ] = "XMLHttpRequest";
+				}
+
+				// Set headers
+				for ( i in headers ) {
+					xhr.setRequestHeader( i, headers[ i ] );
+				}
+
+				// Callback
+				callback = function( type ) {
+					return function() {
+						if ( callback ) {
+							callback = errorCallback = xhr.onload =
+								xhr.onerror = xhr.onabort = xhr.ontimeout =
+									xhr.onreadystatechange = null;
+
+							if ( type === "abort" ) {
+								xhr.abort();
+							} else if ( type === "error" ) {
+
+								// Support: IE <=9 only
+								// On a manual native abort, IE9 throws
+								// errors on any property access that is not readyState
+								if ( typeof xhr.status !== "number" ) {
+									complete( 0, "error" );
+								} else {
+									complete(
+
+										// File: protocol always yields status 0; see trac-8605, trac-14207
+										xhr.status,
+										xhr.statusText
+									);
+								}
+							} else {
+								complete(
+									xhrSuccessStatus[ xhr.status ] || xhr.status,
+									xhr.statusText,
+
+									// Support: IE <=9 only
+									// IE9 has no XHR2 but throws on binary (trac-11426)
+									// For XHR2 non-text, let the caller handle it (gh-2498)
+									( xhr.responseType || "text" ) !== "text"  ||
+									typeof xhr.responseText !== "string" ?
+										{ binary: xhr.response } :
+										{ text: xhr.responseText },
+									xhr.getAllResponseHeaders()
+								);
+							}
+						}
+					};
+				};
+
+				// Listen to events
+				xhr.onload = callback();
+				errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" );
+
+				// Support: IE 9 only
+				// Use onreadystatechange to replace onabort
+				// to handle uncaught aborts
+				if ( xhr.onabort !== undefined ) {
+					xhr.onabort = errorCallback;
+				} else {
+					xhr.onreadystatechange = function() {
+
+						// Check readyState before timeout as it changes
+						if ( xhr.readyState === 4 ) {
+
+							// Allow onerror to be called first,
+							// but that will not handle a native abort
+							// Also, save errorCallback to a variable
+							// as xhr.onerror cannot be accessed
+							window.setTimeout( function() {
+								if ( callback ) {
+									errorCallback();
+								}
+							} );
+						}
+					};
+				}
+
+				// Create the abort callback
+				callback = callback( "abort" );
+
+				try {
+
+					// Do send the request (this may raise an exception)
+					xhr.send( options.hasContent && options.data || null );
+				} catch ( e ) {
+
+					// trac-14683: Only rethrow if this hasn't been notified as an error yet
+					if ( callback ) {
+						throw e;
+					}
+				}
+			},
+
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
+jQuery.ajaxPrefilter( function( s ) {
+	if ( s.crossDomain ) {
+		s.contents.script = false;
+	}
+} );
+
+// Install script dataType
+jQuery.ajaxSetup( {
+	accepts: {
+		script: "text/javascript, application/javascript, " +
+			"application/ecmascript, application/x-ecmascript"
+	},
+	contents: {
+		script: /\b(?:java|ecma)script\b/
+	},
+	converters: {
+		"text script": function( text ) {
+			jQuery.globalEval( text );
+			return text;
+		}
+	}
+} );
+
+// Handle cache's special case and crossDomain
+jQuery.ajaxPrefilter( "script", function( s ) {
+	if ( s.cache === undefined ) {
+		s.cache = false;
+	}
+	if ( s.crossDomain ) {
+		s.type = "GET";
+	}
+} );
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function( s ) {
+
+	// This transport only deals with cross domain or forced-by-attrs requests
+	if ( s.crossDomain || s.scriptAttrs ) {
+		var script, callback;
+		return {
+			send: function( _, complete ) {
+				script = jQuery( "<script>" )
+					.attr( s.scriptAttrs || {} )
+					.prop( { charset: s.scriptCharset, src: s.url } )
+					.on( "load error", callback = function( evt ) {
+						script.remove();
+						callback = null;
+						if ( evt ) {
+							complete( evt.type === "error" ? 404 : 200, evt.type );
+						}
+					} );
+
+				// Use native DOM manipulation to avoid our domManip AJAX trickery
+				document.head.appendChild( script[ 0 ] );
+			},
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+var oldCallbacks = [],
+	rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup( {
+	jsonp: "callback",
+	jsonpCallback: function() {
+		var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce.guid++ ) );
+		this[ callback ] = true;
+		return callback;
+	}
+} );
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+	var callbackName, overwritten, responseContainer,
+		jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+			"url" :
+			typeof s.data === "string" &&
+				( s.contentType || "" )
+					.indexOf( "application/x-www-form-urlencoded" ) === 0 &&
+				rjsonp.test( s.data ) && "data"
+		);
+
+	// Handle iff the expected data type is "jsonp" or we have a parameter to set
+	if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+		// Get callback name, remembering preexisting value associated with it
+		callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ?
+			s.jsonpCallback() :
+			s.jsonpCallback;
+
+		// Insert callback into url or form data
+		if ( jsonProp ) {
+			s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+		} else if ( s.jsonp !== false ) {
+			s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+		}
+
+		// Use data converter to retrieve json after script execution
+		s.converters[ "script json" ] = function() {
+			if ( !responseContainer ) {
+				jQuery.error( callbackName + " was not called" );
+			}
+			return responseContainer[ 0 ];
+		};
+
+		// Force json dataType
+		s.dataTypes[ 0 ] = "json";
+
+		// Install callback
+		overwritten = window[ callbackName ];
+		window[ callbackName ] = function() {
+			responseContainer = arguments;
+		};
+
+		// Clean-up function (fires after converters)
+		jqXHR.always( function() {
+
+			// If previous value didn't exist - remove it
+			if ( overwritten === undefined ) {
+				jQuery( window ).removeProp( callbackName );
+
+			// Otherwise restore preexisting value
+			} else {
+				window[ callbackName ] = overwritten;
+			}
+
+			// Save back as free
+			if ( s[ callbackName ] ) {
+
+				// Make sure that re-using the options doesn't screw things around
+				s.jsonpCallback = originalSettings.jsonpCallback;
+
+				// Save the callback name for future use
+				oldCallbacks.push( callbackName );
+			}
+
+			// Call if it was a function and we have a response
+			if ( responseContainer && isFunction( overwritten ) ) {
+				overwritten( responseContainer[ 0 ] );
+			}
+
+			responseContainer = overwritten = undefined;
+		} );
+
+		// Delegate to script
+		return "script";
+	}
+} );
+
+
+
+
+// Support: Safari 8 only
+// In Safari 8 documents created via document.implementation.createHTMLDocument
+// collapse sibling forms: the second one becomes a child of the first one.
+// Because of that, this security measure has to be disabled in Safari 8.
+// https://bugs.webkit.org/show_bug.cgi?id=137337
+support.createHTMLDocument = ( function() {
+	var body = document.implementation.createHTMLDocument( "" ).body;
+	body.innerHTML = "<form></form><form></form>";
+	return body.childNodes.length === 2;
+} )();
+
+
+// Argument "data" should be string of html
+// context (optional): If specified, the fragment will be created in this context,
+// defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+	if ( typeof data !== "string" ) {
+		return [];
+	}
+	if ( typeof context === "boolean" ) {
+		keepScripts = context;
+		context = false;
+	}
+
+	var base, parsed, scripts;
+
+	if ( !context ) {
+
+		// Stop scripts or inline event handlers from being executed immediately
+		// by using document.implementation
+		if ( support.createHTMLDocument ) {
+			context = document.implementation.createHTMLDocument( "" );
+
+			// Set the base href for the created document
+			// so any parsed elements with URLs
+			// are based on the document's URL (gh-2965)
+			base = context.createElement( "base" );
+			base.href = document.location.href;
+			context.head.appendChild( base );
+		} else {
+			context = document;
+		}
+	}
+
+	parsed = rsingleTag.exec( data );
+	scripts = !keepScripts && [];
+
+	// Single tag
+	if ( parsed ) {
+		return [ context.createElement( parsed[ 1 ] ) ];
+	}
+
+	parsed = buildFragment( [ data ], context, scripts );
+
+	if ( scripts && scripts.length ) {
+		jQuery( scripts ).remove();
+	}
+
+	return jQuery.merge( [], parsed.childNodes );
+};
+
+
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+	var selector, type, response,
+		self = this,
+		off = url.indexOf( " " );
+
+	if ( off > -1 ) {
+		selector = stripAndCollapse( url.slice( off ) );
+		url = url.slice( 0, off );
+	}
+
+	// If it's a function
+	if ( isFunction( params ) ) {
+
+		// We assume that it's the callback
+		callback = params;
+		params = undefined;
+
+	// Otherwise, build a param string
+	} else if ( params && typeof params === "object" ) {
+		type = "POST";
+	}
+
+	// If we have elements to modify, make the request
+	if ( self.length > 0 ) {
+		jQuery.ajax( {
+			url: url,
+
+			// If "type" variable is undefined, then "GET" method will be used.
+			// Make value of this field explicit since
+			// user can override it through ajaxSetup method
+			type: type || "GET",
+			dataType: "html",
+			data: params
+		} ).done( function( responseText ) {
+
+			// Save response for use in complete callback
+			response = arguments;
+
+			self.html( selector ?
+
+				// If a selector was specified, locate the right elements in a dummy div
+				// Exclude scripts to avoid IE 'Permission Denied' errors
+				jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+				// Otherwise use the full result
+				responseText );
+
+		// If the request succeeds, this function gets "data", "status", "jqXHR"
+		// but they are ignored because response was set above.
+		// If it fails, this function gets "jqXHR", "status", "error"
+		} ).always( callback && function( jqXHR, status ) {
+			self.each( function() {
+				callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
+			} );
+		} );
+	}
+
+	return this;
+};
+
+
+
+
+jQuery.expr.pseudos.animated = function( elem ) {
+	return jQuery.grep( jQuery.timers, function( fn ) {
+		return elem === fn.elem;
+	} ).length;
+};
+
+
+
+
+jQuery.offset = {
+	setOffset: function( elem, options, i ) {
+		var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+			position = jQuery.css( elem, "position" ),
+			curElem = jQuery( elem ),
+			props = {};
+
+		// Set position first, in-case top/left are set even on static elem
+		if ( position === "static" ) {
+			elem.style.position = "relative";
+		}
+
+		curOffset = curElem.offset();
+		curCSSTop = jQuery.css( elem, "top" );
+		curCSSLeft = jQuery.css( elem, "left" );
+		calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+			( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
+
+		// Need to be able to calculate position if either
+		// top or left is auto and position is either absolute or fixed
+		if ( calculatePosition ) {
+			curPosition = curElem.position();
+			curTop = curPosition.top;
+			curLeft = curPosition.left;
+
+		} else {
+			curTop = parseFloat( curCSSTop ) || 0;
+			curLeft = parseFloat( curCSSLeft ) || 0;
+		}
+
+		if ( isFunction( options ) ) {
+
+			// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
+			options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
+		}
+
+		if ( options.top != null ) {
+			props.top = ( options.top - curOffset.top ) + curTop;
+		}
+		if ( options.left != null ) {
+			props.left = ( options.left - curOffset.left ) + curLeft;
+		}
+
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+
+		} else {
+			curElem.css( props );
+		}
+	}
+};
+
+jQuery.fn.extend( {
+
+	// offset() relates an element's border box to the document origin
+	offset: function( options ) {
+
+		// Preserve chaining for setter
+		if ( arguments.length ) {
+			return options === undefined ?
+				this :
+				this.each( function( i ) {
+					jQuery.offset.setOffset( this, options, i );
+				} );
+		}
+
+		var rect, win,
+			elem = this[ 0 ];
+
+		if ( !elem ) {
+			return;
+		}
+
+		// Return zeros for disconnected and hidden (display: none) elements (gh-2310)
+		// Support: IE <=11 only
+		// Running getBoundingClientRect on a
+		// disconnected node in IE throws an error
+		if ( !elem.getClientRects().length ) {
+			return { top: 0, left: 0 };
+		}
+
+		// Get document-relative position by adding viewport scroll to viewport-relative gBCR
+		rect = elem.getBoundingClientRect();
+		win = elem.ownerDocument.defaultView;
+		return {
+			top: rect.top + win.pageYOffset,
+			left: rect.left + win.pageXOffset
+		};
+	},
+
+	// position() relates an element's margin box to its offset parent's padding box
+	// This corresponds to the behavior of CSS absolute positioning
+	position: function() {
+		if ( !this[ 0 ] ) {
+			return;
+		}
+
+		var offsetParent, offset, doc,
+			elem = this[ 0 ],
+			parentOffset = { top: 0, left: 0 };
+
+		// position:fixed elements are offset from the viewport, which itself always has zero offset
+		if ( jQuery.css( elem, "position" ) === "fixed" ) {
+
+			// Assume position:fixed implies availability of getBoundingClientRect
+			offset = elem.getBoundingClientRect();
+
+		} else {
+			offset = this.offset();
+
+			// Account for the *real* offset parent, which can be the document or its root element
+			// when a statically positioned element is identified
+			doc = elem.ownerDocument;
+			offsetParent = elem.offsetParent || doc.documentElement;
+			while ( offsetParent &&
+				( offsetParent === doc.body || offsetParent === doc.documentElement ) &&
+				jQuery.css( offsetParent, "position" ) === "static" ) {
+
+				offsetParent = offsetParent.parentNode;
+			}
+			if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) {
+
+				// Incorporate borders into its offset, since they are outside its content origin
+				parentOffset = jQuery( offsetParent ).offset();
+				parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true );
+				parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true );
+			}
+		}
+
+		// Subtract parent offsets and element margins
+		return {
+			top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+			left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
+		};
+	},
+
+	// This method will return documentElement in the following cases:
+	// 1) For the element inside the iframe without offsetParent, this method will return
+	//    documentElement of the parent window
+	// 2) For the hidden or detached element
+	// 3) For body or html element, i.e. in case of the html node - it will return itself
+	//
+	// but those exceptions were never presented as a real life use-cases
+	// and might be considered as more preferable results.
+	//
+	// This logic, however, is not guaranteed and can change at any point in the future
+	offsetParent: function() {
+		return this.map( function() {
+			var offsetParent = this.offsetParent;
+
+			while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+
+			return offsetParent || documentElement;
+		} );
+	}
+} );
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
+	var top = "pageYOffset" === prop;
+
+	jQuery.fn[ method ] = function( val ) {
+		return access( this, function( elem, method, val ) {
+
+			// Coalesce documents and windows
+			var win;
+			if ( isWindow( elem ) ) {
+				win = elem;
+			} else if ( elem.nodeType === 9 ) {
+				win = elem.defaultView;
+			}
+
+			if ( val === undefined ) {
+				return win ? win[ prop ] : elem[ method ];
+			}
+
+			if ( win ) {
+				win.scrollTo(
+					!top ? val : win.pageXOffset,
+					top ? val : win.pageYOffset
+				);
+
+			} else {
+				elem[ method ] = val;
+			}
+		}, method, val, arguments.length );
+	};
+} );
+
+// Support: Safari <=7 - 9.1, Chrome <=37 - 49
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
+// getComputedStyle returns percent when specified for top/left/bottom/right;
+// rather than make the css module depend on the offset module, just check for it here
+jQuery.each( [ "top", "left" ], function( _i, prop ) {
+	jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+		function( elem, computed ) {
+			if ( computed ) {
+				computed = curCSS( elem, prop );
+
+				// If curCSS returns percentage, fallback to offset
+				return rnumnonpx.test( computed ) ?
+					jQuery( elem ).position()[ prop ] + "px" :
+					computed;
+			}
+		}
+	);
+} );
+
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+	jQuery.each( {
+		padding: "inner" + name,
+		content: type,
+		"": "outer" + name
+	}, function( defaultExtra, funcName ) {
+
+		// Margin is only for outerHeight, outerWidth
+		jQuery.fn[ funcName ] = function( margin, value ) {
+			var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+				extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+			return access( this, function( elem, type, value ) {
+				var doc;
+
+				if ( isWindow( elem ) ) {
+
+					// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
+					return funcName.indexOf( "outer" ) === 0 ?
+						elem[ "inner" + name ] :
+						elem.document.documentElement[ "client" + name ];
+				}
+
+				// Get document width or height
+				if ( elem.nodeType === 9 ) {
+					doc = elem.documentElement;
+
+					// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
+					// whichever is greatest
+					return Math.max(
+						elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+						elem.body[ "offset" + name ], doc[ "offset" + name ],
+						doc[ "client" + name ]
+					);
+				}
+
+				return value === undefined ?
+
+					// Get width or height on the element, requesting but not forcing parseFloat
+					jQuery.css( elem, type, extra ) :
+
+					// Set width or height on the element
+					jQuery.style( elem, type, value, extra );
+			}, type, chainable ? margin : undefined, chainable );
+		};
+	} );
+} );
+
+
+jQuery.each( [
+	"ajaxStart",
+	"ajaxStop",
+	"ajaxComplete",
+	"ajaxError",
+	"ajaxSuccess",
+	"ajaxSend"
+], function( _i, type ) {
+	jQuery.fn[ type ] = function( fn ) {
+		return this.on( type, fn );
+	};
+} );
+
+
+
+
+jQuery.fn.extend( {
+
+	bind: function( types, data, fn ) {
+		return this.on( types, null, data, fn );
+	},
+	unbind: function( types, fn ) {
+		return this.off( types, null, fn );
+	},
+
+	delegate: function( selector, types, data, fn ) {
+		return this.on( types, selector, data, fn );
+	},
+	undelegate: function( selector, types, fn ) {
+
+		// ( namespace ) or ( selector, types [, fn] )
+		return arguments.length === 1 ?
+			this.off( selector, "**" ) :
+			this.off( types, selector || "**", fn );
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this
+			.on( "mouseenter", fnOver )
+			.on( "mouseleave", fnOut || fnOver );
+	}
+} );
+
+jQuery.each(
+	( "blur focus focusin focusout resize scroll click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup contextmenu" ).split( " " ),
+	function( _i, name ) {
+
+		// Handle event binding
+		jQuery.fn[ name ] = function( data, fn ) {
+			return arguments.length > 0 ?
+				this.on( name, null, data, fn ) :
+				this.trigger( name );
+		};
+	}
+);
+
+
+
+
+// Support: Android <=4.0 only
+// Make sure we trim BOM and NBSP
+// Require that the "whitespace run" starts from a non-whitespace
+// to avoid O(N^2) behavior when the engine would try matching "\s+$" at each space position.
+var rtrim = /^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;
+
+// Bind a function to a context, optionally partially applying any
+// arguments.
+// jQuery.proxy is deprecated to promote standards (specifically Function#bind)
+// However, it is not slated for removal any time soon
+jQuery.proxy = function( fn, context ) {
+	var tmp, args, proxy;
+
+	if ( typeof context === "string" ) {
+		tmp = fn[ context ];
+		context = fn;
+		fn = tmp;
+	}
+
+	// Quick check to determine if target is callable, in the spec
+	// this throws a TypeError, but we will just return undefined.
+	if ( !isFunction( fn ) ) {
+		return undefined;
+	}
+
+	// Simulated bind
+	args = slice.call( arguments, 2 );
+	proxy = function() {
+		return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+	};
+
+	// Set the guid of unique handler to the same of original handler, so it can be removed
+	proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+	return proxy;
+};
+
+jQuery.holdReady = function( hold ) {
+	if ( hold ) {
+		jQuery.readyWait++;
+	} else {
+		jQuery.ready( true );
+	}
+};
+jQuery.isArray = Array.isArray;
+jQuery.parseJSON = JSON.parse;
+jQuery.nodeName = nodeName;
+jQuery.isFunction = isFunction;
+jQuery.isWindow = isWindow;
+jQuery.camelCase = camelCase;
+jQuery.type = toType;
+
+jQuery.now = Date.now;
+
+jQuery.isNumeric = function( obj ) {
+
+	// As of jQuery 3.0, isNumeric is limited to
+	// strings and numbers (primitives or objects)
+	// that can be coerced to finite numbers (gh-2662)
+	var type = jQuery.type( obj );
+	return ( type === "number" || type === "string" ) &&
+
+		// parseFloat NaNs numeric-cast false positives ("")
+		// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+		// subtraction forces infinities to NaN
+		!isNaN( obj - parseFloat( obj ) );
+};
+
+jQuery.trim = function( text ) {
+	return text == null ?
+		"" :
+		( text + "" ).replace( rtrim, "$1" );
+};
+
+
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+
+// Note that for maximum portability, libraries that are not jQuery should
+// declare themselves as anonymous modules, and avoid setting a global if an
+// AMD loader is present. jQuery is a special case. For more information, see
+// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
+
+if ( typeof define === "function" && define.amd ) {
+	define( "jquery", [], function() {
+		return jQuery;
+	} );
+}
+
+
+
+
+var
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+	if ( window.$ === jQuery ) {
+		window.$ = _$;
+	}
+
+	if ( deep && window.jQuery === jQuery ) {
+		window.jQuery = _jQuery;
+	}
+
+	return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in AMD
+// (trac-7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (trac-13566)
+if ( typeof noGlobal === "undefined" ) {
+	window.jQuery = window.$ = jQuery;
+}
+
+
+
+
+return jQuery;
+} );
diff --git a/WebContentt/public/assets/js/socket.io.js b/WebContentt/public/assets/js/socket.io.js
new file mode 100644
index 0000000..b62e478
--- /dev/null
+++ b/WebContentt/public/assets/js/socket.io.js
@@ -0,0 +1,4908 @@
+/*!
+ * Socket.IO v4.8.1
+ * (c) 2014-2024 Guillermo Rauch
+ * Released under the MIT License.
+ */
+(function (global, factory) {
+  typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+  typeof define === 'function' && define.amd ? define(factory) :
+  (global = typeof globalThis !== 'undefined' ? globalThis : global || self, global.io = factory());
+})(this, (function () { 'use strict';
+
+  function _arrayLikeToArray(r, a) {
+    (null == a || a > r.length) && (a = r.length);
+    for (var e = 0, n = Array(a); e < a; e++) n[e] = r[e];
+    return n;
+  }
+  function _arrayWithoutHoles(r) {
+    if (Array.isArray(r)) return _arrayLikeToArray(r);
+  }
+  function _construct(t, e, r) {
+    if (_isNativeReflectConstruct()) return Reflect.construct.apply(null, arguments);
+    var o = [null];
+    o.push.apply(o, e);
+    var p = new (t.bind.apply(t, o))();
+    return r && _setPrototypeOf(p, r.prototype), p;
+  }
+  function _defineProperties(e, r) {
+    for (var t = 0; t < r.length; t++) {
+      var o = r[t];
+      o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(e, _toPropertyKey(o.key), o);
+    }
+  }
+  function _createClass(e, r, t) {
+    return r && _defineProperties(e.prototype, r), t && _defineProperties(e, t), Object.defineProperty(e, "prototype", {
+      writable: !1
+    }), e;
+  }
+  function _createForOfIteratorHelper(r, e) {
+    var t = "undefined" != typeof Symbol && r[Symbol.iterator] || r["@@iterator"];
+    if (!t) {
+      if (Array.isArray(r) || (t = _unsupportedIterableToArray(r)) || e && r && "number" == typeof r.length) {
+        t && (r = t);
+        var n = 0,
+          F = function () {};
+        return {
+          s: F,
+          n: function () {
+            return n >= r.length ? {
+              done: !0
+            } : {
+              done: !1,
+              value: r[n++]
+            };
+          },
+          e: function (r) {
+            throw r;
+          },
+          f: F
+        };
+      }
+      throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+    }
+    var o,
+      a = !0,
+      u = !1;
+    return {
+      s: function () {
+        t = t.call(r);
+      },
+      n: function () {
+        var r = t.next();
+        return a = r.done, r;
+      },
+      e: function (r) {
+        u = !0, o = r;
+      },
+      f: function () {
+        try {
+          a || null == t.return || t.return();
+        } finally {
+          if (u) throw o;
+        }
+      }
+    };
+  }
+  function _extends() {
+    return _extends = Object.assign ? Object.assign.bind() : function (n) {
+      for (var e = 1; e < arguments.length; e++) {
+        var t = arguments[e];
+        for (var r in t) ({}).hasOwnProperty.call(t, r) && (n[r] = t[r]);
+      }
+      return n;
+    }, _extends.apply(null, arguments);
+  }
+  function _getPrototypeOf(t) {
+    return _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf.bind() : function (t) {
+      return t.__proto__ || Object.getPrototypeOf(t);
+    }, _getPrototypeOf(t);
+  }
+  function _inheritsLoose(t, o) {
+    t.prototype = Object.create(o.prototype), t.prototype.constructor = t, _setPrototypeOf(t, o);
+  }
+  function _isNativeFunction(t) {
+    try {
+      return -1 !== Function.toString.call(t).indexOf("[native code]");
+    } catch (n) {
+      return "function" == typeof t;
+    }
+  }
+  function _isNativeReflectConstruct() {
+    try {
+      var t = !Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {}));
+    } catch (t) {}
+    return (_isNativeReflectConstruct = function () {
+      return !!t;
+    })();
+  }
+  function _iterableToArray(r) {
+    if ("undefined" != typeof Symbol && null != r[Symbol.iterator] || null != r["@@iterator"]) return Array.from(r);
+  }
+  function _nonIterableSpread() {
+    throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
+  }
+  function _setPrototypeOf(t, e) {
+    return _setPrototypeOf = Object.setPrototypeOf ? Object.setPrototypeOf.bind() : function (t, e) {
+      return t.__proto__ = e, t;
+    }, _setPrototypeOf(t, e);
+  }
+  function _toConsumableArray(r) {
+    return _arrayWithoutHoles(r) || _iterableToArray(r) || _unsupportedIterableToArray(r) || _nonIterableSpread();
+  }
+  function _toPrimitive(t, r) {
+    if ("object" != typeof t || !t) return t;
+    var e = t[Symbol.toPrimitive];
+    if (void 0 !== e) {
+      var i = e.call(t, r || "default");
+      if ("object" != typeof i) return i;
+      throw new TypeError("@@toPrimitive must return a primitive value.");
+    }
+    return ("string" === r ? String : Number)(t);
+  }
+  function _toPropertyKey(t) {
+    var i = _toPrimitive(t, "string");
+    return "symbol" == typeof i ? i : i + "";
+  }
+  function _typeof(o) {
+    "@babel/helpers - typeof";
+
+    return _typeof = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (o) {
+      return typeof o;
+    } : function (o) {
+      return o && "function" == typeof Symbol && o.constructor === Symbol && o !== Symbol.prototype ? "symbol" : typeof o;
+    }, _typeof(o);
+  }
+  function _unsupportedIterableToArray(r, a) {
+    if (r) {
+      if ("string" == typeof r) return _arrayLikeToArray(r, a);
+      var t = {}.toString.call(r).slice(8, -1);
+      return "Object" === t && r.constructor && (t = r.constructor.name), "Map" === t || "Set" === t ? Array.from(r) : "Arguments" === t || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(t) ? _arrayLikeToArray(r, a) : void 0;
+    }
+  }
+  function _wrapNativeSuper(t) {
+    var r = "function" == typeof Map ? new Map() : void 0;
+    return _wrapNativeSuper = function (t) {
+      if (null === t || !_isNativeFunction(t)) return t;
+      if ("function" != typeof t) throw new TypeError("Super expression must either be null or a function");
+      if (void 0 !== r) {
+        if (r.has(t)) return r.get(t);
+        r.set(t, Wrapper);
+      }
+      function Wrapper() {
+        return _construct(t, arguments, _getPrototypeOf(this).constructor);
+      }
+      return Wrapper.prototype = Object.create(t.prototype, {
+        constructor: {
+          value: Wrapper,
+          enumerable: !1,
+          writable: !0,
+          configurable: !0
+        }
+      }), _setPrototypeOf(Wrapper, t);
+    }, _wrapNativeSuper(t);
+  }
+
+  var PACKET_TYPES = Object.create(null); // no Map = no polyfill
+  PACKET_TYPES["open"] = "0";
+  PACKET_TYPES["close"] = "1";
+  PACKET_TYPES["ping"] = "2";
+  PACKET_TYPES["pong"] = "3";
+  PACKET_TYPES["message"] = "4";
+  PACKET_TYPES["upgrade"] = "5";
+  PACKET_TYPES["noop"] = "6";
+  var PACKET_TYPES_REVERSE = Object.create(null);
+  Object.keys(PACKET_TYPES).forEach(function (key) {
+    PACKET_TYPES_REVERSE[PACKET_TYPES[key]] = key;
+  });
+  var ERROR_PACKET = {
+    type: "error",
+    data: "parser error"
+  };
+
+  var withNativeBlob$1 = typeof Blob === "function" || typeof Blob !== "undefined" && Object.prototype.toString.call(Blob) === "[object BlobConstructor]";
+  var withNativeArrayBuffer$2 = typeof ArrayBuffer === "function";
+  // ArrayBuffer.isView method is not defined in IE10
+  var isView$1 = function isView(obj) {
+    return typeof ArrayBuffer.isView === "function" ? ArrayBuffer.isView(obj) : obj && obj.buffer instanceof ArrayBuffer;
+  };
+  var encodePacket = function encodePacket(_ref, supportsBinary, callback) {
+    var type = _ref.type,
+      data = _ref.data;
+    if (withNativeBlob$1 && data instanceof Blob) {
+      if (supportsBinary) {
+        return callback(data);
+      } else {
+        return encodeBlobAsBase64(data, callback);
+      }
+    } else if (withNativeArrayBuffer$2 && (data instanceof ArrayBuffer || isView$1(data))) {
+      if (supportsBinary) {
+        return callback(data);
+      } else {
+        return encodeBlobAsBase64(new Blob([data]), callback);
+      }
+    }
+    // plain string
+    return callback(PACKET_TYPES[type] + (data || ""));
+  };
+  var encodeBlobAsBase64 = function encodeBlobAsBase64(data, callback) {
+    var fileReader = new FileReader();
+    fileReader.onload = function () {
+      var content = fileReader.result.split(",")[1];
+      callback("b" + (content || ""));
+    };
+    return fileReader.readAsDataURL(data);
+  };
+  function toArray(data) {
+    if (data instanceof Uint8Array) {
+      return data;
+    } else if (data instanceof ArrayBuffer) {
+      return new Uint8Array(data);
+    } else {
+      return new Uint8Array(data.buffer, data.byteOffset, data.byteLength);
+    }
+  }
+  var TEXT_ENCODER;
+  function encodePacketToBinary(packet, callback) {
+    if (withNativeBlob$1 && packet.data instanceof Blob) {
+      return packet.data.arrayBuffer().then(toArray).then(callback);
+    } else if (withNativeArrayBuffer$2 && (packet.data instanceof ArrayBuffer || isView$1(packet.data))) {
+      return callback(toArray(packet.data));
+    }
+    encodePacket(packet, false, function (encoded) {
+      if (!TEXT_ENCODER) {
+        TEXT_ENCODER = new TextEncoder();
+      }
+      callback(TEXT_ENCODER.encode(encoded));
+    });
+  }
+
+  // imported from https://github.com/socketio/base64-arraybuffer
+  var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+  // Use a lookup table to find the index.
+  var lookup$1 = typeof Uint8Array === 'undefined' ? [] : new Uint8Array(256);
+  for (var i = 0; i < chars.length; i++) {
+    lookup$1[chars.charCodeAt(i)] = i;
+  }
+  var decode$1 = function decode(base64) {
+    var bufferLength = base64.length * 0.75,
+      len = base64.length,
+      i,
+      p = 0,
+      encoded1,
+      encoded2,
+      encoded3,
+      encoded4;
+    if (base64[base64.length - 1] === '=') {
+      bufferLength--;
+      if (base64[base64.length - 2] === '=') {
+        bufferLength--;
+      }
+    }
+    var arraybuffer = new ArrayBuffer(bufferLength),
+      bytes = new Uint8Array(arraybuffer);
+    for (i = 0; i < len; i += 4) {
+      encoded1 = lookup$1[base64.charCodeAt(i)];
+      encoded2 = lookup$1[base64.charCodeAt(i + 1)];
+      encoded3 = lookup$1[base64.charCodeAt(i + 2)];
+      encoded4 = lookup$1[base64.charCodeAt(i + 3)];
+      bytes[p++] = encoded1 << 2 | encoded2 >> 4;
+      bytes[p++] = (encoded2 & 15) << 4 | encoded3 >> 2;
+      bytes[p++] = (encoded3 & 3) << 6 | encoded4 & 63;
+    }
+    return arraybuffer;
+  };
+
+  var withNativeArrayBuffer$1 = typeof ArrayBuffer === "function";
+  var decodePacket = function decodePacket(encodedPacket, binaryType) {
+    if (typeof encodedPacket !== "string") {
+      return {
+        type: "message",
+        data: mapBinary(encodedPacket, binaryType)
+      };
+    }
+    var type = encodedPacket.charAt(0);
+    if (type === "b") {
+      return {
+        type: "message",
+        data: decodeBase64Packet(encodedPacket.substring(1), binaryType)
+      };
+    }
+    var packetType = PACKET_TYPES_REVERSE[type];
+    if (!packetType) {
+      return ERROR_PACKET;
+    }
+    return encodedPacket.length > 1 ? {
+      type: PACKET_TYPES_REVERSE[type],
+      data: encodedPacket.substring(1)
+    } : {
+      type: PACKET_TYPES_REVERSE[type]
+    };
+  };
+  var decodeBase64Packet = function decodeBase64Packet(data, binaryType) {
+    if (withNativeArrayBuffer$1) {
+      var decoded = decode$1(data);
+      return mapBinary(decoded, binaryType);
+    } else {
+      return {
+        base64: true,
+        data: data
+      }; // fallback for old browsers
+    }
+  };
+  var mapBinary = function mapBinary(data, binaryType) {
+    switch (binaryType) {
+      case "blob":
+        if (data instanceof Blob) {
+          // from WebSocket + binaryType "blob"
+          return data;
+        } else {
+          // from HTTP long-polling or WebTransport
+          return new Blob([data]);
+        }
+      case "arraybuffer":
+      default:
+        if (data instanceof ArrayBuffer) {
+          // from HTTP long-polling (base64) or WebSocket + binaryType "arraybuffer"
+          return data;
+        } else {
+          // from WebTransport (Uint8Array)
+          return data.buffer;
+        }
+    }
+  };
+
+  var SEPARATOR = String.fromCharCode(30); // see https://en.wikipedia.org/wiki/Delimiter#ASCII_delimited_text
+  var encodePayload = function encodePayload(packets, callback) {
+    // some packets may be added to the array while encoding, so the initial length must be saved
+    var length = packets.length;
+    var encodedPackets = new Array(length);
+    var count = 0;
+    packets.forEach(function (packet, i) {
+      // force base64 encoding for binary packets
+      encodePacket(packet, false, function (encodedPacket) {
+        encodedPackets[i] = encodedPacket;
+        if (++count === length) {
+          callback(encodedPackets.join(SEPARATOR));
+        }
+      });
+    });
+  };
+  var decodePayload = function decodePayload(encodedPayload, binaryType) {
+    var encodedPackets = encodedPayload.split(SEPARATOR);
+    var packets = [];
+    for (var i = 0; i < encodedPackets.length; i++) {
+      var decodedPacket = decodePacket(encodedPackets[i], binaryType);
+      packets.push(decodedPacket);
+      if (decodedPacket.type === "error") {
+        break;
+      }
+    }
+    return packets;
+  };
+  function createPacketEncoderStream() {
+    return new TransformStream({
+      transform: function transform(packet, controller) {
+        encodePacketToBinary(packet, function (encodedPacket) {
+          var payloadLength = encodedPacket.length;
+          var header;
+          // inspired by the WebSocket format: https://developer.mozilla.org/en-US/docs/Web/API/WebSockets_API/Writing_WebSocket_servers#decoding_payload_length
+          if (payloadLength < 126) {
+            header = new Uint8Array(1);
+            new DataView(header.buffer).setUint8(0, payloadLength);
+          } else if (payloadLength < 65536) {
+            header = new Uint8Array(3);
+            var view = new DataView(header.buffer);
+            view.setUint8(0, 126);
+            view.setUint16(1, payloadLength);
+          } else {
+            header = new Uint8Array(9);
+            var _view = new DataView(header.buffer);
+            _view.setUint8(0, 127);
+            _view.setBigUint64(1, BigInt(payloadLength));
+          }
+          // first bit indicates whether the payload is plain text (0) or binary (1)
+          if (packet.data && typeof packet.data !== "string") {
+            header[0] |= 0x80;
+          }
+          controller.enqueue(header);
+          controller.enqueue(encodedPacket);
+        });
+      }
+    });
+  }
+  var TEXT_DECODER;
+  function totalLength(chunks) {
+    return chunks.reduce(function (acc, chunk) {
+      return acc + chunk.length;
+    }, 0);
+  }
+  function concatChunks(chunks, size) {
+    if (chunks[0].length === size) {
+      return chunks.shift();
+    }
+    var buffer = new Uint8Array(size);
+    var j = 0;
+    for (var i = 0; i < size; i++) {
+      buffer[i] = chunks[0][j++];
+      if (j === chunks[0].length) {
+        chunks.shift();
+        j = 0;
+      }
+    }
+    if (chunks.length && j < chunks[0].length) {
+      chunks[0] = chunks[0].slice(j);
+    }
+    return buffer;
+  }
+  function createPacketDecoderStream(maxPayload, binaryType) {
+    if (!TEXT_DECODER) {
+      TEXT_DECODER = new TextDecoder();
+    }
+    var chunks = [];
+    var state = 0 /* State.READ_HEADER */;
+    var expectedLength = -1;
+    var isBinary = false;
+    return new TransformStream({
+      transform: function transform(chunk, controller) {
+        chunks.push(chunk);
+        while (true) {
+          if (state === 0 /* State.READ_HEADER */) {
+            if (totalLength(chunks) < 1) {
+              break;
+            }
+            var header = concatChunks(chunks, 1);
+            isBinary = (header[0] & 0x80) === 0x80;
+            expectedLength = header[0] & 0x7f;
+            if (expectedLength < 126) {
+              state = 3 /* State.READ_PAYLOAD */;
+            } else if (expectedLength === 126) {
+              state = 1 /* State.READ_EXTENDED_LENGTH_16 */;
+            } else {
+              state = 2 /* State.READ_EXTENDED_LENGTH_64 */;
+            }
+          } else if (state === 1 /* State.READ_EXTENDED_LENGTH_16 */) {
+            if (totalLength(chunks) < 2) {
+              break;
+            }
+            var headerArray = concatChunks(chunks, 2);
+            expectedLength = new DataView(headerArray.buffer, headerArray.byteOffset, headerArray.length).getUint16(0);
+            state = 3 /* State.READ_PAYLOAD */;
+          } else if (state === 2 /* State.READ_EXTENDED_LENGTH_64 */) {
+            if (totalLength(chunks) < 8) {
+              break;
+            }
+            var _headerArray = concatChunks(chunks, 8);
+            var view = new DataView(_headerArray.buffer, _headerArray.byteOffset, _headerArray.length);
+            var n = view.getUint32(0);
+            if (n > Math.pow(2, 53 - 32) - 1) {
+              // the maximum safe integer in JavaScript is 2^53 - 1
+              controller.enqueue(ERROR_PACKET);
+              break;
+            }
+            expectedLength = n * Math.pow(2, 32) + view.getUint32(4);
+            state = 3 /* State.READ_PAYLOAD */;
+          } else {
+            if (totalLength(chunks) < expectedLength) {
+              break;
+            }
+            var data = concatChunks(chunks, expectedLength);
+            controller.enqueue(decodePacket(isBinary ? data : TEXT_DECODER.decode(data), binaryType));
+            state = 0 /* State.READ_HEADER */;
+          }
+          if (expectedLength === 0 || expectedLength > maxPayload) {
+            controller.enqueue(ERROR_PACKET);
+            break;
+          }
+        }
+      }
+    });
+  }
+  var protocol$1 = 4;
+
+  /**
+   * Initialize a new `Emitter`.
+   *
+   * @api public
+   */
+
+  function Emitter(obj) {
+    if (obj) return mixin(obj);
+  }
+
+  /**
+   * Mixin the emitter properties.
+   *
+   * @param {Object} obj
+   * @return {Object}
+   * @api private
+   */
+
+  function mixin(obj) {
+    for (var key in Emitter.prototype) {
+      obj[key] = Emitter.prototype[key];
+    }
+    return obj;
+  }
+
+  /**
+   * Listen on the given `event` with `fn`.
+   *
+   * @param {String} event
+   * @param {Function} fn
+   * @return {Emitter}
+   * @api public
+   */
+
+  Emitter.prototype.on = Emitter.prototype.addEventListener = function (event, fn) {
+    this._callbacks = this._callbacks || {};
+    (this._callbacks['$' + event] = this._callbacks['$' + event] || []).push(fn);
+    return this;
+  };
+
+  /**
+   * Adds an `event` listener that will be invoked a single
+   * time then automatically removed.
+   *
+   * @param {String} event
+   * @param {Function} fn
+   * @return {Emitter}
+   * @api public
+   */
+
+  Emitter.prototype.once = function (event, fn) {
+    function on() {
+      this.off(event, on);
+      fn.apply(this, arguments);
+    }
+    on.fn = fn;
+    this.on(event, on);
+    return this;
+  };
+
+  /**
+   * Remove the given callback for `event` or all
+   * registered callbacks.
+   *
+   * @param {String} event
+   * @param {Function} fn
+   * @return {Emitter}
+   * @api public
+   */
+
+  Emitter.prototype.off = Emitter.prototype.removeListener = Emitter.prototype.removeAllListeners = Emitter.prototype.removeEventListener = function (event, fn) {
+    this._callbacks = this._callbacks || {};
+
+    // all
+    if (0 == arguments.length) {
+      this._callbacks = {};
+      return this;
+    }
+
+    // specific event
+    var callbacks = this._callbacks['$' + event];
+    if (!callbacks) return this;
+
+    // remove all handlers
+    if (1 == arguments.length) {
+      delete this._callbacks['$' + event];
+      return this;
+    }
+
+    // remove specific handler
+    var cb;
+    for (var i = 0; i < callbacks.length; i++) {
+      cb = callbacks[i];
+      if (cb === fn || cb.fn === fn) {
+        callbacks.splice(i, 1);
+        break;
+      }
+    }
+
+    // Remove event specific arrays for event types that no
+    // one is subscribed for to avoid memory leak.
+    if (callbacks.length === 0) {
+      delete this._callbacks['$' + event];
+    }
+    return this;
+  };
+
+  /**
+   * Emit `event` with the given args.
+   *
+   * @param {String} event
+   * @param {Mixed} ...
+   * @return {Emitter}
+   */
+
+  Emitter.prototype.emit = function (event) {
+    this._callbacks = this._callbacks || {};
+    var args = new Array(arguments.length - 1),
+      callbacks = this._callbacks['$' + event];
+    for (var i = 1; i < arguments.length; i++) {
+      args[i - 1] = arguments[i];
+    }
+    if (callbacks) {
+      callbacks = callbacks.slice(0);
+      for (var i = 0, len = callbacks.length; i < len; ++i) {
+        callbacks[i].apply(this, args);
+      }
+    }
+    return this;
+  };
+
+  // alias used for reserved events (protected method)
+  Emitter.prototype.emitReserved = Emitter.prototype.emit;
+
+  /**
+   * Return array of callbacks for `event`.
+   *
+   * @param {String} event
+   * @return {Array}
+   * @api public
+   */
+
+  Emitter.prototype.listeners = function (event) {
+    this._callbacks = this._callbacks || {};
+    return this._callbacks['$' + event] || [];
+  };
+
+  /**
+   * Check if this emitter has `event` handlers.
+   *
+   * @param {String} event
+   * @return {Boolean}
+   * @api public
+   */
+
+  Emitter.prototype.hasListeners = function (event) {
+    return !!this.listeners(event).length;
+  };
+
+  var nextTick = function () {
+    var isPromiseAvailable = typeof Promise === "function" && typeof Promise.resolve === "function";
+    if (isPromiseAvailable) {
+      return function (cb) {
+        return Promise.resolve().then(cb);
+      };
+    } else {
+      return function (cb, setTimeoutFn) {
+        return setTimeoutFn(cb, 0);
+      };
+    }
+  }();
+  var globalThisShim = function () {
+    if (typeof self !== "undefined") {
+      return self;
+    } else if (typeof window !== "undefined") {
+      return window;
+    } else {
+      return Function("return this")();
+    }
+  }();
+  var defaultBinaryType = "arraybuffer";
+  function createCookieJar() {}
+
+  function pick(obj) {
+    for (var _len = arguments.length, attr = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
+      attr[_key - 1] = arguments[_key];
+    }
+    return attr.reduce(function (acc, k) {
+      if (obj.hasOwnProperty(k)) {
+        acc[k] = obj[k];
+      }
+      return acc;
+    }, {});
+  }
+  // Keep a reference to the real timeout functions so they can be used when overridden
+  var NATIVE_SET_TIMEOUT = globalThisShim.setTimeout;
+  var NATIVE_CLEAR_TIMEOUT = globalThisShim.clearTimeout;
+  function installTimerFunctions(obj, opts) {
+    if (opts.useNativeTimers) {
+      obj.setTimeoutFn = NATIVE_SET_TIMEOUT.bind(globalThisShim);
+      obj.clearTimeoutFn = NATIVE_CLEAR_TIMEOUT.bind(globalThisShim);
+    } else {
+      obj.setTimeoutFn = globalThisShim.setTimeout.bind(globalThisShim);
+      obj.clearTimeoutFn = globalThisShim.clearTimeout.bind(globalThisShim);
+    }
+  }
+  // base64 encoded buffers are about 33% bigger (https://en.wikipedia.org/wiki/Base64)
+  var BASE64_OVERHEAD = 1.33;
+  // we could also have used `new Blob([obj]).size`, but it isn't supported in IE9
+  function byteLength(obj) {
+    if (typeof obj === "string") {
+      return utf8Length(obj);
+    }
+    // arraybuffer or blob
+    return Math.ceil((obj.byteLength || obj.size) * BASE64_OVERHEAD);
+  }
+  function utf8Length(str) {
+    var c = 0,
+      length = 0;
+    for (var i = 0, l = str.length; i < l; i++) {
+      c = str.charCodeAt(i);
+      if (c < 0x80) {
+        length += 1;
+      } else if (c < 0x800) {
+        length += 2;
+      } else if (c < 0xd800 || c >= 0xe000) {
+        length += 3;
+      } else {
+        i++;
+        length += 4;
+      }
+    }
+    return length;
+  }
+  /**
+   * Generates a random 8-characters string.
+   */
+  function randomString() {
+    return Date.now().toString(36).substring(3) + Math.random().toString(36).substring(2, 5);
+  }
+
+  // imported from https://github.com/galkn/querystring
+  /**
+   * Compiles a querystring
+   * Returns string representation of the object
+   *
+   * @param {Object}
+   * @api private
+   */
+  function encode(obj) {
+    var str = '';
+    for (var i in obj) {
+      if (obj.hasOwnProperty(i)) {
+        if (str.length) str += '&';
+        str += encodeURIComponent(i) + '=' + encodeURIComponent(obj[i]);
+      }
+    }
+    return str;
+  }
+  /**
+   * Parses a simple querystring into an object
+   *
+   * @param {String} qs
+   * @api private
+   */
+  function decode(qs) {
+    var qry = {};
+    var pairs = qs.split('&');
+    for (var i = 0, l = pairs.length; i < l; i++) {
+      var pair = pairs[i].split('=');
+      qry[decodeURIComponent(pair[0])] = decodeURIComponent(pair[1]);
+    }
+    return qry;
+  }
+
+  var TransportError = /*#__PURE__*/function (_Error) {
+    function TransportError(reason, description, context) {
+      var _this;
+      _this = _Error.call(this, reason) || this;
+      _this.description = description;
+      _this.context = context;
+      _this.type = "TransportError";
+      return _this;
+    }
+    _inheritsLoose(TransportError, _Error);
+    return TransportError;
+  }( /*#__PURE__*/_wrapNativeSuper(Error));
+  var Transport = /*#__PURE__*/function (_Emitter) {
+    /**
+     * Transport abstract constructor.
+     *
+     * @param {Object} opts - options
+     * @protected
+     */
+    function Transport(opts) {
+      var _this2;
+      _this2 = _Emitter.call(this) || this;
+      _this2.writable = false;
+      installTimerFunctions(_this2, opts);
+      _this2.opts = opts;
+      _this2.query = opts.query;
+      _this2.socket = opts.socket;
+      _this2.supportsBinary = !opts.forceBase64;
+      return _this2;
+    }
+    /**
+     * Emits an error.
+     *
+     * @param {String} reason
+     * @param description
+     * @param context - the error context
+     * @return {Transport} for chaining
+     * @protected
+     */
+    _inheritsLoose(Transport, _Emitter);
+    var _proto = Transport.prototype;
+    _proto.onError = function onError(reason, description, context) {
+      _Emitter.prototype.emitReserved.call(this, "error", new TransportError(reason, description, context));
+      return this;
+    }
+    /**
+     * Opens the transport.
+     */;
+    _proto.open = function open() {
+      this.readyState = "opening";
+      this.doOpen();
+      return this;
+    }
+    /**
+     * Closes the transport.
+     */;
+    _proto.close = function close() {
+      if (this.readyState === "opening" || this.readyState === "open") {
+        this.doClose();
+        this.onClose();
+      }
+      return this;
+    }
+    /**
+     * Sends multiple packets.
+     *
+     * @param {Array} packets
+     */;
+    _proto.send = function send(packets) {
+      if (this.readyState === "open") {
+        this.write(packets);
+      }
+    }
+    /**
+     * Called upon open
+     *
+     * @protected
+     */;
+    _proto.onOpen = function onOpen() {
+      this.readyState = "open";
+      this.writable = true;
+      _Emitter.prototype.emitReserved.call(this, "open");
+    }
+    /**
+     * Called with data.
+     *
+     * @param {String} data
+     * @protected
+     */;
+    _proto.onData = function onData(data) {
+      var packet = decodePacket(data, this.socket.binaryType);
+      this.onPacket(packet);
+    }
+    /**
+     * Called with a decoded packet.
+     *
+     * @protected
+     */;
+    _proto.onPacket = function onPacket(packet) {
+      _Emitter.prototype.emitReserved.call(this, "packet", packet);
+    }
+    /**
+     * Called upon close.
+     *
+     * @protected
+     */;
+    _proto.onClose = function onClose(details) {
+      this.readyState = "closed";
+      _Emitter.prototype.emitReserved.call(this, "close", details);
+    }
+    /**
+     * Pauses the transport, in order not to lose packets during an upgrade.
+     *
+     * @param onPause
+     */;
+    _proto.pause = function pause(onPause) {};
+    _proto.createUri = function createUri(schema) {
+      var query = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+      return schema + "://" + this._hostname() + this._port() + this.opts.path + this._query(query);
+    };
+    _proto._hostname = function _hostname() {
+      var hostname = this.opts.hostname;
+      return hostname.indexOf(":") === -1 ? hostname : "[" + hostname + "]";
+    };
+    _proto._port = function _port() {
+      if (this.opts.port && (this.opts.secure && Number(this.opts.port !== 443) || !this.opts.secure && Number(this.opts.port) !== 80)) {
+        return ":" + this.opts.port;
+      } else {
+        return "";
+      }
+    };
+    _proto._query = function _query(query) {
+      var encodedQuery = encode(query);
+      return encodedQuery.length ? "?" + encodedQuery : "";
+    };
+    return Transport;
+  }(Emitter);
+
+  var Polling = /*#__PURE__*/function (_Transport) {
+    function Polling() {
+      var _this;
+      _this = _Transport.apply(this, arguments) || this;
+      _this._polling = false;
+      return _this;
+    }
+    _inheritsLoose(Polling, _Transport);
+    var _proto = Polling.prototype;
+    /**
+     * Opens the socket (triggers polling). We write a PING message to determine
+     * when the transport is open.
+     *
+     * @protected
+     */
+    _proto.doOpen = function doOpen() {
+      this._poll();
+    }
+    /**
+     * Pauses polling.
+     *
+     * @param {Function} onPause - callback upon buffers are flushed and transport is paused
+     * @package
+     */;
+    _proto.pause = function pause(onPause) {
+      var _this2 = this;
+      this.readyState = "pausing";
+      var pause = function pause() {
+        _this2.readyState = "paused";
+        onPause();
+      };
+      if (this._polling || !this.writable) {
+        var total = 0;
+        if (this._polling) {
+          total++;
+          this.once("pollComplete", function () {
+            --total || pause();
+          });
+        }
+        if (!this.writable) {
+          total++;
+          this.once("drain", function () {
+            --total || pause();
+          });
+        }
+      } else {
+        pause();
+      }
+    }
+    /**
+     * Starts polling cycle.
+     *
+     * @private
+     */;
+    _proto._poll = function _poll() {
+      this._polling = true;
+      this.doPoll();
+      this.emitReserved("poll");
+    }
+    /**
+     * Overloads onData to detect payloads.
+     *
+     * @protected
+     */;
+    _proto.onData = function onData(data) {
+      var _this3 = this;
+      var callback = function callback(packet) {
+        // if its the first message we consider the transport open
+        if ("opening" === _this3.readyState && packet.type === "open") {
+          _this3.onOpen();
+        }
+        // if its a close packet, we close the ongoing requests
+        if ("close" === packet.type) {
+          _this3.onClose({
+            description: "transport closed by the server"
+          });
+          return false;
+        }
+        // otherwise bypass onData and handle the message
+        _this3.onPacket(packet);
+      };
+      // decode payload
+      decodePayload(data, this.socket.binaryType).forEach(callback);
+      // if an event did not trigger closing
+      if ("closed" !== this.readyState) {
+        // if we got data we're not polling
+        this._polling = false;
+        this.emitReserved("pollComplete");
+        if ("open" === this.readyState) {
+          this._poll();
+        }
+      }
+    }
+    /**
+     * For polling, send a close packet.
+     *
+     * @protected
+     */;
+    _proto.doClose = function doClose() {
+      var _this4 = this;
+      var close = function close() {
+        _this4.write([{
+          type: "close"
+        }]);
+      };
+      if ("open" === this.readyState) {
+        close();
+      } else {
+        // in case we're trying to close while
+        // handshaking is in progress (GH-164)
+        this.once("open", close);
+      }
+    }
+    /**
+     * Writes a packets payload.
+     *
+     * @param {Array} packets - data packets
+     * @protected
+     */;
+    _proto.write = function write(packets) {
+      var _this5 = this;
+      this.writable = false;
+      encodePayload(packets, function (data) {
+        _this5.doWrite(data, function () {
+          _this5.writable = true;
+          _this5.emitReserved("drain");
+        });
+      });
+    }
+    /**
+     * Generates uri for connection.
+     *
+     * @private
+     */;
+    _proto.uri = function uri() {
+      var schema = this.opts.secure ? "https" : "http";
+      var query = this.query || {};
+      // cache busting is forced
+      if (false !== this.opts.timestampRequests) {
+        query[this.opts.timestampParam] = randomString();
+      }
+      if (!this.supportsBinary && !query.sid) {
+        query.b64 = 1;
+      }
+      return this.createUri(schema, query);
+    };
+    return _createClass(Polling, [{
+      key: "name",
+      get: function get() {
+        return "polling";
+      }
+    }]);
+  }(Transport);
+
+  // imported from https://github.com/component/has-cors
+  var value = false;
+  try {
+    value = typeof XMLHttpRequest !== 'undefined' && 'withCredentials' in new XMLHttpRequest();
+  } catch (err) {
+    // if XMLHttp support is disabled in IE then it will throw
+    // when trying to create
+  }
+  var hasCORS = value;
+
+  function empty() {}
+  var BaseXHR = /*#__PURE__*/function (_Polling) {
+    /**
+     * XHR Polling constructor.
+     *
+     * @param {Object} opts
+     * @package
+     */
+    function BaseXHR(opts) {
+      var _this;
+      _this = _Polling.call(this, opts) || this;
+      if (typeof location !== "undefined") {
+        var isSSL = "https:" === location.protocol;
+        var port = location.port;
+        // some user agents have empty `location.port`
+        if (!port) {
+          port = isSSL ? "443" : "80";
+        }
+        _this.xd = typeof location !== "undefined" && opts.hostname !== location.hostname || port !== opts.port;
+      }
+      return _this;
+    }
+    /**
+     * Sends data.
+     *
+     * @param {String} data to send.
+     * @param {Function} called upon flush.
+     * @private
+     */
+    _inheritsLoose(BaseXHR, _Polling);
+    var _proto = BaseXHR.prototype;
+    _proto.doWrite = function doWrite(data, fn) {
+      var _this2 = this;
+      var req = this.request({
+        method: "POST",
+        data: data
+      });
+      req.on("success", fn);
+      req.on("error", function (xhrStatus, context) {
+        _this2.onError("xhr post error", xhrStatus, context);
+      });
+    }
+    /**
+     * Starts a poll cycle.
+     *
+     * @private
+     */;
+    _proto.doPoll = function doPoll() {
+      var _this3 = this;
+      var req = this.request();
+      req.on("data", this.onData.bind(this));
+      req.on("error", function (xhrStatus, context) {
+        _this3.onError("xhr poll error", xhrStatus, context);
+      });
+      this.pollXhr = req;
+    };
+    return BaseXHR;
+  }(Polling);
+  var Request = /*#__PURE__*/function (_Emitter) {
+    /**
+     * Request constructor
+     *
+     * @param {Object} options
+     * @package
+     */
+    function Request(createRequest, uri, opts) {
+      var _this4;
+      _this4 = _Emitter.call(this) || this;
+      _this4.createRequest = createRequest;
+      installTimerFunctions(_this4, opts);
+      _this4._opts = opts;
+      _this4._method = opts.method || "GET";
+      _this4._uri = uri;
+      _this4._data = undefined !== opts.data ? opts.data : null;
+      _this4._create();
+      return _this4;
+    }
+    /**
+     * Creates the XHR object and sends the request.
+     *
+     * @private
+     */
+    _inheritsLoose(Request, _Emitter);
+    var _proto2 = Request.prototype;
+    _proto2._create = function _create() {
+      var _this5 = this;
+      var _a;
+      var opts = pick(this._opts, "agent", "pfx", "key", "passphrase", "cert", "ca", "ciphers", "rejectUnauthorized", "autoUnref");
+      opts.xdomain = !!this._opts.xd;
+      var xhr = this._xhr = this.createRequest(opts);
+      try {
+        xhr.open(this._method, this._uri, true);
+        try {
+          if (this._opts.extraHeaders) {
+            // @ts-ignore
+            xhr.setDisableHeaderCheck && xhr.setDisableHeaderCheck(true);
+            for (var i in this._opts.extraHeaders) {
+              if (this._opts.extraHeaders.hasOwnProperty(i)) {
+                xhr.setRequestHeader(i, this._opts.extraHeaders[i]);
+              }
+            }
+          }
+        } catch (e) {}
+        if ("POST" === this._method) {
+          try {
+            xhr.setRequestHeader("Content-type", "text/plain;charset=UTF-8");
+          } catch (e) {}
+        }
+        try {
+          xhr.setRequestHeader("Accept", "*/*");
+        } catch (e) {}
+        (_a = this._opts.cookieJar) === null || _a === void 0 ? void 0 : _a.addCookies(xhr);
+        // ie6 check
+        if ("withCredentials" in xhr) {
+          xhr.withCredentials = this._opts.withCredentials;
+        }
+        if (this._opts.requestTimeout) {
+          xhr.timeout = this._opts.requestTimeout;
+        }
+        xhr.onreadystatechange = function () {
+          var _a;
+          if (xhr.readyState === 3) {
+            (_a = _this5._opts.cookieJar) === null || _a === void 0 ? void 0 : _a.parseCookies(
+            // @ts-ignore
+            xhr.getResponseHeader("set-cookie"));
+          }
+          if (4 !== xhr.readyState) return;
+          if (200 === xhr.status || 1223 === xhr.status) {
+            _this5._onLoad();
+          } else {
+            // make sure the `error` event handler that's user-set
+            // does not throw in the same tick and gets caught here
+            _this5.setTimeoutFn(function () {
+              _this5._onError(typeof xhr.status === "number" ? xhr.status : 0);
+            }, 0);
+          }
+        };
+        xhr.send(this._data);
+      } catch (e) {
+        // Need to defer since .create() is called directly from the constructor
+        // and thus the 'error' event can only be only bound *after* this exception
+        // occurs.  Therefore, also, we cannot throw here at all.
+        this.setTimeoutFn(function () {
+          _this5._onError(e);
+        }, 0);
+        return;
+      }
+      if (typeof document !== "undefined") {
+        this._index = Request.requestsCount++;
+        Request.requests[this._index] = this;
+      }
+    }
+    /**
+     * Called upon error.
+     *
+     * @private
+     */;
+    _proto2._onError = function _onError(err) {
+      this.emitReserved("error", err, this._xhr);
+      this._cleanup(true);
+    }
+    /**
+     * Cleans up house.
+     *
+     * @private
+     */;
+    _proto2._cleanup = function _cleanup(fromError) {
+      if ("undefined" === typeof this._xhr || null === this._xhr) {
+        return;
+      }
+      this._xhr.onreadystatechange = empty;
+      if (fromError) {
+        try {
+          this._xhr.abort();
+        } catch (e) {}
+      }
+      if (typeof document !== "undefined") {
+        delete Request.requests[this._index];
+      }
+      this._xhr = null;
+    }
+    /**
+     * Called upon load.
+     *
+     * @private
+     */;
+    _proto2._onLoad = function _onLoad() {
+      var data = this._xhr.responseText;
+      if (data !== null) {
+        this.emitReserved("data", data);
+        this.emitReserved("success");
+        this._cleanup();
+      }
+    }
+    /**
+     * Aborts the request.
+     *
+     * @package
+     */;
+    _proto2.abort = function abort() {
+      this._cleanup();
+    };
+    return Request;
+  }(Emitter);
+  Request.requestsCount = 0;
+  Request.requests = {};
+  /**
+   * Aborts pending requests when unloading the window. This is needed to prevent
+   * memory leaks (e.g. when using IE) and to ensure that no spurious error is
+   * emitted.
+   */
+  if (typeof document !== "undefined") {
+    // @ts-ignore
+    if (typeof attachEvent === "function") {
+      // @ts-ignore
+      attachEvent("onunload", unloadHandler);
+    } else if (typeof addEventListener === "function") {
+      var terminationEvent = "onpagehide" in globalThisShim ? "pagehide" : "unload";
+      addEventListener(terminationEvent, unloadHandler, false);
+    }
+  }
+  function unloadHandler() {
+    for (var i in Request.requests) {
+      if (Request.requests.hasOwnProperty(i)) {
+        Request.requests[i].abort();
+      }
+    }
+  }
+  var hasXHR2 = function () {
+    var xhr = newRequest({
+      xdomain: false
+    });
+    return xhr && xhr.responseType !== null;
+  }();
+  /**
+   * HTTP long-polling based on the built-in `XMLHttpRequest` object.
+   *
+   * Usage: browser
+   *
+   * @see https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest
+   */
+  var XHR = /*#__PURE__*/function (_BaseXHR) {
+    function XHR(opts) {
+      var _this6;
+      _this6 = _BaseXHR.call(this, opts) || this;
+      var forceBase64 = opts && opts.forceBase64;
+      _this6.supportsBinary = hasXHR2 && !forceBase64;
+      return _this6;
+    }
+    _inheritsLoose(XHR, _BaseXHR);
+    var _proto3 = XHR.prototype;
+    _proto3.request = function request() {
+      var opts = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
+      _extends(opts, {
+        xd: this.xd
+      }, this.opts);
+      return new Request(newRequest, this.uri(), opts);
+    };
+    return XHR;
+  }(BaseXHR);
+  function newRequest(opts) {
+    var xdomain = opts.xdomain;
+    // XMLHttpRequest can be disabled on IE
+    try {
+      if ("undefined" !== typeof XMLHttpRequest && (!xdomain || hasCORS)) {
+        return new XMLHttpRequest();
+      }
+    } catch (e) {}
+    if (!xdomain) {
+      try {
+        return new globalThisShim[["Active"].concat("Object").join("X")]("Microsoft.XMLHTTP");
+      } catch (e) {}
+    }
+  }
+
+  // detect ReactNative environment
+  var isReactNative = typeof navigator !== "undefined" && typeof navigator.product === "string" && navigator.product.toLowerCase() === "reactnative";
+  var BaseWS = /*#__PURE__*/function (_Transport) {
+    function BaseWS() {
+      return _Transport.apply(this, arguments) || this;
+    }
+    _inheritsLoose(BaseWS, _Transport);
+    var _proto = BaseWS.prototype;
+    _proto.doOpen = function doOpen() {
+      var uri = this.uri();
+      var protocols = this.opts.protocols;
+      // React Native only supports the 'headers' option, and will print a warning if anything else is passed
+      var opts = isReactNative ? {} : pick(this.opts, "agent", "perMessageDeflate", "pfx", "key", "passphrase", "cert", "ca", "ciphers", "rejectUnauthorized", "localAddress", "protocolVersion", "origin", "maxPayload", "family", "checkServerIdentity");
+      if (this.opts.extraHeaders) {
+        opts.headers = this.opts.extraHeaders;
+      }
+      try {
+        this.ws = this.createSocket(uri, protocols, opts);
+      } catch (err) {
+        return this.emitReserved("error", err);
+      }
+      this.ws.binaryType = this.socket.binaryType;
+      this.addEventListeners();
+    }
+    /**
+     * Adds event listeners to the socket
+     *
+     * @private
+     */;
+    _proto.addEventListeners = function addEventListeners() {
+      var _this = this;
+      this.ws.onopen = function () {
+        if (_this.opts.autoUnref) {
+          _this.ws._socket.unref();
+        }
+        _this.onOpen();
+      };
+      this.ws.onclose = function (closeEvent) {
+        return _this.onClose({
+          description: "websocket connection closed",
+          context: closeEvent
+        });
+      };
+      this.ws.onmessage = function (ev) {
+        return _this.onData(ev.data);
+      };
+      this.ws.onerror = function (e) {
+        return _this.onError("websocket error", e);
+      };
+    };
+    _proto.write = function write(packets) {
+      var _this2 = this;
+      this.writable = false;
+      // encodePacket efficient as it uses WS framing
+      // no need for encodePayload
+      var _loop = function _loop() {
+        var packet = packets[i];
+        var lastPacket = i === packets.length - 1;
+        encodePacket(packet, _this2.supportsBinary, function (data) {
+          // Sometimes the websocket has already been closed but the browser didn't
+          // have a chance of informing us about it yet, in that case send will
+          // throw an error
+          try {
+            _this2.doWrite(packet, data);
+          } catch (e) {}
+          if (lastPacket) {
+            // fake drain
+            // defer to next tick to allow Socket to clear writeBuffer
+            nextTick(function () {
+              _this2.writable = true;
+              _this2.emitReserved("drain");
+            }, _this2.setTimeoutFn);
+          }
+        });
+      };
+      for (var i = 0; i < packets.length; i++) {
+        _loop();
+      }
+    };
+    _proto.doClose = function doClose() {
+      if (typeof this.ws !== "undefined") {
+        this.ws.onerror = function () {};
+        this.ws.close();
+        this.ws = null;
+      }
+    }
+    /**
+     * Generates uri for connection.
+     *
+     * @private
+     */;
+    _proto.uri = function uri() {
+      var schema = this.opts.secure ? "wss" : "ws";
+      var query = this.query || {};
+      // append timestamp to URI
+      if (this.opts.timestampRequests) {
+        query[this.opts.timestampParam] = randomString();
+      }
+      // communicate binary support capabilities
+      if (!this.supportsBinary) {
+        query.b64 = 1;
+      }
+      return this.createUri(schema, query);
+    };
+    return _createClass(BaseWS, [{
+      key: "name",
+      get: function get() {
+        return "websocket";
+      }
+    }]);
+  }(Transport);
+  var WebSocketCtor = globalThisShim.WebSocket || globalThisShim.MozWebSocket;
+  /**
+   * WebSocket transport based on the built-in `WebSocket` object.
+   *
+   * Usage: browser, Node.js (since v21), Deno, Bun
+   *
+   * @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket
+   * @see https://caniuse.com/mdn-api_websocket
+   * @see https://nodejs.org/api/globals.html#websocket
+   */
+  var WS = /*#__PURE__*/function (_BaseWS) {
+    function WS() {
+      return _BaseWS.apply(this, arguments) || this;
+    }
+    _inheritsLoose(WS, _BaseWS);
+    var _proto2 = WS.prototype;
+    _proto2.createSocket = function createSocket(uri, protocols, opts) {
+      return !isReactNative ? protocols ? new WebSocketCtor(uri, protocols) : new WebSocketCtor(uri) : new WebSocketCtor(uri, protocols, opts);
+    };
+    _proto2.doWrite = function doWrite(_packet, data) {
+      this.ws.send(data);
+    };
+    return WS;
+  }(BaseWS);
+
+  /**
+   * WebTransport transport based on the built-in `WebTransport` object.
+   *
+   * Usage: browser, Node.js (with the `@fails-components/webtransport` package)
+   *
+   * @see https://developer.mozilla.org/en-US/docs/Web/API/WebTransport
+   * @see https://caniuse.com/webtransport
+   */
+  var WT = /*#__PURE__*/function (_Transport) {
+    function WT() {
+      return _Transport.apply(this, arguments) || this;
+    }
+    _inheritsLoose(WT, _Transport);
+    var _proto = WT.prototype;
+    _proto.doOpen = function doOpen() {
+      var _this = this;
+      try {
+        // @ts-ignore
+        this._transport = new WebTransport(this.createUri("https"), this.opts.transportOptions[this.name]);
+      } catch (err) {
+        return this.emitReserved("error", err);
+      }
+      this._transport.closed.then(function () {
+        _this.onClose();
+      })["catch"](function (err) {
+        _this.onError("webtransport error", err);
+      });
+      // note: we could have used async/await, but that would require some additional polyfills
+      this._transport.ready.then(function () {
+        _this._transport.createBidirectionalStream().then(function (stream) {
+          var decoderStream = createPacketDecoderStream(Number.MAX_SAFE_INTEGER, _this.socket.binaryType);
+          var reader = stream.readable.pipeThrough(decoderStream).getReader();
+          var encoderStream = createPacketEncoderStream();
+          encoderStream.readable.pipeTo(stream.writable);
+          _this._writer = encoderStream.writable.getWriter();
+          var read = function read() {
+            reader.read().then(function (_ref) {
+              var done = _ref.done,
+                value = _ref.value;
+              if (done) {
+                return;
+              }
+              _this.onPacket(value);
+              read();
+            })["catch"](function (err) {});
+          };
+          read();
+          var packet = {
+            type: "open"
+          };
+          if (_this.query.sid) {
+            packet.data = "{\"sid\":\"".concat(_this.query.sid, "\"}");
+          }
+          _this._writer.write(packet).then(function () {
+            return _this.onOpen();
+          });
+        });
+      });
+    };
+    _proto.write = function write(packets) {
+      var _this2 = this;
+      this.writable = false;
+      var _loop = function _loop() {
+        var packet = packets[i];
+        var lastPacket = i === packets.length - 1;
+        _this2._writer.write(packet).then(function () {
+          if (lastPacket) {
+            nextTick(function () {
+              _this2.writable = true;
+              _this2.emitReserved("drain");
+            }, _this2.setTimeoutFn);
+          }
+        });
+      };
+      for (var i = 0; i < packets.length; i++) {
+        _loop();
+      }
+    };
+    _proto.doClose = function doClose() {
+      var _a;
+      (_a = this._transport) === null || _a === void 0 ? void 0 : _a.close();
+    };
+    return _createClass(WT, [{
+      key: "name",
+      get: function get() {
+        return "webtransport";
+      }
+    }]);
+  }(Transport);
+
+  var transports = {
+    websocket: WS,
+    webtransport: WT,
+    polling: XHR
+  };
+
+  // imported from https://github.com/galkn/parseuri
+  /**
+   * Parses a URI
+   *
+   * Note: we could also have used the built-in URL object, but it isn't supported on all platforms.
+   *
+   * See:
+   * - https://developer.mozilla.org/en-US/docs/Web/API/URL
+   * - https://caniuse.com/url
+   * - https://www.rfc-editor.org/rfc/rfc3986#appendix-B
+   *
+   * History of the parse() method:
+   * - first commit: https://github.com/socketio/socket.io-client/commit/4ee1d5d94b3906a9c052b459f1a818b15f38f91c
+   * - export into its own module: https://github.com/socketio/engine.io-client/commit/de2c561e4564efeb78f1bdb1ba39ef81b2822cb3
+   * - reimport: https://github.com/socketio/engine.io-client/commit/df32277c3f6d622eec5ed09f493cae3f3391d242
+   *
+   * @author Steven Levithan <stevenlevithan.com> (MIT license)
+   * @api private
+   */
+  var re = /^(?:(?![^:@\/?#]+:[^:@\/]*@)(http|https|ws|wss):\/\/)?((?:(([^:@\/?#]*)(?::([^:@\/?#]*))?)?@)?((?:[a-f0-9]{0,4}:){2,7}[a-f0-9]{0,4}|[^:\/?#]*)(?::(\d*))?)(((\/(?:[^?#](?![^?#\/]*\.[^?#\/.]+(?:[?#]|$)))*\/?)?([^?#\/]*))(?:\?([^#]*))?(?:#(.*))?)/;
+  var parts = ['source', 'protocol', 'authority', 'userInfo', 'user', 'password', 'host', 'port', 'relative', 'path', 'directory', 'file', 'query', 'anchor'];
+  function parse(str) {
+    if (str.length > 8000) {
+      throw "URI too long";
+    }
+    var src = str,
+      b = str.indexOf('['),
+      e = str.indexOf(']');
+    if (b != -1 && e != -1) {
+      str = str.substring(0, b) + str.substring(b, e).replace(/:/g, ';') + str.substring(e, str.length);
+    }
+    var m = re.exec(str || ''),
+      uri = {},
+      i = 14;
+    while (i--) {
+      uri[parts[i]] = m[i] || '';
+    }
+    if (b != -1 && e != -1) {
+      uri.source = src;
+      uri.host = uri.host.substring(1, uri.host.length - 1).replace(/;/g, ':');
+      uri.authority = uri.authority.replace('[', '').replace(']', '').replace(/;/g, ':');
+      uri.ipv6uri = true;
+    }
+    uri.pathNames = pathNames(uri, uri['path']);
+    uri.queryKey = queryKey(uri, uri['query']);
+    return uri;
+  }
+  function pathNames(obj, path) {
+    var regx = /\/{2,9}/g,
+      names = path.replace(regx, "/").split("/");
+    if (path.slice(0, 1) == '/' || path.length === 0) {
+      names.splice(0, 1);
+    }
+    if (path.slice(-1) == '/') {
+      names.splice(names.length - 1, 1);
+    }
+    return names;
+  }
+  function queryKey(uri, query) {
+    var data = {};
+    query.replace(/(?:^|&)([^&=]*)=?([^&]*)/g, function ($0, $1, $2) {
+      if ($1) {
+        data[$1] = $2;
+      }
+    });
+    return data;
+  }
+
+  var withEventListeners = typeof addEventListener === "function" && typeof removeEventListener === "function";
+  var OFFLINE_EVENT_LISTENERS = [];
+  if (withEventListeners) {
+    // within a ServiceWorker, any event handler for the 'offline' event must be added on the initial evaluation of the
+    // script, so we create one single event listener here which will forward the event to the socket instances
+    addEventListener("offline", function () {
+      OFFLINE_EVENT_LISTENERS.forEach(function (listener) {
+        return listener();
+      });
+    }, false);
+  }
+  /**
+   * This class provides a WebSocket-like interface to connect to an Engine.IO server. The connection will be established
+   * with one of the available low-level transports, like HTTP long-polling, WebSocket or WebTransport.
+   *
+   * This class comes without upgrade mechanism, which means that it will keep the first low-level transport that
+   * successfully establishes the connection.
+   *
+   * In order to allow tree-shaking, there are no transports included, that's why the `transports` option is mandatory.
+   *
+   * @example
+   * import { SocketWithoutUpgrade, WebSocket } from "engine.io-client";
+   *
+   * const socket = new SocketWithoutUpgrade({
+   *   transports: [WebSocket]
+   * });
+   *
+   * socket.on("open", () => {
+   *   socket.send("hello");
+   * });
+   *
+   * @see SocketWithUpgrade
+   * @see Socket
+   */
+  var SocketWithoutUpgrade = /*#__PURE__*/function (_Emitter) {
+    /**
+     * Socket constructor.
+     *
+     * @param {String|Object} uri - uri or options
+     * @param {Object} opts - options
+     */
+    function SocketWithoutUpgrade(uri, opts) {
+      var _this;
+      _this = _Emitter.call(this) || this;
+      _this.binaryType = defaultBinaryType;
+      _this.writeBuffer = [];
+      _this._prevBufferLen = 0;
+      _this._pingInterval = -1;
+      _this._pingTimeout = -1;
+      _this._maxPayload = -1;
+      /**
+       * The expiration timestamp of the {@link _pingTimeoutTimer} object is tracked, in case the timer is throttled and the
+       * callback is not fired on time. This can happen for example when a laptop is suspended or when a phone is locked.
+       */
+      _this._pingTimeoutTime = Infinity;
+      if (uri && "object" === _typeof(uri)) {
+        opts = uri;
+        uri = null;
+      }
+      if (uri) {
+        var parsedUri = parse(uri);
+        opts.hostname = parsedUri.host;
+        opts.secure = parsedUri.protocol === "https" || parsedUri.protocol === "wss";
+        opts.port = parsedUri.port;
+        if (parsedUri.query) opts.query = parsedUri.query;
+      } else if (opts.host) {
+        opts.hostname = parse(opts.host).host;
+      }
+      installTimerFunctions(_this, opts);
+      _this.secure = null != opts.secure ? opts.secure : typeof location !== "undefined" && "https:" === location.protocol;
+      if (opts.hostname && !opts.port) {
+        // if no port is specified manually, use the protocol default
+        opts.port = _this.secure ? "443" : "80";
+      }
+      _this.hostname = opts.hostname || (typeof location !== "undefined" ? location.hostname : "localhost");
+      _this.port = opts.port || (typeof location !== "undefined" && location.port ? location.port : _this.secure ? "443" : "80");
+      _this.transports = [];
+      _this._transportsByName = {};
+      opts.transports.forEach(function (t) {
+        var transportName = t.prototype.name;
+        _this.transports.push(transportName);
+        _this._transportsByName[transportName] = t;
+      });
+      _this.opts = _extends({
+        path: "/engine.io",
+        agent: false,
+        withCredentials: false,
+        upgrade: true,
+        timestampParam: "t",
+        rememberUpgrade: false,
+        addTrailingSlash: true,
+        rejectUnauthorized: true,
+        perMessageDeflate: {
+          threshold: 1024
+        },
+        transportOptions: {},
+        closeOnBeforeunload: false
+      }, opts);
+      _this.opts.path = _this.opts.path.replace(/\/$/, "") + (_this.opts.addTrailingSlash ? "/" : "");
+      if (typeof _this.opts.query === "string") {
+        _this.opts.query = decode(_this.opts.query);
+      }
+      if (withEventListeners) {
+        if (_this.opts.closeOnBeforeunload) {
+          // Firefox closes the connection when the "beforeunload" event is emitted but not Chrome. This event listener
+          // ensures every browser behaves the same (no "disconnect" event at the Socket.IO level when the page is
+          // closed/reloaded)
+          _this._beforeunloadEventListener = function () {
+            if (_this.transport) {
+              // silently close the transport
+              _this.transport.removeAllListeners();
+              _this.transport.close();
+            }
+          };
+          addEventListener("beforeunload", _this._beforeunloadEventListener, false);
+        }
+        if (_this.hostname !== "localhost") {
+          _this._offlineEventListener = function () {
+            _this._onClose("transport close", {
+              description: "network connection lost"
+            });
+          };
+          OFFLINE_EVENT_LISTENERS.push(_this._offlineEventListener);
+        }
+      }
+      if (_this.opts.withCredentials) {
+        _this._cookieJar = createCookieJar();
+      }
+      _this._open();
+      return _this;
+    }
+    /**
+     * Creates transport of the given type.
+     *
+     * @param {String} name - transport name
+     * @return {Transport}
+     * @private
+     */
+    _inheritsLoose(SocketWithoutUpgrade, _Emitter);
+    var _proto = SocketWithoutUpgrade.prototype;
+    _proto.createTransport = function createTransport(name) {
+      var query = _extends({}, this.opts.query);
+      // append engine.io protocol identifier
+      query.EIO = protocol$1;
+      // transport name
+      query.transport = name;
+      // session id if we already have one
+      if (this.id) query.sid = this.id;
+      var opts = _extends({}, this.opts, {
+        query: query,
+        socket: this,
+        hostname: this.hostname,
+        secure: this.secure,
+        port: this.port
+      }, this.opts.transportOptions[name]);
+      return new this._transportsByName[name](opts);
+    }
+    /**
+     * Initializes transport to use and starts probe.
+     *
+     * @private
+     */;
+    _proto._open = function _open() {
+      var _this2 = this;
+      if (this.transports.length === 0) {
+        // Emit error on next tick so it can be listened to
+        this.setTimeoutFn(function () {
+          _this2.emitReserved("error", "No transports available");
+        }, 0);
+        return;
+      }
+      var transportName = this.opts.rememberUpgrade && SocketWithoutUpgrade.priorWebsocketSuccess && this.transports.indexOf("websocket") !== -1 ? "websocket" : this.transports[0];
+      this.readyState = "opening";
+      var transport = this.createTransport(transportName);
+      transport.open();
+      this.setTransport(transport);
+    }
+    /**
+     * Sets the current transport. Disables the existing one (if any).
+     *
+     * @private
+     */;
+    _proto.setTransport = function setTransport(transport) {
+      var _this3 = this;
+      if (this.transport) {
+        this.transport.removeAllListeners();
+      }
+      // set up transport
+      this.transport = transport;
+      // set up transport listeners
+      transport.on("drain", this._onDrain.bind(this)).on("packet", this._onPacket.bind(this)).on("error", this._onError.bind(this)).on("close", function (reason) {
+        return _this3._onClose("transport close", reason);
+      });
+    }
+    /**
+     * Called when connection is deemed open.
+     *
+     * @private
+     */;
+    _proto.onOpen = function onOpen() {
+      this.readyState = "open";
+      SocketWithoutUpgrade.priorWebsocketSuccess = "websocket" === this.transport.name;
+      this.emitReserved("open");
+      this.flush();
+    }
+    /**
+     * Handles a packet.
+     *
+     * @private
+     */;
+    _proto._onPacket = function _onPacket(packet) {
+      if ("opening" === this.readyState || "open" === this.readyState || "closing" === this.readyState) {
+        this.emitReserved("packet", packet);
+        // Socket is live - any packet counts
+        this.emitReserved("heartbeat");
+        switch (packet.type) {
+          case "open":
+            this.onHandshake(JSON.parse(packet.data));
+            break;
+          case "ping":
+            this._sendPacket("pong");
+            this.emitReserved("ping");
+            this.emitReserved("pong");
+            this._resetPingTimeout();
+            break;
+          case "error":
+            var err = new Error("server error");
+            // @ts-ignore
+            err.code = packet.data;
+            this._onError(err);
+            break;
+          case "message":
+            this.emitReserved("data", packet.data);
+            this.emitReserved("message", packet.data);
+            break;
+        }
+      }
+    }
+    /**
+     * Called upon handshake completion.
+     *
+     * @param {Object} data - handshake obj
+     * @private
+     */;
+    _proto.onHandshake = function onHandshake(data) {
+      this.emitReserved("handshake", data);
+      this.id = data.sid;
+      this.transport.query.sid = data.sid;
+      this._pingInterval = data.pingInterval;
+      this._pingTimeout = data.pingTimeout;
+      this._maxPayload = data.maxPayload;
+      this.onOpen();
+      // In case open handler closes socket
+      if ("closed" === this.readyState) return;
+      this._resetPingTimeout();
+    }
+    /**
+     * Sets and resets ping timeout timer based on server pings.
+     *
+     * @private
+     */;
+    _proto._resetPingTimeout = function _resetPingTimeout() {
+      var _this4 = this;
+      this.clearTimeoutFn(this._pingTimeoutTimer);
+      var delay = this._pingInterval + this._pingTimeout;
+      this._pingTimeoutTime = Date.now() + delay;
+      this._pingTimeoutTimer = this.setTimeoutFn(function () {
+        _this4._onClose("ping timeout");
+      }, delay);
+      if (this.opts.autoUnref) {
+        this._pingTimeoutTimer.unref();
+      }
+    }
+    /**
+     * Called on `drain` event
+     *
+     * @private
+     */;
+    _proto._onDrain = function _onDrain() {
+      this.writeBuffer.splice(0, this._prevBufferLen);
+      // setting prevBufferLen = 0 is very important
+      // for example, when upgrading, upgrade packet is sent over,
+      // and a nonzero prevBufferLen could cause problems on `drain`
+      this._prevBufferLen = 0;
+      if (0 === this.writeBuffer.length) {
+        this.emitReserved("drain");
+      } else {
+        this.flush();
+      }
+    }
+    /**
+     * Flush write buffers.
+     *
+     * @private
+     */;
+    _proto.flush = function flush() {
+      if ("closed" !== this.readyState && this.transport.writable && !this.upgrading && this.writeBuffer.length) {
+        var packets = this._getWritablePackets();
+        this.transport.send(packets);
+        // keep track of current length of writeBuffer
+        // splice writeBuffer and callbackBuffer on `drain`
+        this._prevBufferLen = packets.length;
+        this.emitReserved("flush");
+      }
+    }
+    /**
+     * Ensure the encoded size of the writeBuffer is below the maxPayload value sent by the server (only for HTTP
+     * long-polling)
+     *
+     * @private
+     */;
+    _proto._getWritablePackets = function _getWritablePackets() {
+      var shouldCheckPayloadSize = this._maxPayload && this.transport.name === "polling" && this.writeBuffer.length > 1;
+      if (!shouldCheckPayloadSize) {
+        return this.writeBuffer;
+      }
+      var payloadSize = 1; // first packet type
+      for (var i = 0; i < this.writeBuffer.length; i++) {
+        var data = this.writeBuffer[i].data;
+        if (data) {
+          payloadSize += byteLength(data);
+        }
+        if (i > 0 && payloadSize > this._maxPayload) {
+          return this.writeBuffer.slice(0, i);
+        }
+        payloadSize += 2; // separator + packet type
+      }
+      return this.writeBuffer;
+    }
+    /**
+     * Checks whether the heartbeat timer has expired but the socket has not yet been notified.
+     *
+     * Note: this method is private for now because it does not really fit the WebSocket API, but if we put it in the
+     * `write()` method then the message would not be buffered by the Socket.IO client.
+     *
+     * @return {boolean}
+     * @private
+     */
+    /* private */;
+    _proto._hasPingExpired = function _hasPingExpired() {
+      var _this5 = this;
+      if (!this._pingTimeoutTime) return true;
+      var hasExpired = Date.now() > this._pingTimeoutTime;
+      if (hasExpired) {
+        this._pingTimeoutTime = 0;
+        nextTick(function () {
+          _this5._onClose("ping timeout");
+        }, this.setTimeoutFn);
+      }
+      return hasExpired;
+    }
+    /**
+     * Sends a message.
+     *
+     * @param {String} msg - message.
+     * @param {Object} options.
+     * @param {Function} fn - callback function.
+     * @return {Socket} for chaining.
+     */;
+    _proto.write = function write(msg, options, fn) {
+      this._sendPacket("message", msg, options, fn);
+      return this;
+    }
+    /**
+     * Sends a message. Alias of {@link Socket#write}.
+     *
+     * @param {String} msg - message.
+     * @param {Object} options.
+     * @param {Function} fn - callback function.
+     * @return {Socket} for chaining.
+     */;
+    _proto.send = function send(msg, options, fn) {
+      this._sendPacket("message", msg, options, fn);
+      return this;
+    }
+    /**
+     * Sends a packet.
+     *
+     * @param {String} type: packet type.
+     * @param {String} data.
+     * @param {Object} options.
+     * @param {Function} fn - callback function.
+     * @private
+     */;
+    _proto._sendPacket = function _sendPacket(type, data, options, fn) {
+      if ("function" === typeof data) {
+        fn = data;
+        data = undefined;
+      }
+      if ("function" === typeof options) {
+        fn = options;
+        options = null;
+      }
+      if ("closing" === this.readyState || "closed" === this.readyState) {
+        return;
+      }
+      options = options || {};
+      options.compress = false !== options.compress;
+      var packet = {
+        type: type,
+        data: data,
+        options: options
+      };
+      this.emitReserved("packetCreate", packet);
+      this.writeBuffer.push(packet);
+      if (fn) this.once("flush", fn);
+      this.flush();
+    }
+    /**
+     * Closes the connection.
+     */;
+    _proto.close = function close() {
+      var _this6 = this;
+      var close = function close() {
+        _this6._onClose("forced close");
+        _this6.transport.close();
+      };
+      var cleanupAndClose = function cleanupAndClose() {
+        _this6.off("upgrade", cleanupAndClose);
+        _this6.off("upgradeError", cleanupAndClose);
+        close();
+      };
+      var waitForUpgrade = function waitForUpgrade() {
+        // wait for upgrade to finish since we can't send packets while pausing a transport
+        _this6.once("upgrade", cleanupAndClose);
+        _this6.once("upgradeError", cleanupAndClose);
+      };
+      if ("opening" === this.readyState || "open" === this.readyState) {
+        this.readyState = "closing";
+        if (this.writeBuffer.length) {
+          this.once("drain", function () {
+            if (_this6.upgrading) {
+              waitForUpgrade();
+            } else {
+              close();
+            }
+          });
+        } else if (this.upgrading) {
+          waitForUpgrade();
+        } else {
+          close();
+        }
+      }
+      return this;
+    }
+    /**
+     * Called upon transport error
+     *
+     * @private
+     */;
+    _proto._onError = function _onError(err) {
+      SocketWithoutUpgrade.priorWebsocketSuccess = false;
+      if (this.opts.tryAllTransports && this.transports.length > 1 && this.readyState === "opening") {
+        this.transports.shift();
+        return this._open();
+      }
+      this.emitReserved("error", err);
+      this._onClose("transport error", err);
+    }
+    /**
+     * Called upon transport close.
+     *
+     * @private
+     */;
+    _proto._onClose = function _onClose(reason, description) {
+      if ("opening" === this.readyState || "open" === this.readyState || "closing" === this.readyState) {
+        // clear timers
+        this.clearTimeoutFn(this._pingTimeoutTimer);
+        // stop event from firing again for transport
+        this.transport.removeAllListeners("close");
+        // ensure transport won't stay open
+        this.transport.close();
+        // ignore further transport communication
+        this.transport.removeAllListeners();
+        if (withEventListeners) {
+          if (this._beforeunloadEventListener) {
+            removeEventListener("beforeunload", this._beforeunloadEventListener, false);
+          }
+          if (this._offlineEventListener) {
+            var i = OFFLINE_EVENT_LISTENERS.indexOf(this._offlineEventListener);
+            if (i !== -1) {
+              OFFLINE_EVENT_LISTENERS.splice(i, 1);
+            }
+          }
+        }
+        // set ready state
+        this.readyState = "closed";
+        // clear session id
+        this.id = null;
+        // emit close event
+        this.emitReserved("close", reason, description);
+        // clean buffers after, so users can still
+        // grab the buffers on `close` event
+        this.writeBuffer = [];
+        this._prevBufferLen = 0;
+      }
+    };
+    return SocketWithoutUpgrade;
+  }(Emitter);
+  SocketWithoutUpgrade.protocol = protocol$1;
+  /**
+   * This class provides a WebSocket-like interface to connect to an Engine.IO server. The connection will be established
+   * with one of the available low-level transports, like HTTP long-polling, WebSocket or WebTransport.
+   *
+   * This class comes with an upgrade mechanism, which means that once the connection is established with the first
+   * low-level transport, it will try to upgrade to a better transport.
+   *
+   * In order to allow tree-shaking, there are no transports included, that's why the `transports` option is mandatory.
+   *
+   * @example
+   * import { SocketWithUpgrade, WebSocket } from "engine.io-client";
+   *
+   * const socket = new SocketWithUpgrade({
+   *   transports: [WebSocket]
+   * });
+   *
+   * socket.on("open", () => {
+   *   socket.send("hello");
+   * });
+   *
+   * @see SocketWithoutUpgrade
+   * @see Socket
+   */
+  var SocketWithUpgrade = /*#__PURE__*/function (_SocketWithoutUpgrade) {
+    function SocketWithUpgrade() {
+      var _this7;
+      _this7 = _SocketWithoutUpgrade.apply(this, arguments) || this;
+      _this7._upgrades = [];
+      return _this7;
+    }
+    _inheritsLoose(SocketWithUpgrade, _SocketWithoutUpgrade);
+    var _proto2 = SocketWithUpgrade.prototype;
+    _proto2.onOpen = function onOpen() {
+      _SocketWithoutUpgrade.prototype.onOpen.call(this);
+      if ("open" === this.readyState && this.opts.upgrade) {
+        for (var i = 0; i < this._upgrades.length; i++) {
+          this._probe(this._upgrades[i]);
+        }
+      }
+    }
+    /**
+     * Probes a transport.
+     *
+     * @param {String} name - transport name
+     * @private
+     */;
+    _proto2._probe = function _probe(name) {
+      var _this8 = this;
+      var transport = this.createTransport(name);
+      var failed = false;
+      SocketWithoutUpgrade.priorWebsocketSuccess = false;
+      var onTransportOpen = function onTransportOpen() {
+        if (failed) return;
+        transport.send([{
+          type: "ping",
+          data: "probe"
+        }]);
+        transport.once("packet", function (msg) {
+          if (failed) return;
+          if ("pong" === msg.type && "probe" === msg.data) {
+            _this8.upgrading = true;
+            _this8.emitReserved("upgrading", transport);
+            if (!transport) return;
+            SocketWithoutUpgrade.priorWebsocketSuccess = "websocket" === transport.name;
+            _this8.transport.pause(function () {
+              if (failed) return;
+              if ("closed" === _this8.readyState) return;
+              cleanup();
+              _this8.setTransport(transport);
+              transport.send([{
+                type: "upgrade"
+              }]);
+              _this8.emitReserved("upgrade", transport);
+              transport = null;
+              _this8.upgrading = false;
+              _this8.flush();
+            });
+          } else {
+            var err = new Error("probe error");
+            // @ts-ignore
+            err.transport = transport.name;
+            _this8.emitReserved("upgradeError", err);
+          }
+        });
+      };
+      function freezeTransport() {
+        if (failed) return;
+        // Any callback called by transport should be ignored since now
+        failed = true;
+        cleanup();
+        transport.close();
+        transport = null;
+      }
+      // Handle any error that happens while probing
+      var onerror = function onerror(err) {
+        var error = new Error("probe error: " + err);
+        // @ts-ignore
+        error.transport = transport.name;
+        freezeTransport();
+        _this8.emitReserved("upgradeError", error);
+      };
+      function onTransportClose() {
+        onerror("transport closed");
+      }
+      // When the socket is closed while we're probing
+      function onclose() {
+        onerror("socket closed");
+      }
+      // When the socket is upgraded while we're probing
+      function onupgrade(to) {
+        if (transport && to.name !== transport.name) {
+          freezeTransport();
+        }
+      }
+      // Remove all listeners on the transport and on self
+      var cleanup = function cleanup() {
+        transport.removeListener("open", onTransportOpen);
+        transport.removeListener("error", onerror);
+        transport.removeListener("close", onTransportClose);
+        _this8.off("close", onclose);
+        _this8.off("upgrading", onupgrade);
+      };
+      transport.once("open", onTransportOpen);
+      transport.once("error", onerror);
+      transport.once("close", onTransportClose);
+      this.once("close", onclose);
+      this.once("upgrading", onupgrade);
+      if (this._upgrades.indexOf("webtransport") !== -1 && name !== "webtransport") {
+        // favor WebTransport
+        this.setTimeoutFn(function () {
+          if (!failed) {
+            transport.open();
+          }
+        }, 200);
+      } else {
+        transport.open();
+      }
+    };
+    _proto2.onHandshake = function onHandshake(data) {
+      this._upgrades = this._filterUpgrades(data.upgrades);
+      _SocketWithoutUpgrade.prototype.onHandshake.call(this, data);
+    }
+    /**
+     * Filters upgrades, returning only those matching client transports.
+     *
+     * @param {Array} upgrades - server upgrades
+     * @private
+     */;
+    _proto2._filterUpgrades = function _filterUpgrades(upgrades) {
+      var filteredUpgrades = [];
+      for (var i = 0; i < upgrades.length; i++) {
+        if (~this.transports.indexOf(upgrades[i])) filteredUpgrades.push(upgrades[i]);
+      }
+      return filteredUpgrades;
+    };
+    return SocketWithUpgrade;
+  }(SocketWithoutUpgrade);
+  /**
+   * This class provides a WebSocket-like interface to connect to an Engine.IO server. The connection will be established
+   * with one of the available low-level transports, like HTTP long-polling, WebSocket or WebTransport.
+   *
+   * This class comes with an upgrade mechanism, which means that once the connection is established with the first
+   * low-level transport, it will try to upgrade to a better transport.
+   *
+   * @example
+   * import { Socket } from "engine.io-client";
+   *
+   * const socket = new Socket();
+   *
+   * socket.on("open", () => {
+   *   socket.send("hello");
+   * });
+   *
+   * @see SocketWithoutUpgrade
+   * @see SocketWithUpgrade
+   */
+  var Socket$1 = /*#__PURE__*/function (_SocketWithUpgrade) {
+    function Socket(uri) {
+      var opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+      var o = _typeof(uri) === "object" ? uri : opts;
+      if (!o.transports || o.transports && typeof o.transports[0] === "string") {
+        o.transports = (o.transports || ["polling", "websocket", "webtransport"]).map(function (transportName) {
+          return transports[transportName];
+        }).filter(function (t) {
+          return !!t;
+        });
+      }
+      return _SocketWithUpgrade.call(this, uri, o) || this;
+    }
+    _inheritsLoose(Socket, _SocketWithUpgrade);
+    return Socket;
+  }(SocketWithUpgrade);
+
+  Socket$1.protocol;
+
+  function getDefaultExportFromCjs (x) {
+  	return x && x.__esModule && Object.prototype.hasOwnProperty.call(x, 'default') ? x['default'] : x;
+  }
+
+  var browser = {exports: {}};
+
+  var ms;
+  var hasRequiredMs;
+  function requireMs() {
+    if (hasRequiredMs) return ms;
+    hasRequiredMs = 1;
+    var s = 1000;
+    var m = s * 60;
+    var h = m * 60;
+    var d = h * 24;
+    var w = d * 7;
+    var y = d * 365.25;
+
+    /**
+     * Parse or format the given `val`.
+     *
+     * Options:
+     *
+     *  - `long` verbose formatting [false]
+     *
+     * @param {String|Number} val
+     * @param {Object} [options]
+     * @throws {Error} throw an error if val is not a non-empty string or a number
+     * @return {String|Number}
+     * @api public
+     */
+
+    ms = function ms(val, options) {
+      options = options || {};
+      var type = _typeof(val);
+      if (type === 'string' && val.length > 0) {
+        return parse(val);
+      } else if (type === 'number' && isFinite(val)) {
+        return options["long"] ? fmtLong(val) : fmtShort(val);
+      }
+      throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val));
+    };
+
+    /**
+     * Parse the given `str` and return milliseconds.
+     *
+     * @param {String} str
+     * @return {Number}
+     * @api private
+     */
+
+    function parse(str) {
+      str = String(str);
+      if (str.length > 100) {
+        return;
+      }
+      var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str);
+      if (!match) {
+        return;
+      }
+      var n = parseFloat(match[1]);
+      var type = (match[2] || 'ms').toLowerCase();
+      switch (type) {
+        case 'years':
+        case 'year':
+        case 'yrs':
+        case 'yr':
+        case 'y':
+          return n * y;
+        case 'weeks':
+        case 'week':
+        case 'w':
+          return n * w;
+        case 'days':
+        case 'day':
+        case 'd':
+          return n * d;
+        case 'hours':
+        case 'hour':
+        case 'hrs':
+        case 'hr':
+        case 'h':
+          return n * h;
+        case 'minutes':
+        case 'minute':
+        case 'mins':
+        case 'min':
+        case 'm':
+          return n * m;
+        case 'seconds':
+        case 'second':
+        case 'secs':
+        case 'sec':
+        case 's':
+          return n * s;
+        case 'milliseconds':
+        case 'millisecond':
+        case 'msecs':
+        case 'msec':
+        case 'ms':
+          return n;
+        default:
+          return undefined;
+      }
+    }
+
+    /**
+     * Short format for `ms`.
+     *
+     * @param {Number} ms
+     * @return {String}
+     * @api private
+     */
+
+    function fmtShort(ms) {
+      var msAbs = Math.abs(ms);
+      if (msAbs >= d) {
+        return Math.round(ms / d) + 'd';
+      }
+      if (msAbs >= h) {
+        return Math.round(ms / h) + 'h';
+      }
+      if (msAbs >= m) {
+        return Math.round(ms / m) + 'm';
+      }
+      if (msAbs >= s) {
+        return Math.round(ms / s) + 's';
+      }
+      return ms + 'ms';
+    }
+
+    /**
+     * Long format for `ms`.
+     *
+     * @param {Number} ms
+     * @return {String}
+     * @api private
+     */
+
+    function fmtLong(ms) {
+      var msAbs = Math.abs(ms);
+      if (msAbs >= d) {
+        return plural(ms, msAbs, d, 'day');
+      }
+      if (msAbs >= h) {
+        return plural(ms, msAbs, h, 'hour');
+      }
+      if (msAbs >= m) {
+        return plural(ms, msAbs, m, 'minute');
+      }
+      if (msAbs >= s) {
+        return plural(ms, msAbs, s, 'second');
+      }
+      return ms + ' ms';
+    }
+
+    /**
+     * Pluralization helper.
+     */
+
+    function plural(ms, msAbs, n, name) {
+      var isPlural = msAbs >= n * 1.5;
+      return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+    }
+    return ms;
+  }
+
+  /**
+   * This is the common logic for both the Node.js and web browser
+   * implementations of `debug()`.
+   */
+
+  function setup(env) {
+    createDebug.debug = createDebug;
+    createDebug["default"] = createDebug;
+    createDebug.coerce = coerce;
+    createDebug.disable = disable;
+    createDebug.enable = enable;
+    createDebug.enabled = enabled;
+    createDebug.humanize = requireMs();
+    createDebug.destroy = destroy;
+    Object.keys(env).forEach(function (key) {
+      createDebug[key] = env[key];
+    });
+
+    /**
+    * The currently active debug mode names, and names to skip.
+    */
+
+    createDebug.names = [];
+    createDebug.skips = [];
+
+    /**
+    * Map of special "%n" handling functions, for the debug "format" argument.
+    *
+    * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+    */
+    createDebug.formatters = {};
+
+    /**
+    * Selects a color for a debug namespace
+    * @param {String} namespace The namespace string for the debug instance to be colored
+    * @return {Number|String} An ANSI color code for the given namespace
+    * @api private
+    */
+    function selectColor(namespace) {
+      var hash = 0;
+      for (var i = 0; i < namespace.length; i++) {
+        hash = (hash << 5) - hash + namespace.charCodeAt(i);
+        hash |= 0; // Convert to 32bit integer
+      }
+      return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+    }
+    createDebug.selectColor = selectColor;
+
+    /**
+    * Create a debugger with the given `namespace`.
+    *
+    * @param {String} namespace
+    * @return {Function}
+    * @api public
+    */
+    function createDebug(namespace) {
+      var prevTime;
+      var enableOverride = null;
+      var namespacesCache;
+      var enabledCache;
+      function debug() {
+        for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+          args[_key] = arguments[_key];
+        }
+        // Disabled?
+        if (!debug.enabled) {
+          return;
+        }
+        var self = debug;
+
+        // Set `diff` timestamp
+        var curr = Number(new Date());
+        var ms = curr - (prevTime || curr);
+        self.diff = ms;
+        self.prev = prevTime;
+        self.curr = curr;
+        prevTime = curr;
+        args[0] = createDebug.coerce(args[0]);
+        if (typeof args[0] !== 'string') {
+          // Anything else let's inspect with %O
+          args.unshift('%O');
+        }
+
+        // Apply any `formatters` transformations
+        var index = 0;
+        args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+          // If we encounter an escaped % then don't increase the array index
+          if (match === '%%') {
+            return '%';
+          }
+          index++;
+          var formatter = createDebug.formatters[format];
+          if (typeof formatter === 'function') {
+            var val = args[index];
+            match = formatter.call(self, val);
+
+            // Now we need to remove `args[index]` since it's inlined in the `format`
+            args.splice(index, 1);
+            index--;
+          }
+          return match;
+        });
+
+        // Apply env-specific formatting (colors, etc.)
+        createDebug.formatArgs.call(self, args);
+        var logFn = self.log || createDebug.log;
+        logFn.apply(self, args);
+      }
+      debug.namespace = namespace;
+      debug.useColors = createDebug.useColors();
+      debug.color = createDebug.selectColor(namespace);
+      debug.extend = extend;
+      debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
+
+      Object.defineProperty(debug, 'enabled', {
+        enumerable: true,
+        configurable: false,
+        get: function get() {
+          if (enableOverride !== null) {
+            return enableOverride;
+          }
+          if (namespacesCache !== createDebug.namespaces) {
+            namespacesCache = createDebug.namespaces;
+            enabledCache = createDebug.enabled(namespace);
+          }
+          return enabledCache;
+        },
+        set: function set(v) {
+          enableOverride = v;
+        }
+      });
+
+      // Env-specific initialization logic for debug instances
+      if (typeof createDebug.init === 'function') {
+        createDebug.init(debug);
+      }
+      return debug;
+    }
+    function extend(namespace, delimiter) {
+      var newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+      newDebug.log = this.log;
+      return newDebug;
+    }
+
+    /**
+    * Enables a debug mode by namespaces. This can include modes
+    * separated by a colon and wildcards.
+    *
+    * @param {String} namespaces
+    * @api public
+    */
+    function enable(namespaces) {
+      createDebug.save(namespaces);
+      createDebug.namespaces = namespaces;
+      createDebug.names = [];
+      createDebug.skips = [];
+      var i;
+      var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+      var len = split.length;
+      for (i = 0; i < len; i++) {
+        if (!split[i]) {
+          // ignore empty strings
+          continue;
+        }
+        namespaces = split[i].replace(/\*/g, '.*?');
+        if (namespaces[0] === '-') {
+          createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$'));
+        } else {
+          createDebug.names.push(new RegExp('^' + namespaces + '$'));
+        }
+      }
+    }
+
+    /**
+    * Disable debug output.
+    *
+    * @return {String} namespaces
+    * @api public
+    */
+    function disable() {
+      var namespaces = [].concat(_toConsumableArray(createDebug.names.map(toNamespace)), _toConsumableArray(createDebug.skips.map(toNamespace).map(function (namespace) {
+        return '-' + namespace;
+      }))).join(',');
+      createDebug.enable('');
+      return namespaces;
+    }
+
+    /**
+    * Returns true if the given mode name is enabled, false otherwise.
+    *
+    * @param {String} name
+    * @return {Boolean}
+    * @api public
+    */
+    function enabled(name) {
+      if (name[name.length - 1] === '*') {
+        return true;
+      }
+      var i;
+      var len;
+      for (i = 0, len = createDebug.skips.length; i < len; i++) {
+        if (createDebug.skips[i].test(name)) {
+          return false;
+        }
+      }
+      for (i = 0, len = createDebug.names.length; i < len; i++) {
+        if (createDebug.names[i].test(name)) {
+          return true;
+        }
+      }
+      return false;
+    }
+
+    /**
+    * Convert regexp to namespace
+    *
+    * @param {RegExp} regxep
+    * @return {String} namespace
+    * @api private
+    */
+    function toNamespace(regexp) {
+      return regexp.toString().substring(2, regexp.toString().length - 2).replace(/\.\*\?$/, '*');
+    }
+
+    /**
+    * Coerce `val`.
+    *
+    * @param {Mixed} val
+    * @return {Mixed}
+    * @api private
+    */
+    function coerce(val) {
+      if (val instanceof Error) {
+        return val.stack || val.message;
+      }
+      return val;
+    }
+
+    /**
+    * XXX DO NOT USE. This is a temporary stub function.
+    * XXX It WILL be removed in the next major release.
+    */
+    function destroy() {
+      console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
+    }
+    createDebug.enable(createDebug.load());
+    return createDebug;
+  }
+  var common = setup;
+
+  /* eslint-env browser */
+  browser.exports;
+  (function (module, exports) {
+    /**
+     * This is the web browser implementation of `debug()`.
+     */
+
+    exports.formatArgs = formatArgs;
+    exports.save = save;
+    exports.load = load;
+    exports.useColors = useColors;
+    exports.storage = localstorage();
+    exports.destroy = function () {
+      var warned = false;
+      return function () {
+        if (!warned) {
+          warned = true;
+          console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
+        }
+      };
+    }();
+
+    /**
+     * Colors.
+     */
+
+    exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+
+    /**
+     * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+     * and the Firebug extension (any Firefox version) are known
+     * to support "%c" CSS customizations.
+     *
+     * TODO: add a `localStorage` variable to explicitly enable/disable colors
+     */
+
+    // eslint-disable-next-line complexity
+    function useColors() {
+      // NB: In an Electron preload script, document will be defined but not fully
+      // initialized. Since we know we're in Chrome, we'll just detect this case
+      // explicitly
+      if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+        return true;
+      }
+
+      // Internet Explorer and Edge do not support colors.
+      if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+        return false;
+      }
+
+      // Is webkit? http://stackoverflow.com/a/16459606/376773
+      // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+      return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance ||
+      // Is firebug? http://stackoverflow.com/a/398120/376773
+      typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) ||
+      // Is firefox >= v31?
+      // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+      typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 ||
+      // Double check webkit in userAgent just in case we are in a worker
+      typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+    }
+
+    /**
+     * Colorize log arguments if enabled.
+     *
+     * @api public
+     */
+
+    function formatArgs(args) {
+      args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+      if (!this.useColors) {
+        return;
+      }
+      var c = 'color: ' + this.color;
+      args.splice(1, 0, c, 'color: inherit');
+
+      // The final "%c" is somewhat tricky, because there could be other
+      // arguments passed either before or after the %c, so we need to
+      // figure out the correct index to insert the CSS into
+      var index = 0;
+      var lastC = 0;
+      args[0].replace(/%[a-zA-Z%]/g, function (match) {
+        if (match === '%%') {
+          return;
+        }
+        index++;
+        if (match === '%c') {
+          // We only are interested in the *last* %c
+          // (the user may have provided their own)
+          lastC = index;
+        }
+      });
+      args.splice(lastC, 0, c);
+    }
+
+    /**
+     * Invokes `console.debug()` when available.
+     * No-op when `console.debug` is not a "function".
+     * If `console.debug` is not available, falls back
+     * to `console.log`.
+     *
+     * @api public
+     */
+    exports.log = console.debug || console.log || function () {};
+
+    /**
+     * Save `namespaces`.
+     *
+     * @param {String} namespaces
+     * @api private
+     */
+    function save(namespaces) {
+      try {
+        if (namespaces) {
+          exports.storage.setItem('debug', namespaces);
+        } else {
+          exports.storage.removeItem('debug');
+        }
+      } catch (error) {
+        // Swallow
+        // XXX (@Qix-) should we be logging these?
+      }
+    }
+
+    /**
+     * Load `namespaces`.
+     *
+     * @return {String} returns the previously persisted debug modes
+     * @api private
+     */
+    function load() {
+      var r;
+      try {
+        r = exports.storage.getItem('debug');
+      } catch (error) {
+        // Swallow
+        // XXX (@Qix-) should we be logging these?
+      }
+
+      // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+      if (!r && typeof process !== 'undefined' && 'env' in process) {
+        r = process.env.DEBUG;
+      }
+      return r;
+    }
+
+    /**
+     * Localstorage attempts to return the localstorage.
+     *
+     * This is necessary because safari throws
+     * when a user disables cookies/localstorage
+     * and you attempt to access it.
+     *
+     * @return {LocalStorage}
+     * @api private
+     */
+
+    function localstorage() {
+      try {
+        // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+        // The Browser also has localStorage in the global context.
+        return localStorage;
+      } catch (error) {
+        // Swallow
+        // XXX (@Qix-) should we be logging these?
+      }
+    }
+    module.exports = common(exports);
+    var formatters = module.exports.formatters;
+
+    /**
+     * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+     */
+
+    formatters.j = function (v) {
+      try {
+        return JSON.stringify(v);
+      } catch (error) {
+        return '[UnexpectedJSONParseError]: ' + error.message;
+      }
+    };
+  })(browser, browser.exports);
+  var browserExports = browser.exports;
+  var debugModule = /*@__PURE__*/getDefaultExportFromCjs(browserExports);
+
+  var debug$3 = debugModule("socket.io-client:url"); // debug()
+  /**
+   * URL parser.
+   *
+   * @param uri - url
+   * @param path - the request path of the connection
+   * @param loc - An object meant to mimic window.location.
+   *        Defaults to window.location.
+   * @public
+   */
+  function url(uri) {
+    var path = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : "";
+    var loc = arguments.length > 2 ? arguments[2] : undefined;
+    var obj = uri;
+    // default to window.location
+    loc = loc || typeof location !== "undefined" && location;
+    if (null == uri) uri = loc.protocol + "//" + loc.host;
+    // relative path support
+    if (typeof uri === "string") {
+      if ("/" === uri.charAt(0)) {
+        if ("/" === uri.charAt(1)) {
+          uri = loc.protocol + uri;
+        } else {
+          uri = loc.host + uri;
+        }
+      }
+      if (!/^(https?|wss?):\/\//.test(uri)) {
+        debug$3("protocol-less url %s", uri);
+        if ("undefined" !== typeof loc) {
+          uri = loc.protocol + "//" + uri;
+        } else {
+          uri = "https://" + uri;
+        }
+      }
+      // parse
+      debug$3("parse %s", uri);
+      obj = parse(uri);
+    }
+    // make sure we treat `localhost:80` and `localhost` equally
+    if (!obj.port) {
+      if (/^(http|ws)$/.test(obj.protocol)) {
+        obj.port = "80";
+      } else if (/^(http|ws)s$/.test(obj.protocol)) {
+        obj.port = "443";
+      }
+    }
+    obj.path = obj.path || "/";
+    var ipv6 = obj.host.indexOf(":") !== -1;
+    var host = ipv6 ? "[" + obj.host + "]" : obj.host;
+    // define unique id
+    obj.id = obj.protocol + "://" + host + ":" + obj.port + path;
+    // define href
+    obj.href = obj.protocol + "://" + host + (loc && loc.port === obj.port ? "" : ":" + obj.port);
+    return obj;
+  }
+
+  var withNativeArrayBuffer = typeof ArrayBuffer === "function";
+  var isView = function isView(obj) {
+    return typeof ArrayBuffer.isView === "function" ? ArrayBuffer.isView(obj) : obj.buffer instanceof ArrayBuffer;
+  };
+  var toString = Object.prototype.toString;
+  var withNativeBlob = typeof Blob === "function" || typeof Blob !== "undefined" && toString.call(Blob) === "[object BlobConstructor]";
+  var withNativeFile = typeof File === "function" || typeof File !== "undefined" && toString.call(File) === "[object FileConstructor]";
+  /**
+   * Returns true if obj is a Buffer, an ArrayBuffer, a Blob or a File.
+   *
+   * @private
+   */
+  function isBinary(obj) {
+    return withNativeArrayBuffer && (obj instanceof ArrayBuffer || isView(obj)) || withNativeBlob && obj instanceof Blob || withNativeFile && obj instanceof File;
+  }
+  function hasBinary(obj, toJSON) {
+    if (!obj || _typeof(obj) !== "object") {
+      return false;
+    }
+    if (Array.isArray(obj)) {
+      for (var i = 0, l = obj.length; i < l; i++) {
+        if (hasBinary(obj[i])) {
+          return true;
+        }
+      }
+      return false;
+    }
+    if (isBinary(obj)) {
+      return true;
+    }
+    if (obj.toJSON && typeof obj.toJSON === "function" && arguments.length === 1) {
+      return hasBinary(obj.toJSON(), true);
+    }
+    for (var key in obj) {
+      if (Object.prototype.hasOwnProperty.call(obj, key) && hasBinary(obj[key])) {
+        return true;
+      }
+    }
+    return false;
+  }
+
+  /**
+   * Replaces every Buffer | ArrayBuffer | Blob | File in packet with a numbered placeholder.
+   *
+   * @param {Object} packet - socket.io event packet
+   * @return {Object} with deconstructed packet and list of buffers
+   * @public
+   */
+  function deconstructPacket(packet) {
+    var buffers = [];
+    var packetData = packet.data;
+    var pack = packet;
+    pack.data = _deconstructPacket(packetData, buffers);
+    pack.attachments = buffers.length; // number of binary 'attachments'
+    return {
+      packet: pack,
+      buffers: buffers
+    };
+  }
+  function _deconstructPacket(data, buffers) {
+    if (!data) return data;
+    if (isBinary(data)) {
+      var placeholder = {
+        _placeholder: true,
+        num: buffers.length
+      };
+      buffers.push(data);
+      return placeholder;
+    } else if (Array.isArray(data)) {
+      var newData = new Array(data.length);
+      for (var i = 0; i < data.length; i++) {
+        newData[i] = _deconstructPacket(data[i], buffers);
+      }
+      return newData;
+    } else if (_typeof(data) === "object" && !(data instanceof Date)) {
+      var _newData = {};
+      for (var key in data) {
+        if (Object.prototype.hasOwnProperty.call(data, key)) {
+          _newData[key] = _deconstructPacket(data[key], buffers);
+        }
+      }
+      return _newData;
+    }
+    return data;
+  }
+  /**
+   * Reconstructs a binary packet from its placeholder packet and buffers
+   *
+   * @param {Object} packet - event packet with placeholders
+   * @param {Array} buffers - binary buffers to put in placeholder positions
+   * @return {Object} reconstructed packet
+   * @public
+   */
+  function reconstructPacket(packet, buffers) {
+    packet.data = _reconstructPacket(packet.data, buffers);
+    delete packet.attachments; // no longer useful
+    return packet;
+  }
+  function _reconstructPacket(data, buffers) {
+    if (!data) return data;
+    if (data && data._placeholder === true) {
+      var isIndexValid = typeof data.num === "number" && data.num >= 0 && data.num < buffers.length;
+      if (isIndexValid) {
+        return buffers[data.num]; // appropriate buffer (should be natural order anyway)
+      } else {
+        throw new Error("illegal attachments");
+      }
+    } else if (Array.isArray(data)) {
+      for (var i = 0; i < data.length; i++) {
+        data[i] = _reconstructPacket(data[i], buffers);
+      }
+    } else if (_typeof(data) === "object") {
+      for (var key in data) {
+        if (Object.prototype.hasOwnProperty.call(data, key)) {
+          data[key] = _reconstructPacket(data[key], buffers);
+        }
+      }
+    }
+    return data;
+  }
+
+  /**
+   * These strings must not be used as event names, as they have a special meaning.
+   */
+  var RESERVED_EVENTS$1 = ["connect",
+  // used on the client side
+  "connect_error",
+  // used on the client side
+  "disconnect",
+  // used on both sides
+  "disconnecting",
+  // used on the server side
+  "newListener",
+  // used by the Node.js EventEmitter
+  "removeListener" // used by the Node.js EventEmitter
+  ];
+  /**
+   * Protocol version.
+   *
+   * @public
+   */
+  var protocol = 5;
+  var PacketType;
+  (function (PacketType) {
+    PacketType[PacketType["CONNECT"] = 0] = "CONNECT";
+    PacketType[PacketType["DISCONNECT"] = 1] = "DISCONNECT";
+    PacketType[PacketType["EVENT"] = 2] = "EVENT";
+    PacketType[PacketType["ACK"] = 3] = "ACK";
+    PacketType[PacketType["CONNECT_ERROR"] = 4] = "CONNECT_ERROR";
+    PacketType[PacketType["BINARY_EVENT"] = 5] = "BINARY_EVENT";
+    PacketType[PacketType["BINARY_ACK"] = 6] = "BINARY_ACK";
+  })(PacketType || (PacketType = {}));
+  /**
+   * A socket.io Encoder instance
+   */
+  var Encoder = /*#__PURE__*/function () {
+    /**
+     * Encoder constructor
+     *
+     * @param {function} replacer - custom replacer to pass down to JSON.parse
+     */
+    function Encoder(replacer) {
+      this.replacer = replacer;
+    }
+    /**
+     * Encode a packet as a single string if non-binary, or as a
+     * buffer sequence, depending on packet type.
+     *
+     * @param {Object} obj - packet object
+     */
+    var _proto = Encoder.prototype;
+    _proto.encode = function encode(obj) {
+      if (obj.type === PacketType.EVENT || obj.type === PacketType.ACK) {
+        if (hasBinary(obj)) {
+          return this.encodeAsBinary({
+            type: obj.type === PacketType.EVENT ? PacketType.BINARY_EVENT : PacketType.BINARY_ACK,
+            nsp: obj.nsp,
+            data: obj.data,
+            id: obj.id
+          });
+        }
+      }
+      return [this.encodeAsString(obj)];
+    }
+    /**
+     * Encode packet as string.
+     */;
+    _proto.encodeAsString = function encodeAsString(obj) {
+      // first is type
+      var str = "" + obj.type;
+      // attachments if we have them
+      if (obj.type === PacketType.BINARY_EVENT || obj.type === PacketType.BINARY_ACK) {
+        str += obj.attachments + "-";
+      }
+      // if we have a namespace other than `/`
+      // we append it followed by a comma `,`
+      if (obj.nsp && "/" !== obj.nsp) {
+        str += obj.nsp + ",";
+      }
+      // immediately followed by the id
+      if (null != obj.id) {
+        str += obj.id;
+      }
+      // json data
+      if (null != obj.data) {
+        str += JSON.stringify(obj.data, this.replacer);
+      }
+      return str;
+    }
+    /**
+     * Encode packet as 'buffer sequence' by removing blobs, and
+     * deconstructing packet into object with placeholders and
+     * a list of buffers.
+     */;
+    _proto.encodeAsBinary = function encodeAsBinary(obj) {
+      var deconstruction = deconstructPacket(obj);
+      var pack = this.encodeAsString(deconstruction.packet);
+      var buffers = deconstruction.buffers;
+      buffers.unshift(pack); // add packet info to beginning of data list
+      return buffers; // write all the buffers
+    };
+    return Encoder;
+  }();
+  /**
+   * A socket.io Decoder instance
+   *
+   * @return {Object} decoder
+   */
+  var Decoder = /*#__PURE__*/function (_Emitter) {
+    /**
+     * Decoder constructor
+     *
+     * @param {function} reviver - custom reviver to pass down to JSON.stringify
+     */
+    function Decoder(reviver) {
+      var _this;
+      _this = _Emitter.call(this) || this;
+      _this.reviver = reviver;
+      return _this;
+    }
+    /**
+     * Decodes an encoded packet string into packet JSON.
+     *
+     * @param {String} obj - encoded packet
+     */
+    _inheritsLoose(Decoder, _Emitter);
+    var _proto2 = Decoder.prototype;
+    _proto2.add = function add(obj) {
+      var packet;
+      if (typeof obj === "string") {
+        if (this.reconstructor) {
+          throw new Error("got plaintext data when reconstructing a packet");
+        }
+        packet = this.decodeString(obj);
+        var isBinaryEvent = packet.type === PacketType.BINARY_EVENT;
+        if (isBinaryEvent || packet.type === PacketType.BINARY_ACK) {
+          packet.type = isBinaryEvent ? PacketType.EVENT : PacketType.ACK;
+          // binary packet's json
+          this.reconstructor = new BinaryReconstructor(packet);
+          // no attachments, labeled binary but no binary data to follow
+          if (packet.attachments === 0) {
+            _Emitter.prototype.emitReserved.call(this, "decoded", packet);
+          }
+        } else {
+          // non-binary full packet
+          _Emitter.prototype.emitReserved.call(this, "decoded", packet);
+        }
+      } else if (isBinary(obj) || obj.base64) {
+        // raw binary data
+        if (!this.reconstructor) {
+          throw new Error("got binary data when not reconstructing a packet");
+        } else {
+          packet = this.reconstructor.takeBinaryData(obj);
+          if (packet) {
+            // received final buffer
+            this.reconstructor = null;
+            _Emitter.prototype.emitReserved.call(this, "decoded", packet);
+          }
+        }
+      } else {
+        throw new Error("Unknown type: " + obj);
+      }
+    }
+    /**
+     * Decode a packet String (JSON data)
+     *
+     * @param {String} str
+     * @return {Object} packet
+     */;
+    _proto2.decodeString = function decodeString(str) {
+      var i = 0;
+      // look up type
+      var p = {
+        type: Number(str.charAt(0))
+      };
+      if (PacketType[p.type] === undefined) {
+        throw new Error("unknown packet type " + p.type);
+      }
+      // look up attachments if type binary
+      if (p.type === PacketType.BINARY_EVENT || p.type === PacketType.BINARY_ACK) {
+        var start = i + 1;
+        while (str.charAt(++i) !== "-" && i != str.length) {}
+        var buf = str.substring(start, i);
+        if (buf != Number(buf) || str.charAt(i) !== "-") {
+          throw new Error("Illegal attachments");
+        }
+        p.attachments = Number(buf);
+      }
+      // look up namespace (if any)
+      if ("/" === str.charAt(i + 1)) {
+        var _start = i + 1;
+        while (++i) {
+          var c = str.charAt(i);
+          if ("," === c) break;
+          if (i === str.length) break;
+        }
+        p.nsp = str.substring(_start, i);
+      } else {
+        p.nsp = "/";
+      }
+      // look up id
+      var next = str.charAt(i + 1);
+      if ("" !== next && Number(next) == next) {
+        var _start2 = i + 1;
+        while (++i) {
+          var _c = str.charAt(i);
+          if (null == _c || Number(_c) != _c) {
+            --i;
+            break;
+          }
+          if (i === str.length) break;
+        }
+        p.id = Number(str.substring(_start2, i + 1));
+      }
+      // look up json data
+      if (str.charAt(++i)) {
+        var payload = this.tryParse(str.substr(i));
+        if (Decoder.isPayloadValid(p.type, payload)) {
+          p.data = payload;
+        } else {
+          throw new Error("invalid payload");
+        }
+      }
+      return p;
+    };
+    _proto2.tryParse = function tryParse(str) {
+      try {
+        return JSON.parse(str, this.reviver);
+      } catch (e) {
+        return false;
+      }
+    };
+    Decoder.isPayloadValid = function isPayloadValid(type, payload) {
+      switch (type) {
+        case PacketType.CONNECT:
+          return isObject(payload);
+        case PacketType.DISCONNECT:
+          return payload === undefined;
+        case PacketType.CONNECT_ERROR:
+          return typeof payload === "string" || isObject(payload);
+        case PacketType.EVENT:
+        case PacketType.BINARY_EVENT:
+          return Array.isArray(payload) && (typeof payload[0] === "number" || typeof payload[0] === "string" && RESERVED_EVENTS$1.indexOf(payload[0]) === -1);
+        case PacketType.ACK:
+        case PacketType.BINARY_ACK:
+          return Array.isArray(payload);
+      }
+    }
+    /**
+     * Deallocates a parser's resources
+     */;
+    _proto2.destroy = function destroy() {
+      if (this.reconstructor) {
+        this.reconstructor.finishedReconstruction();
+        this.reconstructor = null;
+      }
+    };
+    return Decoder;
+  }(Emitter);
+  /**
+   * A manager of a binary event's 'buffer sequence'. Should
+   * be constructed whenever a packet of type BINARY_EVENT is
+   * decoded.
+   *
+   * @param {Object} packet
+   * @return {BinaryReconstructor} initialized reconstructor
+   */
+  var BinaryReconstructor = /*#__PURE__*/function () {
+    function BinaryReconstructor(packet) {
+      this.packet = packet;
+      this.buffers = [];
+      this.reconPack = packet;
+    }
+    /**
+     * Method to be called when binary data received from connection
+     * after a BINARY_EVENT packet.
+     *
+     * @param {Buffer | ArrayBuffer} binData - the raw binary data received
+     * @return {null | Object} returns null if more binary data is expected or
+     *   a reconstructed packet object if all buffers have been received.
+     */
+    var _proto3 = BinaryReconstructor.prototype;
+    _proto3.takeBinaryData = function takeBinaryData(binData) {
+      this.buffers.push(binData);
+      if (this.buffers.length === this.reconPack.attachments) {
+        // done with buffer list
+        var packet = reconstructPacket(this.reconPack, this.buffers);
+        this.finishedReconstruction();
+        return packet;
+      }
+      return null;
+    }
+    /**
+     * Cleans up binary packet reconstruction variables.
+     */;
+    _proto3.finishedReconstruction = function finishedReconstruction() {
+      this.reconPack = null;
+      this.buffers = [];
+    };
+    return BinaryReconstructor;
+  }();
+  function isNamespaceValid(nsp) {
+    return typeof nsp === "string";
+  }
+  // see https://caniuse.com/mdn-javascript_builtins_number_isinteger
+  var isInteger = Number.isInteger || function (value) {
+    return typeof value === "number" && isFinite(value) && Math.floor(value) === value;
+  };
+  function isAckIdValid(id) {
+    return id === undefined || isInteger(id);
+  }
+  // see https://stackoverflow.com/questions/8511281/check-if-a-value-is-an-object-in-javascript
+  function isObject(value) {
+    return Object.prototype.toString.call(value) === "[object Object]";
+  }
+  function isDataValid(type, payload) {
+    switch (type) {
+      case PacketType.CONNECT:
+        return payload === undefined || isObject(payload);
+      case PacketType.DISCONNECT:
+        return payload === undefined;
+      case PacketType.EVENT:
+        return Array.isArray(payload) && (typeof payload[0] === "number" || typeof payload[0] === "string" && RESERVED_EVENTS$1.indexOf(payload[0]) === -1);
+      case PacketType.ACK:
+        return Array.isArray(payload);
+      case PacketType.CONNECT_ERROR:
+        return typeof payload === "string" || isObject(payload);
+      default:
+        return false;
+    }
+  }
+  function isPacketValid(packet) {
+    return isNamespaceValid(packet.nsp) && isAckIdValid(packet.id) && isDataValid(packet.type, packet.data);
+  }
+
+  var parser = /*#__PURE__*/Object.freeze({
+    __proto__: null,
+    protocol: protocol,
+    get PacketType () { return PacketType; },
+    Encoder: Encoder,
+    Decoder: Decoder,
+    isPacketValid: isPacketValid
+  });
+
+  function on(obj, ev, fn) {
+    obj.on(ev, fn);
+    return function subDestroy() {
+      obj.off(ev, fn);
+    };
+  }
+
+  var debug$2 = debugModule("socket.io-client:socket"); // debug()
+  /**
+   * Internal events.
+   * These events can't be emitted by the user.
+   */
+  var RESERVED_EVENTS = Object.freeze({
+    connect: 1,
+    connect_error: 1,
+    disconnect: 1,
+    disconnecting: 1,
+    // EventEmitter reserved events: https://nodejs.org/api/events.html#events_event_newlistener
+    newListener: 1,
+    removeListener: 1
+  });
+  /**
+   * A Socket is the fundamental class for interacting with the server.
+   *
+   * A Socket belongs to a certain Namespace (by default /) and uses an underlying {@link Manager} to communicate.
+   *
+   * @example
+   * const socket = io();
+   *
+   * socket.on("connect", () => {
+   *   console.log("connected");
+   * });
+   *
+   * // send an event to the server
+   * socket.emit("foo", "bar");
+   *
+   * socket.on("foobar", () => {
+   *   // an event was received from the server
+   * });
+   *
+   * // upon disconnection
+   * socket.on("disconnect", (reason) => {
+   *   console.log(`disconnected due to ${reason}`);
+   * });
+   */
+  var Socket = /*#__PURE__*/function (_Emitter) {
+    /**
+     * `Socket` constructor.
+     */
+    function Socket(io, nsp, opts) {
+      var _this;
+      _this = _Emitter.call(this) || this;
+      /**
+       * Whether the socket is currently connected to the server.
+       *
+       * @example
+       * const socket = io();
+       *
+       * socket.on("connect", () => {
+       *   console.log(socket.connected); // true
+       * });
+       *
+       * socket.on("disconnect", () => {
+       *   console.log(socket.connected); // false
+       * });
+       */
+      _this.connected = false;
+      /**
+       * Whether the connection state was recovered after a temporary disconnection. In that case, any missed packets will
+       * be transmitted by the server.
+       */
+      _this.recovered = false;
+      /**
+       * Buffer for packets received before the CONNECT packet
+       */
+      _this.receiveBuffer = [];
+      /**
+       * Buffer for packets that will be sent once the socket is connected
+       */
+      _this.sendBuffer = [];
+      /**
+       * The queue of packets to be sent with retry in case of failure.
+       *
+       * Packets are sent one by one, each waiting for the server acknowledgement, in order to guarantee the delivery order.
+       * @private
+       */
+      _this._queue = [];
+      /**
+       * A sequence to generate the ID of the {@link QueuedPacket}.
+       * @private
+       */
+      _this._queueSeq = 0;
+      _this.ids = 0;
+      /**
+       * A map containing acknowledgement handlers.
+       *
+       * The `withError` attribute is used to differentiate handlers that accept an error as first argument:
+       *
+       * - `socket.emit("test", (err, value) => { ... })` with `ackTimeout` option
+       * - `socket.timeout(5000).emit("test", (err, value) => { ... })`
+       * - `const value = await socket.emitWithAck("test")`
+       *
+       * From those that don't:
+       *
+       * - `socket.emit("test", (value) => { ... });`
+       *
+       * In the first case, the handlers will be called with an error when:
+       *
+       * - the timeout is reached
+       * - the socket gets disconnected
+       *
+       * In the second case, the handlers will be simply discarded upon disconnection, since the client will never receive
+       * an acknowledgement from the server.
+       *
+       * @private
+       */
+      _this.acks = {};
+      _this.flags = {};
+      _this.io = io;
+      _this.nsp = nsp;
+      if (opts && opts.auth) {
+        _this.auth = opts.auth;
+      }
+      _this._opts = _extends({}, opts);
+      if (_this.io._autoConnect) _this.open();
+      return _this;
+    }
+    /**
+     * Whether the socket is currently disconnected
+     *
+     * @example
+     * const socket = io();
+     *
+     * socket.on("connect", () => {
+     *   console.log(socket.disconnected); // false
+     * });
+     *
+     * socket.on("disconnect", () => {
+     *   console.log(socket.disconnected); // true
+     * });
+     */
+    _inheritsLoose(Socket, _Emitter);
+    var _proto = Socket.prototype;
+    /**
+     * Subscribe to open, close and packet events
+     *
+     * @private
+     */
+    _proto.subEvents = function subEvents() {
+      if (this.subs) return;
+      var io = this.io;
+      this.subs = [on(io, "open", this.onopen.bind(this)), on(io, "packet", this.onpacket.bind(this)), on(io, "error", this.onerror.bind(this)), on(io, "close", this.onclose.bind(this))];
+    }
+    /**
+     * Whether the Socket will try to reconnect when its Manager connects or reconnects.
+     *
+     * @example
+     * const socket = io();
+     *
+     * console.log(socket.active); // true
+     *
+     * socket.on("disconnect", (reason) => {
+     *   if (reason === "io server disconnect") {
+     *     // the disconnection was initiated by the server, you need to manually reconnect
+     *     console.log(socket.active); // false
+     *   }
+     *   // else the socket will automatically try to reconnect
+     *   console.log(socket.active); // true
+     * });
+     */;
+    /**
+     * "Opens" the socket.
+     *
+     * @example
+     * const socket = io({
+     *   autoConnect: false
+     * });
+     *
+     * socket.connect();
+     */
+    _proto.connect = function connect() {
+      if (this.connected) return this;
+      this.subEvents();
+      if (!this.io["_reconnecting"]) this.io.open(); // ensure open
+      if ("open" === this.io._readyState) this.onopen();
+      return this;
+    }
+    /**
+     * Alias for {@link connect()}.
+     */;
+    _proto.open = function open() {
+      return this.connect();
+    }
+    /**
+     * Sends a `message` event.
+     *
+     * This method mimics the WebSocket.send() method.
+     *
+     * @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
+     *
+     * @example
+     * socket.send("hello");
+     *
+     * // this is equivalent to
+     * socket.emit("message", "hello");
+     *
+     * @return self
+     */;
+    _proto.send = function send() {
+      for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+        args[_key] = arguments[_key];
+      }
+      args.unshift("message");
+      this.emit.apply(this, args);
+      return this;
+    }
+    /**
+     * Override `emit`.
+     * If the event is in `events`, it's emitted normally.
+     *
+     * @example
+     * socket.emit("hello", "world");
+     *
+     * // all serializable datastructures are supported (no need to call JSON.stringify)
+     * socket.emit("hello", 1, "2", { 3: ["4"], 5: Uint8Array.from([6]) });
+     *
+     * // with an acknowledgement from the server
+     * socket.emit("hello", "world", (val) => {
+     *   // ...
+     * });
+     *
+     * @return self
+     */;
+    _proto.emit = function emit(ev) {
+      var _a, _b, _c;
+      if (RESERVED_EVENTS.hasOwnProperty(ev)) {
+        throw new Error('"' + ev.toString() + '" is a reserved event name');
+      }
+      for (var _len2 = arguments.length, args = new Array(_len2 > 1 ? _len2 - 1 : 0), _key2 = 1; _key2 < _len2; _key2++) {
+        args[_key2 - 1] = arguments[_key2];
+      }
+      args.unshift(ev);
+      if (this._opts.retries && !this.flags.fromQueue && !this.flags["volatile"]) {
+        this._addToQueue(args);
+        return this;
+      }
+      var packet = {
+        type: PacketType.EVENT,
+        data: args
+      };
+      packet.options = {};
+      packet.options.compress = this.flags.compress !== false;
+      // event ack callback
+      if ("function" === typeof args[args.length - 1]) {
+        var id = this.ids++;
+        debug$2("emitting packet with ack id %d", id);
+        var ack = args.pop();
+        this._registerAckCallback(id, ack);
+        packet.id = id;
+      }
+      var isTransportWritable = (_b = (_a = this.io.engine) === null || _a === void 0 ? void 0 : _a.transport) === null || _b === void 0 ? void 0 : _b.writable;
+      var isConnected = this.connected && !((_c = this.io.engine) === null || _c === void 0 ? void 0 : _c._hasPingExpired());
+      var discardPacket = this.flags["volatile"] && !isTransportWritable;
+      if (discardPacket) {
+        debug$2("discard packet as the transport is not currently writable");
+      } else if (isConnected) {
+        this.notifyOutgoingListeners(packet);
+        this.packet(packet);
+      } else {
+        this.sendBuffer.push(packet);
+      }
+      this.flags = {};
+      return this;
+    }
+    /**
+     * @private
+     */;
+    _proto._registerAckCallback = function _registerAckCallback(id, ack) {
+      var _this2 = this;
+      var _a;
+      var timeout = (_a = this.flags.timeout) !== null && _a !== void 0 ? _a : this._opts.ackTimeout;
+      if (timeout === undefined) {
+        this.acks[id] = ack;
+        return;
+      }
+      // @ts-ignore
+      var timer = this.io.setTimeoutFn(function () {
+        delete _this2.acks[id];
+        for (var i = 0; i < _this2.sendBuffer.length; i++) {
+          if (_this2.sendBuffer[i].id === id) {
+            debug$2("removing packet with ack id %d from the buffer", id);
+            _this2.sendBuffer.splice(i, 1);
+          }
+        }
+        debug$2("event with ack id %d has timed out after %d ms", id, timeout);
+        ack.call(_this2, new Error("operation has timed out"));
+      }, timeout);
+      var fn = function fn() {
+        // @ts-ignore
+        _this2.io.clearTimeoutFn(timer);
+        for (var _len3 = arguments.length, args = new Array(_len3), _key3 = 0; _key3 < _len3; _key3++) {
+          args[_key3] = arguments[_key3];
+        }
+        ack.apply(_this2, args);
+      };
+      fn.withError = true;
+      this.acks[id] = fn;
+    }
+    /**
+     * Emits an event and waits for an acknowledgement
+     *
+     * @example
+     * // without timeout
+     * const response = await socket.emitWithAck("hello", "world");
+     *
+     * // with a specific timeout
+     * try {
+     *   const response = await socket.timeout(1000).emitWithAck("hello", "world");
+     * } catch (err) {
+     *   // the server did not acknowledge the event in the given delay
+     * }
+     *
+     * @return a Promise that will be fulfilled when the server acknowledges the event
+     */;
+    _proto.emitWithAck = function emitWithAck(ev) {
+      var _this3 = this;
+      for (var _len4 = arguments.length, args = new Array(_len4 > 1 ? _len4 - 1 : 0), _key4 = 1; _key4 < _len4; _key4++) {
+        args[_key4 - 1] = arguments[_key4];
+      }
+      return new Promise(function (resolve, reject) {
+        var fn = function fn(arg1, arg2) {
+          return arg1 ? reject(arg1) : resolve(arg2);
+        };
+        fn.withError = true;
+        args.push(fn);
+        _this3.emit.apply(_this3, [ev].concat(args));
+      });
+    }
+    /**
+     * Add the packet to the queue.
+     * @param args
+     * @private
+     */;
+    _proto._addToQueue = function _addToQueue(args) {
+      var _this4 = this;
+      var ack;
+      if (typeof args[args.length - 1] === "function") {
+        ack = args.pop();
+      }
+      var packet = {
+        id: this._queueSeq++,
+        tryCount: 0,
+        pending: false,
+        args: args,
+        flags: _extends({
+          fromQueue: true
+        }, this.flags)
+      };
+      args.push(function (err) {
+        if (packet !== _this4._queue[0]) {
+          // the packet has already been acknowledged
+          return;
+        }
+        var hasError = err !== null;
+        if (hasError) {
+          if (packet.tryCount > _this4._opts.retries) {
+            debug$2("packet [%d] is discarded after %d tries", packet.id, packet.tryCount);
+            _this4._queue.shift();
+            if (ack) {
+              ack(err);
+            }
+          }
+        } else {
+          debug$2("packet [%d] was successfully sent", packet.id);
+          _this4._queue.shift();
+          if (ack) {
+            for (var _len5 = arguments.length, responseArgs = new Array(_len5 > 1 ? _len5 - 1 : 0), _key5 = 1; _key5 < _len5; _key5++) {
+              responseArgs[_key5 - 1] = arguments[_key5];
+            }
+            ack.apply(void 0, [null].concat(responseArgs));
+          }
+        }
+        packet.pending = false;
+        return _this4._drainQueue();
+      });
+      this._queue.push(packet);
+      this._drainQueue();
+    }
+    /**
+     * Send the first packet of the queue, and wait for an acknowledgement from the server.
+     * @param force - whether to resend a packet that has not been acknowledged yet
+     *
+     * @private
+     */;
+    _proto._drainQueue = function _drainQueue() {
+      var force = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
+      debug$2("draining queue");
+      if (!this.connected || this._queue.length === 0) {
+        return;
+      }
+      var packet = this._queue[0];
+      if (packet.pending && !force) {
+        debug$2("packet [%d] has already been sent and is waiting for an ack", packet.id);
+        return;
+      }
+      packet.pending = true;
+      packet.tryCount++;
+      debug$2("sending packet [%d] (try n°%d)", packet.id, packet.tryCount);
+      this.flags = packet.flags;
+      this.emit.apply(this, packet.args);
+    }
+    /**
+     * Sends a packet.
+     *
+     * @param packet
+     * @private
+     */;
+    _proto.packet = function packet(_packet) {
+      _packet.nsp = this.nsp;
+      this.io._packet(_packet);
+    }
+    /**
+     * Called upon engine `open`.
+     *
+     * @private
+     */;
+    _proto.onopen = function onopen() {
+      var _this5 = this;
+      debug$2("transport is open - connecting");
+      if (typeof this.auth == "function") {
+        this.auth(function (data) {
+          _this5._sendConnectPacket(data);
+        });
+      } else {
+        this._sendConnectPacket(this.auth);
+      }
+    }
+    /**
+     * Sends a CONNECT packet to initiate the Socket.IO session.
+     *
+     * @param data
+     * @private
+     */;
+    _proto._sendConnectPacket = function _sendConnectPacket(data) {
+      this.packet({
+        type: PacketType.CONNECT,
+        data: this._pid ? _extends({
+          pid: this._pid,
+          offset: this._lastOffset
+        }, data) : data
+      });
+    }
+    /**
+     * Called upon engine or manager `error`.
+     *
+     * @param err
+     * @private
+     */;
+    _proto.onerror = function onerror(err) {
+      if (!this.connected) {
+        this.emitReserved("connect_error", err);
+      }
+    }
+    /**
+     * Called upon engine `close`.
+     *
+     * @param reason
+     * @param description
+     * @private
+     */;
+    _proto.onclose = function onclose(reason, description) {
+      debug$2("close (%s)", reason);
+      this.connected = false;
+      delete this.id;
+      this.emitReserved("disconnect", reason, description);
+      this._clearAcks();
+    }
+    /**
+     * Clears the acknowledgement handlers upon disconnection, since the client will never receive an acknowledgement from
+     * the server.
+     *
+     * @private
+     */;
+    _proto._clearAcks = function _clearAcks() {
+      var _this6 = this;
+      Object.keys(this.acks).forEach(function (id) {
+        var isBuffered = _this6.sendBuffer.some(function (packet) {
+          return String(packet.id) === id;
+        });
+        if (!isBuffered) {
+          // note: handlers that do not accept an error as first argument are ignored here
+          var ack = _this6.acks[id];
+          delete _this6.acks[id];
+          if (ack.withError) {
+            ack.call(_this6, new Error("socket has been disconnected"));
+          }
+        }
+      });
+    }
+    /**
+     * Called with socket packet.
+     *
+     * @param packet
+     * @private
+     */;
+    _proto.onpacket = function onpacket(packet) {
+      var sameNamespace = packet.nsp === this.nsp;
+      if (!sameNamespace) return;
+      switch (packet.type) {
+        case PacketType.CONNECT:
+          if (packet.data && packet.data.sid) {
+            this.onconnect(packet.data.sid, packet.data.pid);
+          } else {
+            this.emitReserved("connect_error", new Error("It seems you are trying to reach a Socket.IO server in v2.x with a v3.x client, but they are not compatible (more information here: https://socket.io/docs/v3/migrating-from-2-x-to-3-0/)"));
+          }
+          break;
+        case PacketType.EVENT:
+        case PacketType.BINARY_EVENT:
+          this.onevent(packet);
+          break;
+        case PacketType.ACK:
+        case PacketType.BINARY_ACK:
+          this.onack(packet);
+          break;
+        case PacketType.DISCONNECT:
+          this.ondisconnect();
+          break;
+        case PacketType.CONNECT_ERROR:
+          this.destroy();
+          var err = new Error(packet.data.message);
+          // @ts-ignore
+          err.data = packet.data.data;
+          this.emitReserved("connect_error", err);
+          break;
+      }
+    }
+    /**
+     * Called upon a server event.
+     *
+     * @param packet
+     * @private
+     */;
+    _proto.onevent = function onevent(packet) {
+      var args = packet.data || [];
+      debug$2("emitting event %j", args);
+      if (null != packet.id) {
+        debug$2("attaching ack callback to event");
+        args.push(this.ack(packet.id));
+      }
+      if (this.connected) {
+        this.emitEvent(args);
+      } else {
+        this.receiveBuffer.push(Object.freeze(args));
+      }
+    };
+    _proto.emitEvent = function emitEvent(args) {
+      if (this._anyListeners && this._anyListeners.length) {
+        var listeners = this._anyListeners.slice();
+        var _iterator = _createForOfIteratorHelper(listeners),
+          _step;
+        try {
+          for (_iterator.s(); !(_step = _iterator.n()).done;) {
+            var listener = _step.value;
+            listener.apply(this, args);
+          }
+        } catch (err) {
+          _iterator.e(err);
+        } finally {
+          _iterator.f();
+        }
+      }
+      _Emitter.prototype.emit.apply(this, args);
+      if (this._pid && args.length && typeof args[args.length - 1] === "string") {
+        this._lastOffset = args[args.length - 1];
+      }
+    }
+    /**
+     * Produces an ack callback to emit with an event.
+     *
+     * @private
+     */;
+    _proto.ack = function ack(id) {
+      var self = this;
+      var sent = false;
+      return function () {
+        // prevent double callbacks
+        if (sent) return;
+        sent = true;
+        for (var _len6 = arguments.length, args = new Array(_len6), _key6 = 0; _key6 < _len6; _key6++) {
+          args[_key6] = arguments[_key6];
+        }
+        debug$2("sending ack %j", args);
+        self.packet({
+          type: PacketType.ACK,
+          id: id,
+          data: args
+        });
+      };
+    }
+    /**
+     * Called upon a server acknowledgement.
+     *
+     * @param packet
+     * @private
+     */;
+    _proto.onack = function onack(packet) {
+      var ack = this.acks[packet.id];
+      if (typeof ack !== "function") {
+        debug$2("bad ack %s", packet.id);
+        return;
+      }
+      delete this.acks[packet.id];
+      debug$2("calling ack %s with %j", packet.id, packet.data);
+      // @ts-ignore FIXME ack is incorrectly inferred as 'never'
+      if (ack.withError) {
+        packet.data.unshift(null);
+      }
+      // @ts-ignore
+      ack.apply(this, packet.data);
+    }
+    /**
+     * Called upon server connect.
+     *
+     * @private
+     */;
+    _proto.onconnect = function onconnect(id, pid) {
+      debug$2("socket connected with id %s", id);
+      this.id = id;
+      this.recovered = pid && this._pid === pid;
+      this._pid = pid; // defined only if connection state recovery is enabled
+      this.connected = true;
+      this.emitBuffered();
+      this.emitReserved("connect");
+      this._drainQueue(true);
+    }
+    /**
+     * Emit buffered events (received and emitted).
+     *
+     * @private
+     */;
+    _proto.emitBuffered = function emitBuffered() {
+      var _this7 = this;
+      this.receiveBuffer.forEach(function (args) {
+        return _this7.emitEvent(args);
+      });
+      this.receiveBuffer = [];
+      this.sendBuffer.forEach(function (packet) {
+        _this7.notifyOutgoingListeners(packet);
+        _this7.packet(packet);
+      });
+      this.sendBuffer = [];
+    }
+    /**
+     * Called upon server disconnect.
+     *
+     * @private
+     */;
+    _proto.ondisconnect = function ondisconnect() {
+      debug$2("server disconnect (%s)", this.nsp);
+      this.destroy();
+      this.onclose("io server disconnect");
+    }
+    /**
+     * Called upon forced client/server side disconnections,
+     * this method ensures the manager stops tracking us and
+     * that reconnections don't get triggered for this.
+     *
+     * @private
+     */;
+    _proto.destroy = function destroy() {
+      if (this.subs) {
+        // clean subscriptions to avoid reconnections
+        this.subs.forEach(function (subDestroy) {
+          return subDestroy();
+        });
+        this.subs = undefined;
+      }
+      this.io["_destroy"](this);
+    }
+    /**
+     * Disconnects the socket manually. In that case, the socket will not try to reconnect.
+     *
+     * If this is the last active Socket instance of the {@link Manager}, the low-level connection will be closed.
+     *
+     * @example
+     * const socket = io();
+     *
+     * socket.on("disconnect", (reason) => {
+     *   // console.log(reason); prints "io client disconnect"
+     * });
+     *
+     * socket.disconnect();
+     *
+     * @return self
+     */;
+    _proto.disconnect = function disconnect() {
+      if (this.connected) {
+        debug$2("performing disconnect (%s)", this.nsp);
+        this.packet({
+          type: PacketType.DISCONNECT
+        });
+      }
+      // remove socket from pool
+      this.destroy();
+      if (this.connected) {
+        // fire events
+        this.onclose("io client disconnect");
+      }
+      return this;
+    }
+    /**
+     * Alias for {@link disconnect()}.
+     *
+     * @return self
+     */;
+    _proto.close = function close() {
+      return this.disconnect();
+    }
+    /**
+     * Sets the compress flag.
+     *
+     * @example
+     * socket.compress(false).emit("hello");
+     *
+     * @param compress - if `true`, compresses the sending data
+     * @return self
+     */;
+    _proto.compress = function compress(_compress) {
+      this.flags.compress = _compress;
+      return this;
+    }
+    /**
+     * Sets a modifier for a subsequent event emission that the event message will be dropped when this socket is not
+     * ready to send messages.
+     *
+     * @example
+     * socket.volatile.emit("hello"); // the server may or may not receive it
+     *
+     * @returns self
+     */;
+    /**
+     * Sets a modifier for a subsequent event emission that the callback will be called with an error when the
+     * given number of milliseconds have elapsed without an acknowledgement from the server:
+     *
+     * @example
+     * socket.timeout(5000).emit("my-event", (err) => {
+     *   if (err) {
+     *     // the server did not acknowledge the event in the given delay
+     *   }
+     * });
+     *
+     * @returns self
+     */
+    _proto.timeout = function timeout(_timeout) {
+      this.flags.timeout = _timeout;
+      return this;
+    }
+    /**
+     * Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
+     * callback.
+     *
+     * @example
+     * socket.onAny((event, ...args) => {
+     *   console.log(`got ${event}`);
+     * });
+     *
+     * @param listener
+     */;
+    _proto.onAny = function onAny(listener) {
+      this._anyListeners = this._anyListeners || [];
+      this._anyListeners.push(listener);
+      return this;
+    }
+    /**
+     * Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
+     * callback. The listener is added to the beginning of the listeners array.
+     *
+     * @example
+     * socket.prependAny((event, ...args) => {
+     *   console.log(`got event ${event}`);
+     * });
+     *
+     * @param listener
+     */;
+    _proto.prependAny = function prependAny(listener) {
+      this._anyListeners = this._anyListeners || [];
+      this._anyListeners.unshift(listener);
+      return this;
+    }
+    /**
+     * Removes the listener that will be fired when any event is emitted.
+     *
+     * @example
+     * const catchAllListener = (event, ...args) => {
+     *   console.log(`got event ${event}`);
+     * }
+     *
+     * socket.onAny(catchAllListener);
+     *
+     * // remove a specific listener
+     * socket.offAny(catchAllListener);
+     *
+     * // or remove all listeners
+     * socket.offAny();
+     *
+     * @param listener
+     */;
+    _proto.offAny = function offAny(listener) {
+      if (!this._anyListeners) {
+        return this;
+      }
+      if (listener) {
+        var listeners = this._anyListeners;
+        for (var i = 0; i < listeners.length; i++) {
+          if (listener === listeners[i]) {
+            listeners.splice(i, 1);
+            return this;
+          }
+        }
+      } else {
+        this._anyListeners = [];
+      }
+      return this;
+    }
+    /**
+     * Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
+     * e.g. to remove listeners.
+     */;
+    _proto.listenersAny = function listenersAny() {
+      return this._anyListeners || [];
+    }
+    /**
+     * Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
+     * callback.
+     *
+     * Note: acknowledgements sent to the server are not included.
+     *
+     * @example
+     * socket.onAnyOutgoing((event, ...args) => {
+     *   console.log(`sent event ${event}`);
+     * });
+     *
+     * @param listener
+     */;
+    _proto.onAnyOutgoing = function onAnyOutgoing(listener) {
+      this._anyOutgoingListeners = this._anyOutgoingListeners || [];
+      this._anyOutgoingListeners.push(listener);
+      return this;
+    }
+    /**
+     * Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
+     * callback. The listener is added to the beginning of the listeners array.
+     *
+     * Note: acknowledgements sent to the server are not included.
+     *
+     * @example
+     * socket.prependAnyOutgoing((event, ...args) => {
+     *   console.log(`sent event ${event}`);
+     * });
+     *
+     * @param listener
+     */;
+    _proto.prependAnyOutgoing = function prependAnyOutgoing(listener) {
+      this._anyOutgoingListeners = this._anyOutgoingListeners || [];
+      this._anyOutgoingListeners.unshift(listener);
+      return this;
+    }
+    /**
+     * Removes the listener that will be fired when any event is emitted.
+     *
+     * @example
+     * const catchAllListener = (event, ...args) => {
+     *   console.log(`sent event ${event}`);
+     * }
+     *
+     * socket.onAnyOutgoing(catchAllListener);
+     *
+     * // remove a specific listener
+     * socket.offAnyOutgoing(catchAllListener);
+     *
+     * // or remove all listeners
+     * socket.offAnyOutgoing();
+     *
+     * @param [listener] - the catch-all listener (optional)
+     */;
+    _proto.offAnyOutgoing = function offAnyOutgoing(listener) {
+      if (!this._anyOutgoingListeners) {
+        return this;
+      }
+      if (listener) {
+        var listeners = this._anyOutgoingListeners;
+        for (var i = 0; i < listeners.length; i++) {
+          if (listener === listeners[i]) {
+            listeners.splice(i, 1);
+            return this;
+          }
+        }
+      } else {
+        this._anyOutgoingListeners = [];
+      }
+      return this;
+    }
+    /**
+     * Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
+     * e.g. to remove listeners.
+     */;
+    _proto.listenersAnyOutgoing = function listenersAnyOutgoing() {
+      return this._anyOutgoingListeners || [];
+    }
+    /**
+     * Notify the listeners for each packet sent
+     *
+     * @param packet
+     *
+     * @private
+     */;
+    _proto.notifyOutgoingListeners = function notifyOutgoingListeners(packet) {
+      if (this._anyOutgoingListeners && this._anyOutgoingListeners.length) {
+        var listeners = this._anyOutgoingListeners.slice();
+        var _iterator2 = _createForOfIteratorHelper(listeners),
+          _step2;
+        try {
+          for (_iterator2.s(); !(_step2 = _iterator2.n()).done;) {
+            var listener = _step2.value;
+            listener.apply(this, packet.data);
+          }
+        } catch (err) {
+          _iterator2.e(err);
+        } finally {
+          _iterator2.f();
+        }
+      }
+    };
+    return _createClass(Socket, [{
+      key: "disconnected",
+      get: function get() {
+        return !this.connected;
+      }
+    }, {
+      key: "active",
+      get: function get() {
+        return !!this.subs;
+      }
+    }, {
+      key: "volatile",
+      get: function get() {
+        this.flags["volatile"] = true;
+        return this;
+      }
+    }]);
+  }(Emitter);
+
+  /**
+   * Initialize backoff timer with `opts`.
+   *
+   * - `min` initial timeout in milliseconds [100]
+   * - `max` max timeout [10000]
+   * - `jitter` [0]
+   * - `factor` [2]
+   *
+   * @param {Object} opts
+   * @api public
+   */
+  function Backoff(opts) {
+    opts = opts || {};
+    this.ms = opts.min || 100;
+    this.max = opts.max || 10000;
+    this.factor = opts.factor || 2;
+    this.jitter = opts.jitter > 0 && opts.jitter <= 1 ? opts.jitter : 0;
+    this.attempts = 0;
+  }
+  /**
+   * Return the backoff duration.
+   *
+   * @return {Number}
+   * @api public
+   */
+  Backoff.prototype.duration = function () {
+    var ms = this.ms * Math.pow(this.factor, this.attempts++);
+    if (this.jitter) {
+      var rand = Math.random();
+      var deviation = Math.floor(rand * this.jitter * ms);
+      ms = (Math.floor(rand * 10) & 1) == 0 ? ms - deviation : ms + deviation;
+    }
+    return Math.min(ms, this.max) | 0;
+  };
+  /**
+   * Reset the number of attempts.
+   *
+   * @api public
+   */
+  Backoff.prototype.reset = function () {
+    this.attempts = 0;
+  };
+  /**
+   * Set the minimum duration
+   *
+   * @api public
+   */
+  Backoff.prototype.setMin = function (min) {
+    this.ms = min;
+  };
+  /**
+   * Set the maximum duration
+   *
+   * @api public
+   */
+  Backoff.prototype.setMax = function (max) {
+    this.max = max;
+  };
+  /**
+   * Set the jitter
+   *
+   * @api public
+   */
+  Backoff.prototype.setJitter = function (jitter) {
+    this.jitter = jitter;
+  };
+
+  var debug$1 = debugModule("socket.io-client:manager"); // debug()
+  var Manager = /*#__PURE__*/function (_Emitter) {
+    function Manager(uri, opts) {
+      var _this;
+      var _a;
+      _this = _Emitter.call(this) || this;
+      _this.nsps = {};
+      _this.subs = [];
+      if (uri && "object" === _typeof(uri)) {
+        opts = uri;
+        uri = undefined;
+      }
+      opts = opts || {};
+      opts.path = opts.path || "/socket.io";
+      _this.opts = opts;
+      installTimerFunctions(_this, opts);
+      _this.reconnection(opts.reconnection !== false);
+      _this.reconnectionAttempts(opts.reconnectionAttempts || Infinity);
+      _this.reconnectionDelay(opts.reconnectionDelay || 1000);
+      _this.reconnectionDelayMax(opts.reconnectionDelayMax || 5000);
+      _this.randomizationFactor((_a = opts.randomizationFactor) !== null && _a !== void 0 ? _a : 0.5);
+      _this.backoff = new Backoff({
+        min: _this.reconnectionDelay(),
+        max: _this.reconnectionDelayMax(),
+        jitter: _this.randomizationFactor()
+      });
+      _this.timeout(null == opts.timeout ? 20000 : opts.timeout);
+      _this._readyState = "closed";
+      _this.uri = uri;
+      var _parser = opts.parser || parser;
+      _this.encoder = new _parser.Encoder();
+      _this.decoder = new _parser.Decoder();
+      _this._autoConnect = opts.autoConnect !== false;
+      if (_this._autoConnect) _this.open();
+      return _this;
+    }
+    _inheritsLoose(Manager, _Emitter);
+    var _proto = Manager.prototype;
+    _proto.reconnection = function reconnection(v) {
+      if (!arguments.length) return this._reconnection;
+      this._reconnection = !!v;
+      if (!v) {
+        this.skipReconnect = true;
+      }
+      return this;
+    };
+    _proto.reconnectionAttempts = function reconnectionAttempts(v) {
+      if (v === undefined) return this._reconnectionAttempts;
+      this._reconnectionAttempts = v;
+      return this;
+    };
+    _proto.reconnectionDelay = function reconnectionDelay(v) {
+      var _a;
+      if (v === undefined) return this._reconnectionDelay;
+      this._reconnectionDelay = v;
+      (_a = this.backoff) === null || _a === void 0 ? void 0 : _a.setMin(v);
+      return this;
+    };
+    _proto.randomizationFactor = function randomizationFactor(v) {
+      var _a;
+      if (v === undefined) return this._randomizationFactor;
+      this._randomizationFactor = v;
+      (_a = this.backoff) === null || _a === void 0 ? void 0 : _a.setJitter(v);
+      return this;
+    };
+    _proto.reconnectionDelayMax = function reconnectionDelayMax(v) {
+      var _a;
+      if (v === undefined) return this._reconnectionDelayMax;
+      this._reconnectionDelayMax = v;
+      (_a = this.backoff) === null || _a === void 0 ? void 0 : _a.setMax(v);
+      return this;
+    };
+    _proto.timeout = function timeout(v) {
+      if (!arguments.length) return this._timeout;
+      this._timeout = v;
+      return this;
+    }
+    /**
+     * Starts trying to reconnect if reconnection is enabled and we have not
+     * started reconnecting yet
+     *
+     * @private
+     */;
+    _proto.maybeReconnectOnOpen = function maybeReconnectOnOpen() {
+      // Only try to reconnect if it's the first time we're connecting
+      if (!this._reconnecting && this._reconnection && this.backoff.attempts === 0) {
+        // keeps reconnection from firing twice for the same reconnection loop
+        this.reconnect();
+      }
+    }
+    /**
+     * Sets the current transport `socket`.
+     *
+     * @param {Function} fn - optional, callback
+     * @return self
+     * @public
+     */;
+    _proto.open = function open(fn) {
+      var _this2 = this;
+      debug$1("readyState %s", this._readyState);
+      if (~this._readyState.indexOf("open")) return this;
+      debug$1("opening %s", this.uri);
+      this.engine = new Socket$1(this.uri, this.opts);
+      var socket = this.engine;
+      var self = this;
+      this._readyState = "opening";
+      this.skipReconnect = false;
+      // emit `open`
+      var openSubDestroy = on(socket, "open", function () {
+        self.onopen();
+        fn && fn();
+      });
+      var onError = function onError(err) {
+        debug$1("error");
+        _this2.cleanup();
+        _this2._readyState = "closed";
+        _this2.emitReserved("error", err);
+        if (fn) {
+          fn(err);
+        } else {
+          // Only do this if there is no fn to handle the error
+          _this2.maybeReconnectOnOpen();
+        }
+      };
+      // emit `error`
+      var errorSub = on(socket, "error", onError);
+      if (false !== this._timeout) {
+        var timeout = this._timeout;
+        debug$1("connect attempt will timeout after %d", timeout);
+        // set timer
+        var timer = this.setTimeoutFn(function () {
+          debug$1("connect attempt timed out after %d", timeout);
+          openSubDestroy();
+          onError(new Error("timeout"));
+          socket.close();
+        }, timeout);
+        if (this.opts.autoUnref) {
+          timer.unref();
+        }
+        this.subs.push(function () {
+          _this2.clearTimeoutFn(timer);
+        });
+      }
+      this.subs.push(openSubDestroy);
+      this.subs.push(errorSub);
+      return this;
+    }
+    /**
+     * Alias for open()
+     *
+     * @return self
+     * @public
+     */;
+    _proto.connect = function connect(fn) {
+      return this.open(fn);
+    }
+    /**
+     * Called upon transport open.
+     *
+     * @private
+     */;
+    _proto.onopen = function onopen() {
+      debug$1("open");
+      // clear old subs
+      this.cleanup();
+      // mark as open
+      this._readyState = "open";
+      this.emitReserved("open");
+      // add new subs
+      var socket = this.engine;
+      this.subs.push(on(socket, "ping", this.onping.bind(this)), on(socket, "data", this.ondata.bind(this)), on(socket, "error", this.onerror.bind(this)), on(socket, "close", this.onclose.bind(this)),
+      // @ts-ignore
+      on(this.decoder, "decoded", this.ondecoded.bind(this)));
+    }
+    /**
+     * Called upon a ping.
+     *
+     * @private
+     */;
+    _proto.onping = function onping() {
+      this.emitReserved("ping");
+    }
+    /**
+     * Called with data.
+     *
+     * @private
+     */;
+    _proto.ondata = function ondata(data) {
+      try {
+        this.decoder.add(data);
+      } catch (e) {
+        this.onclose("parse error", e);
+      }
+    }
+    /**
+     * Called when parser fully decodes a packet.
+     *
+     * @private
+     */;
+    _proto.ondecoded = function ondecoded(packet) {
+      var _this3 = this;
+      // the nextTick call prevents an exception in a user-provided event listener from triggering a disconnection due to a "parse error"
+      nextTick(function () {
+        _this3.emitReserved("packet", packet);
+      }, this.setTimeoutFn);
+    }
+    /**
+     * Called upon socket error.
+     *
+     * @private
+     */;
+    _proto.onerror = function onerror(err) {
+      debug$1("error", err);
+      this.emitReserved("error", err);
+    }
+    /**
+     * Creates a new socket for the given `nsp`.
+     *
+     * @return {Socket}
+     * @public
+     */;
+    _proto.socket = function socket(nsp, opts) {
+      var socket = this.nsps[nsp];
+      if (!socket) {
+        socket = new Socket(this, nsp, opts);
+        this.nsps[nsp] = socket;
+      } else if (this._autoConnect && !socket.active) {
+        socket.connect();
+      }
+      return socket;
+    }
+    /**
+     * Called upon a socket close.
+     *
+     * @param socket
+     * @private
+     */;
+    _proto._destroy = function _destroy(socket) {
+      var nsps = Object.keys(this.nsps);
+      for (var _i = 0, _nsps = nsps; _i < _nsps.length; _i++) {
+        var nsp = _nsps[_i];
+        var _socket = this.nsps[nsp];
+        if (_socket.active) {
+          debug$1("socket %s is still active, skipping close", nsp);
+          return;
+        }
+      }
+      this._close();
+    }
+    /**
+     * Writes a packet.
+     *
+     * @param packet
+     * @private
+     */;
+    _proto._packet = function _packet(packet) {
+      debug$1("writing packet %j", packet);
+      var encodedPackets = this.encoder.encode(packet);
+      for (var i = 0; i < encodedPackets.length; i++) {
+        this.engine.write(encodedPackets[i], packet.options);
+      }
+    }
+    /**
+     * Clean up transport subscriptions and packet buffer.
+     *
+     * @private
+     */;
+    _proto.cleanup = function cleanup() {
+      debug$1("cleanup");
+      this.subs.forEach(function (subDestroy) {
+        return subDestroy();
+      });
+      this.subs.length = 0;
+      this.decoder.destroy();
+    }
+    /**
+     * Close the current socket.
+     *
+     * @private
+     */;
+    _proto._close = function _close() {
+      debug$1("disconnect");
+      this.skipReconnect = true;
+      this._reconnecting = false;
+      this.onclose("forced close");
+    }
+    /**
+     * Alias for close()
+     *
+     * @private
+     */;
+    _proto.disconnect = function disconnect() {
+      return this._close();
+    }
+    /**
+     * Called when:
+     *
+     * - the low-level engine is closed
+     * - the parser encountered a badly formatted packet
+     * - all sockets are disconnected
+     *
+     * @private
+     */;
+    _proto.onclose = function onclose(reason, description) {
+      var _a;
+      debug$1("closed due to %s", reason);
+      this.cleanup();
+      (_a = this.engine) === null || _a === void 0 ? void 0 : _a.close();
+      this.backoff.reset();
+      this._readyState = "closed";
+      this.emitReserved("close", reason, description);
+      if (this._reconnection && !this.skipReconnect) {
+        this.reconnect();
+      }
+    }
+    /**
+     * Attempt a reconnection.
+     *
+     * @private
+     */;
+    _proto.reconnect = function reconnect() {
+      var _this4 = this;
+      if (this._reconnecting || this.skipReconnect) return this;
+      var self = this;
+      if (this.backoff.attempts >= this._reconnectionAttempts) {
+        debug$1("reconnect failed");
+        this.backoff.reset();
+        this.emitReserved("reconnect_failed");
+        this._reconnecting = false;
+      } else {
+        var delay = this.backoff.duration();
+        debug$1("will wait %dms before reconnect attempt", delay);
+        this._reconnecting = true;
+        var timer = this.setTimeoutFn(function () {
+          if (self.skipReconnect) return;
+          debug$1("attempting reconnect");
+          _this4.emitReserved("reconnect_attempt", self.backoff.attempts);
+          // check again for the case socket closed in above events
+          if (self.skipReconnect) return;
+          self.open(function (err) {
+            if (err) {
+              debug$1("reconnect attempt error");
+              self._reconnecting = false;
+              self.reconnect();
+              _this4.emitReserved("reconnect_error", err);
+            } else {
+              debug$1("reconnect success");
+              self.onreconnect();
+            }
+          });
+        }, delay);
+        if (this.opts.autoUnref) {
+          timer.unref();
+        }
+        this.subs.push(function () {
+          _this4.clearTimeoutFn(timer);
+        });
+      }
+    }
+    /**
+     * Called upon successful reconnect.
+     *
+     * @private
+     */;
+    _proto.onreconnect = function onreconnect() {
+      var attempt = this.backoff.attempts;
+      this._reconnecting = false;
+      this.backoff.reset();
+      this.emitReserved("reconnect", attempt);
+    };
+    return Manager;
+  }(Emitter);
+
+  var debug = debugModule("socket.io-client"); // debug()
+  /**
+   * Managers cache.
+   */
+  var cache = {};
+  function lookup(uri, opts) {
+    if (_typeof(uri) === "object") {
+      opts = uri;
+      uri = undefined;
+    }
+    opts = opts || {};
+    var parsed = url(uri, opts.path || "/socket.io");
+    var source = parsed.source;
+    var id = parsed.id;
+    var path = parsed.path;
+    var sameNamespace = cache[id] && path in cache[id]["nsps"];
+    var newConnection = opts.forceNew || opts["force new connection"] || false === opts.multiplex || sameNamespace;
+    var io;
+    if (newConnection) {
+      debug("ignoring socket cache for %s", source);
+      io = new Manager(source, opts);
+    } else {
+      if (!cache[id]) {
+        debug("new io instance for %s", source);
+        cache[id] = new Manager(source, opts);
+      }
+      io = cache[id];
+    }
+    if (parsed.query && !opts.query) {
+      opts.query = parsed.queryKey;
+    }
+    return io.socket(parsed.path, opts);
+  }
+  // so that "lookup" can be used both as a function (e.g. `io(...)`) and as a
+  // namespace (e.g. `io.connect(...)`), for backward compatibility
+  _extends(lookup, {
+    Manager: Manager,
+    Socket: Socket,
+    io: lookup,
+    connect: lookup
+  });
+
+  return lookup;
+
+}));
+//# sourceMappingURL=socket.io.js.map
diff --git a/WebContentt/public/index.html b/WebContentt/public/index.html
new file mode 100644
index 0000000..2ad0ba1
--- /dev/null
+++ b/WebContentt/public/index.html
@@ -0,0 +1,93 @@
+<!DOCTYPE html>
+<html data-bs-theme="light" lang="en">
+
+<head>
+    <meta charset="utf-8">
+    <meta name="viewport" content="width=device-width, initial-scale=1.0, shrink-to-fit=no">
+    <title>SIPIntercom</title>
+    <link rel="stylesheet" href="assets/bootstrap/css/bootstrap.min.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Pro.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Pro.css">
+    <link rel="stylesheet" href="assets/css/FontAwesome.css">
+    <link rel="stylesheet" href="assets/css/all.min.css">
+    <link rel="stylesheet" href="assets/css/Navbar-Centered-Brand-icons.css">
+</head>
+
+<body onload="indexload()">
+    <nav class="navbar navbar-expand-md bg-body py-3">
+        <div class="container"><a class="navbar-brand d-flex align-items-center" href="#"><span class="bs-icon-sm bs-icon-rounded bs-icon-primary d-flex justify-content-center align-items-center me-2 bs-icon"><svg xmlns="http://www.w3.org/2000/svg" width="1em" height="1em" fill="currentColor" viewBox="0 0 16 16" class="bi bi-bezier">
+                        <path fill-rule="evenodd" d="M0 10.5A1.5 1.5 0 0 1 1.5 9h1A1.5 1.5 0 0 1 4 10.5v1A1.5 1.5 0 0 1 2.5 13h-1A1.5 1.5 0 0 1 0 11.5zm1.5-.5a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5zm10.5.5A1.5 1.5 0 0 1 13.5 9h1a1.5 1.5 0 0 1 1.5 1.5v1a1.5 1.5 0 0 1-1.5 1.5h-1a1.5 1.5 0 0 1-1.5-1.5zm1.5-.5a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5zM6 4.5A1.5 1.5 0 0 1 7.5 3h1A1.5 1.5 0 0 1 10 4.5v1A1.5 1.5 0 0 1 8.5 7h-1A1.5 1.5 0 0 1 6 5.5zM7.5 4a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5z"></path>
+                        <path d="M6 4.5H1.866a1 1 0 1 0 0 1h2.668A6.517 6.517 0 0 0 1.814 9H2.5c.123 0 .244.015.358.043a5.517 5.517 0 0 1 3.185-3.185A1.503 1.503 0 0 1 6 5.5zm3.957 1.358A1.5 1.5 0 0 0 10 5.5v-1h4.134a1 1 0 1 1 0 1h-2.668a6.517 6.517 0 0 1 2.72 3.5H13.5c-.123 0-.243.015-.358.043a5.517 5.517 0 0 0-3.185-3.185z"></path>
+                    </svg></span><span>SIP Intercom</span></a><button data-bs-toggle="collapse" class="navbar-toggler" data-bs-target="#navcol-4"><span class="visually-hidden">Toggle navigation</span><span class="navbar-toggler-icon"></span></button>
+            <div class="collapse navbar-collapse flex-grow-0 order-md-first" id="navcol-4">
+                <ul class="navbar-nav me-auto">
+                    <li class="nav-item"><a class="nav-link active" href="#">Overview</a></li>
+                    <li class="nav-item"><a class="nav-link" href="setting.html">Setting</a></li>
+                </ul>
+                <div class="d-md-none my-2"><button class="btn btn-light me-2" type="button">Button</button><button class="btn btn-primary" type="button">Button</button></div>
+            </div>
+            <div class="d-none d-md-block"><button class="btn btn-light me-2" type="button">Log Off</button></div>
+        </div>
+    </nav>
+    <div class="container">
+        <div class="row">
+            <div class="col">
+                <p>SIP Status</p>
+            </div>
+            <div class="col">
+                <p id="sipStatus">No Status</p>
+            </div>
+        </div>
+        <div class="row">
+            <div class="col">
+                <p>CPU Status</p>
+            </div>
+            <div class="col">
+                <p id="cpuStatus">No Status</p>
+            </div>
+        </div>
+        <div class="row">
+            <div class="col">
+                <p>RAM Status</p>
+            </div>
+            <div class="col">
+                <p id="ramStatus">No Status</p>
+            </div>
+        </div>
+        <div class="row">
+            <div class="col">
+                <p>Storage Status</p>
+            </div>
+            <div class="col">
+                <p id="storageStatus">No Status</p>
+            </div>
+        </div>
+        <div class="row">
+            <div class="col">
+                <p>Network Status</p>
+            </div>
+            <div class="col">
+                <p id="networkStatus">No Status</p>
+            </div>
+        </div>
+    </div>
+    <div class="container">
+        <div class="row">
+            <div class="col">
+                <p>Dial To</p>
+            </div>
+            <div class="col"><input type="text" id="dialNumber" name="dialNumber"></div>
+            <div class="col"><button class="btn btn-primary btn-lg" id="dialButton" type="button">Dial</button></div>
+        </div>
+    </div>
+    <script src="assets/bootstrap/js/bootstrap.min.js"></script>
+    <script src="assets/js/jquery-3.7.1.js"></script>
+    <script src="assets/js/socket.io.js"></script>
+    <script src="assets/js/app.js"></script>
+</body>
+
+</html>
\ No newline at end of file
diff --git a/WebContentt/public/login.html b/WebContentt/public/login.html
new file mode 100644
index 0000000..6df4ecd
--- /dev/null
+++ b/WebContentt/public/login.html
@@ -0,0 +1,53 @@
+<!DOCTYPE html>
+<html data-bs-theme="light" lang="en">
+
+<head>
+    <meta charset="utf-8">
+    <meta name="viewport" content="width=device-width, initial-scale=1.0, shrink-to-fit=no">
+    <title>SIPIntercom</title>
+    <link rel="stylesheet" href="assets/bootstrap/css/bootstrap.min.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Pro.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Pro.css">
+    <link rel="stylesheet" href="assets/css/FontAwesome.css">
+    <link rel="stylesheet" href="assets/css/all.min.css">
+    <link rel="stylesheet" href="assets/css/Navbar-Centered-Brand-icons.css">
+</head>
+
+<body onload="loginload()">
+    <section class="position-relative py-4 py-xl-5">
+        <div class="container">
+            <div class="row mb-5">
+                <div class="col-md-8 col-xl-6 text-center mx-auto">
+                    <h2>Log in</h2>
+                    <p class="w-lg-50">SIP Intercom</p>
+                </div>
+            </div>
+            <div class="row d-flex justify-content-center">
+                <div class="col-md-6 col-xl-4">
+                    <div class="card mb-5">
+                        <div class="card-body d-flex flex-column align-items-center">
+                            <div class="bs-icon-xl bs-icon-circle bs-icon-primary bs-icon my-4"><svg xmlns="http://www.w3.org/2000/svg" width="1em" height="1em" fill="currentColor" viewBox="0 0 16 16" class="bi bi-person">
+                                    <path d="M8 8a3 3 0 1 0 0-6 3 3 0 0 0 0 6m2-3a2 2 0 1 1-4 0 2 2 0 0 1 4 0m4 8c0 1-1 1-1 1H3s-1 0-1-1 1-4 6-4 6 3 6 4m-1-.004c-.001-.246-.154-.986-.832-1.664C11.516 10.68 10.289 10 8 10c-2.29 0-3.516.68-4.168 1.332-.678.678-.83 1.418-.832 1.664z"></path>
+                                </svg></div>
+                            <form class="text-center" method="post">
+                                <div class="mb-3"><input class="form-control" type="email" name="username" placeholder="Username"></div>
+                                <div class="mb-3"><input class="form-control" type="password" name="password" placeholder="Password"></div>
+                                <div class="mb-3"><button class="btn btn-primary d-block w-100" type="submit">Login</button></div>
+                            </form>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </section>
+    <script src="assets/bootstrap/js/bootstrap.min.js"></script>
+    <script src="assets/js/jquery-3.7.1.js"></script>
+    <script src="assets/js/socket.io.js"></script>
+    <script src="assets/js/app.js"></script>
+</body>
+
+</html>
\ No newline at end of file
diff --git a/WebContentt/public/setting.html b/WebContentt/public/setting.html
new file mode 100644
index 0000000..d10fb37
--- /dev/null
+++ b/WebContentt/public/setting.html
@@ -0,0 +1,90 @@
+<!DOCTYPE html>
+<html data-bs-theme="light" lang="en">
+
+<head>
+    <meta charset="utf-8">
+    <meta name="viewport" content="width=device-width, initial-scale=1.0, shrink-to-fit=no">
+    <title>SIPIntercom</title>
+    <link rel="stylesheet" href="assets/bootstrap/css/bootstrap.min.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%205%20Pro.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Brands.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Duotone.css">
+    <link rel="stylesheet" href="assets/css/Font%20Awesome%206%20Pro.css">
+    <link rel="stylesheet" href="assets/css/FontAwesome.css">
+    <link rel="stylesheet" href="assets/css/all.min.css">
+    <link rel="stylesheet" href="assets/css/Navbar-Centered-Brand-icons.css">
+</head>
+
+<body onload="settingload()">
+    <nav class="navbar navbar-expand-md bg-body py-3">
+        <div class="container"><a class="navbar-brand d-flex align-items-center" href="#"><span class="bs-icon-sm bs-icon-rounded bs-icon-primary d-flex justify-content-center align-items-center me-2 bs-icon"><svg xmlns="http://www.w3.org/2000/svg" width="1em" height="1em" fill="currentColor" viewBox="0 0 16 16" class="bi bi-bezier">
+                        <path fill-rule="evenodd" d="M0 10.5A1.5 1.5 0 0 1 1.5 9h1A1.5 1.5 0 0 1 4 10.5v1A1.5 1.5 0 0 1 2.5 13h-1A1.5 1.5 0 0 1 0 11.5zm1.5-.5a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5zm10.5.5A1.5 1.5 0 0 1 13.5 9h1a1.5 1.5 0 0 1 1.5 1.5v1a1.5 1.5 0 0 1-1.5 1.5h-1a1.5 1.5 0 0 1-1.5-1.5zm1.5-.5a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5zM6 4.5A1.5 1.5 0 0 1 7.5 3h1A1.5 1.5 0 0 1 10 4.5v1A1.5 1.5 0 0 1 8.5 7h-1A1.5 1.5 0 0 1 6 5.5zM7.5 4a.5.5 0 0 0-.5.5v1a.5.5 0 0 0 .5.5h1a.5.5 0 0 0 .5-.5v-1a.5.5 0 0 0-.5-.5z"></path>
+                        <path d="M6 4.5H1.866a1 1 0 1 0 0 1h2.668A6.517 6.517 0 0 0 1.814 9H2.5c.123 0 .244.015.358.043a5.517 5.517 0 0 1 3.185-3.185A1.503 1.503 0 0 1 6 5.5zm3.957 1.358A1.5 1.5 0 0 0 10 5.5v-1h4.134a1 1 0 1 1 0 1h-2.668a6.517 6.517 0 0 1 2.72 3.5H13.5c-.123 0-.243.015-.358.043a5.517 5.517 0 0 0-3.185-3.185z"></path>
+                    </svg></span><span>SIP Intercom</span></a><button data-bs-toggle="collapse" class="navbar-toggler" data-bs-target="#navcol-4"><span class="visually-hidden">Toggle navigation</span><span class="navbar-toggler-icon"></span></button>
+            <div class="collapse navbar-collapse flex-grow-0 order-md-first" id="navcol-4">
+                <ul class="navbar-nav me-auto">
+                    <li class="nav-item"><a class="nav-link" href="index.html">Overview</a></li>
+                    <li class="nav-item"><a class="nav-link active" href="#">Setting</a></li>
+                </ul>
+                <div class="d-md-none my-2"><button class="btn btn-light me-2" type="button">Button</button><button class="btn btn-primary" type="button">Button</button></div>
+            </div>
+            <div class="d-none d-md-block"><button class="btn btn-light me-2" type="button">Log Off</button></div>
+        </div>
+    </nav>
+    <div class="container">
+        <form>
+            <div class="col">
+                <div class="row">
+                    <div class="col"><label class="col-form-label">Login Username</label></div>
+                    <div class="col"><input class="form-control" type="text" id="webUsername" name="webUsername" placeholder="Login Username"></div>
+                </div>
+                <div class="row">
+                    <div class="col"><label class="col-form-label">Login Password</label></div>
+                    <div class="col"><input class="form-control" type="text" id="webPassword" name="webPassword" placeholder="Login Password"></div>
+                </div>
+            </div>
+            <div class="col">
+                <div class="row">
+                    <div class="col"><button class="btn btn-primary btn-lg" type="button">Save&nbsp;&nbsp;<svg xmlns="http://www.w3.org/2000/svg" viewBox="-32 0 512 512" width="1em" height="1em" fill="currentColor">
+                                <!--! Font Awesome Free 6.4.2 by @fontawesome - https://fontawesome.com License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License) Copyright 2023 Fonticons, Inc. -->
+                                <path d="M48 96V416c0 8.8 7.2 16 16 16H384c8.8 0 16-7.2 16-16V170.5c0-4.2-1.7-8.3-4.7-11.3l33.9-33.9c12 12 18.7 28.3 18.7 45.3V416c0 35.3-28.7 64-64 64H64c-35.3 0-64-28.7-64-64V96C0 60.7 28.7 32 64 32H309.5c17 0 33.3 6.7 45.3 18.7l74.5 74.5-33.9 33.9L320.8 84.7c-.3-.3-.5-.5-.8-.8V184c0 13.3-10.7 24-24 24H104c-13.3 0-24-10.7-24-24V80H64c-8.8 0-16 7.2-16 16zm80-16v80H272V80H128zm32 240a64 64 0 1 1 128 0 64 64 0 1 1 -128 0z"></path>
+                            </svg></button></div>
+                </div>
+            </div>
+        </form>
+    </div>
+    <div class="container">
+        <form>
+            <div class="row">
+                <div class="col"><label class="col-form-label">SIP Server</label></div>
+                <div class="col"><input class="form-control" type="text" id="sipServer" name="sipServer" placeholder="SIP Server"></div>
+            </div>
+            <div class="row">
+                <div class="col"><label class="col-form-label">SIP Port</label></div>
+                <div class="col"><input class="form-control" type="text" id="sipPort" name="sipPort" placeholder="SIP Portnumber"></div>
+            </div>
+            <div class="row">
+                <div class="col"><label class="col-form-label">SIP Username</label></div>
+                <div class="col"><input class="form-control" type="text" id="sipUsername" name="sipUsername" placeholder="SIP Username"></div>
+            </div>
+            <div class="row">
+                <div class="col"><label class="col-form-label">SIP Password</label></div>
+                <div class="col"><input class="form-control" type="text" id="sipPassword" name="sipPassword" placeholder="SIP Password"></div>
+            </div>
+            <div class="row">
+                <div class="col"><button class="btn btn-primary btn-lg" type="button">Save&nbsp;&nbsp;<svg xmlns="http://www.w3.org/2000/svg" viewBox="-32 0 512 512" width="1em" height="1em" fill="currentColor">
+                            <!--! Font Awesome Free 6.4.2 by @fontawesome - https://fontawesome.com License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License) Copyright 2023 Fonticons, Inc. -->
+                            <path d="M48 96V416c0 8.8 7.2 16 16 16H384c8.8 0 16-7.2 16-16V170.5c0-4.2-1.7-8.3-4.7-11.3l33.9-33.9c12 12 18.7 28.3 18.7 45.3V416c0 35.3-28.7 64-64 64H64c-35.3 0-64-28.7-64-64V96C0 60.7 28.7 32 64 32H309.5c17 0 33.3 6.7 45.3 18.7l74.5 74.5-33.9 33.9L320.8 84.7c-.3-.3-.5-.5-.8-.8V184c0 13.3-10.7 24-24 24H104c-13.3 0-24-10.7-24-24V80H64c-8.8 0-16 7.2-16 16zm80-16v80H272V80H128zm32 240a64 64 0 1 1 128 0 64 64 0 1 1 -128 0z"></path>
+                        </svg></button></div>
+            </div>
+        </form>
+    </div>
+    <script src="assets/bootstrap/js/bootstrap.min.js"></script>
+    <script src="assets/js/jquery-3.7.1.js"></script>
+    <script src="assets/js/socket.io.js"></script>
+    <script src="assets/js/app.js"></script>
+</body>
+
+</html>
\ No newline at end of file